mirror of
https://github.com/XTLS/Xray-core.git
synced 2026-01-13 14:17:09 +08:00
Compare commits
122 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
a149c78a4c | ||
|
|
b0886027f5 | ||
|
|
7033f7cf5f | ||
|
|
ffc2f7c4e2 | ||
|
|
ab927d2cca | ||
|
|
0c0d878456 | ||
|
|
24b637cd5e | ||
|
|
f2cb13a8ec | ||
|
|
dbcbb519e3 | ||
|
|
8a5bf06925 | ||
|
|
b0b2aaa70c | ||
|
|
d111a046c0 | ||
|
|
eaf30aa14a | ||
|
|
42d158bd85 | ||
|
|
00bcd40c34 | ||
|
|
1adfc2720a | ||
|
|
0f79126379 | ||
|
|
7246001029 | ||
|
|
5e6eff5ffa | ||
|
|
1dca3cb3dd | ||
|
|
28d17ac17f | ||
|
|
e6019a89c9 | ||
|
|
3213e5dd81 | ||
|
|
c950edede2 | ||
|
|
64892fb2c3 | ||
|
|
0403e6ddc3 | ||
|
|
d9d239750b | ||
|
|
73e10f0f6f | ||
|
|
7a9e72b133 | ||
|
|
66b58e6076 | ||
|
|
17cdeac57f | ||
|
|
e4bf620795 | ||
|
|
31c7141fef | ||
|
|
57b9006d26 | ||
|
|
d9d04a230f | ||
|
|
3dc9fba20d | ||
|
|
d45298a10d | ||
|
|
6e8581f5dc | ||
|
|
86a8fb5d84 | ||
|
|
3531b95d82 | ||
|
|
b977899926 | ||
|
|
2220411644 | ||
|
|
3b8618b379 | ||
|
|
e8a8465220 | ||
|
|
1f92b948c0 | ||
|
|
53b99efe78 | ||
|
|
1e3d739a5b | ||
|
|
7b7084f825 | ||
|
|
bf94fb53ca | ||
|
|
1d13a8da49 | ||
|
|
f65c21337c | ||
|
|
4bf8b6d89c | ||
|
|
95a68a6d73 | ||
|
|
7f2fad73d4 | ||
|
|
3ed14c2fcd | ||
|
|
b63049f404 | ||
|
|
a9e11075d1 | ||
|
|
e564d9ef7e | ||
|
|
6c936e2fd3 | ||
|
|
b2d8168284 | ||
|
|
e0910ab4d9 | ||
|
|
d46af8b5d4 | ||
|
|
0470381fe2 | ||
|
|
b0e7ad9663 | ||
|
|
4e63c22197 | ||
|
|
36961ed882 | ||
|
|
de54d4b08f | ||
|
|
32713bcc0e | ||
|
|
9dec65e367 | ||
|
|
3fe85449a9 | ||
|
|
e0526c27b3 | ||
|
|
a0a32ee00d | ||
|
|
60b06877bf | ||
|
|
9adce5a6c4 | ||
|
|
100edc370b | ||
|
|
819717d278 | ||
|
|
fcc9d97074 | ||
|
|
439c91d509 | ||
|
|
924fe16077 | ||
|
|
3de5af0611 | ||
|
|
d7cd71b741 | ||
|
|
f50eff5ebb | ||
|
|
db32ce6fd9 | ||
|
|
ad1807dd99 | ||
|
|
e1a5392beb | ||
|
|
24f564b401 | ||
|
|
54af48a1ae | ||
|
|
055fb51ed9 | ||
|
|
6380abca73 | ||
|
|
1dae2c5636 | ||
|
|
e9ea658852 | ||
|
|
d67cf3d598 | ||
|
|
ca633fc8c5 | ||
|
|
c345d4818e | ||
|
|
7fb1f65354 | ||
|
|
4b97edae74 | ||
|
|
8aabbeefe1 | ||
|
|
48fab4d398 | ||
|
|
8b9c0ae593 | ||
|
|
347d9735da | ||
|
|
9aa49be703 | ||
|
|
fed8610d3f | ||
|
|
d22c2d034c | ||
|
|
4c10a9eb4e | ||
|
|
4ff1ff1d7d | ||
|
|
573b7807c0 | ||
|
|
81d993158f | ||
|
|
df39991bb3 | ||
|
|
1b87264c53 | ||
|
|
96d7156eba | ||
|
|
d170416219 | ||
|
|
8ca8a7126b | ||
|
|
1174ff3090 | ||
|
|
523c416bb5 | ||
|
|
c13b8ec9bb | ||
|
|
4cd343f2d5 | ||
|
|
d032a8deb7 | ||
|
|
303fd6e261 | ||
|
|
c880b916ee | ||
|
|
ceff4185dc | ||
|
|
59c7c4897c | ||
|
|
8ffc430351 |
33
.github/build/friendly-filenames.json
vendored
Normal file
33
.github/build/friendly-filenames.json
vendored
Normal file
@@ -0,0 +1,33 @@
|
||||
{
|
||||
"android-arm64": { "friendlyName": "android-arm64-v8a" },
|
||||
"darwin-amd64": { "friendlyName": "macos-64" },
|
||||
"darwin-arm64": { "friendlyName": "macos-arm64-v8a" },
|
||||
"dragonfly-amd64": { "friendlyName": "dragonfly-64" },
|
||||
"freebsd-386": { "friendlyName": "freebsd-32" },
|
||||
"freebsd-amd64": { "friendlyName": "freebsd-64" },
|
||||
"freebsd-arm64": { "friendlyName": "freebsd-arm64-v8a" },
|
||||
"freebsd-arm7": { "friendlyName": "freebsd-arm32-v7a" },
|
||||
"linux-386": { "friendlyName": "linux-32" },
|
||||
"linux-amd64": { "friendlyName": "linux-64" },
|
||||
"linux-arm5": { "friendlyName": "linux-arm32-v5" },
|
||||
"linux-arm64": { "friendlyName": "linux-arm64-v8a" },
|
||||
"linux-arm6": { "friendlyName": "linux-arm32-v6" },
|
||||
"linux-arm7": { "friendlyName": "linux-arm32-v7a" },
|
||||
"linux-mips64le": { "friendlyName": "linux-mips64le" },
|
||||
"linux-mips64": { "friendlyName": "linux-mips64" },
|
||||
"linux-mipslesoftfloat": { "friendlyName": "linux-mips32le-softfloat" },
|
||||
"linux-mipsle": { "friendlyName": "linux-mips32le" },
|
||||
"linux-mipssoftfloat": { "friendlyName": "linux-mips32-softfloat" },
|
||||
"linux-mips": { "friendlyName": "linux-mips32" },
|
||||
"linux-ppc64le": { "friendlyName": "linux-ppc64le" },
|
||||
"linux-ppc64": { "friendlyName": "linux-ppc64" },
|
||||
"linux-riscv64": { "friendlyName": "linux-riscv64" },
|
||||
"linux-s390x": { "friendlyName": "linux-s390x" },
|
||||
"openbsd-386": { "friendlyName": "openbsd-32" },
|
||||
"openbsd-amd64": { "friendlyName": "openbsd-64" },
|
||||
"openbsd-arm64": { "friendlyName": "openbsd-arm64-v8a" },
|
||||
"openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
|
||||
"windows-386": { "friendlyName": "windows-32" },
|
||||
"windows-amd64": { "friendlyName": "windows-64" },
|
||||
"windows-arm7": { "friendlyName": "windows-arm32-v7a" }
|
||||
}
|
||||
204
.github/workflows/release.yml
vendored
Normal file
204
.github/workflows/release.yml
vendored
Normal file
@@ -0,0 +1,204 @@
|
||||
name: Build and Release
|
||||
|
||||
on:
|
||||
workflow_dispatch:
|
||||
release:
|
||||
types: [published]
|
||||
push:
|
||||
branches:
|
||||
- main
|
||||
paths:
|
||||
- "**/*.go"
|
||||
- "go.mod"
|
||||
- "go.sum"
|
||||
- ".github/workflows/*.yml"
|
||||
pull_request:
|
||||
types: [opened, synchronize, reopened]
|
||||
paths:
|
||||
- "**/*.go"
|
||||
- "go.mod"
|
||||
- "go.sum"
|
||||
- ".github/workflows/*.yml"
|
||||
jobs:
|
||||
build:
|
||||
strategy:
|
||||
matrix:
|
||||
# Include amd64 on all platforms.
|
||||
goos: [windows, freebsd, openbsd, linux, dragonfly, darwin]
|
||||
goarch: [amd64, 386]
|
||||
exclude:
|
||||
# Exclude i386 on darwin and dragonfly.
|
||||
- goarch: 386
|
||||
goos: dragonfly
|
||||
- goarch: 386
|
||||
goos: darwin
|
||||
include:
|
||||
# BEIGIN MacOS ARM64
|
||||
- goos: darwin
|
||||
goarch: arm64
|
||||
# END MacOS ARM64
|
||||
# BEGIN Linux ARM 5 6 7
|
||||
- goos: linux
|
||||
goarch: arm
|
||||
goarm: 7
|
||||
- goos: linux
|
||||
goarch: arm
|
||||
goarm: 6
|
||||
- goos: linux
|
||||
goarch: arm
|
||||
goarm: 5
|
||||
# END Linux ARM 5 6 7
|
||||
# BEGIN Android ARM 8
|
||||
- goos: android
|
||||
goarch: arm64
|
||||
# END Android ARM 8
|
||||
# Windows ARM 7
|
||||
- goos: windows
|
||||
goarch: arm
|
||||
goarm: 7
|
||||
# BEGIN Other architectures
|
||||
# BEGIN riscv64 & ARM64
|
||||
- goos: linux
|
||||
goarch: arm64
|
||||
- goos: linux
|
||||
goarch: riscv64
|
||||
# END riscv64 & ARM64
|
||||
# BEGIN MIPS
|
||||
- goos: linux
|
||||
goarch: mips64
|
||||
- goos: linux
|
||||
goarch: mips64le
|
||||
- goos: linux
|
||||
goarch: mipsle
|
||||
- goos: linux
|
||||
goarch: mips
|
||||
# END MIPS
|
||||
# BEGIN PPC
|
||||
- goos: linux
|
||||
goarch: ppc64
|
||||
- goos: linux
|
||||
goarch: ppc64le
|
||||
# END PPC
|
||||
# BEGIN FreeBSD ARM
|
||||
- goos: freebsd
|
||||
goarch: arm64
|
||||
- goos: freebsd
|
||||
goarch: arm
|
||||
goarm: 7
|
||||
# END FreeBSD ARM
|
||||
# BEGIN S390X
|
||||
- goos: linux
|
||||
goarch: s390x
|
||||
# END S390X
|
||||
# END Other architectures
|
||||
# BEGIN OPENBSD ARM
|
||||
- goos: openbsd
|
||||
goarch: arm64
|
||||
- goos: openbsd
|
||||
goarch: arm
|
||||
goarm: 7
|
||||
# END OPENBSD ARM
|
||||
fail-fast: false
|
||||
|
||||
runs-on: ubuntu-latest
|
||||
env:
|
||||
GOOS: ${{ matrix.goos }}
|
||||
GOARCH: ${{ matrix.goarch }}
|
||||
GOARM: ${{ matrix.goarm }}
|
||||
CGO_ENABLED: 0
|
||||
steps:
|
||||
- name: Checkout codebase
|
||||
uses: actions/checkout@v2
|
||||
|
||||
- name: Show workflow information
|
||||
id: get_filename
|
||||
run: |
|
||||
export _NAME=$(jq ".[\"$GOOS-$GOARCH$GOARM$GOMIPS\"].friendlyName" -r < .github/build/friendly-filenames.json)
|
||||
echo "GOOS: $GOOS, GOARCH: $GOARCH, GOARM: $GOARM, GOMIPS: $GOMIPS, RELEASE_NAME: $_NAME"
|
||||
echo "::set-output name=ASSET_NAME::$_NAME"
|
||||
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v2
|
||||
with:
|
||||
go-version: ^1.17.1
|
||||
|
||||
- name: Get project dependencies
|
||||
run: go mod download
|
||||
|
||||
- name: Replace Custom to Commit ID
|
||||
if: github.event_name != 'release'
|
||||
run: |
|
||||
ID=$(git rev-parse --short ${{ github.sha }})
|
||||
if [ "${{ github.event_name }}" == 'pull_request' ]
|
||||
then
|
||||
ID=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
|
||||
fi
|
||||
sed -i '/build/ s/Custom/'$ID'/' ./core/core.go
|
||||
|
||||
- name: Build Xray
|
||||
run: |
|
||||
mkdir -p build_assets
|
||||
go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
|
||||
|
||||
- name: Build Mips softfloat Xray
|
||||
if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
|
||||
run: |
|
||||
GOMIPS=softfloat go build -v -o build_assets/xray_softfloat -trimpath -ldflags "-s -w -buildid=" ./main
|
||||
|
||||
- name: Rename Windows Xray
|
||||
if: matrix.goos == 'windows'
|
||||
run: |
|
||||
cd ./build_assets || exit 1
|
||||
mv xray xray.exe
|
||||
|
||||
- name: Prepare to release
|
||||
run: |
|
||||
cp ${GITHUB_WORKSPACE}/README.md ./build_assets/README.md
|
||||
cp ${GITHUB_WORKSPACE}/LICENSE ./build_assets/LICENSE
|
||||
LIST=('geoip geoip geoip' 'domain-list-community dlc geosite')
|
||||
for i in "${LIST[@]}"
|
||||
do
|
||||
INFO=($(echo $i | awk 'BEGIN{FS=" ";OFS=" "} {print $1,$2,$3}'))
|
||||
LASTEST_TAG="$(curl -sL "https://api.github.com/repos/v2fly/${INFO[0]}/releases" | jq -r ".[0].tag_name" || echo "latest")"
|
||||
FILE_NAME="${INFO[2]}.dat"
|
||||
echo -e "Downloading ${FILE_NAME}..."
|
||||
curl -L "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat" -o ./build_assets/${FILE_NAME}
|
||||
echo -e "Verifying HASH key..."
|
||||
HASH="$(curl -sL "https://github.com/v2fly/${INFO[0]}/releases/download/${LASTEST_TAG}/${INFO[1]}.dat.sha256sum" | awk -F ' ' '{print $1}')"
|
||||
[ "$(sha256sum "./build_assets/${FILE_NAME}" | awk -F ' ' '{print $1}')" == "${HASH}" ] || { echo -e "The HASH key of ${FILE_NAME} does not match cloud one."; exit 1; }
|
||||
done
|
||||
|
||||
- name: Create ZIP archive
|
||||
shell: bash
|
||||
run: |
|
||||
pushd build_assets || exit 1
|
||||
touch -mt $(date +%Y01010000) *
|
||||
zip -9vr ../Xray-$ASSET_NAME.zip .
|
||||
popd || exit 1
|
||||
FILE=./Xray-$ASSET_NAME.zip
|
||||
DGST=$FILE.dgst
|
||||
for METHOD in {"md5","sha1","sha256","sha512"}
|
||||
do
|
||||
openssl dgst -$METHOD $FILE | sed 's/([^)]*)//g' >>$DGST
|
||||
done
|
||||
|
||||
- name: Change the name
|
||||
run: |
|
||||
mv build_assets Xray-$ASSET_NAME
|
||||
|
||||
- name: Upload files to Artifacts
|
||||
uses: actions/upload-artifact@v2
|
||||
with:
|
||||
name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
|
||||
path: |
|
||||
./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}/*
|
||||
|
||||
- name: Upload binaries to release
|
||||
uses: svenstaro/upload-release-action@v2
|
||||
if: github.event_name == 'release'
|
||||
with:
|
||||
repo_token: ${{ secrets.GITHUB_TOKEN }}
|
||||
file: ./Xray-${{ steps.get_filename.outputs.ASSET_NAME }}.zip*
|
||||
tag: ${{ github.ref }}
|
||||
file_glob: true
|
||||
48
.github/workflows/test.yml
vendored
Normal file
48
.github/workflows/test.yml
vendored
Normal file
@@ -0,0 +1,48 @@
|
||||
name: Test
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- main
|
||||
paths:
|
||||
- "**/*.go"
|
||||
- "go.mod"
|
||||
- "go.sum"
|
||||
- ".github/workflows/*.yml"
|
||||
pull_request:
|
||||
types: [opened, synchronize, reopened]
|
||||
paths:
|
||||
- "**/*.go"
|
||||
- "go.mod"
|
||||
- "go.sum"
|
||||
- ".github/workflows/*.yml"
|
||||
|
||||
jobs:
|
||||
test:
|
||||
runs-on: ${{ matrix.os }}
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
os: [windows-latest, ubuntu-latest, macos-latest]
|
||||
steps:
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v2
|
||||
with:
|
||||
go-version: ^1.17.1
|
||||
- name: Checkout codebase
|
||||
uses: actions/checkout@v2
|
||||
|
||||
- name: Prepare geo*dat
|
||||
if: ${{ matrix.os != 'windows-latest' }}
|
||||
run: |
|
||||
mkdir resources
|
||||
wget -O ./resources/geoip.dat https://github.com/v2fly/geoip/releases/latest/download/geoip.dat
|
||||
wget -O ./resources/geosite.dat https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat
|
||||
- name: Prepare geo*dat for Windows
|
||||
if: ${{ matrix.os == 'windows-latest' }}
|
||||
run: |
|
||||
mkdir resources
|
||||
Invoke-WebRequest -Uri "https://github.com/v2fly/geoip/releases/latest/download/geoip.dat" -OutFile "./resources/geoip.dat"
|
||||
Invoke-WebRequest -Uri "https://github.com/v2fly/domain-list-community/releases/latest/download/dlc.dat" -OutFile "./resources/geosite.dat"
|
||||
- name: Test
|
||||
run: go test -timeout 1h -v ./...
|
||||
16
README.md
16
README.md
@@ -17,12 +17,15 @@
|
||||
- One Click
|
||||
- [ProxySU](https://github.com/proxysu/ProxySU)
|
||||
- [v2ray-agent](https://github.com/mack-a/v2ray-agent)
|
||||
- [Xray-yes](https://github.com/jiuqi9997/Xray-yes)
|
||||
- [Xray_onekey](https://github.com/wulabing/Xray_onekey)
|
||||
- Magisk
|
||||
- [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
|
||||
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
|
||||
- Homebrew
|
||||
- [Repository 0](https://github.com/N4FA/homebrew-xray)
|
||||
- [Repository 1](https://github.com/xiruizhao/homebrew-xray)
|
||||
- `brew install xray`
|
||||
- [(Tap) Repository 0](https://github.com/N4FA/homebrew-xray)
|
||||
- [(Tap) Repository 1](https://github.com/xiruizhao/homebrew-xray)
|
||||
|
||||
## Usage
|
||||
|
||||
@@ -34,14 +37,19 @@
|
||||
- [PassWall](https://github.com/xiaorouji/openwrt-passwall)
|
||||
- [Hello World](https://github.com/jerrykuku/luci-app-vssr)
|
||||
- [ShadowSocksR Plus+](https://github.com/fw876/helloworld)
|
||||
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
|
||||
- Windows
|
||||
- [v2rayN](https://github.com/2dust/v2rayN)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||
- [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
|
||||
- Android
|
||||
- [v2rayNG](https://github.com/2dust/v2rayNG)
|
||||
- [AnXray](https://github.com/XTLS/AnXray)
|
||||
- [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
|
||||
- iOS / Mac
|
||||
- iOS & macOS (with M1 chip)
|
||||
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
|
||||
- macOS (Intel chip & M1 chip)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||
|
||||
## Credits
|
||||
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/commander/config.proto
|
||||
|
||||
package commander
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Config is the settings for Commander.
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
@@ -3,9 +3,10 @@ package commander
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"google.golang.org/grpc"
|
||||
"google.golang.org/grpc/reflection"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
)
|
||||
|
||||
// Service is a Commander service.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dispatcher/config.proto
|
||||
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type SessionConfig struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -15,6 +15,7 @@ import (
|
||||
"github.com/xtls/xray-core/common/protocol"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/features/policy"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
@@ -175,17 +176,28 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
|
||||
return inboundLink, outboundLink
|
||||
}
|
||||
|
||||
func shouldOverride(result SniffResult, request session.SniffingRequest) bool {
|
||||
func shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
|
||||
domain := result.Domain()
|
||||
for _, d := range request.ExcludeForDomain {
|
||||
if domain == d {
|
||||
if strings.ToLower(domain) == d {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
protocol := result.Protocol()
|
||||
var fakeDNSEngine dns.FakeDNSEngine
|
||||
core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
|
||||
fakeDNSEngine = fdns
|
||||
})
|
||||
protocolString := result.Protocol()
|
||||
if resComp, ok := result.(SnifferResultComposite); ok {
|
||||
protocolString = resComp.ProtocolForDomainResult()
|
||||
}
|
||||
for _, p := range request.OverrideDestinationForProtocol {
|
||||
if strings.HasPrefix(protocol, p) {
|
||||
if strings.HasPrefix(protocolString, p) {
|
||||
return true
|
||||
}
|
||||
if fakeDNSEngine != nil && protocolString != "bittorrent" && p == "fakedns" &&
|
||||
destination.Address.Family().IsIP() && fakeDNSEngine.GetFakeIPRange().Contains(destination.Address.IP()) {
|
||||
newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
|
||||
return true
|
||||
}
|
||||
}
|
||||
@@ -210,19 +222,33 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
}
|
||||
sniffingRequest := content.SniffingRequest
|
||||
if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
|
||||
switch {
|
||||
case !sniffingRequest.Enabled:
|
||||
go d.routedDispatch(ctx, outbound, destination)
|
||||
} else {
|
||||
case destination.Network != net.Network_TCP:
|
||||
// Only metadata sniff will be used for non tcp connection
|
||||
result, err := sniffer(ctx, nil, true)
|
||||
if err == nil {
|
||||
content.Protocol = result.Protocol()
|
||||
if shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||
domain := result.Domain()
|
||||
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||
destination.Address = net.ParseAddress(domain)
|
||||
ob.Target = destination
|
||||
}
|
||||
}
|
||||
go d.routedDispatch(ctx, outbound, destination)
|
||||
default:
|
||||
go func() {
|
||||
cReader := &cachedReader{
|
||||
reader: outbound.Reader.(*pipe.Reader),
|
||||
}
|
||||
outbound.Reader = cReader
|
||||
result, err := sniffer(ctx, cReader)
|
||||
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly)
|
||||
if err == nil {
|
||||
content.Protocol = result.Protocol()
|
||||
}
|
||||
if err == nil && shouldOverride(result, sniffingRequest) {
|
||||
if err == nil && shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||
domain := result.Domain()
|
||||
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||
destination.Address = net.ParseAddress(domain)
|
||||
@@ -234,34 +260,50 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
||||
return inbound, nil
|
||||
}
|
||||
|
||||
func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
|
||||
func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool) (SniffResult, error) {
|
||||
payload := buf.New()
|
||||
defer payload.Release()
|
||||
|
||||
sniffer := NewSniffer()
|
||||
totalAttempt := 0
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
totalAttempt++
|
||||
if totalAttempt > 2 {
|
||||
return nil, errSniffingTimeout
|
||||
}
|
||||
sniffer := NewSniffer(ctx)
|
||||
|
||||
cReader.Cache(payload)
|
||||
if !payload.IsEmpty() {
|
||||
result, err := sniffer.Sniff(payload.Bytes())
|
||||
if err != common.ErrNoClue {
|
||||
return result, err
|
||||
metaresult, metadataErr := sniffer.SniffMetadata(ctx)
|
||||
|
||||
if metadataOnly {
|
||||
return metaresult, metadataErr
|
||||
}
|
||||
|
||||
contentResult, contentErr := func() (SniffResult, error) {
|
||||
totalAttempt := 0
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
totalAttempt++
|
||||
if totalAttempt > 2 {
|
||||
return nil, errSniffingTimeout
|
||||
}
|
||||
|
||||
cReader.Cache(payload)
|
||||
if !payload.IsEmpty() {
|
||||
result, err := sniffer.Sniff(ctx, payload.Bytes())
|
||||
if err != common.ErrNoClue {
|
||||
return result, err
|
||||
}
|
||||
}
|
||||
if payload.IsFull() {
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
}
|
||||
if payload.IsFull() {
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
}
|
||||
}()
|
||||
if contentErr != nil && metadataErr == nil {
|
||||
return metaresult, nil
|
||||
}
|
||||
if contentErr == nil && metadataErr == nil {
|
||||
return CompositeResult(metaresult, contentResult), nil
|
||||
}
|
||||
return contentResult, contentErr
|
||||
}
|
||||
|
||||
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
|
||||
|
||||
49
app/dispatcher/fakednssniffer.go
Normal file
49
app/dispatcher/fakednssniffer.go
Normal file
@@ -0,0 +1,49 @@
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
// newFakeDNSSniffer Create a Fake DNS metadata sniffer
|
||||
func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
|
||||
var fakeDNSEngine dns.FakeDNSEngine
|
||||
err := core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
|
||||
fakeDNSEngine = fdns
|
||||
})
|
||||
if err != nil {
|
||||
return protocolSnifferWithMetadata{}, err
|
||||
}
|
||||
if fakeDNSEngine == nil {
|
||||
errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
|
||||
return protocolSnifferWithMetadata{}, errNotInit
|
||||
}
|
||||
return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
|
||||
Target := session.OutboundFromContext(ctx).Target
|
||||
if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
|
||||
domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
|
||||
if domainFromFakeDNS != "" {
|
||||
newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
|
||||
return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
|
||||
}
|
||||
}
|
||||
return nil, common.ErrNoClue
|
||||
}, metadataSniffer: true}, nil
|
||||
}
|
||||
|
||||
type fakeDNSSniffResult struct {
|
||||
domainName string
|
||||
}
|
||||
|
||||
func (fakeDNSSniffResult) Protocol() string {
|
||||
return "fakedns"
|
||||
}
|
||||
|
||||
func (f fakeDNSSniffResult) Domain() string {
|
||||
return f.domainName
|
||||
}
|
||||
@@ -1,6 +1,8 @@
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/protocol/bittorrent"
|
||||
"github.com/xtls/xray-core/common/protocol/http"
|
||||
@@ -12,30 +14,46 @@ type SniffResult interface {
|
||||
Domain() string
|
||||
}
|
||||
|
||||
type protocolSniffer func([]byte) (SniffResult, error)
|
||||
type protocolSniffer func(context.Context, []byte) (SniffResult, error)
|
||||
|
||||
type Sniffer struct {
|
||||
sniffer []protocolSniffer
|
||||
type protocolSnifferWithMetadata struct {
|
||||
protocolSniffer protocolSniffer
|
||||
// A Metadata sniffer will be invoked on connection establishment only, with nil body,
|
||||
// for both TCP and UDP connections
|
||||
// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
|
||||
metadataSniffer bool
|
||||
}
|
||||
|
||||
func NewSniffer() *Sniffer {
|
||||
return &Sniffer{
|
||||
sniffer: []protocolSniffer{
|
||||
func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
|
||||
func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
|
||||
func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
|
||||
type Sniffer struct {
|
||||
sniffer []protocolSnifferWithMetadata
|
||||
}
|
||||
|
||||
func NewSniffer(ctx context.Context) *Sniffer {
|
||||
ret := &Sniffer{
|
||||
sniffer: []protocolSnifferWithMetadata{
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false},
|
||||
},
|
||||
}
|
||||
if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
|
||||
ret.sniffer = append(ret.sniffer, sniffer)
|
||||
}
|
||||
return ret
|
||||
}
|
||||
|
||||
var errUnknownContent = newError("unknown content")
|
||||
|
||||
func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSniffer
|
||||
for _, s := range s.sniffer {
|
||||
result, err := s(payload)
|
||||
func (s *Sniffer) Sniff(c context.Context, payload []byte) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSnifferWithMetadata
|
||||
for _, si := range s.sniffer {
|
||||
s := si.protocolSniffer
|
||||
if si.metadataSniffer {
|
||||
continue
|
||||
}
|
||||
result, err := s(c, payload)
|
||||
if err == common.ErrNoClue {
|
||||
pendingSniffer = append(pendingSniffer, s)
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
|
||||
@@ -51,3 +69,55 @@ func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
||||
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
|
||||
func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSnifferWithMetadata
|
||||
for _, si := range s.sniffer {
|
||||
s := si.protocolSniffer
|
||||
if !si.metadataSniffer {
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
result, err := s(c, nil)
|
||||
if err == common.ErrNoClue {
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
|
||||
if err == nil && result != nil {
|
||||
return result, nil
|
||||
}
|
||||
}
|
||||
|
||||
if len(pendingSniffer) > 0 {
|
||||
s.sniffer = pendingSniffer
|
||||
return nil, common.ErrNoClue
|
||||
}
|
||||
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
|
||||
func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
|
||||
return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
|
||||
}
|
||||
|
||||
type compositeResult struct {
|
||||
domainResult SniffResult
|
||||
protocolResult SniffResult
|
||||
}
|
||||
|
||||
func (c compositeResult) Protocol() string {
|
||||
return c.protocolResult.Protocol()
|
||||
}
|
||||
|
||||
func (c compositeResult) Domain() string {
|
||||
return c.domainResult.Domain()
|
||||
}
|
||||
|
||||
func (c compositeResult) ProtocolForDomainResult() string {
|
||||
return c.domainResult.Protocol()
|
||||
}
|
||||
|
||||
type SnifferResultComposite interface {
|
||||
ProtocolForDomainResult() string
|
||||
}
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dns/config.proto
|
||||
|
||||
package dns
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
router "github.com/xtls/xray-core/app/router"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
@@ -23,10 +22,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type DomainMatchingType int32
|
||||
|
||||
const (
|
||||
@@ -473,7 +468,7 @@ var file_app_dns_config_proto_rawDesc = []byte{
|
||||
0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
|
||||
0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
|
||||
0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
|
||||
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xa5, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
|
||||
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
|
||||
@@ -507,16 +502,17 @@ var file_app_dns_config_proto_rawDesc = []byte{
|
||||
0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
|
||||
0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
|
||||
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
||||
0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
|
||||
0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
|
||||
0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
|
||||
0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
|
||||
0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
|
||||
0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
|
||||
0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a,
|
||||
0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54,
|
||||
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a,
|
||||
0x09, 0x53, 0x75, 0x62, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07,
|
||||
0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67,
|
||||
0x65, 0x78, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68,
|
||||
0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c,
|
||||
0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72,
|
||||
0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -68,4 +68,6 @@ message Config {
|
||||
|
||||
// Tag is the inbound tag of DNS client.
|
||||
string tag = 6;
|
||||
|
||||
reserved 7;
|
||||
}
|
||||
|
||||
@@ -2,18 +2,20 @@ package dns
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
// Fqdn normalize domain make sure it ends with '.'
|
||||
func Fqdn(domain string) string {
|
||||
if len(domain) > 0 && domain[len(domain)-1] == '.' {
|
||||
if len(domain) > 0 && strings.HasSuffix(domain, ".") {
|
||||
return domain
|
||||
}
|
||||
return domain + "."
|
||||
@@ -112,7 +114,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
|
||||
return opt
|
||||
}
|
||||
|
||||
func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
||||
func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
||||
qA := dnsmessage.Question{
|
||||
Name: dnsmessage.MustNewName(domain),
|
||||
Type: dnsmessage.TypeA,
|
||||
|
||||
@@ -7,9 +7,11 @@ import (
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
"github.com/miekg/dns"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func Test_parseResponse(t *testing.T) {
|
||||
@@ -92,7 +94,7 @@ func Test_buildReqMsgs(t *testing.T) {
|
||||
}
|
||||
type args struct {
|
||||
domain string
|
||||
option IPOption
|
||||
option dns_feature.IPOption
|
||||
reqOpts *dnsmessage.Resource
|
||||
}
|
||||
tests := []struct {
|
||||
@@ -100,10 +102,26 @@ func Test_buildReqMsgs(t *testing.T) {
|
||||
args args
|
||||
want int
|
||||
}{
|
||||
{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
|
||||
{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
|
||||
{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
|
||||
{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
|
||||
{"dual stack", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}, nil}, 2},
|
||||
{"ipv4 only", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
}, nil}, 1},
|
||||
{"ipv6 only", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}, nil}, 1},
|
||||
{"none/error", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
}, nil}, 0},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
|
||||
@@ -12,7 +12,10 @@ import (
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/net/cnc"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
@@ -22,7 +25,6 @@ import (
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
// DoHNameServer implemented DNS over HTTPS (RFC8484) Wire Format,
|
||||
@@ -47,6 +49,57 @@ func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.
|
||||
s := baseDOHNameServer(url, "DOH", clientIP)
|
||||
|
||||
s.dispatcher = dispatcher
|
||||
tr := &http.Transport{
|
||||
MaxIdleConns: 30,
|
||||
IdleConnTimeout: 90 * time.Second,
|
||||
TLSHandshakeTimeout: 30 * time.Second,
|
||||
ForceAttemptHTTP2: true,
|
||||
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
||||
dispatcherCtx := context.Background()
|
||||
|
||||
dest, err := net.ParseDestination(network + ":" + addr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
dispatcherCtx = session.ContextWithContent(dispatcherCtx, session.ContentFromContext(ctx))
|
||||
dispatcherCtx = session.ContextWithInbound(dispatcherCtx, session.InboundFromContext(ctx))
|
||||
dispatcherCtx = log.ContextWithAccessMessage(dispatcherCtx, &log.AccessMessage{
|
||||
From: "DoH",
|
||||
To: s.dohURL,
|
||||
Status: log.AccessAccepted,
|
||||
Reason: "",
|
||||
})
|
||||
|
||||
link, err := s.dispatcher.Dispatch(dispatcherCtx, dest)
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
|
||||
}
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
cc := common.ChainedClosable{}
|
||||
if cw, ok := link.Writer.(common.Closable); ok {
|
||||
cc = append(cc, cw)
|
||||
}
|
||||
if cr, ok := link.Reader.(common.Closable); ok {
|
||||
cc = append(cc, cr)
|
||||
}
|
||||
return cnc.NewConnection(
|
||||
cnc.ConnectionInputMulti(link.Writer),
|
||||
cnc.ConnectionOutputMulti(link.Reader),
|
||||
cnc.ConnectionOnClose(cc),
|
||||
), nil
|
||||
},
|
||||
}
|
||||
s.httpClient = &http.Client{
|
||||
Timeout: time.Second * 180,
|
||||
Transport: tr,
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
@@ -64,6 +117,12 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
|
||||
return nil, err
|
||||
}
|
||||
conn, err := internet.DialSystem(ctx, dest, nil)
|
||||
log.Record(&log.AccessMessage{
|
||||
From: "DoH",
|
||||
To: s.dohURL,
|
||||
Status: log.AccessAccepted,
|
||||
Detour: "local",
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -177,7 +236,7 @@ func (s *DoHNameServer) newReqID() uint16 {
|
||||
return uint16(atomic.AddUint32(&s.reqID, 1))
|
||||
}
|
||||
|
||||
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
||||
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
if s.name+"." == "DOH//"+domain {
|
||||
@@ -249,41 +308,6 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
||||
|
||||
hc := s.httpClient
|
||||
|
||||
// Dispatched connection will be closed (interrupted) after each request
|
||||
// This makes DOH inefficient without a keep-alived connection
|
||||
// See: core/app/proxyman/outbound/handler.go:113
|
||||
// Using mux (https request wrapped in a stream layer) improves the situation.
|
||||
// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
|
||||
// a normal network eg. the server side of xray
|
||||
|
||||
if s.dispatcher != nil {
|
||||
tr := &http.Transport{
|
||||
MaxIdleConns: 30,
|
||||
IdleConnTimeout: 90 * time.Second,
|
||||
TLSHandshakeTimeout: 30 * time.Second,
|
||||
ForceAttemptHTTP2: true,
|
||||
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
||||
dest, err := net.ParseDestination(network + ":" + addr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
link, err := s.dispatcher.Dispatch(ctx, dest)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return cnc.NewConnection(
|
||||
cnc.ConnectionInputMulti(link.Writer),
|
||||
cnc.ConnectionOutputMulti(link.Reader),
|
||||
), nil
|
||||
},
|
||||
}
|
||||
hc = &http.Client{
|
||||
Timeout: time.Second * 180,
|
||||
Transport: tr,
|
||||
}
|
||||
}
|
||||
|
||||
resp, err := hc.Do(req.WithContext(ctx))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -298,7 +322,7 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
||||
return ioutil.ReadAll(resp.Body)
|
||||
}
|
||||
|
||||
func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
||||
func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
@@ -341,12 +365,13 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
|
||||
}
|
||||
|
||||
// QueryIP is called from dns.Server->queryIPTimeout
|
||||
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) { // nolint: dupl
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
@@ -377,10 +402,12 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOpt
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
|
||||
9
app/dns/fakedns/errors.generated.go
Normal file
9
app/dns/fakedns/errors.generated.go
Normal file
@@ -0,0 +1,9 @@
|
||||
package fakedns
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errPathObjHolder struct{}
|
||||
|
||||
func newError(values ...interface{}) *errors.Error {
|
||||
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||
}
|
||||
134
app/dns/fakedns/fake.go
Normal file
134
app/dns/fakedns/fake.go
Normal file
@@ -0,0 +1,134 @@
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"math"
|
||||
"math/big"
|
||||
gonet "net"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/cache"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
type Holder struct {
|
||||
domainToIP cache.Lru
|
||||
ipRange *gonet.IPNet
|
||||
|
||||
config *FakeDnsPool
|
||||
}
|
||||
|
||||
func (*Holder) Type() interface{} {
|
||||
return (*dns.FakeDNSEngine)(nil)
|
||||
}
|
||||
|
||||
func (fkdns *Holder) Start() error {
|
||||
return fkdns.initializeFromConfig()
|
||||
}
|
||||
|
||||
func (fkdns *Holder) Close() error {
|
||||
fkdns.domainToIP = nil
|
||||
fkdns.ipRange = nil
|
||||
return nil
|
||||
}
|
||||
|
||||
func NewFakeDNSHolder() (*Holder, error) {
|
||||
var fkdns *Holder
|
||||
var err error
|
||||
|
||||
if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
|
||||
return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
|
||||
}
|
||||
err = fkdns.initialize(dns.FakeIPPool, 65535)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return fkdns, nil
|
||||
}
|
||||
|
||||
func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
|
||||
return &Holder{nil, nil, conf}, nil
|
||||
}
|
||||
|
||||
func (fkdns *Holder) initializeFromConfig() error {
|
||||
return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
|
||||
}
|
||||
|
||||
func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
|
||||
var ipRange *gonet.IPNet
|
||||
var err error
|
||||
|
||||
if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
|
||||
return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
|
||||
}
|
||||
|
||||
ones, bits := ipRange.Mask.Size()
|
||||
rooms := bits - ones
|
||||
if math.Log2(float64(lruSize)) >= float64(rooms) {
|
||||
return newError("LRU size is bigger than subnet size").AtError()
|
||||
}
|
||||
fkdns.domainToIP = cache.NewLru(lruSize)
|
||||
fkdns.ipRange = ipRange
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetFakeIPForDomain check and generate a fake IP for a domain name
|
||||
func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
|
||||
if v, ok := fkdns.domainToIP.Get(domain); ok {
|
||||
return []net.Address{v.(net.Address)}
|
||||
}
|
||||
var currentTimeMillis = uint64(time.Now().UnixNano() / 1e6)
|
||||
ones, bits := fkdns.ipRange.Mask.Size()
|
||||
rooms := bits - ones
|
||||
if rooms < 64 {
|
||||
currentTimeMillis %= (uint64(1) << rooms)
|
||||
}
|
||||
var bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||
bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
|
||||
var ip net.Address
|
||||
for {
|
||||
ip = net.IPAddress(bigIntIP.Bytes())
|
||||
|
||||
// if we run for a long time, we may go back to beginning and start seeing the IP in use
|
||||
if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
|
||||
break
|
||||
}
|
||||
|
||||
bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
|
||||
if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
|
||||
bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||
}
|
||||
}
|
||||
fkdns.domainToIP.Put(domain, ip)
|
||||
return []net.Address{ip}
|
||||
}
|
||||
|
||||
// GetDomainFromFakeDNS check if an IP is a fake IP and have corresponding domain name
|
||||
func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
|
||||
if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
|
||||
return ""
|
||||
}
|
||||
if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
|
||||
return k.(string)
|
||||
}
|
||||
newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
|
||||
return ""
|
||||
}
|
||||
|
||||
// GetFakeIPRange return fake IP range from configuration
|
||||
func (fkdns *Holder) GetFakeIPRange() *gonet.IPNet {
|
||||
return fkdns.ipRange
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
var f *Holder
|
||||
var err error
|
||||
if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}))
|
||||
}
|
||||
3
app/dns/fakedns/fakedns.go
Normal file
3
app/dns/fakedns/fakedns.go
Normal file
@@ -0,0 +1,3 @@
|
||||
package fakedns
|
||||
|
||||
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
||||
158
app/dns/fakedns/fakedns.pb.go
Normal file
158
app/dns/fakedns/fakedns.pb.go
Normal file
@@ -0,0 +1,158 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dns/fakedns/fakedns.proto
|
||||
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
const (
|
||||
// Verify that this generated code is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
type FakeDnsPool struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
IpPool string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
|
||||
LruSize int64 `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"` //Size of Pool for remembering relationship between domain name and IP address
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) Reset() {
|
||||
*x = FakeDnsPool{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*FakeDnsPool) ProtoMessage() {}
|
||||
|
||||
func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
|
||||
func (*FakeDnsPool) Descriptor() ([]byte, []int) {
|
||||
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) GetIpPool() string {
|
||||
if x != nil {
|
||||
return x.IpPool
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) GetLruSize() int64 {
|
||||
if x != nil {
|
||||
return x.LruSize
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
|
||||
0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
|
||||
0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
|
||||
0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
|
||||
0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
|
||||
0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
|
||||
0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
|
||||
0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
|
||||
0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65,
|
||||
0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
|
||||
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
|
||||
0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e,
|
||||
0x46, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
|
||||
)
|
||||
|
||||
func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
|
||||
})
|
||||
return file_app_dns_fakedns_fakedns_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
|
||||
var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
|
||||
(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
|
||||
}
|
||||
var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
|
||||
0, // [0:0] is the sub-list for method output_type
|
||||
0, // [0:0] is the sub-list for method input_type
|
||||
0, // [0:0] is the sub-list for extension type_name
|
||||
0, // [0:0] is the sub-list for extension extendee
|
||||
0, // [0:0] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_dns_fakedns_fakedns_proto_init() }
|
||||
func file_app_dns_fakedns_fakedns_proto_init() {
|
||||
if File_app_dns_fakedns_fakedns_proto != nil {
|
||||
return
|
||||
}
|
||||
if !protoimpl.UnsafeEnabled {
|
||||
file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*FakeDnsPool); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
}
|
||||
type x struct{}
|
||||
out := protoimpl.TypeBuilder{
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
|
||||
NumEnums: 0,
|
||||
NumMessages: 1,
|
||||
NumExtensions: 0,
|
||||
NumServices: 0,
|
||||
},
|
||||
GoTypes: file_app_dns_fakedns_fakedns_proto_goTypes,
|
||||
DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
|
||||
MessageInfos: file_app_dns_fakedns_fakedns_proto_msgTypes,
|
||||
}.Build()
|
||||
File_app_dns_fakedns_fakedns_proto = out.File
|
||||
file_app_dns_fakedns_fakedns_proto_rawDesc = nil
|
||||
file_app_dns_fakedns_fakedns_proto_goTypes = nil
|
||||
file_app_dns_fakedns_fakedns_proto_depIdxs = nil
|
||||
}
|
||||
12
app/dns/fakedns/fakedns.proto
Normal file
12
app/dns/fakedns/fakedns.proto
Normal file
@@ -0,0 +1,12 @@
|
||||
syntax = "proto3";
|
||||
|
||||
package xray.app.dns.fakedns;
|
||||
option csharp_namespace = "Xray.App.Dns.Fakedns";
|
||||
option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
|
||||
option java_package = "com.xray.app.dns.fakedns";
|
||||
option java_multiple_files = true;
|
||||
|
||||
message FakeDnsPool{
|
||||
string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
|
||||
int64 lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
|
||||
}
|
||||
105
app/dns/fakedns/fakedns_test.go
Normal file
105
app/dns/fakedns/fakedns_test.go
Normal file
@@ -0,0 +1,105 @@
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/uuid"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
var (
|
||||
ipPrefix = "198.18."
|
||||
)
|
||||
|
||||
func TestNewFakeDnsHolder(_ *testing.T) {
|
||||
_, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMapping(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
|
||||
assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||
assert.Equal(t, "fakednstest.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||
assert.Equal(t, "fakednstest2.example.com", result)
|
||||
}
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
|
||||
IpPool: dns.FakeIPPool,
|
||||
LruSize: 256,
|
||||
})
|
||||
common.Must(err)
|
||||
|
||||
err = fkdns.Start()
|
||||
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
|
||||
for i := 0; i <= 8192; i++ {
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||
assert.Equal(t, "fakednstest.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||
assert.Equal(t, "fakednstest2.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
uuid := uuid.New()
|
||||
domain := uuid.String() + ".fakednstest.example.com"
|
||||
tempAddr := fkdns.GetFakeIPForDomain(domain)
|
||||
rsaddr := tempAddr[0].IP().String()
|
||||
|
||||
result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
|
||||
assert.Equal(t, domain, result)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/features"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
// StaticHosts represents static domain-ip mapping in DNS server.
|
||||
@@ -92,7 +93,7 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
|
||||
return sh, nil
|
||||
}
|
||||
|
||||
func filterIP(ips []net.Address, option IPOption) []net.Address {
|
||||
func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
|
||||
filtered := make([]net.Address, 0, len(ips))
|
||||
for _, ip := range ips {
|
||||
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
|
||||
@@ -106,7 +107,7 @@ func filterIP(ips []net.Address, option IPOption) []net.Address {
|
||||
}
|
||||
|
||||
// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
|
||||
func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
|
||||
func (h *StaticHosts) LookupIP(domain string, option dns.IPOption) []net.Address {
|
||||
indices := h.matchers.Match(domain)
|
||||
if len(indices) == 0 {
|
||||
return nil
|
||||
|
||||
@@ -8,6 +8,7 @@ import (
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestStaticHosts(t *testing.T) {
|
||||
@@ -39,7 +40,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
common.Must(err)
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("example.com", IPOption{
|
||||
ips := hosts.LookupIP("example.com", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
@@ -52,7 +53,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("www.example.cn", IPOption{
|
||||
ips := hosts.LookupIP("www.example.cn", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
@@ -65,7 +66,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("baidu.com", IPOption{
|
||||
ips := hosts.LookupIP("baidu.com", dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
|
||||
@@ -4,39 +4,26 @@ import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/dns/localdns"
|
||||
)
|
||||
|
||||
// IPOption is an object for IP query options.
|
||||
type IPOption struct {
|
||||
IPv4Enable bool
|
||||
IPv6Enable bool
|
||||
}
|
||||
|
||||
// Client is the interface for DNS client.
|
||||
type Client interface {
|
||||
// Name of the Client.
|
||||
Name() string
|
||||
|
||||
// QueryIP sends IP queries to its configured server.
|
||||
QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
|
||||
QueryIP(ctx context.Context, domain string, option dns.IPOption) ([]net.IP, error)
|
||||
}
|
||||
|
||||
type LocalNameServer struct {
|
||||
client *localdns.Client
|
||||
}
|
||||
|
||||
func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
if option.IPv4Enable && option.IPv6Enable {
|
||||
return s.client.LookupIP(domain)
|
||||
}
|
||||
|
||||
if option.IPv4Enable {
|
||||
return s.client.LookupIPv4(domain)
|
||||
}
|
||||
|
||||
if option.IPv6Enable {
|
||||
return s.client.LookupIPv6(domain)
|
||||
func (s *LocalNameServer) QueryIP(_ context.Context, domain string, option dns.IPOption) ([]net.IP, error) {
|
||||
if option.IPv4Enable || option.IPv6Enable {
|
||||
return s.client.LookupIP(domain, option)
|
||||
}
|
||||
|
||||
return nil, newError("neither IPv4 nor IPv6 is enabled")
|
||||
|
||||
41
app/dns/nameserver_fakedns.go
Normal file
41
app/dns/nameserver_fakedns.go
Normal file
@@ -0,0 +1,41 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
type FakeDNSServer struct {
|
||||
fakeDNSEngine dns.FakeDNSEngine
|
||||
}
|
||||
|
||||
func NewFakeDNSServer() *FakeDNSServer {
|
||||
return &FakeDNSServer{}
|
||||
}
|
||||
|
||||
func (FakeDNSServer) Name() string {
|
||||
return "FakeDNS"
|
||||
}
|
||||
|
||||
func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ dns.IPOption) ([]net.IP, error) {
|
||||
if f.fakeDNSEngine == nil {
|
||||
if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
|
||||
f.fakeDNSEngine = fd
|
||||
}); err != nil {
|
||||
return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
|
||||
}
|
||||
}
|
||||
ips := f.fakeDNSEngine.GetFakeIPForDomain(domain)
|
||||
|
||||
netIP := toNetIP(ips)
|
||||
if netIP == nil {
|
||||
return nil, newError("Unable to convert IP to net ip").AtError()
|
||||
}
|
||||
|
||||
newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
|
||||
|
||||
return netIP, nil
|
||||
}
|
||||
@@ -7,14 +7,16 @@ import (
|
||||
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestLocalNameServer(t *testing.T) {
|
||||
s := NewLocalNameServer()
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
|
||||
ips, err := s.QueryIP(ctx, "google.com", IPOption{
|
||||
ips, err := s.QueryIP(ctx, "google.com", dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
cancel()
|
||||
common.Must(err)
|
||||
|
||||
@@ -29,7 +29,8 @@ type Server struct {
|
||||
sync.Mutex
|
||||
hosts *StaticHosts
|
||||
clientIP net.IP
|
||||
clients []Client // clientIdx -> Client
|
||||
clients []Client // clientIdx -> Client
|
||||
ctx context.Context
|
||||
ipIndexMap []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
|
||||
domainRules [][]string // clientIdx -> domainRuleIdx -> DomainRule
|
||||
domainMatcher strmatcher.IndexMatcher
|
||||
@@ -74,6 +75,7 @@ func generateRandomTag() string {
|
||||
func New(ctx context.Context, config *Config) (*Server, error) {
|
||||
server := &Server{
|
||||
clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
|
||||
ctx: ctx,
|
||||
tag: config.Tag,
|
||||
}
|
||||
if server.tag == "" {
|
||||
@@ -143,6 +145,9 @@ func New(ctx context.Context, config *Config) (*Server, error) {
|
||||
server.clients[idx] = c
|
||||
}))
|
||||
|
||||
case address.Family().IsDomain() && address.Domain() == "fakedns":
|
||||
server.clients = append(server.clients, NewFakeDNSServer())
|
||||
|
||||
default:
|
||||
// UDP classic DNS mode
|
||||
dest := endpoint.AsDestination()
|
||||
@@ -294,13 +299,14 @@ func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]n
|
||||
return newIps, nil
|
||||
}
|
||||
|
||||
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
|
||||
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option dns.IPOption) ([]net.IP, error) {
|
||||
ctx, cancel := context.WithTimeout(s.ctx, time.Second*4)
|
||||
if len(s.tag) > 0 {
|
||||
ctx = session.ContextWithInbound(ctx, &session.Inbound{
|
||||
Tag: s.tag,
|
||||
})
|
||||
}
|
||||
|
||||
ips, err := client.QueryIP(ctx, domain, option)
|
||||
cancel()
|
||||
|
||||
@@ -312,31 +318,7 @@ func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IP
|
||||
return ips, err
|
||||
}
|
||||
|
||||
// LookupIP implements dns.Client.
|
||||
func (s *Server) LookupIP(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
}
|
||||
|
||||
// LookupIPv4 implements dns.IPv4Lookup.
|
||||
func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
})
|
||||
}
|
||||
|
||||
// LookupIPv6 implements dns.IPv6Lookup.
|
||||
func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
}
|
||||
|
||||
func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
|
||||
func (s *Server) lookupStatic(domain string, option dns.IPOption, depth int32) []net.Address {
|
||||
ips := s.hosts.LookupIP(domain, option)
|
||||
if ips == nil {
|
||||
return nil
|
||||
@@ -360,14 +342,14 @@ func toNetIP(ips []net.Address) []net.IP {
|
||||
return netips
|
||||
}
|
||||
|
||||
func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
|
||||
// LookupIP implements dns.Client.
|
||||
func (s *Server) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
|
||||
if domain == "" {
|
||||
return nil, newError("empty domain name")
|
||||
}
|
||||
domain = strings.ToLower(domain)
|
||||
|
||||
// normalize the FQDN form query
|
||||
if domain[len(domain)-1] == '.' {
|
||||
if strings.HasSuffix(domain, ".") {
|
||||
domain = domain[:len(domain)-1]
|
||||
}
|
||||
|
||||
@@ -404,6 +386,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
|
||||
for _, idx := range indices {
|
||||
clientIdx := int(s.matcherInfos[idx].clientIdx)
|
||||
matchedClient = s.clients[clientIdx]
|
||||
if !option.FakeEnable && strings.EqualFold(matchedClient.Name(), "FakeDNS") {
|
||||
newError("skip DNS resolution for domain ", domain, " at server ", matchedClient.Name()).AtDebug().WriteToLog()
|
||||
continue
|
||||
}
|
||||
ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
|
||||
if len(ips) > 0 {
|
||||
return ips, nil
|
||||
@@ -423,7 +409,10 @@ func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, err
|
||||
newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
|
||||
continue
|
||||
}
|
||||
|
||||
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
|
||||
newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
|
||||
continue
|
||||
}
|
||||
ips, err := s.queryIPTimeout(idx, client, domain, option)
|
||||
if len(ips) > 0 {
|
||||
return ips, nil
|
||||
|
||||
@@ -154,7 +154,11 @@ func TestUDPServerSubnet(t *testing.T) {
|
||||
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -209,7 +213,11 @@ func TestUDPServer(t *testing.T) {
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -220,7 +228,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("facebook.com")
|
||||
ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -231,7 +243,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
_, err := client.LookupIP("notexist.google.com")
|
||||
_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err == nil {
|
||||
t.Fatal("nil error")
|
||||
}
|
||||
@@ -241,8 +257,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
clientv6 := client.(feature_dns.IPv6Lookup)
|
||||
ips, err := clientv6.LookupIPv6("ipv4only.google.com")
|
||||
ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != feature_dns.ErrEmptyResponse {
|
||||
t.Fatal("error: ", err)
|
||||
}
|
||||
@@ -254,7 +273,11 @@ func TestUDPServer(t *testing.T) {
|
||||
dnsServer.Shutdown()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -331,7 +354,11 @@ func TestPrioritizedDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -390,10 +417,12 @@ func TestUDPServerIPv6(t *testing.T) {
|
||||
common.Must(err)
|
||||
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
client6 := client.(feature_dns.IPv6Lookup)
|
||||
|
||||
{
|
||||
ips, err := client6.LookupIPv6("ipv6.google.com")
|
||||
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -456,7 +485,11 @@ func TestStaticHostDomain(t *testing.T) {
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("example.com")
|
||||
ips, err := client.LookupIP("example.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -563,7 +596,11 @@ func TestIPMatch(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -682,7 +719,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{ // Will match dotless:
|
||||
ips, err := client.LookupIP("hostname")
|
||||
ips, err := client.LookupIP("hostname", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -693,7 +734,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match domain:local
|
||||
ips, err := client.LookupIP("hostname.local")
|
||||
ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -704,7 +749,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match static ip
|
||||
ips, err := client.LookupIP("hostnamestatic")
|
||||
ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -715,7 +764,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match domain replacing
|
||||
ips, err := client.LookupIP("hostnamealias")
|
||||
ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -726,7 +779,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
|
||||
ips, err := client.LookupIP("localhost")
|
||||
ips, err := client.LookupIP("localhost", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -737,7 +794,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||
ips, err := client.LookupIP("localhost-a")
|
||||
ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -748,7 +809,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||
ips, err := client.LookupIP("localhost-b")
|
||||
ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -759,7 +824,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:
|
||||
ips, err := client.LookupIP("Mijia Cloud")
|
||||
ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -921,7 +990,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{ // Will match server 1,2 and server 1 returns expected ip
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -932,8 +1005,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
|
||||
clientv4 := client.(feature_dns.IPv4Lookup)
|
||||
ips, err := clientv4.LookupIPv4("ipv6.google.com")
|
||||
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -944,7 +1020,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 3,1,2 and server 3 returns expected one
|
||||
ips, err := client.LookupIP("api.google.com")
|
||||
ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -955,7 +1035,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 4,3,1,2 and server 4 returns expected one
|
||||
ips, err := client.LookupIP("v2.api.google.com")
|
||||
ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
|
||||
@@ -7,7 +7,10 @@ import (
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
|
||||
@@ -17,7 +20,6 @@ import (
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"github.com/xtls/xray-core/transport/internet/udp"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
type ClassicNameServer struct {
|
||||
@@ -52,7 +54,7 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
|
||||
Execute: s.Cleanup,
|
||||
}
|
||||
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
|
||||
newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
|
||||
newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
|
||||
return s
|
||||
}
|
||||
|
||||
@@ -178,7 +180,7 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
|
||||
s.requests[id] = *req
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
||||
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
||||
@@ -190,14 +192,21 @@ func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
udpCtx = session.ContextWithInbound(udpCtx, inbound)
|
||||
}
|
||||
|
||||
udpCtx = session.ContextWithContent(udpCtx, &session.Content{
|
||||
Protocol: "dns",
|
||||
})
|
||||
udpCtx = log.ContextWithAccessMessage(udpCtx, &log.AccessMessage{
|
||||
From: "DNS",
|
||||
To: s.address,
|
||||
Status: log.AccessAccepted,
|
||||
Reason: "",
|
||||
})
|
||||
s.udpServer.Dispatch(udpCtx, s.address, b)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
||||
func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
@@ -235,12 +244,14 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]
|
||||
return nil, dns_feature.ErrEmptyResponse
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
// QueryIP implements Server.
|
||||
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSCacheHit, 0, err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
@@ -271,10 +282,12 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option I
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{s.name, domain, ips, log.DNSQueried, time.Since(start), err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/log/command/config.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/log/config.proto
|
||||
|
||||
package log
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
log "github.com/xtls/xray-core/common/log"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type LogType int32
|
||||
|
||||
const (
|
||||
@@ -88,6 +83,7 @@ type Config struct {
|
||||
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
|
||||
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
|
||||
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
|
||||
EnableDnsLog bool `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
@@ -133,7 +129,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
|
||||
if x != nil {
|
||||
return x.ErrorLogLevel
|
||||
}
|
||||
return log.Severity_Unknown
|
||||
return log.Severity(0)
|
||||
}
|
||||
|
||||
func (x *Config) GetErrorLogPath() string {
|
||||
@@ -157,13 +153,20 @@ func (x *Config) GetAccessLogPath() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *Config) GetEnableDnsLog() bool {
|
||||
if x != nil {
|
||||
return x.EnableDnsLog
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
var File_app_log_config_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_log_config_proto_rawDesc = []byte{
|
||||
0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
|
||||
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
|
||||
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
|
||||
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
|
||||
0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
|
||||
@@ -181,15 +184,17 @@ var file_app_log_config_proto_rawDesc = []byte{
|
||||
0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
|
||||
0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
|
||||
0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
|
||||
0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
||||
0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
|
||||
0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
|
||||
0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
|
||||
0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
|
||||
0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
|
||||
0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
|
||||
0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
|
||||
0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
|
||||
0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
|
||||
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
|
||||
0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
|
||||
0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
|
||||
0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
||||
0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
|
||||
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -22,4 +22,5 @@ message Config {
|
||||
|
||||
LogType access_log_type = 4;
|
||||
string access_log_path = 5;
|
||||
bool enable_dns_log = 6;
|
||||
}
|
||||
|
||||
@@ -17,6 +17,7 @@ type Instance struct {
|
||||
accessLogger log.Handler
|
||||
errorLogger log.Handler
|
||||
active bool
|
||||
dns bool
|
||||
}
|
||||
|
||||
// New creates a new log.Instance based on the given config.
|
||||
@@ -24,6 +25,7 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
|
||||
g := &Instance{
|
||||
config: config,
|
||||
active: false,
|
||||
dns: config.EnableDnsLog,
|
||||
}
|
||||
log.RegisterHandler(g)
|
||||
|
||||
@@ -103,6 +105,10 @@ func (g *Instance) Handle(msg log.Message) {
|
||||
if g.accessLogger != nil {
|
||||
g.accessLogger.Handle(msg)
|
||||
}
|
||||
case *log.DNSLog:
|
||||
if g.dns && g.accessLogger != nil {
|
||||
g.accessLogger.Handle(msg)
|
||||
}
|
||||
case *log.GeneralMessage:
|
||||
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
|
||||
g.errorLogger.Handle(msg)
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/golang/mock/gomock"
|
||||
|
||||
"github.com/xtls/xray-core/app/log"
|
||||
"github.com/xtls/xray-core/common"
|
||||
clog "github.com/xtls/xray-core/common/log"
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/policy/config.proto
|
||||
|
||||
package policy
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Second struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/proxyman/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protocol "github.com/xtls/xray-core/common/protocol"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
core "github.com/xtls/xray-core/core"
|
||||
@@ -24,10 +23,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type AddUserOperation struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/proxyman/config.proto
|
||||
|
||||
package proxyman
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
internet "github.com/xtls/xray-core/transport/internet"
|
||||
@@ -24,10 +23,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type KnownProtocols int32
|
||||
|
||||
const (
|
||||
@@ -239,9 +234,12 @@ type SniffingConfig struct {
|
||||
// Whether or not to enable content sniffing on an inbound connection.
|
||||
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
|
||||
// Override target destination if sniff'ed protocol is in the given list.
|
||||
// Supported values are "http", "tls".
|
||||
// Supported values are "http", "tls", "fakedns".
|
||||
DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
|
||||
DomainsExcluded []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
|
||||
// Whether should only try to sniff metadata without waiting for client input.
|
||||
// Can be used to support SMTP like protocol where server send the first message.
|
||||
MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
|
||||
}
|
||||
|
||||
func (x *SniffingConfig) Reset() {
|
||||
@@ -297,6 +295,13 @@ func (x *SniffingConfig) GetDomainsExcluded() []string {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *SniffingConfig) GetMetadataOnly() bool {
|
||||
if x != nil {
|
||||
return x.MetadataOnly
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type ReceiverConfig struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
@@ -764,7 +769,7 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
|
||||
0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
|
||||
0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
|
||||
0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
|
||||
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x88, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
|
||||
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xad, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
|
||||
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
|
||||
0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
|
||||
0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
|
||||
@@ -773,86 +778,88 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
|
||||
0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
|
||||
0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
|
||||
0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x43, 0x6f, 0x6e,
|
||||
0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67,
|
||||
0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
|
||||
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61,
|
||||
0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x33,
|
||||
0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
|
||||
0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69, 0x73,
|
||||
0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f,
|
||||
0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
|
||||
0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78,
|
||||
0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53,
|
||||
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
|
||||
0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f, 0x73,
|
||||
0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04,
|
||||
0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
|
||||
0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53,
|
||||
0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72,
|
||||
0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c, 0x72,
|
||||
0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f,
|
||||
0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28,
|
||||
0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e,
|
||||
0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e, 0x0a,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65,
|
||||
0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e,
|
||||
0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e, 0x64,
|
||||
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e, 0x0a,
|
||||
0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||
0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e, 0x69,
|
||||
0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e, 0x69,
|
||||
0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04, 0x08,
|
||||
0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x48,
|
||||
0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03,
|
||||
0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x4d,
|
||||
0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
||||
0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
|
||||
0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65, 0x63,
|
||||
0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47, 0x0a,
|
||||
0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
|
||||
0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
|
||||
0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76,
|
||||
0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74,
|
||||
0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
|
||||
0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61,
|
||||
0x6e, 0x67, 0x65, 0x12, 0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20,
|
||||
0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
|
||||
0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x52, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f,
|
||||
0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18,
|
||||
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
|
||||
0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c,
|
||||
0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||
0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
||||
0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72,
|
||||
0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||
0x12, 0x40, 0x0a, 0x1c, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67,
|
||||
0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e,
|
||||
0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f,
|
||||
0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69,
|
||||
0x6f, 0x6e, 0x12, 0x4e, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65,
|
||||
0x72, 0x72, 0x69, 0x64, 0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e,
|
||||
0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02,
|
||||
0x18, 0x01, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69,
|
||||
0x64, 0x65, 0x12, 0x4e, 0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73,
|
||||
0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61,
|
||||
0x6e, 0x2e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x52, 0x10, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||
0x67, 0x73, 0x4a, 0x04, 0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62,
|
||||
0x6f, 0x75, 0x6e, 0x64, 0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03,
|
||||
0x74, 0x61, 0x67, 0x12, 0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f,
|
||||
0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72,
|
||||
0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
|
||||
0x52, 0x10, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||
0x67, 0x73, 0x12, 0x47, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74,
|
||||
0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
|
||||
0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72,
|
||||
0x6f, 0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f,
|
||||
0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02,
|
||||
0x0a, 0x0c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d,
|
||||
0x0a, 0x03, 0x76, 0x69, 0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50,
|
||||
0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a,
|
||||
0x0f, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||
0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72,
|
||||
0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74,
|
||||
0x2e, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73,
|
||||
0x74, 0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a,
|
||||
0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
||||
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64,
|
||||
0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
|
||||
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75,
|
||||
0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65, 0x6e,
|
||||
0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69, 0x61,
|
||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d,
|
||||
0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65,
|
||||
0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65,
|
||||
0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d,
|
||||
0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78,
|
||||
0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
|
||||
0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72,
|
||||
0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79,
|
||||
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65, 0x74,
|
||||
0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c,
|
||||
0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69,
|
||||
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
|
||||
0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x50, 0x0a, 0x12, 0x4d,
|
||||
0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01,
|
||||
0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a, 0x0b, 0x63,
|
||||
0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
|
||||
0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x2a, 0x23, 0x0a,
|
||||
0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x12,
|
||||
0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a, 0x03, 0x54, 0x4c, 0x53,
|
||||
0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
|
||||
0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50, 0x01, 0x5a, 0x26, 0x67,
|
||||
0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70,
|
||||
0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f,
|
||||
0x33,
|
||||
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
|
||||
0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
|
||||
0x50, 0x72, 0x6f, 0x78, 0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75,
|
||||
0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||
0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69,
|
||||
0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d,
|
||||
0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||
0x22, 0x50, 0x0a, 0x12, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67,
|
||||
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65,
|
||||
0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64,
|
||||
0x12, 0x20, 0x0a, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18,
|
||||
0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e,
|
||||
0x63, 0x79, 0x2a, 0x23, 0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f,
|
||||
0x63, 0x6f, 0x6c, 0x73, 0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07,
|
||||
0x0a, 0x03, 0x54, 0x4c, 0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e,
|
||||
0x50, 0x01, 0x5a, 0x26, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
|
||||
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
|
||||
0x70, 0x2f, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06,
|
||||
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -54,9 +54,13 @@ message SniffingConfig {
|
||||
bool enabled = 1;
|
||||
|
||||
// Override target destination if sniff'ed protocol is in the given list.
|
||||
// Supported values are "http", "tls".
|
||||
// Supported values are "http", "tls", "fakedns".
|
||||
repeated string destination_override = 2;
|
||||
repeated string domains_excluded = 3;
|
||||
|
||||
// Whether should only try to sniff metadata without waiting for client input.
|
||||
// Can be used to support SMTP like protocol where server send the first message.
|
||||
bool metadata_only = 4;
|
||||
}
|
||||
|
||||
message ReceiverConfig {
|
||||
|
||||
@@ -133,6 +133,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
|
||||
address: address,
|
||||
port: net.Port(port),
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
stream: mss,
|
||||
|
||||
@@ -153,6 +153,7 @@ func (h *DynamicInboundHandler) refresh() error {
|
||||
address: address,
|
||||
port: port,
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: h.receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
stream: h.streamSettings,
|
||||
|
||||
@@ -42,6 +42,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler inbound.Handler) error
|
||||
|
||||
tag := handler.Tag()
|
||||
if len(tag) > 0 {
|
||||
if _, found := m.taggedHandlers[tag]; found {
|
||||
return newError("existing tag found: " + tag)
|
||||
}
|
||||
m.taggedHandlers[tag] = handler
|
||||
} else {
|
||||
m.untaggedHandler = append(m.untaggedHandler, handler)
|
||||
|
||||
@@ -6,6 +6,8 @@ import (
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
|
||||
"github.com/xtls/xray-core/app/proxyman"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
@@ -54,7 +56,7 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
|
||||
return s.SocketSettings.Tproxy
|
||||
}
|
||||
|
||||
func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
func (w *tcpWorker) callback(conn stat.Connection) {
|
||||
ctx, cancel := context.WithCancel(w.ctx)
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
@@ -80,7 +82,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
}
|
||||
|
||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||
conn = &internet.StatCouterConnection{
|
||||
conn = &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: w.uplinkCounter,
|
||||
WriteCounter: w.downlinkCounter,
|
||||
@@ -98,6 +100,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
|
||||
@@ -116,7 +119,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
|
||||
|
||||
func (w *tcpWorker) Start() error {
|
||||
ctx := context.Background()
|
||||
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
|
||||
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
|
||||
go w.callback(conn)
|
||||
})
|
||||
if err != nil {
|
||||
@@ -235,6 +238,7 @@ type udpWorker struct {
|
||||
tag string
|
||||
stream *internet.MemoryStreamConfig
|
||||
dispatcher routing.Dispatcher
|
||||
sniffingConfig *proxyman.SniffingConfig
|
||||
uplinkCounter stats.Counter
|
||||
downlinkCounter stats.Counter
|
||||
|
||||
@@ -297,7 +301,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
||||
common.Must(w.checker.Start())
|
||||
|
||||
go func() {
|
||||
ctx := context.Background()
|
||||
ctx := w.ctx
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
|
||||
@@ -311,6 +315,13 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
||||
Gateway: net.UDPDestination(w.address, w.port),
|
||||
Tag: w.tag,
|
||||
})
|
||||
content := new(session.Content)
|
||||
if w.sniffingConfig != nil {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
|
||||
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
@@ -427,13 +438,13 @@ type dsWorker struct {
|
||||
ctx context.Context
|
||||
}
|
||||
|
||||
func (w *dsWorker) callback(conn internet.Connection) {
|
||||
func (w *dsWorker) callback(conn stat.Connection) {
|
||||
ctx, cancel := context.WithCancel(w.ctx)
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
|
||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||
conn = &internet.StatCouterConnection{
|
||||
conn = &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: w.uplinkCounter,
|
||||
WriteCounter: w.downlinkCounter,
|
||||
@@ -451,6 +462,7 @@ func (w *dsWorker) callback(conn internet.Connection) {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
|
||||
@@ -472,7 +484,7 @@ func (w *dsWorker) Port() net.Port {
|
||||
}
|
||||
func (w *dsWorker) Start() error {
|
||||
ctx := context.Background()
|
||||
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
|
||||
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
|
||||
go w.callback(conn)
|
||||
})
|
||||
if err != nil {
|
||||
|
||||
@@ -3,6 +3,8 @@ package outbound
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
|
||||
"github.com/xtls/xray-core/app/proxyman"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/mux"
|
||||
@@ -158,7 +160,7 @@ func (h *Handler) Address() net.Address {
|
||||
}
|
||||
|
||||
// Dial implements internet.Dialer.
|
||||
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
|
||||
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
|
||||
if h.senderSettings != nil {
|
||||
if h.senderSettings.ProxySettings.HasTag() {
|
||||
tag := h.senderSettings.ProxySettings.Tag
|
||||
@@ -201,9 +203,9 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
|
||||
return h.getStatCouterConnection(conn), err
|
||||
}
|
||||
|
||||
func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
|
||||
func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
|
||||
if h.uplinkCounter != nil || h.downlinkCounter != nil {
|
||||
return &internet.StatCouterConnection{
|
||||
return &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: h.downlinkCounter,
|
||||
WriteCounter: h.uplinkCounter,
|
||||
|
||||
@@ -4,6 +4,8 @@ import (
|
||||
"context"
|
||||
"testing"
|
||||
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
|
||||
"github.com/xtls/xray-core/app/policy"
|
||||
. "github.com/xtls/xray-core/app/proxyman/outbound"
|
||||
"github.com/xtls/xray-core/app/stats"
|
||||
@@ -12,7 +14,6 @@ import (
|
||||
core "github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/proxy/freedom"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
)
|
||||
|
||||
func TestInterfaces(t *testing.T) {
|
||||
@@ -44,9 +45,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
|
||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||
})
|
||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||
_, ok := conn.(*internet.StatCouterConnection)
|
||||
_, ok := conn.(*stat.CounterConnection)
|
||||
if ok {
|
||||
t.Errorf("Expected conn to not be StatCouterConnection")
|
||||
t.Errorf("Expected conn to not be CounterConnection")
|
||||
}
|
||||
}
|
||||
|
||||
@@ -73,8 +74,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
|
||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||
})
|
||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||
_, ok := conn.(*internet.StatCouterConnection)
|
||||
_, ok := conn.(*stat.CounterConnection)
|
||||
if !ok {
|
||||
t.Errorf("Expected conn to be StatCouterConnection")
|
||||
t.Errorf("Expected conn to be CounterConnection")
|
||||
}
|
||||
}
|
||||
|
||||
@@ -109,6 +109,9 @@ func (m *Manager) AddHandler(ctx context.Context, handler outbound.Handler) erro
|
||||
|
||||
tag := handler.Tag()
|
||||
if len(tag) > 0 {
|
||||
if _, found := m.taggedHandler[tag]; found {
|
||||
return newError("existing tag found: " + tag)
|
||||
}
|
||||
m.taggedHandler[tag] = handler
|
||||
} else {
|
||||
m.untaggedHandlers = append(m.untaggedHandlers, handler)
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
||||
"github.com/xtls/xray-core/common/mux"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/reverse/config.proto
|
||||
|
||||
package reverse
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Control_State int32
|
||||
|
||||
const (
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/mux"
|
||||
@@ -157,6 +158,9 @@ func (p *StaticMuxPicker) PickAvailable() (*mux.ClientWorker, error) {
|
||||
if w.draining {
|
||||
continue
|
||||
}
|
||||
if w.client.Closed() {
|
||||
continue
|
||||
}
|
||||
if w.client.ActiveConnections() < minConn {
|
||||
minConn = w.client.ActiveConnections()
|
||||
minIdx = i
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/router/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// RoutingContext is the context with information relative to routing process.
|
||||
// It conforms to the structure of xray.features.routing.Context and
|
||||
// xray.features.routing.Route.
|
||||
@@ -91,7 +86,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
|
||||
if x != nil {
|
||||
return x.Network
|
||||
}
|
||||
return net.Network_Unknown
|
||||
return net.Network(0)
|
||||
}
|
||||
|
||||
func (x *RoutingContext) GetSourceIPs() [][]byte {
|
||||
|
||||
@@ -8,6 +8,9 @@ import (
|
||||
"github.com/golang/mock/gomock"
|
||||
"github.com/google/go-cmp/cmp"
|
||||
"github.com/google/go-cmp/cmp/cmpopts"
|
||||
"google.golang.org/grpc"
|
||||
"google.golang.org/grpc/test/bufconn"
|
||||
|
||||
"github.com/xtls/xray-core/app/router"
|
||||
. "github.com/xtls/xray-core/app/router/command"
|
||||
"github.com/xtls/xray-core/app/stats"
|
||||
@@ -15,8 +18,6 @@ import (
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"github.com/xtls/xray-core/testing/mocks"
|
||||
"google.golang.org/grpc"
|
||||
"google.golang.org/grpc/test/bufconn"
|
||||
)
|
||||
|
||||
func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
|
||||
@@ -66,6 +66,24 @@ type DomainMatcher struct {
|
||||
matchers strmatcher.IndexMatcher
|
||||
}
|
||||
|
||||
func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
|
||||
g := strmatcher.NewMphMatcherGroup()
|
||||
for _, d := range domains {
|
||||
matcherType, f := matcherTypeMap[d.Type]
|
||||
if !f {
|
||||
return nil, newError("unsupported domain type", d.Type)
|
||||
}
|
||||
_, err := g.AddPattern(d.Value, matcherType)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
g.Build()
|
||||
return &DomainMatcher{
|
||||
matchers: g,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
||||
g := new(strmatcher.MatcherGroup)
|
||||
for _, d := range domains {
|
||||
@@ -82,7 +100,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
||||
}
|
||||
|
||||
func (m *DomainMatcher) ApplyDomain(domain string) bool {
|
||||
return len(m.matchers.Match(domain)) > 0
|
||||
return len(m.matchers.Match(strings.ToLower(domain))) > 0
|
||||
}
|
||||
|
||||
// Apply implements Condition.
|
||||
@@ -91,7 +109,7 @@ func (m *DomainMatcher) Apply(ctx routing.Context) bool {
|
||||
if len(domain) == 0 {
|
||||
return false
|
||||
}
|
||||
return m.ApplyDomain(strings.ToLower(domain))
|
||||
return m.ApplyDomain(domain)
|
||||
}
|
||||
|
||||
type MultiGeoIPMatcher struct {
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
||||
"github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
@@ -18,10 +19,10 @@ func init() {
|
||||
common.Must(err)
|
||||
|
||||
if _, err := os.Stat(platform.GetAssetLocation("geoip.dat")); err != nil && os.IsNotExist(err) {
|
||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "release", "config", "geoip.dat")))
|
||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geoip.dat"), filepath.Join(wd, "..", "..", "resources", "geoip.dat")))
|
||||
}
|
||||
if _, err := os.Stat(platform.GetAssetLocation("geosite.dat")); err != nil && os.IsNotExist(err) {
|
||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "release", "config", "geosite.dat")))
|
||||
common.Must(filesystem.CopyFile(platform.GetAssetLocation("geosite.dat"), filepath.Join(wd, "..", "..", "resources", "geosite.dat")))
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -359,6 +359,9 @@ func TestChinaSites(t *testing.T) {
|
||||
matcher, err := NewDomainMatcher(domains)
|
||||
common.Must(err)
|
||||
|
||||
acMatcher, err := NewMphMatcherGroup(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
@@ -387,9 +390,96 @@ func TestChinaSites(t *testing.T) {
|
||||
}
|
||||
|
||||
for _, testCase := range testCases {
|
||||
r := matcher.ApplyDomain(testCase.Domain)
|
||||
if r != testCase.Output {
|
||||
t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
|
||||
r1 := matcher.ApplyDomain(testCase.Domain)
|
||||
r2 := acMatcher.ApplyDomain(testCase.Domain)
|
||||
if r1 != testCase.Output {
|
||||
t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
|
||||
} else if r2 != testCase.Output {
|
||||
t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkMphDomainMatcher(b *testing.B) {
|
||||
domains, err := loadGeoSite("CN")
|
||||
common.Must(err)
|
||||
|
||||
matcher, err := NewMphMatcherGroup(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
}
|
||||
testCases := []TestCase{
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
}
|
||||
|
||||
for i := 0; i < 1024; i++ {
|
||||
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||
}
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
for _, testCase := range testCases {
|
||||
_ = matcher.ApplyDomain(testCase.Domain)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkDomainMatcher(b *testing.B) {
|
||||
domains, err := loadGeoSite("CN")
|
||||
common.Must(err)
|
||||
|
||||
matcher, err := NewDomainMatcher(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
}
|
||||
testCases := []TestCase{
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
}
|
||||
|
||||
for i := 0; i < 1024; i++ {
|
||||
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||
}
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
for _, testCase := range testCases {
|
||||
_ = matcher.ApplyDomain(testCase.Domain)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -67,11 +67,24 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
|
||||
conds := NewConditionChan()
|
||||
|
||||
if len(rr.Domain) > 0 {
|
||||
matcher, err := NewDomainMatcher(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition").Base(err)
|
||||
switch rr.DomainMatcher {
|
||||
case "linear":
|
||||
matcher, err := NewDomainMatcher(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition").Base(err)
|
||||
}
|
||||
conds.Add(matcher)
|
||||
case "mph", "hybrid":
|
||||
fallthrough
|
||||
default:
|
||||
matcher, err := NewMphMatcherGroup(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
|
||||
}
|
||||
newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
|
||||
conds.Add(matcher)
|
||||
}
|
||||
conds.Add(matcher)
|
||||
|
||||
}
|
||||
|
||||
if len(rr.UserEmail) > 0 {
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/router/config.proto
|
||||
|
||||
package router
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Type of domain value.
|
||||
type Domain_Type int32
|
||||
|
||||
@@ -515,6 +510,7 @@ type RoutingRule struct {
|
||||
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
|
||||
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
|
||||
Attributes string `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
|
||||
DomainMatcher string `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
|
||||
}
|
||||
|
||||
func (x *RoutingRule) Reset() {
|
||||
@@ -672,6 +668,13 @@ func (x *RoutingRule) GetAttributes() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *RoutingRule) GetDomainMatcher() string {
|
||||
if x != nil {
|
||||
return x.DomainMatcher
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type isRoutingRule_TargetTag interface {
|
||||
isRoutingRule_TargetTag()
|
||||
}
|
||||
@@ -946,7 +949,7 @@ var file_app_router_config_proto_rawDesc = []byte{
|
||||
0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
|
||||
0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||
0x79, 0x22, 0xb5, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||
0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
|
||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
|
||||
0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
|
||||
@@ -994,36 +997,38 @@ var file_app_router_config_proto_rawDesc = []byte{
|
||||
0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
|
||||
0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
|
||||
0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
|
||||
0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
|
||||
0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
|
||||
0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
|
||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
|
||||
0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
|
||||
0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
|
||||
0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
|
||||
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
|
||||
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
|
||||
0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
|
||||
0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
|
||||
0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
|
||||
0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
|
||||
0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
|
||||
0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
|
||||
0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
|
||||
0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
|
||||
0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
|
||||
0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
|
||||
0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
|
||||
0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
|
||||
0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
|
||||
0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6d,
|
||||
0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x64, 0x6f,
|
||||
0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x42, 0x0c, 0x0a, 0x0a, 0x74,
|
||||
0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c,
|
||||
0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
|
||||
0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11,
|
||||
0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f,
|
||||
0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
|
||||
0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f,
|
||||
0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73,
|
||||
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e,
|
||||
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
|
||||
0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72,
|
||||
0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20,
|
||||
0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
|
||||
0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||
0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e,
|
||||
0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32,
|
||||
0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65,
|
||||
0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52,
|
||||
0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47,
|
||||
0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||
0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73,
|
||||
0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e,
|
||||
0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44,
|
||||
0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01,
|
||||
0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c,
|
||||
0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f,
|
||||
0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
|
||||
0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -119,6 +119,8 @@ message RoutingRule {
|
||||
repeated string protocol = 9;
|
||||
|
||||
string attributes = 15;
|
||||
|
||||
string domain_matcher = 17;
|
||||
}
|
||||
|
||||
message BalancingRule {
|
||||
|
||||
@@ -5,10 +5,12 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/golang/mock/gomock"
|
||||
|
||||
. "github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
routing_session "github.com/xtls/xray-core/features/routing/session"
|
||||
"github.com/xtls/xray-core/testing/mocks"
|
||||
@@ -115,7 +117,11 @@ func TestIPOnDemand(t *testing.T) {
|
||||
defer mockCtl.Finish()
|
||||
|
||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, nil))
|
||||
@@ -150,7 +156,11 @@ func TestIPIfNonMatchDomain(t *testing.T) {
|
||||
defer mockCtl.Finish()
|
||||
|
||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, nil))
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/stats/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type GetStatsRequest struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/stats/config.proto
|
||||
|
||||
package stats
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -24,18 +24,48 @@ type Buffer struct {
|
||||
UDP *net.Destination
|
||||
}
|
||||
|
||||
// New creates a Buffer with 0 length and 2K capacity.
|
||||
// New creates a Buffer with 0 length and 8K capacity.
|
||||
func New() *Buffer {
|
||||
buf := pool.Get().([]byte)
|
||||
if cap(buf) >= Size {
|
||||
buf = buf[:Size]
|
||||
} else {
|
||||
buf = make([]byte, Size)
|
||||
}
|
||||
|
||||
return &Buffer{
|
||||
v: pool.Get().([]byte),
|
||||
v: buf,
|
||||
}
|
||||
}
|
||||
|
||||
func NewExisted(b []byte) *Buffer {
|
||||
if cap(b) < Size {
|
||||
panic("Invalid buffer")
|
||||
}
|
||||
|
||||
oLen := len(b)
|
||||
if oLen < Size {
|
||||
b = b[:Size]
|
||||
}
|
||||
|
||||
return &Buffer{
|
||||
v: b,
|
||||
end: int32(oLen),
|
||||
}
|
||||
}
|
||||
|
||||
// StackNew creates a new Buffer object on stack.
|
||||
// This method is for buffers that is released in the same function.
|
||||
func StackNew() Buffer {
|
||||
buf := pool.Get().([]byte)
|
||||
if cap(buf) >= Size {
|
||||
buf = buf[:Size]
|
||||
} else {
|
||||
buf = make([]byte, Size)
|
||||
}
|
||||
|
||||
return Buffer{
|
||||
v: pool.Get().([]byte),
|
||||
v: buf,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -48,7 +78,10 @@ func (b *Buffer) Release() {
|
||||
p := b.v
|
||||
b.v = nil
|
||||
b.Clear()
|
||||
pool.Put(p)
|
||||
|
||||
if cap(p) == Size {
|
||||
pool.Put(p)
|
||||
}
|
||||
b.UDP = nil
|
||||
}
|
||||
|
||||
@@ -110,6 +143,9 @@ func (b *Buffer) BytesTo(to int32) []byte {
|
||||
if to < 0 {
|
||||
to += b.Len()
|
||||
}
|
||||
if to < 0 {
|
||||
to = 0
|
||||
}
|
||||
return b.v[b.start : b.start+to]
|
||||
}
|
||||
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
. "github.com/xtls/xray-core/common/buf"
|
||||
)
|
||||
|
||||
@@ -6,6 +6,9 @@ import (
|
||||
"os"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/features/stats"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
)
|
||||
|
||||
// Reader extends io.Reader with MultiBuffer.
|
||||
@@ -29,9 +32,17 @@ type Writer interface {
|
||||
}
|
||||
|
||||
// WriteAllBytes ensures all bytes are written into the given writer.
|
||||
func WriteAllBytes(writer io.Writer, payload []byte) error {
|
||||
func WriteAllBytes(writer io.Writer, payload []byte, c stats.Counter) error {
|
||||
wc := 0
|
||||
defer func() {
|
||||
if c != nil {
|
||||
c.Add(int64(wc))
|
||||
}
|
||||
}()
|
||||
|
||||
for len(payload) > 0 {
|
||||
n, err := writer.Write(payload)
|
||||
wc += n
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -65,7 +76,13 @@ func NewReader(reader io.Reader) Reader {
|
||||
if err != nil {
|
||||
newError("failed to get sysconn").Base(err).WriteToLog()
|
||||
} else {
|
||||
return NewReadVReader(reader, rawConn)
|
||||
var counter stats.Counter
|
||||
|
||||
if statConn, ok := reader.(*stat.CounterConnection); ok {
|
||||
reader = statConn.Connection
|
||||
counter = statConn.ReadCounter
|
||||
}
|
||||
return NewReadVReader(reader, rawConn, counter)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -104,13 +121,24 @@ func NewWriter(writer io.Writer) Writer {
|
||||
return mw
|
||||
}
|
||||
|
||||
if isPacketWriter(writer) {
|
||||
var iConn = writer
|
||||
if statConn, ok := writer.(*stat.CounterConnection); ok {
|
||||
iConn = statConn.Connection
|
||||
}
|
||||
|
||||
if isPacketWriter(iConn) {
|
||||
return &SequentialWriter{
|
||||
Writer: writer,
|
||||
}
|
||||
}
|
||||
|
||||
var counter stats.Counter
|
||||
|
||||
if statConn, ok := writer.(*stat.CounterConnection); ok {
|
||||
counter = statConn.WriteCounter
|
||||
}
|
||||
return &BufferToBytesWriter{
|
||||
Writer: writer,
|
||||
Writer: iConn,
|
||||
counter: counter,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -9,6 +9,7 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
. "github.com/xtls/xray-core/common/buf"
|
||||
)
|
||||
|
||||
@@ -1,6 +1,5 @@
|
||||
// +build !windows
|
||||
// +build !wasm
|
||||
// +build !illumos
|
||||
//go:build !windows && !wasm && !illumos
|
||||
// +build !windows,!wasm,!illumos
|
||||
|
||||
package buf
|
||||
|
||||
|
||||
@@ -1,12 +1,14 @@
|
||||
//go:build !wasm
|
||||
// +build !wasm
|
||||
|
||||
package buf
|
||||
|
||||
import (
|
||||
"io"
|
||||
"runtime"
|
||||
"syscall"
|
||||
|
||||
"github.com/xtls/xray-core/features/stats"
|
||||
|
||||
"github.com/xtls/xray-core/common/platform"
|
||||
)
|
||||
|
||||
@@ -54,17 +56,19 @@ type ReadVReader struct {
|
||||
rawConn syscall.RawConn
|
||||
mr multiReader
|
||||
alloc allocStrategy
|
||||
counter stats.Counter
|
||||
}
|
||||
|
||||
// NewReadVReader creates a new ReadVReader.
|
||||
func NewReadVReader(reader io.Reader, rawConn syscall.RawConn) *ReadVReader {
|
||||
func NewReadVReader(reader io.Reader, rawConn syscall.RawConn, counter stats.Counter) *ReadVReader {
|
||||
return &ReadVReader{
|
||||
Reader: reader,
|
||||
rawConn: rawConn,
|
||||
alloc: allocStrategy{
|
||||
current: 1,
|
||||
},
|
||||
mr: newMultiReader(),
|
||||
mr: newMultiReader(),
|
||||
counter: counter,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -123,10 +127,16 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
|
||||
if b.IsFull() {
|
||||
r.alloc.Adjust(1)
|
||||
}
|
||||
if r.counter != nil && b != nil {
|
||||
r.counter.Add(int64(b.Len()))
|
||||
}
|
||||
return MultiBuffer{b}, err
|
||||
}
|
||||
|
||||
mb, err := r.readMulti()
|
||||
if r.counter != nil && mb != nil {
|
||||
r.counter.Add(int64(mb.Len()))
|
||||
}
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -134,17 +144,13 @@ func (r *ReadVReader) ReadMultiBuffer() (MultiBuffer, error) {
|
||||
return mb, nil
|
||||
}
|
||||
|
||||
var useReadv = true
|
||||
var useReadv bool
|
||||
|
||||
func init() {
|
||||
const defaultFlagValue = "NOT_DEFINED_AT_ALL"
|
||||
value := platform.NewEnvFlag("xray.buf.readv").GetValue(func() string { return defaultFlagValue })
|
||||
switch value {
|
||||
case defaultFlagValue, "auto":
|
||||
if (runtime.GOARCH == "386" || runtime.GOARCH == "amd64" || runtime.GOARCH == "s390x") && (runtime.GOOS == "linux" || runtime.GOOS == "darwin" || runtime.GOOS == "windows") {
|
||||
useReadv = true
|
||||
}
|
||||
case "enable":
|
||||
case defaultFlagValue, "auto", "enable":
|
||||
useReadv = true
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build wasm
|
||||
// +build wasm
|
||||
|
||||
package buf
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build !wasm
|
||||
// +build !wasm
|
||||
|
||||
package buf_test
|
||||
@@ -9,10 +10,11 @@ import (
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
|
||||
"golang.org/x/sync/errgroup"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
. "github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/testing/servers/tcp"
|
||||
"golang.org/x/sync/errgroup"
|
||||
)
|
||||
|
||||
func TestReadvReader(t *testing.T) {
|
||||
@@ -50,7 +52,7 @@ func TestReadvReader(t *testing.T) {
|
||||
rawConn, err := conn.(*net.TCPConn).SyscallConn()
|
||||
common.Must(err)
|
||||
|
||||
reader := NewReadVReader(conn, rawConn)
|
||||
reader := NewReadVReader(conn, rawConn, nil)
|
||||
var rmb MultiBuffer
|
||||
for {
|
||||
mb, err := reader.ReadMultiBuffer()
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build illumos
|
||||
// +build illumos
|
||||
|
||||
package buf
|
||||
|
||||
@@ -5,6 +5,8 @@ import (
|
||||
"net"
|
||||
"sync"
|
||||
|
||||
"github.com/xtls/xray-core/features/stats"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
)
|
||||
@@ -13,7 +15,8 @@ import (
|
||||
type BufferToBytesWriter struct {
|
||||
io.Writer
|
||||
|
||||
cache [][]byte
|
||||
counter stats.Counter
|
||||
cache [][]byte
|
||||
}
|
||||
|
||||
// WriteMultiBuffer implements Writer. This method takes ownership of the given buffer.
|
||||
@@ -26,7 +29,7 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
|
||||
}
|
||||
|
||||
if len(mb) == 1 {
|
||||
return WriteAllBytes(w.Writer, mb[0].Bytes())
|
||||
return WriteAllBytes(w.Writer, mb[0].Bytes(), w.counter)
|
||||
}
|
||||
|
||||
if cap(w.cache) < len(mb) {
|
||||
@@ -45,9 +48,15 @@ func (w *BufferToBytesWriter) WriteMultiBuffer(mb MultiBuffer) error {
|
||||
}()
|
||||
|
||||
nb := net.Buffers(bs)
|
||||
|
||||
wc := int64(0)
|
||||
defer func() {
|
||||
if w.counter != nil {
|
||||
w.counter.Add(wc)
|
||||
}
|
||||
}()
|
||||
for size > 0 {
|
||||
n, err := nb.WriteTo(w.Writer)
|
||||
wc += n
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
@@ -173,7 +182,7 @@ func (w *BufferedWriter) flushInternal() error {
|
||||
w.buffer = nil
|
||||
|
||||
if writer, ok := w.writer.(io.Writer); ok {
|
||||
err := WriteAllBytes(writer, b.Bytes())
|
||||
err := WriteAllBytes(writer, b.Bytes(), nil)
|
||||
b.Release()
|
||||
return err
|
||||
}
|
||||
|
||||
85
common/cache/lru.go
vendored
Normal file
85
common/cache/lru.go
vendored
Normal file
@@ -0,0 +1,85 @@
|
||||
package cache
|
||||
|
||||
import (
|
||||
"container/list"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
// Lru simple, fast lru cache implementation
|
||||
type Lru interface {
|
||||
Get(key interface{}) (value interface{}, ok bool)
|
||||
GetKeyFromValue(value interface{}) (key interface{}, ok bool)
|
||||
PeekKeyFromValue(value interface{}) (key interface{}, ok bool) // Peek means check but NOT bring to top
|
||||
Put(key, value interface{})
|
||||
}
|
||||
|
||||
type lru struct {
|
||||
capacity int
|
||||
doubleLinkedlist *list.List
|
||||
keyToElement *sync.Map
|
||||
valueToElement *sync.Map
|
||||
mu *sync.Mutex
|
||||
}
|
||||
|
||||
type lruElement struct {
|
||||
key interface{}
|
||||
value interface{}
|
||||
}
|
||||
|
||||
// NewLru init a lru cache
|
||||
func NewLru(cap int) Lru {
|
||||
return lru{
|
||||
capacity: cap,
|
||||
doubleLinkedlist: list.New(),
|
||||
keyToElement: new(sync.Map),
|
||||
valueToElement: new(sync.Map),
|
||||
mu: new(sync.Mutex),
|
||||
}
|
||||
}
|
||||
|
||||
func (l lru) Get(key interface{}) (value interface{}, ok bool) {
|
||||
if v, ok := l.keyToElement.Load(key); ok {
|
||||
element := v.(*list.Element)
|
||||
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||
return element.Value.(lruElement).value, true
|
||||
}
|
||||
return nil, false
|
||||
}
|
||||
|
||||
func (l lru) GetKeyFromValue(value interface{}) (key interface{}, ok bool) {
|
||||
if k, ok := l.valueToElement.Load(value); ok {
|
||||
element := k.(*list.Element)
|
||||
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||
return element.Value.(lruElement).key, true
|
||||
}
|
||||
return nil, false
|
||||
}
|
||||
|
||||
func (l lru) PeekKeyFromValue(value interface{}) (key interface{}, ok bool) {
|
||||
if k, ok := l.valueToElement.Load(value); ok {
|
||||
element := k.(*list.Element)
|
||||
return element.Value.(lruElement).key, true
|
||||
}
|
||||
return nil, false
|
||||
}
|
||||
|
||||
func (l lru) Put(key, value interface{}) {
|
||||
e := lruElement{key, value}
|
||||
if v, ok := l.keyToElement.Load(key); ok {
|
||||
element := v.(*list.Element)
|
||||
element.Value = e
|
||||
l.doubleLinkedlist.MoveBefore(element, l.doubleLinkedlist.Front())
|
||||
} else {
|
||||
l.mu.Lock()
|
||||
element := l.doubleLinkedlist.PushFront(e)
|
||||
l.keyToElement.Store(key, element)
|
||||
l.valueToElement.Store(value, element)
|
||||
if l.doubleLinkedlist.Len() > l.capacity {
|
||||
toBeRemove := l.doubleLinkedlist.Back()
|
||||
l.doubleLinkedlist.Remove(toBeRemove)
|
||||
l.keyToElement.Delete(toBeRemove.Value.(lruElement).key)
|
||||
l.valueToElement.Delete(toBeRemove.Value.(lruElement).value)
|
||||
}
|
||||
l.mu.Unlock()
|
||||
}
|
||||
}
|
||||
86
common/cache/lru_test.go
vendored
Normal file
86
common/cache/lru_test.go
vendored
Normal file
@@ -0,0 +1,86 @@
|
||||
package cache_test
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
. "github.com/xtls/xray-core/common/cache"
|
||||
)
|
||||
|
||||
func TestLruReplaceValue(t *testing.T) {
|
||||
lru := NewLru(2)
|
||||
lru.Put(2, 6)
|
||||
lru.Put(1, 5)
|
||||
lru.Put(1, 2)
|
||||
v, _ := lru.Get(1)
|
||||
if v != 2 {
|
||||
t.Error("should get 2", v)
|
||||
}
|
||||
v, _ = lru.Get(2)
|
||||
if v != 6 {
|
||||
t.Error("should get 6", v)
|
||||
}
|
||||
}
|
||||
|
||||
func TestLruRemoveOld(t *testing.T) {
|
||||
lru := NewLru(2)
|
||||
v, ok := lru.Get(2)
|
||||
if ok {
|
||||
t.Error("should get nil", v)
|
||||
}
|
||||
lru.Put(1, 1)
|
||||
lru.Put(2, 2)
|
||||
v, _ = lru.Get(1)
|
||||
if v != 1 {
|
||||
t.Error("should get 1", v)
|
||||
}
|
||||
lru.Put(3, 3)
|
||||
v, ok = lru.Get(2)
|
||||
if ok {
|
||||
t.Error("should get nil", v)
|
||||
}
|
||||
lru.Put(4, 4)
|
||||
v, ok = lru.Get(1)
|
||||
if ok {
|
||||
t.Error("should get nil", v)
|
||||
}
|
||||
v, _ = lru.Get(3)
|
||||
if v != 3 {
|
||||
t.Error("should get 3", v)
|
||||
}
|
||||
v, _ = lru.Get(4)
|
||||
if v != 4 {
|
||||
t.Error("should get 4", v)
|
||||
}
|
||||
}
|
||||
|
||||
func TestGetKeyFromValue(t *testing.T) {
|
||||
lru := NewLru(2)
|
||||
lru.Put(3, 3)
|
||||
lru.Put(2, 2)
|
||||
lru.GetKeyFromValue(3)
|
||||
lru.Put(1, 1)
|
||||
v, ok := lru.GetKeyFromValue(2)
|
||||
if ok {
|
||||
t.Error("should get nil", v)
|
||||
}
|
||||
v, _ = lru.GetKeyFromValue(3)
|
||||
if v != 3 {
|
||||
t.Error("should get 3", v)
|
||||
}
|
||||
}
|
||||
|
||||
func TestPeekKeyFromValue(t *testing.T) {
|
||||
lru := NewLru(2)
|
||||
lru.Put(3, 3)
|
||||
lru.Put(2, 2)
|
||||
lru.PeekKeyFromValue(3)
|
||||
lru.Put(1, 1)
|
||||
v, ok := lru.PeekKeyFromValue(3)
|
||||
if ok {
|
||||
t.Error("should get nil", v)
|
||||
}
|
||||
v, _ = lru.PeekKeyFromValue(2)
|
||||
if v != 2 {
|
||||
t.Error("should get 2", v)
|
||||
}
|
||||
}
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build generate
|
||||
// +build generate
|
||||
|
||||
package main
|
||||
|
||||
@@ -50,7 +50,7 @@ func NewCryptionWriter(stream cipher.Stream, writer io.Writer) *CryptionWriter {
|
||||
func (w *CryptionWriter) Write(data []byte) (int, error) {
|
||||
w.stream.XORKeyStream(data, data)
|
||||
|
||||
if err := buf.WriteAllBytes(w.writer, data); err != nil {
|
||||
if err := buf.WriteAllBytes(w.writer, data, nil); err != nil {
|
||||
return 0, err
|
||||
}
|
||||
return len(data), nil
|
||||
|
||||
@@ -2,11 +2,8 @@ package main
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"log"
|
||||
"os"
|
||||
"path/filepath"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
)
|
||||
|
||||
func main() {
|
||||
@@ -20,26 +17,21 @@ func main() {
|
||||
pkg = "core"
|
||||
}
|
||||
|
||||
moduleName, gmnErr := common.GetModuleName(pwd)
|
||||
if gmnErr != nil {
|
||||
fmt.Println("can not get module path", gmnErr)
|
||||
os.Exit(1)
|
||||
}
|
||||
|
||||
file, err := os.OpenFile("errors.generated.go", os.O_WRONLY|os.O_TRUNC|os.O_CREATE, 0644)
|
||||
if err != nil {
|
||||
log.Fatalf("Failed to generate errors.generated.go: %v", err)
|
||||
fmt.Printf("Failed to generate errors.generated.go: %v", err)
|
||||
os.Exit(1)
|
||||
}
|
||||
defer file.Close()
|
||||
|
||||
fmt.Fprintln(file, "package", pkg)
|
||||
fmt.Fprintln(file, "")
|
||||
fmt.Fprintln(file, "import \""+moduleName+"/common/errors\"")
|
||||
fmt.Fprintln(file, "")
|
||||
fmt.Fprintln(file, "type errPathObjHolder struct{}")
|
||||
fmt.Fprintln(file, "")
|
||||
fmt.Fprintln(file, "func newError(values ...interface{}) *errors.Error {")
|
||||
fmt.Fprintln(file, " return errors.New(values...).WithPathObj(errPathObjHolder{})")
|
||||
fmt.Fprintln(file, "}")
|
||||
fmt.Fprintf(file, `package %s
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errPathObjHolder struct{}
|
||||
|
||||
func newError(values ...interface{}) *errors.Error {
|
||||
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||
}
|
||||
`, pkg)
|
||||
}
|
||||
|
||||
@@ -40,10 +40,8 @@ func (err *Error) pkgPath() string {
|
||||
return ""
|
||||
}
|
||||
path := reflect.TypeOf(err.pathObj).PkgPath()
|
||||
for i := 0; i < len(path); i++ {
|
||||
if path[i] == '/' {
|
||||
return path[trim:]
|
||||
}
|
||||
if len(path) >= trim {
|
||||
return path[trim:]
|
||||
}
|
||||
return path
|
||||
}
|
||||
|
||||
59
common/log/dns.go
Normal file
59
common/log/dns.go
Normal file
@@ -0,0 +1,59 @@
|
||||
package log
|
||||
|
||||
import (
|
||||
"net"
|
||||
"strings"
|
||||
"time"
|
||||
)
|
||||
|
||||
type DNSLog struct {
|
||||
Server string
|
||||
Domain string
|
||||
Result []net.IP
|
||||
Status dnsStatus
|
||||
Elapsed time.Duration
|
||||
Error error
|
||||
}
|
||||
|
||||
func (l *DNSLog) String() string {
|
||||
builder := &strings.Builder{}
|
||||
|
||||
// Server got answer: domain -> [ip1, ip2] 23ms
|
||||
builder.WriteString(l.Server)
|
||||
builder.WriteString(" ")
|
||||
builder.WriteString(string(l.Status))
|
||||
builder.WriteString(" ")
|
||||
builder.WriteString(l.Domain)
|
||||
builder.WriteString(" -> [")
|
||||
builder.WriteString(joinNetIP(l.Result))
|
||||
builder.WriteString("]")
|
||||
|
||||
if l.Elapsed > 0 {
|
||||
builder.WriteString(" ")
|
||||
builder.WriteString(l.Elapsed.String())
|
||||
}
|
||||
if l.Error != nil {
|
||||
builder.WriteString(" <")
|
||||
builder.WriteString(l.Error.Error())
|
||||
builder.WriteString(">")
|
||||
}
|
||||
return builder.String()
|
||||
}
|
||||
|
||||
type dnsStatus string
|
||||
|
||||
var (
|
||||
DNSQueried = dnsStatus("got answer:")
|
||||
DNSCacheHit = dnsStatus("cache HIT:")
|
||||
)
|
||||
|
||||
func joinNetIP(ips []net.IP) string {
|
||||
if len(ips) == 0 {
|
||||
return ""
|
||||
}
|
||||
sips := make([]string, 0, len(ips))
|
||||
for _, ip := range ips {
|
||||
sips = append(sips, ip.String())
|
||||
}
|
||||
return strings.Join(sips, ", ")
|
||||
}
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/log/log.proto
|
||||
|
||||
package log
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Severity int32
|
||||
|
||||
const (
|
||||
|
||||
@@ -330,7 +330,7 @@ func (m *ClientWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
|
||||
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
||||
}
|
||||
|
||||
rr := s.NewReader(reader)
|
||||
rr := s.NewReader(reader, &meta.Target)
|
||||
err := buf.Copy(rr, s.output)
|
||||
if err != nil && buf.IsWriteError(err) {
|
||||
newError("failed to write to downstream. closing session ", s.ID).Base(err).WriteToLog()
|
||||
|
||||
@@ -6,6 +6,7 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/golang/mock/gomock"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/mux"
|
||||
|
||||
@@ -81,6 +81,9 @@ func (f FrameMetadata) WriteTo(b *buf.Buffer) error {
|
||||
if err := addrParser.WriteAddressPort(b, f.Target.Address, f.Target.Port); err != nil {
|
||||
return err
|
||||
}
|
||||
} else if b.UDP != nil {
|
||||
b.WriteByte(byte(TargetNetworkUDP))
|
||||
addrParser.WriteAddressPort(b, b.UDP.Address, b.UDP.Port)
|
||||
}
|
||||
|
||||
len1 := b.Len()
|
||||
@@ -119,7 +122,7 @@ func (f *FrameMetadata) UnmarshalFromBuffer(b *buf.Buffer) error {
|
||||
f.Option = bitmask.Byte(b.Byte(3))
|
||||
f.Target.Network = net.Network_Unknown
|
||||
|
||||
if f.SessionStatus == SessionStatusNew {
|
||||
if f.SessionStatus == SessionStatusNew || (f.SessionStatus == SessionStatusKeep && b.Len() != 4) {
|
||||
if b.Len() < 8 {
|
||||
return newError("insufficient buffer: ", b.Len())
|
||||
}
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/crypto"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/serial"
|
||||
)
|
||||
|
||||
@@ -12,13 +13,15 @@ import (
|
||||
type PacketReader struct {
|
||||
reader io.Reader
|
||||
eof bool
|
||||
dest *net.Destination
|
||||
}
|
||||
|
||||
// NewPacketReader creates a new PacketReader.
|
||||
func NewPacketReader(reader io.Reader) *PacketReader {
|
||||
func NewPacketReader(reader io.Reader, dest *net.Destination) *PacketReader {
|
||||
return &PacketReader{
|
||||
reader: reader,
|
||||
eof: false,
|
||||
dest: dest,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -43,6 +46,9 @@ func (r *PacketReader) ReadMultiBuffer() (buf.MultiBuffer, error) {
|
||||
return nil, err
|
||||
}
|
||||
r.eof = true
|
||||
if r.dest != nil && r.dest.Network == net.Network_UDP {
|
||||
b.UDP = r.dest
|
||||
}
|
||||
return buf.MultiBuffer{b}, nil
|
||||
}
|
||||
|
||||
|
||||
@@ -145,7 +145,7 @@ func (w *ServerWorker) handleStatusNew(ctx context.Context, meta *FrameMetadata,
|
||||
return nil
|
||||
}
|
||||
|
||||
rr := s.NewReader(reader)
|
||||
rr := s.NewReader(reader, &meta.Target)
|
||||
if err := buf.Copy(rr, s.output); err != nil {
|
||||
buf.Copy(rr, buf.Discard)
|
||||
common.Interrupt(s.input)
|
||||
@@ -168,7 +168,7 @@ func (w *ServerWorker) handleStatusKeep(meta *FrameMetadata, reader *buf.Buffere
|
||||
return buf.Copy(NewStreamReader(reader), buf.Discard)
|
||||
}
|
||||
|
||||
rr := s.NewReader(reader)
|
||||
rr := s.NewReader(reader, &meta.Target)
|
||||
err := buf.Copy(rr, s.output)
|
||||
|
||||
if err != nil && buf.IsWriteError(err) {
|
||||
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/protocol"
|
||||
)
|
||||
|
||||
@@ -152,9 +153,9 @@ func (s *Session) Close() error {
|
||||
}
|
||||
|
||||
// NewReader creates a buf.Reader based on the transfer type of this Session.
|
||||
func (s *Session) NewReader(reader *buf.BufferedReader) buf.Reader {
|
||||
func (s *Session) NewReader(reader *buf.BufferedReader, dest *net.Destination) buf.Reader {
|
||||
if s.transferType == protocol.TransferTypeStream {
|
||||
return NewStreamReader(reader)
|
||||
}
|
||||
return NewPacketReader(reader)
|
||||
return NewPacketReader(reader, dest)
|
||||
}
|
||||
|
||||
@@ -63,6 +63,9 @@ func (w *Writer) writeMetaOnly() error {
|
||||
|
||||
func writeMetaWithFrame(writer buf.Writer, meta FrameMetadata, data buf.MultiBuffer) error {
|
||||
frame := buf.New()
|
||||
if len(data) == 1 {
|
||||
frame.UDP = data[0].UDP
|
||||
}
|
||||
if err := meta.WriteTo(frame); err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/net/address.proto
|
||||
|
||||
package net
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Address of a network host. It may be either an IP address or a domain
|
||||
// address.
|
||||
type IPOrDomain struct {
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/net/destination.proto
|
||||
|
||||
package net
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Endpoint of a network connection.
|
||||
type Endpoint struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/net/network.proto
|
||||
|
||||
package net
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Network int32
|
||||
|
||||
const (
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/net/port.proto
|
||||
|
||||
package net
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// PortRange represents a range of ports.
|
||||
type PortRange struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build !windows
|
||||
// +build !windows
|
||||
|
||||
package ctlcmd
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build windows
|
||||
// +build windows
|
||||
|
||||
package ctlcmd
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build !windows
|
||||
// +build !windows
|
||||
|
||||
package platform
|
||||
@@ -30,6 +31,7 @@ func GetAssetLocation(file string) string {
|
||||
defPath,
|
||||
filepath.Join("/usr/local/share/xray/", file),
|
||||
filepath.Join("/usr/share/xray/", file),
|
||||
filepath.Join("/opt/share/xray/", file),
|
||||
} {
|
||||
if _, err := os.Stat(p); os.IsNotExist(err) {
|
||||
continue
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
//go:build windows
|
||||
// +build windows
|
||||
|
||||
package platform
|
||||
|
||||
@@ -55,7 +55,7 @@ func TestAddressReading(t *testing.T) {
|
||||
},
|
||||
{
|
||||
Options: []AddressOption{AddressFamilyByte(0x03, net.AddressFamilyDomain)},
|
||||
Input: []byte{3, 9, 118, 50, 114, 97, 121, 46, 99, 111, 109, 0, 80},
|
||||
Input: []byte{3, 11, 101, 120, 97, 109, 112, 108, 101, 46, 99, 111, 109, 0, 80},
|
||||
Address: net.DomainAddress("example.com"),
|
||||
Port: net.Port(80),
|
||||
},
|
||||
@@ -84,8 +84,9 @@ func TestAddressReading(t *testing.T) {
|
||||
}
|
||||
|
||||
for _, tc := range data {
|
||||
b := buf.New()
|
||||
parser := NewAddressParser(tc.Options...)
|
||||
|
||||
b := buf.New()
|
||||
addr, port, err := parser.ReadAddressPort(b, bytes.NewReader(tc.Input))
|
||||
b.Release()
|
||||
if tc.Error {
|
||||
|
||||
@@ -4,10 +4,11 @@ import (
|
||||
"encoding/binary"
|
||||
"sync"
|
||||
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/serial"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
func PackMessage(msg *dnsmessage.Message) (*buf.Buffer, error) {
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/protocol/headers.proto
|
||||
|
||||
package protocol
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type SecurityType int32
|
||||
|
||||
const (
|
||||
@@ -34,6 +29,7 @@ const (
|
||||
SecurityType_AES128_GCM SecurityType = 3
|
||||
SecurityType_CHACHA20_POLY1305 SecurityType = 4
|
||||
SecurityType_NONE SecurityType = 5
|
||||
SecurityType_ZERO SecurityType = 6
|
||||
)
|
||||
|
||||
// Enum value maps for SecurityType.
|
||||
@@ -45,6 +41,7 @@ var (
|
||||
3: "AES128_GCM",
|
||||
4: "CHACHA20_POLY1305",
|
||||
5: "NONE",
|
||||
6: "ZERO",
|
||||
}
|
||||
SecurityType_value = map[string]int32{
|
||||
"UNKNOWN": 0,
|
||||
@@ -53,6 +50,7 @@ var (
|
||||
"AES128_GCM": 3,
|
||||
"CHACHA20_POLY1305": 4,
|
||||
"NONE": 5,
|
||||
"ZERO": 6,
|
||||
}
|
||||
)
|
||||
|
||||
@@ -141,19 +139,20 @@ var file_common_protocol_headers_proto_rawDesc = []byte{
|
||||
0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x22, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x2e, 0x53, 0x65, 0x63,
|
||||
0x75, 0x72, 0x69, 0x74, 0x79, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x2a,
|
||||
0x62, 0x0a, 0x0c, 0x53, 0x65, 0x63, 0x75, 0x72, 0x69, 0x74, 0x79, 0x54, 0x79, 0x70, 0x65, 0x12,
|
||||
0x6c, 0x0a, 0x0c, 0x53, 0x65, 0x63, 0x75, 0x72, 0x69, 0x74, 0x79, 0x54, 0x79, 0x70, 0x65, 0x12,
|
||||
0x0b, 0x0a, 0x07, 0x55, 0x4e, 0x4b, 0x4e, 0x4f, 0x57, 0x4e, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06,
|
||||
0x4c, 0x45, 0x47, 0x41, 0x43, 0x59, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x55, 0x54, 0x4f,
|
||||
0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x41, 0x45, 0x53, 0x31, 0x32, 0x38, 0x5f, 0x47, 0x43, 0x4d,
|
||||
0x10, 0x03, 0x12, 0x15, 0x0a, 0x11, 0x43, 0x48, 0x41, 0x43, 0x48, 0x41, 0x32, 0x30, 0x5f, 0x50,
|
||||
0x4f, 0x4c, 0x59, 0x31, 0x33, 0x30, 0x35, 0x10, 0x04, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x4f, 0x4e,
|
||||
0x45, 0x10, 0x05, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x50,
|
||||
0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74,
|
||||
0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0xaa, 0x02, 0x14, 0x58,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x43, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x50, 0x72, 0x6f, 0x74, 0x6f,
|
||||
0x63, 0x6f, 0x6c, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x45, 0x10, 0x05, 0x12, 0x08, 0x0a, 0x04, 0x5a, 0x45, 0x52, 0x4f, 0x10, 0x06, 0x42, 0x5e, 0x0a,
|
||||
0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e,
|
||||
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74,
|
||||
0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x70, 0x72,
|
||||
0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x43, 0x6f,
|
||||
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x62, 0x06, 0x70,
|
||||
0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -13,6 +13,7 @@ enum SecurityType {
|
||||
AES128_GCM = 3;
|
||||
CHACHA20_POLY1305 = 4;
|
||||
NONE = 5;
|
||||
ZERO = 6;
|
||||
}
|
||||
|
||||
message SecurityConfig {
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/protocol/server_spec.proto
|
||||
|
||||
package protocol
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type ServerEndpoint struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -102,7 +102,7 @@ func ReadClientHello(data []byte, h *SniffHeader) error {
|
||||
return errNotClientHello
|
||||
}
|
||||
if nameType == 0 {
|
||||
serverName := strings.ToLower(string(d[:nameLen]))
|
||||
serverName := string(d[:nameLen])
|
||||
// An SNI value may not include a
|
||||
// trailing dot. See
|
||||
// https://tools.ietf.org/html/rfc6066#section-3.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/protocol/user.proto
|
||||
|
||||
package protocol
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// User is a generic user for all procotols.
|
||||
type User struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: common/serial/typed_message.proto
|
||||
|
||||
package serial
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// TypedMessage is a serialized proto message along with its type name.
|
||||
type TypedMessage struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user