mirror of
https://github.com/XTLS/Xray-core.git
synced 2026-01-13 22:27:05 +08:00
Compare commits
272 Commits
issue-temp
...
v1.5.10
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
35d5a7fe93 | ||
|
|
71a9a6dd55 | ||
|
|
2096821c07 | ||
|
|
4140bcd11a | ||
|
|
59602db02d | ||
|
|
76638d793c | ||
|
|
b67314796f | ||
|
|
340234166b | ||
|
|
50b5ea5a54 | ||
|
|
5e323958b6 | ||
|
|
2b46178ff9 | ||
|
|
c835622b37 | ||
|
|
05483cc729 | ||
|
|
b4e11e1856 | ||
|
|
f956b142d8 | ||
|
|
7d52ded2a3 | ||
|
|
e459daaaf6 | ||
|
|
00230a74d5 | ||
|
|
9480bc0379 | ||
|
|
0eed604ba3 | ||
|
|
52930a16b2 | ||
|
|
0f2a6f2088 | ||
|
|
9f365b7b45 | ||
|
|
a809596829 | ||
|
|
7d946562eb | ||
|
|
d4f18b1342 | ||
|
|
ba4ce4c24f | ||
|
|
a1c3aed9d3 | ||
|
|
ec8904066a | ||
|
|
def30a0882 | ||
|
|
bd0cf955c7 | ||
|
|
e91f033c01 | ||
|
|
f1b70b4155 | ||
|
|
cc67e83a8f | ||
|
|
ea9246ec7f | ||
|
|
0c9bd21b59 | ||
|
|
34aab75484 | ||
|
|
c3505632fd | ||
|
|
6f93ef7736 | ||
|
|
c4a307e84d | ||
|
|
f1d753f069 | ||
|
|
91ce752405 | ||
|
|
f0b58d9ee0 | ||
|
|
d56f38d38e | ||
|
|
7b72e19e16 | ||
|
|
4e5752f93e | ||
|
|
36906d018d | ||
|
|
79f3057687 | ||
|
|
c375b144f8 | ||
|
|
1edce576ca | ||
|
|
cf7e675c45 | ||
|
|
b6391cbbe1 | ||
|
|
398375d76f | ||
|
|
3b77e26fa7 | ||
|
|
22706041d1 | ||
|
|
087f0d1240 | ||
|
|
3f64f3206c | ||
|
|
f046feb9ca | ||
|
|
778992eeb9 | ||
|
|
5f3949a838 | ||
|
|
95af983154 | ||
|
|
63895caf60 | ||
|
|
dcba88e511 | ||
|
|
244db57398 | ||
|
|
3bfd6853f4 | ||
|
|
00c4b6f44f | ||
|
|
2f86c7c795 | ||
|
|
5e18ae68b7 | ||
|
|
8caf690680 | ||
|
|
b413066012 | ||
|
|
c9df755426 | ||
|
|
11518fe089 | ||
|
|
4fb4dacae7 | ||
|
|
99f45a2d7f | ||
|
|
24a0ae0ea9 | ||
|
|
e8400e65f0 | ||
|
|
393d211d1e | ||
|
|
c6550aecfc | ||
|
|
430235a1cf | ||
|
|
755268b7d4 | ||
|
|
70306c4ec8 | ||
|
|
35eb165f63 | ||
|
|
91ffb7617d | ||
|
|
09ca5c7341 | ||
|
|
97b7460786 | ||
|
|
fd508e92ca | ||
|
|
441e770b96 | ||
|
|
3d3801fc25 | ||
|
|
7f00df4f02 | ||
|
|
94c249a8c8 | ||
|
|
c1a54ae58e | ||
|
|
03ade23022 | ||
|
|
8bff676fb0 | ||
|
|
d78d1f119c | ||
|
|
cd93e10d58 | ||
|
|
7dcf08c5ef | ||
|
|
22e46b846c | ||
|
|
496b2c02c5 | ||
|
|
cf1ee095a2 | ||
|
|
b3ab94ef5b | ||
|
|
b6f77e4944 | ||
|
|
d4f38ac339 | ||
|
|
ebf2873146 | ||
|
|
41ce6ccf9f | ||
|
|
42284a757c | ||
|
|
d51db9469e | ||
|
|
aa554871ef | ||
|
|
578d903a9e | ||
|
|
30a40aa6f1 | ||
|
|
dfcfecf7d8 | ||
|
|
68d37adf88 | ||
|
|
e96e5994d0 | ||
|
|
b4cdb6075b | ||
|
|
dde033ca1f | ||
|
|
9ad26fa049 | ||
|
|
800b3bd3fe | ||
|
|
1447615f3a | ||
|
|
980b35b3fe | ||
|
|
9ea1bf7c1d | ||
|
|
63da3a5481 | ||
|
|
3057a7c999 | ||
|
|
c8e2a99e68 | ||
|
|
756bac7fa4 | ||
|
|
b0a08d3ed3 | ||
|
|
0d292e0dcd | ||
|
|
dd9da23a59 | ||
|
|
4e88a369c4 | ||
|
|
e93da4bd02 | ||
|
|
d5a7901601 | ||
|
|
6fb5c887b2 | ||
|
|
4fc284a8e9 | ||
|
|
7c240e8630 | ||
|
|
d6ae4e9ba2 | ||
|
|
c3298c38a0 | ||
|
|
eb6ced79e7 | ||
|
|
63d0cb1bd6 | ||
|
|
dd6769954c | ||
|
|
28b17b529d | ||
|
|
abb8ba8b0e | ||
|
|
7038bded7b | ||
|
|
ff35118af5 | ||
|
|
707efd6d12 | ||
|
|
5c366db847 | ||
|
|
77d0419aca | ||
|
|
238bd5d050 | ||
|
|
3fe61ed4a2 | ||
|
|
13bc0432bc | ||
|
|
9b204ed99b | ||
|
|
acb81ebe3d | ||
|
|
6a60332700 | ||
|
|
45dc97e2b6 | ||
|
|
0f0a424e8c | ||
|
|
c4fc277758 | ||
|
|
3bf3d96472 | ||
|
|
3c7189a3e7 | ||
|
|
27224868ab | ||
|
|
50e576081e | ||
|
|
625cf7361a | ||
|
|
a3023e43ef | ||
|
|
6c9e57d624 | ||
|
|
76a3f24169 | ||
|
|
a58e20c811 | ||
|
|
2ab80d68ef | ||
|
|
a208b07a73 | ||
|
|
6b6974c804 | ||
|
|
e286cdcaa8 | ||
|
|
d77be80b40 | ||
|
|
500c6de359 | ||
|
|
a229a7f85e | ||
|
|
cd4631ce99 | ||
|
|
5e606169f1 | ||
|
|
3f3b54f673 | ||
|
|
575c7a9687 | ||
|
|
bad397bf22 | ||
|
|
e6711d1b48 | ||
|
|
4bb61701b5 | ||
|
|
ef4c63812b | ||
|
|
e50f2af418 | ||
|
|
3554886ce1 | ||
|
|
a97d45c93a | ||
|
|
ffa01e8dda | ||
|
|
4abf98c1be | ||
|
|
1ef824c0b4 | ||
|
|
ed39fc3b79 | ||
|
|
3b31189f13 | ||
|
|
490e360c20 | ||
|
|
32ae6d3952 | ||
|
|
9f9059c7b1 | ||
|
|
a149c78a4c | ||
|
|
b0886027f5 | ||
|
|
7033f7cf5f | ||
|
|
ffc2f7c4e2 | ||
|
|
ab927d2cca | ||
|
|
0c0d878456 | ||
|
|
24b637cd5e | ||
|
|
f2cb13a8ec | ||
|
|
dbcbb519e3 | ||
|
|
8a5bf06925 | ||
|
|
b0b2aaa70c | ||
|
|
d111a046c0 | ||
|
|
eaf30aa14a | ||
|
|
42d158bd85 | ||
|
|
00bcd40c34 | ||
|
|
1adfc2720a | ||
|
|
0f79126379 | ||
|
|
7246001029 | ||
|
|
5e6eff5ffa | ||
|
|
1dca3cb3dd | ||
|
|
28d17ac17f | ||
|
|
e6019a89c9 | ||
|
|
3213e5dd81 | ||
|
|
c950edede2 | ||
|
|
64892fb2c3 | ||
|
|
0403e6ddc3 | ||
|
|
d9d239750b | ||
|
|
73e10f0f6f | ||
|
|
7a9e72b133 | ||
|
|
66b58e6076 | ||
|
|
17cdeac57f | ||
|
|
e4bf620795 | ||
|
|
31c7141fef | ||
|
|
57b9006d26 | ||
|
|
d9d04a230f | ||
|
|
3dc9fba20d | ||
|
|
d45298a10d | ||
|
|
6e8581f5dc | ||
|
|
86a8fb5d84 | ||
|
|
3531b95d82 | ||
|
|
b977899926 | ||
|
|
2220411644 | ||
|
|
3b8618b379 | ||
|
|
e8a8465220 | ||
|
|
1f92b948c0 | ||
|
|
53b99efe78 | ||
|
|
1e3d739a5b | ||
|
|
7b7084f825 | ||
|
|
bf94fb53ca | ||
|
|
1d13a8da49 | ||
|
|
f65c21337c | ||
|
|
4bf8b6d89c | ||
|
|
95a68a6d73 | ||
|
|
7f2fad73d4 | ||
|
|
3ed14c2fcd | ||
|
|
b63049f404 | ||
|
|
a9e11075d1 | ||
|
|
e564d9ef7e | ||
|
|
6c936e2fd3 | ||
|
|
b2d8168284 | ||
|
|
e0910ab4d9 | ||
|
|
d46af8b5d4 | ||
|
|
0470381fe2 | ||
|
|
b0e7ad9663 | ||
|
|
4e63c22197 | ||
|
|
36961ed882 | ||
|
|
de54d4b08f | ||
|
|
32713bcc0e | ||
|
|
9dec65e367 | ||
|
|
3fe85449a9 | ||
|
|
e0526c27b3 | ||
|
|
a0a32ee00d | ||
|
|
60b06877bf | ||
|
|
9adce5a6c4 | ||
|
|
100edc370b | ||
|
|
819717d278 | ||
|
|
fcc9d97074 | ||
|
|
439c91d509 | ||
|
|
924fe16077 | ||
|
|
3de5af0611 | ||
|
|
d7cd71b741 | ||
|
|
f50eff5ebb | ||
|
|
db32ce6fd9 | ||
|
|
ad1807dd99 |
3
.github/build/friendly-filenames.json
vendored
3
.github/build/friendly-filenames.json
vendored
@@ -29,5 +29,6 @@
|
||||
"openbsd-arm7": { "friendlyName": "openbsd-arm32-v7a" },
|
||||
"windows-386": { "friendlyName": "windows-32" },
|
||||
"windows-amd64": { "friendlyName": "windows-64" },
|
||||
"windows-arm64": { "friendlyName": "windows-arm64-v8a" },
|
||||
"windows-arm7": { "friendlyName": "windows-arm32-v7a" }
|
||||
}
|
||||
}
|
||||
15
.github/dependabot.yml
vendored
Normal file
15
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,15 @@
|
||||
# To get started with Dependabot version updates, you'll need to specify which
|
||||
# package ecosystems to update and where the package manifests are located.
|
||||
# Please see the documentation for all configuration options:
|
||||
# https://help.github.com/github/administering-a-repository/configuration-options-for-dependency-updates
|
||||
|
||||
version: 2
|
||||
updates:
|
||||
- package-ecosystem: "gomod"
|
||||
directory: "/" # Location of package manifests
|
||||
schedule:
|
||||
interval: "daily"
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "daily"
|
||||
20
.github/workflows/release.yml
vendored
20
.github/workflows/release.yml
vendored
@@ -21,6 +21,8 @@ on:
|
||||
- ".github/workflows/*.yml"
|
||||
jobs:
|
||||
build:
|
||||
permissions:
|
||||
contents: write
|
||||
strategy:
|
||||
matrix:
|
||||
# Include amd64 on all platforms.
|
||||
@@ -52,7 +54,9 @@ jobs:
|
||||
- goos: android
|
||||
goarch: arm64
|
||||
# END Android ARM 8
|
||||
# Windows ARM 7
|
||||
# Windows ARM
|
||||
- goos: windows
|
||||
goarch: arm64
|
||||
- goos: windows
|
||||
goarch: arm
|
||||
goarm: 7
|
||||
@@ -108,7 +112,7 @@ jobs:
|
||||
CGO_ENABLED: 0
|
||||
steps:
|
||||
- name: Checkout codebase
|
||||
uses: actions/checkout@v2
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Show workflow information
|
||||
id: get_filename
|
||||
@@ -119,9 +123,10 @@ jobs:
|
||||
echo "ASSET_NAME=$_NAME" >> $GITHUB_ENV
|
||||
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v2
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: ^1.16
|
||||
go-version: 1.18
|
||||
check-latest: true
|
||||
|
||||
- name: Get project dependencies
|
||||
run: go mod download
|
||||
@@ -140,6 +145,11 @@ jobs:
|
||||
run: |
|
||||
mkdir -p build_assets
|
||||
go build -v -o build_assets/xray -trimpath -ldflags "-s -w -buildid=" ./main
|
||||
|
||||
- name: Build background Xray on Windows
|
||||
if: matrix.goos == 'windows'
|
||||
run: |
|
||||
go build -v -o build_assets/wxray.exe -trimpath -ldflags "-s -w -H windowsgui -buildid=" ./main
|
||||
|
||||
- name: Build Mips softfloat Xray
|
||||
if: matrix.goarch == 'mips' || matrix.goarch == 'mipsle'
|
||||
@@ -188,7 +198,7 @@ jobs:
|
||||
mv build_assets Xray-$ASSET_NAME
|
||||
|
||||
- name: Upload files to Artifacts
|
||||
uses: actions/upload-artifact@v2
|
||||
uses: actions/upload-artifact@v3
|
||||
with:
|
||||
name: Xray-${{ steps.get_filename.outputs.ASSET_NAME }}
|
||||
path: |
|
||||
|
||||
9
.github/workflows/test.yml
vendored
9
.github/workflows/test.yml
vendored
@@ -19,6 +19,8 @@ on:
|
||||
|
||||
jobs:
|
||||
test:
|
||||
permissions:
|
||||
contents: read
|
||||
runs-on: ${{ matrix.os }}
|
||||
strategy:
|
||||
fail-fast: false
|
||||
@@ -26,11 +28,12 @@ jobs:
|
||||
os: [windows-latest, ubuntu-latest, macos-latest]
|
||||
steps:
|
||||
- name: Set up Go
|
||||
uses: actions/setup-go@v2
|
||||
uses: actions/setup-go@v3
|
||||
with:
|
||||
go-version: ^1.16
|
||||
go-version: 1.18
|
||||
check-latest: true
|
||||
- name: Checkout codebase
|
||||
uses: actions/checkout@v2
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Prepare geo*dat
|
||||
if: ${{ matrix.os != 'windows-latest' }}
|
||||
|
||||
28
.gitignore
vendored
Normal file
28
.gitignore
vendored
Normal file
@@ -0,0 +1,28 @@
|
||||
# Binaries for programs and plugins
|
||||
*.exe
|
||||
*.exe~
|
||||
*.dll
|
||||
*.so
|
||||
*.dylib
|
||||
|
||||
# Test binary, built with `go test -c`
|
||||
*.test
|
||||
|
||||
# Output of the go coverage tool, specifically when used with LiteIDE
|
||||
*.out
|
||||
|
||||
# Dependency directories (remove the comment below to include it)
|
||||
# vendor/
|
||||
|
||||
*.DS_Store
|
||||
.idea
|
||||
*.zip
|
||||
*.tar.gz
|
||||
xray
|
||||
mockgen
|
||||
vprotogen
|
||||
!infra/vprotogen/
|
||||
errorgen
|
||||
!common/errors/errorgen/
|
||||
*.dat
|
||||
.vscode
|
||||
128
CODE_OF_CONDUCT.md
Normal file
128
CODE_OF_CONDUCT.md
Normal file
@@ -0,0 +1,128 @@
|
||||
# Contributor Covenant Code of Conduct
|
||||
|
||||
## Our Pledge
|
||||
|
||||
We as members, contributors, and leaders pledge to make participation in our
|
||||
community a harassment-free experience for everyone, regardless of age, body
|
||||
size, visible or invisible disability, ethnicity, sex characteristics, gender
|
||||
identity and expression, level of experience, education, socio-economic status,
|
||||
nationality, personal appearance, race, religion, or sexual identity
|
||||
and orientation.
|
||||
|
||||
We pledge to act and interact in ways that contribute to an open, welcoming,
|
||||
diverse, inclusive, and healthy community.
|
||||
|
||||
## Our Standards
|
||||
|
||||
Examples of behavior that contributes to a positive environment for our
|
||||
community include:
|
||||
|
||||
* Demonstrating empathy and kindness toward other people
|
||||
* Being respectful of differing opinions, viewpoints, and experiences
|
||||
* Giving and gracefully accepting constructive feedback
|
||||
* Accepting responsibility and apologizing to those affected by our mistakes,
|
||||
and learning from the experience
|
||||
* Focusing on what is best not just for us as individuals, but for the
|
||||
overall community
|
||||
|
||||
Examples of unacceptable behavior include:
|
||||
|
||||
* The use of sexualized language or imagery, and sexual attention or
|
||||
advances of any kind
|
||||
* Trolling, insulting or derogatory comments, and personal or political attacks
|
||||
* Public or private harassment
|
||||
* Publishing others' private information, such as a physical or email
|
||||
address, without their explicit permission
|
||||
* Other conduct which could reasonably be considered inappropriate in a
|
||||
professional setting
|
||||
|
||||
## Enforcement Responsibilities
|
||||
|
||||
Community leaders are responsible for clarifying and enforcing our standards of
|
||||
acceptable behavior and will take appropriate and fair corrective action in
|
||||
response to any behavior that they deem inappropriate, threatening, offensive,
|
||||
or harmful.
|
||||
|
||||
Community leaders have the right and responsibility to remove, edit, or reject
|
||||
comments, commits, code, wiki edits, issues, and other contributions that are
|
||||
not aligned to this Code of Conduct, and will communicate reasons for moderation
|
||||
decisions when appropriate.
|
||||
|
||||
## Scope
|
||||
|
||||
This Code of Conduct applies within all community spaces, and also applies when
|
||||
an individual is officially representing the community in public spaces.
|
||||
Examples of representing our community include using an official e-mail address,
|
||||
posting via an official social media account, or acting as an appointed
|
||||
representative at an online or offline event.
|
||||
|
||||
## Enforcement
|
||||
|
||||
Instances of abusive, harassing, or otherwise unacceptable behavior may be
|
||||
reported to the community leaders responsible for enforcement at
|
||||
https://t.me/projectXtls.
|
||||
All complaints will be reviewed and investigated promptly and fairly.
|
||||
|
||||
All community leaders are obligated to respect the privacy and security of the
|
||||
reporter of any incident.
|
||||
|
||||
## Enforcement Guidelines
|
||||
|
||||
Community leaders will follow these Community Impact Guidelines in determining
|
||||
the consequences for any action they deem in violation of this Code of Conduct:
|
||||
|
||||
### 1. Correction
|
||||
|
||||
**Community Impact**: Use of inappropriate language or other behavior deemed
|
||||
unprofessional or unwelcome in the community.
|
||||
|
||||
**Consequence**: A private, written warning from community leaders, providing
|
||||
clarity around the nature of the violation and an explanation of why the
|
||||
behavior was inappropriate. A public apology may be requested.
|
||||
|
||||
### 2. Warning
|
||||
|
||||
**Community Impact**: A violation through a single incident or series
|
||||
of actions.
|
||||
|
||||
**Consequence**: A warning with consequences for continued behavior. No
|
||||
interaction with the people involved, including unsolicited interaction with
|
||||
those enforcing the Code of Conduct, for a specified period of time. This
|
||||
includes avoiding interactions in community spaces as well as external channels
|
||||
like social media. Violating these terms may lead to a temporary or
|
||||
permanent ban.
|
||||
|
||||
### 3. Temporary Ban
|
||||
|
||||
**Community Impact**: A serious violation of community standards, including
|
||||
sustained inappropriate behavior.
|
||||
|
||||
**Consequence**: A temporary ban from any sort of interaction or public
|
||||
communication with the community for a specified period of time. No public or
|
||||
private interaction with the people involved, including unsolicited interaction
|
||||
with those enforcing the Code of Conduct, is allowed during this period.
|
||||
Violating these terms may lead to a permanent ban.
|
||||
|
||||
### 4. Permanent Ban
|
||||
|
||||
**Community Impact**: Demonstrating a pattern of violation of community
|
||||
standards, including sustained inappropriate behavior, harassment of an
|
||||
individual, or aggression toward or disparagement of classes of individuals.
|
||||
|
||||
**Consequence**: A permanent ban from any sort of public interaction within
|
||||
the community.
|
||||
|
||||
## Attribution
|
||||
|
||||
This Code of Conduct is adapted from the [Contributor Covenant][homepage],
|
||||
version 2.0, available at
|
||||
https://www.contributor-covenant.org/version/2/0/code_of_conduct.html.
|
||||
|
||||
Community Impact Guidelines were inspired by [Mozilla's code of conduct
|
||||
enforcement ladder](https://github.com/mozilla/diversity).
|
||||
|
||||
[homepage]: https://www.contributor-covenant.org
|
||||
|
||||
For answers to common questions about this code of conduct, see the FAQ at
|
||||
https://www.contributor-covenant.org/faq. Translations are available at
|
||||
https://www.contributor-covenant.org/translations.
|
||||
29
README.md
29
README.md
@@ -1,6 +1,6 @@
|
||||
# Project X
|
||||
|
||||
[Project X](https://github.com/XTLS) originates from XTLS protocol, provides a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core) and [Xray-flutter](https://github.com/XTLS/Xray-flutter).
|
||||
[Project X](https://github.com/XTLS) originates from XTLS protocol, provides a set of network tools such as [Xray-core](https://github.com/XTLS/Xray-core).
|
||||
|
||||
## License
|
||||
|
||||
@@ -13,7 +13,6 @@
|
||||
- [Xray-script](https://github.com/kirin10000/Xray-script)
|
||||
- Docker
|
||||
- [teddysun/xray](https://hub.docker.com/r/teddysun/xray)
|
||||
- Xray-docker
|
||||
- One Click
|
||||
- [ProxySU](https://github.com/proxysu/ProxySU)
|
||||
- [v2ray-agent](https://github.com/mack-a/v2ray-agent)
|
||||
@@ -23,8 +22,12 @@
|
||||
- [Xray4Magisk](https://github.com/CerteKim/Xray4Magisk)
|
||||
- [Xray_For_Magisk](https://github.com/E7KMbb/Xray_For_Magisk)
|
||||
- Homebrew
|
||||
- [Repository 0](https://github.com/N4FA/homebrew-xray)
|
||||
- [Repository 1](https://github.com/xiruizhao/homebrew-xray)
|
||||
- `brew install xray`
|
||||
- [(Tap) Repository 0](https://github.com/N4FA/homebrew-xray)
|
||||
- [(Tap) Repository 1](https://github.com/xiruizhao/homebrew-xray)
|
||||
|
||||
## Contributing
|
||||
[Code Of Conduct](https://github.com/XTLS/Xray-core/blob/main/CODE_OF_CONDUCT.md)
|
||||
|
||||
## Usage
|
||||
|
||||
@@ -39,13 +42,17 @@
|
||||
- [luci-app-xray](https://github.com/yichya/luci-app-xray) ([openwrt-xray](https://github.com/yichya/openwrt-xray))
|
||||
- Windows
|
||||
- [v2rayN](https://github.com/2dust/v2rayN)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray)
|
||||
- [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||
- [Netch (NetFilter & TUN/TAP)](https://github.com/NetchX/Netch) (This project had been archived and currently inactive)
|
||||
- Android
|
||||
- [v2rayNG](https://github.com/2dust/v2rayNG)
|
||||
- [Kitsunebi](https://github.com/rurirei/Kitsunebi/tree/release_xtls)
|
||||
- iOS / Mac
|
||||
- iOS & macOS (with M1 chip)
|
||||
- [Shadowrocket](https://apps.apple.com/app/shadowrocket/id932747118)
|
||||
- [Stash](https://apps.apple.com/app/stash/id1596063349)
|
||||
- macOS (Intel chip & M1 chip)
|
||||
- [Qv2ray](https://github.com/Qv2ray/Qv2ray) (This project had been archived and currently inactive)
|
||||
- [V2RayXS](https://github.com/tzmax/V2RayXS)
|
||||
|
||||
## Credits
|
||||
|
||||
@@ -54,26 +61,30 @@ This repo relies on the following third-party projects:
|
||||
- Special thanks:
|
||||
- [v2fly/v2ray-core](https://github.com/v2fly/v2ray-core)
|
||||
- In production:
|
||||
- [ghodss/yaml](https://github.com/ghodss/yaml)
|
||||
- [gorilla/websocket](https://github.com/gorilla/websocket)
|
||||
- [lucas-clemente/quic-go](https://github.com/lucas-clemente/quic-go)
|
||||
- [pelletier/go-toml](https://github.com/pelletier/go-toml)
|
||||
- [pires/go-proxyproto](https://github.com/pires/go-proxyproto)
|
||||
- [refraction-networking/utls](https://github.com/refraction-networking/utls)
|
||||
- [seiflotfy/cuckoofilter](https://github.com/seiflotfy/cuckoofilter)
|
||||
- [google/starlark-go](https://github.com/google/starlark-go)
|
||||
- For testing only:
|
||||
- [miekg/dns](https://github.com/miekg/dns)
|
||||
- [stretchr/testify](https://github.com/stretchr/testify)
|
||||
- [h12w/socks](https://github.com/h12w/socks)
|
||||
|
||||
## Compilation
|
||||
|
||||
### Windows
|
||||
|
||||
```
|
||||
```bash
|
||||
go build -o xray.exe -trimpath -ldflags "-s -w -buildid=" ./main
|
||||
```
|
||||
|
||||
### Linux / macOS
|
||||
|
||||
```
|
||||
```bash
|
||||
go build -o xray -trimpath -ldflags "-s -w -buildid=" ./main
|
||||
```
|
||||
|
||||
|
||||
@@ -7,12 +7,11 @@ import (
|
||||
"net"
|
||||
"sync"
|
||||
|
||||
"google.golang.org/grpc"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/signal/done"
|
||||
core "github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"google.golang.org/grpc"
|
||||
)
|
||||
|
||||
// Commander is a Xray feature that provides gRPC methods to external clients.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/commander/config.proto
|
||||
|
||||
package commander
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Config is the settings for Commander.
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
|
||||
@@ -37,7 +37,7 @@ func (l *OutboundListener) Accept() (net.Conn, error) {
|
||||
}
|
||||
}
|
||||
|
||||
// Close implement net.Listener.
|
||||
// Close implements net.Listener.
|
||||
func (l *OutboundListener) Close() error {
|
||||
common.Must(l.done.Close())
|
||||
L:
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dispatcher/config.proto
|
||||
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type SessionConfig struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -4,6 +4,7 @@ package dispatcher
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"strings"
|
||||
"sync"
|
||||
"time"
|
||||
@@ -15,6 +16,7 @@ import (
|
||||
"github.com/xtls/xray-core/common/protocol"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/features/policy"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
@@ -24,9 +26,7 @@ import (
|
||||
"github.com/xtls/xray-core/transport/pipe"
|
||||
)
|
||||
|
||||
var (
|
||||
errSniffingTimeout = newError("timeout on sniffing")
|
||||
)
|
||||
var errSniffingTimeout = newError("timeout on sniffing")
|
||||
|
||||
type cachedReader struct {
|
||||
sync.Mutex
|
||||
@@ -93,13 +93,18 @@ type DefaultDispatcher struct {
|
||||
router routing.Router
|
||||
policy policy.Manager
|
||||
stats stats.Manager
|
||||
dns dns.Client
|
||||
fdns dns.FakeDNSEngine
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
d := new(DefaultDispatcher)
|
||||
if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
|
||||
return d.Init(config.(*Config), om, router, pm, sm)
|
||||
if err := core.RequireFeatures(ctx, func(om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dc dns.Client) error {
|
||||
core.RequireFeatures(ctx, func(fdns dns.FakeDNSEngine) {
|
||||
d.fdns = fdns
|
||||
})
|
||||
return d.Init(config.(*Config), om, router, pm, sm, dc)
|
||||
}); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -108,11 +113,12 @@ func init() {
|
||||
}
|
||||
|
||||
// Init initializes DefaultDispatcher.
|
||||
func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager) error {
|
||||
func (d *DefaultDispatcher) Init(config *Config, om outbound.Manager, router routing.Router, pm policy.Manager, sm stats.Manager, dns dns.Client) error {
|
||||
d.ohm = om
|
||||
d.router = router
|
||||
d.policy = pm
|
||||
d.stats = sm
|
||||
d.dns = dns
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -129,10 +135,77 @@ func (*DefaultDispatcher) Start() error {
|
||||
// Close implements common.Closable.
|
||||
func (*DefaultDispatcher) Close() error { return nil }
|
||||
|
||||
func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *transport.Link) {
|
||||
opt := pipe.OptionsFromContext(ctx)
|
||||
uplinkReader, uplinkWriter := pipe.New(opt...)
|
||||
downlinkReader, downlinkWriter := pipe.New(opt...)
|
||||
func (d *DefaultDispatcher) getLink(ctx context.Context, network net.Network, sniffing session.SniffingRequest) (*transport.Link, *transport.Link) {
|
||||
downOpt := pipe.OptionsFromContext(ctx)
|
||||
upOpt := downOpt
|
||||
|
||||
if network == net.Network_UDP {
|
||||
var ip2domain *sync.Map // net.IP.String() => domain, this map is used by server side when client turn on fakedns
|
||||
// Client will send domain address in the buffer.UDP.Address, server record all possible target IP addrs.
|
||||
// When target replies, server will restore the domain and send back to client.
|
||||
// Note: this map is not global but per connection context
|
||||
upOpt = append(upOpt, pipe.OnTransmission(func(mb buf.MultiBuffer) buf.MultiBuffer {
|
||||
for i, buffer := range mb {
|
||||
if buffer.UDP == nil {
|
||||
continue
|
||||
}
|
||||
addr := buffer.UDP.Address
|
||||
if addr.Family().IsIP() {
|
||||
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && fkr0.IsIPInIPPool(addr) && sniffing.Enabled {
|
||||
domain := fkr0.GetDomainFromFakeDNS(addr)
|
||||
if len(domain) > 0 {
|
||||
buffer.UDP.Address = net.DomainAddress(domain)
|
||||
newError("[fakedns client] override with domain: ", domain, " for xUDP buffer at ", i).WriteToLog(session.ExportIDToError(ctx))
|
||||
} else {
|
||||
newError("[fakedns client] failed to find domain! :", addr.String(), " for xUDP buffer at ", i).AtWarning().WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if ip2domain == nil {
|
||||
ip2domain = new(sync.Map)
|
||||
newError("[fakedns client] create a new map").WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
domain := addr.Domain()
|
||||
ips, err := d.dns.LookupIP(domain, dns.IPOption{true, true, false})
|
||||
if err == nil {
|
||||
for _, ip := range ips {
|
||||
ip2domain.Store(ip.String(), domain)
|
||||
}
|
||||
newError("[fakedns client] candidate ip: "+fmt.Sprintf("%v", ips), " for xUDP buffer at ", i).WriteToLog(session.ExportIDToError(ctx))
|
||||
} else {
|
||||
newError("[fakedns client] failed to look up IP for ", domain, " for xUDP buffer at ", i).Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
}
|
||||
}
|
||||
return mb
|
||||
}))
|
||||
downOpt = append(downOpt, pipe.OnTransmission(func(mb buf.MultiBuffer) buf.MultiBuffer {
|
||||
for i, buffer := range mb {
|
||||
if buffer.UDP == nil {
|
||||
continue
|
||||
}
|
||||
addr := buffer.UDP.Address
|
||||
if addr.Family().IsIP() {
|
||||
if ip2domain == nil {
|
||||
continue
|
||||
}
|
||||
if domain, found := ip2domain.Load(addr.IP().String()); found {
|
||||
buffer.UDP.Address = net.DomainAddress(domain.(string))
|
||||
newError("[fakedns client] restore domain: ", domain.(string), " for xUDP buffer at ", i).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
} else {
|
||||
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok {
|
||||
fakeIp := fkr0.GetFakeIPForDomain(addr.Domain())
|
||||
buffer.UDP.Address = fakeIp[0]
|
||||
newError("[fakedns client] restore FakeIP: ", buffer.UDP, fmt.Sprintf("%v", fakeIp), " for xUDP buffer at ", i).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
}
|
||||
}
|
||||
return mb
|
||||
}))
|
||||
}
|
||||
uplinkReader, uplinkWriter := pipe.New(upOpt...)
|
||||
downlinkReader, downlinkWriter := pipe.New(downOpt...)
|
||||
|
||||
inboundLink := &transport.Link{
|
||||
Reader: downlinkReader,
|
||||
@@ -175,19 +248,34 @@ func (d *DefaultDispatcher) getLink(ctx context.Context) (*transport.Link, *tran
|
||||
return inboundLink, outboundLink
|
||||
}
|
||||
|
||||
func shouldOverride(result SniffResult, request session.SniffingRequest) bool {
|
||||
func (d *DefaultDispatcher) shouldOverride(ctx context.Context, result SniffResult, request session.SniffingRequest, destination net.Destination) bool {
|
||||
domain := result.Domain()
|
||||
if domain == "" {
|
||||
return false
|
||||
}
|
||||
for _, d := range request.ExcludeForDomain {
|
||||
if domain == d {
|
||||
if strings.ToLower(domain) == d {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
protocol := result.Protocol()
|
||||
protocolString := result.Protocol()
|
||||
if resComp, ok := result.(SnifferResultComposite); ok {
|
||||
protocolString = resComp.ProtocolForDomainResult()
|
||||
}
|
||||
for _, p := range request.OverrideDestinationForProtocol {
|
||||
if strings.HasPrefix(protocol, p) {
|
||||
if strings.HasPrefix(protocolString, p) {
|
||||
return true
|
||||
}
|
||||
if fkr0, ok := d.fdns.(dns.FakeDNSEngineRev0); ok && protocolString != "bittorrent" && p == "fakedns" &&
|
||||
destination.Address.Family().IsIP() && fkr0.IsIPInIPPool(destination.Address) {
|
||||
newError("Using sniffer ", protocolString, " since the fake DNS missed").WriteToLog(session.ExportIDToError(ctx))
|
||||
return true
|
||||
}
|
||||
if resultSubset, ok := result.(SnifferIsProtoSubsetOf); ok {
|
||||
if resultSubset.IsProtoSubsetOf(p) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return false
|
||||
@@ -202,15 +290,15 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
||||
Target: destination,
|
||||
}
|
||||
ctx = session.ContextWithOutbound(ctx, ob)
|
||||
|
||||
inbound, outbound := d.getLink(ctx)
|
||||
content := session.ContentFromContext(ctx)
|
||||
if content == nil {
|
||||
content = new(session.Content)
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
}
|
||||
|
||||
sniffingRequest := content.SniffingRequest
|
||||
if destination.Network != net.Network_TCP || !sniffingRequest.Enabled {
|
||||
inbound, outbound := d.getLink(ctx, destination.Network, sniffingRequest)
|
||||
if !sniffingRequest.Enabled {
|
||||
go d.routedDispatch(ctx, outbound, destination)
|
||||
} else {
|
||||
go func() {
|
||||
@@ -218,15 +306,19 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
||||
reader: outbound.Reader.(*pipe.Reader),
|
||||
}
|
||||
outbound.Reader = cReader
|
||||
result, err := sniffer(ctx, cReader)
|
||||
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
|
||||
if err == nil {
|
||||
content.Protocol = result.Protocol()
|
||||
}
|
||||
if err == nil && shouldOverride(result, sniffingRequest) {
|
||||
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||
domain := result.Domain()
|
||||
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||
destination.Address = net.ParseAddress(domain)
|
||||
ob.Target = destination
|
||||
if sniffingRequest.RouteOnly && result.Protocol() != "fakedns" {
|
||||
ob.RouteTarget = destination
|
||||
} else {
|
||||
ob.Target = destination
|
||||
}
|
||||
}
|
||||
d.routedDispatch(ctx, outbound, destination)
|
||||
}()
|
||||
@@ -234,52 +326,133 @@ func (d *DefaultDispatcher) Dispatch(ctx context.Context, destination net.Destin
|
||||
return inbound, nil
|
||||
}
|
||||
|
||||
func sniffer(ctx context.Context, cReader *cachedReader) (SniffResult, error) {
|
||||
// DispatchLink implements routing.Dispatcher.
|
||||
func (d *DefaultDispatcher) DispatchLink(ctx context.Context, destination net.Destination, outbound *transport.Link) error {
|
||||
if !destination.IsValid() {
|
||||
return newError("Dispatcher: Invalid destination.")
|
||||
}
|
||||
ob := &session.Outbound{
|
||||
Target: destination,
|
||||
}
|
||||
ctx = session.ContextWithOutbound(ctx, ob)
|
||||
content := session.ContentFromContext(ctx)
|
||||
if content == nil {
|
||||
content = new(session.Content)
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
}
|
||||
sniffingRequest := content.SniffingRequest
|
||||
if !sniffingRequest.Enabled {
|
||||
go d.routedDispatch(ctx, outbound, destination)
|
||||
} else {
|
||||
go func() {
|
||||
cReader := &cachedReader{
|
||||
reader: outbound.Reader.(*pipe.Reader),
|
||||
}
|
||||
outbound.Reader = cReader
|
||||
result, err := sniffer(ctx, cReader, sniffingRequest.MetadataOnly, destination.Network)
|
||||
if err == nil {
|
||||
content.Protocol = result.Protocol()
|
||||
}
|
||||
if err == nil && d.shouldOverride(ctx, result, sniffingRequest, destination) {
|
||||
domain := result.Domain()
|
||||
newError("sniffed domain: ", domain).WriteToLog(session.ExportIDToError(ctx))
|
||||
destination.Address = net.ParseAddress(domain)
|
||||
if sniffingRequest.RouteOnly && result.Protocol() != "fakedns" {
|
||||
ob.RouteTarget = destination
|
||||
} else {
|
||||
ob.Target = destination
|
||||
}
|
||||
}
|
||||
d.routedDispatch(ctx, outbound, destination)
|
||||
}()
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func sniffer(ctx context.Context, cReader *cachedReader, metadataOnly bool, network net.Network) (SniffResult, error) {
|
||||
payload := buf.New()
|
||||
defer payload.Release()
|
||||
|
||||
sniffer := NewSniffer()
|
||||
totalAttempt := 0
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
totalAttempt++
|
||||
if totalAttempt > 2 {
|
||||
return nil, errSniffingTimeout
|
||||
}
|
||||
sniffer := NewSniffer(ctx)
|
||||
|
||||
cReader.Cache(payload)
|
||||
if !payload.IsEmpty() {
|
||||
result, err := sniffer.Sniff(payload.Bytes())
|
||||
if err != common.ErrNoClue {
|
||||
return result, err
|
||||
metaresult, metadataErr := sniffer.SniffMetadata(ctx)
|
||||
|
||||
if metadataOnly {
|
||||
return metaresult, metadataErr
|
||||
}
|
||||
|
||||
contentResult, contentErr := func() (SniffResult, error) {
|
||||
totalAttempt := 0
|
||||
for {
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
totalAttempt++
|
||||
if totalAttempt > 2 {
|
||||
return nil, errSniffingTimeout
|
||||
}
|
||||
|
||||
cReader.Cache(payload)
|
||||
if !payload.IsEmpty() {
|
||||
result, err := sniffer.Sniff(ctx, payload.Bytes(), network)
|
||||
if err != common.ErrNoClue {
|
||||
return result, err
|
||||
}
|
||||
}
|
||||
if payload.IsFull() {
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
}
|
||||
if payload.IsFull() {
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
}
|
||||
}()
|
||||
if contentErr != nil && metadataErr == nil {
|
||||
return metaresult, nil
|
||||
}
|
||||
if contentErr == nil && metadataErr == nil {
|
||||
return CompositeResult(metaresult, contentResult), nil
|
||||
}
|
||||
return contentResult, contentErr
|
||||
}
|
||||
|
||||
func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.Link, destination net.Destination) {
|
||||
var handler outbound.Handler
|
||||
|
||||
skipRoutePick := false
|
||||
if content := session.ContentFromContext(ctx); content != nil {
|
||||
skipRoutePick = content.SkipRoutePick
|
||||
ob := session.OutboundFromContext(ctx)
|
||||
if hosts, ok := d.dns.(dns.HostsLookup); ok && destination.Address.Family().IsDomain() {
|
||||
proxied := hosts.LookupHosts(ob.Target.String())
|
||||
if proxied != nil {
|
||||
ro := ob.RouteTarget == destination
|
||||
destination.Address = *proxied
|
||||
if ro {
|
||||
ob.RouteTarget = destination
|
||||
} else {
|
||||
ob.Target = destination
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
var handler outbound.Handler
|
||||
|
||||
routingLink := routing_session.AsRoutingContext(ctx)
|
||||
inTag := routingLink.GetInboundTag()
|
||||
isPickRoute := false
|
||||
if d.router != nil && !skipRoutePick {
|
||||
isPickRoute := 0
|
||||
if forcedOutboundTag := session.GetForcedOutboundTagFromContext(ctx); forcedOutboundTag != "" {
|
||||
ctx = session.SetForcedOutboundTagToContext(ctx, "")
|
||||
if h := d.ohm.GetHandler(forcedOutboundTag); h != nil {
|
||||
isPickRoute = 1
|
||||
newError("taking platform initialized detour [", forcedOutboundTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
|
||||
handler = h
|
||||
} else {
|
||||
newError("non existing tag for platform initialized detour: ", forcedOutboundTag).AtError().WriteToLog(session.ExportIDToError(ctx))
|
||||
common.Close(link.Writer)
|
||||
common.Interrupt(link.Reader)
|
||||
return
|
||||
}
|
||||
} else if d.router != nil {
|
||||
if route, err := d.router.PickRoute(routingLink); err == nil {
|
||||
outTag := route.GetOutboundTag()
|
||||
isPickRoute = true
|
||||
if h := d.ohm.GetHandler(outTag); h != nil {
|
||||
isPickRoute = 2
|
||||
newError("taking detour [", outTag, "] for [", destination, "]").WriteToLog(session.ExportIDToError(ctx))
|
||||
handler = h
|
||||
} else {
|
||||
@@ -303,18 +476,14 @@ func (d *DefaultDispatcher) routedDispatch(ctx context.Context, link *transport.
|
||||
|
||||
if accessMessage := log.AccessMessageFromContext(ctx); accessMessage != nil {
|
||||
if tag := handler.Tag(); tag != "" {
|
||||
if isPickRoute {
|
||||
if inTag != "" {
|
||||
accessMessage.Detour = inTag + " -> " + tag
|
||||
} else {
|
||||
accessMessage.Detour = tag
|
||||
}
|
||||
if inTag == "" {
|
||||
accessMessage.Detour = tag
|
||||
} else if isPickRoute == 1 {
|
||||
accessMessage.Detour = inTag + " ==> " + tag
|
||||
} else if isPickRoute == 2 {
|
||||
accessMessage.Detour = inTag + " -> " + tag
|
||||
} else {
|
||||
if inTag != "" {
|
||||
accessMessage.Detour = inTag + " >> " + tag
|
||||
} else {
|
||||
accessMessage.Detour = tag
|
||||
}
|
||||
accessMessage.Detour = inTag + " >> " + tag
|
||||
}
|
||||
}
|
||||
log.Record(accessMessage)
|
||||
|
||||
119
app/dispatcher/fakednssniffer.go
Normal file
119
app/dispatcher/fakednssniffer.go
Normal file
@@ -0,0 +1,119 @@
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
"context"
|
||||
"strings"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
// newFakeDNSSniffer Creates a Fake DNS metadata sniffer
|
||||
func newFakeDNSSniffer(ctx context.Context) (protocolSnifferWithMetadata, error) {
|
||||
var fakeDNSEngine dns.FakeDNSEngine
|
||||
{
|
||||
fakeDNSEngineFeat := core.MustFromContext(ctx).GetFeature((*dns.FakeDNSEngine)(nil))
|
||||
if fakeDNSEngineFeat != nil {
|
||||
fakeDNSEngine = fakeDNSEngineFeat.(dns.FakeDNSEngine)
|
||||
}
|
||||
}
|
||||
|
||||
if fakeDNSEngine == nil {
|
||||
errNotInit := newError("FakeDNSEngine is not initialized, but such a sniffer is used").AtError()
|
||||
return protocolSnifferWithMetadata{}, errNotInit
|
||||
}
|
||||
return protocolSnifferWithMetadata{protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
|
||||
Target := session.OutboundFromContext(ctx).Target
|
||||
if Target.Network == net.Network_TCP || Target.Network == net.Network_UDP {
|
||||
domainFromFakeDNS := fakeDNSEngine.GetDomainFromFakeDNS(Target.Address)
|
||||
if domainFromFakeDNS != "" {
|
||||
newError("fake dns got domain: ", domainFromFakeDNS, " for ip: ", Target.Address.String()).WriteToLog(session.ExportIDToError(ctx))
|
||||
return &fakeDNSSniffResult{domainName: domainFromFakeDNS}, nil
|
||||
}
|
||||
}
|
||||
|
||||
if ipAddressInRangeValueI := ctx.Value(ipAddressInRange); ipAddressInRangeValueI != nil {
|
||||
ipAddressInRangeValue := ipAddressInRangeValueI.(*ipAddressInRangeOpt)
|
||||
if fkr0, ok := fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
|
||||
inPool := fkr0.IsIPInIPPool(Target.Address)
|
||||
ipAddressInRangeValue.addressInRange = &inPool
|
||||
}
|
||||
}
|
||||
|
||||
return nil, common.ErrNoClue
|
||||
}, metadataSniffer: true}, nil
|
||||
}
|
||||
|
||||
type fakeDNSSniffResult struct {
|
||||
domainName string
|
||||
}
|
||||
|
||||
func (fakeDNSSniffResult) Protocol() string {
|
||||
return "fakedns"
|
||||
}
|
||||
|
||||
func (f fakeDNSSniffResult) Domain() string {
|
||||
return f.domainName
|
||||
}
|
||||
|
||||
type fakeDNSExtraOpts int
|
||||
|
||||
const ipAddressInRange fakeDNSExtraOpts = 1
|
||||
|
||||
type ipAddressInRangeOpt struct {
|
||||
addressInRange *bool
|
||||
}
|
||||
|
||||
type DNSThenOthersSniffResult struct {
|
||||
domainName string
|
||||
protocolOriginalName string
|
||||
}
|
||||
|
||||
func (f DNSThenOthersSniffResult) IsProtoSubsetOf(protocolName string) bool {
|
||||
return strings.HasPrefix(protocolName, f.protocolOriginalName)
|
||||
}
|
||||
|
||||
func (DNSThenOthersSniffResult) Protocol() string {
|
||||
return "fakedns+others"
|
||||
}
|
||||
|
||||
func (f DNSThenOthersSniffResult) Domain() string {
|
||||
return f.domainName
|
||||
}
|
||||
|
||||
func newFakeDNSThenOthers(ctx context.Context, fakeDNSSniffer protocolSnifferWithMetadata, others []protocolSnifferWithMetadata) (
|
||||
protocolSnifferWithMetadata, error,
|
||||
) { // nolint: unparam
|
||||
// ctx may be used in the future
|
||||
_ = ctx
|
||||
return protocolSnifferWithMetadata{
|
||||
protocolSniffer: func(ctx context.Context, bytes []byte) (SniffResult, error) {
|
||||
ipAddressInRangeValue := &ipAddressInRangeOpt{}
|
||||
ctx = context.WithValue(ctx, ipAddressInRange, ipAddressInRangeValue)
|
||||
result, err := fakeDNSSniffer.protocolSniffer(ctx, bytes)
|
||||
if err == nil {
|
||||
return result, nil
|
||||
}
|
||||
if ipAddressInRangeValue.addressInRange != nil {
|
||||
if *ipAddressInRangeValue.addressInRange {
|
||||
for _, v := range others {
|
||||
if v.metadataSniffer || bytes != nil {
|
||||
if result, err := v.protocolSniffer(ctx, bytes); err == nil {
|
||||
return DNSThenOthersSniffResult{domainName: result.Domain(), protocolOriginalName: result.Protocol()}, nil
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil, common.ErrNoClue
|
||||
}
|
||||
newError("ip address not in fake dns range, return as is").AtDebug().WriteToLog()
|
||||
return nil, common.ErrNoClue
|
||||
}
|
||||
newError("fake dns sniffer did not set address in range option, assume false.").AtWarning().WriteToLog()
|
||||
return nil, common.ErrNoClue
|
||||
},
|
||||
metadataSniffer: false,
|
||||
}, nil
|
||||
}
|
||||
@@ -1,9 +1,13 @@
|
||||
package dispatcher
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/protocol/bittorrent"
|
||||
"github.com/xtls/xray-core/common/protocol/http"
|
||||
"github.com/xtls/xray-core/common/protocol/quic"
|
||||
"github.com/xtls/xray-core/common/protocol/tls"
|
||||
)
|
||||
|
||||
@@ -12,30 +16,54 @@ type SniffResult interface {
|
||||
Domain() string
|
||||
}
|
||||
|
||||
type protocolSniffer func([]byte) (SniffResult, error)
|
||||
type protocolSniffer func(context.Context, []byte) (SniffResult, error)
|
||||
|
||||
type Sniffer struct {
|
||||
sniffer []protocolSniffer
|
||||
type protocolSnifferWithMetadata struct {
|
||||
protocolSniffer protocolSniffer
|
||||
// A Metadata sniffer will be invoked on connection establishment only, with nil body,
|
||||
// for both TCP and UDP connections
|
||||
// It will not be shown as a traffic type for routing unless there is no other successful sniffing.
|
||||
metadataSniffer bool
|
||||
network net.Network
|
||||
}
|
||||
|
||||
func NewSniffer() *Sniffer {
|
||||
return &Sniffer{
|
||||
sniffer: []protocolSniffer{
|
||||
func(b []byte) (SniffResult, error) { return http.SniffHTTP(b) },
|
||||
func(b []byte) (SniffResult, error) { return tls.SniffTLS(b) },
|
||||
func(b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) },
|
||||
type Sniffer struct {
|
||||
sniffer []protocolSnifferWithMetadata
|
||||
}
|
||||
|
||||
func NewSniffer(ctx context.Context) *Sniffer {
|
||||
ret := &Sniffer{
|
||||
sniffer: []protocolSnifferWithMetadata{
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return http.SniffHTTP(b) }, false, net.Network_TCP},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return tls.SniffTLS(b) }, false, net.Network_TCP},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffBittorrent(b) }, false, net.Network_TCP},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return quic.SniffQUIC(b) }, false, net.Network_UDP},
|
||||
{func(c context.Context, b []byte) (SniffResult, error) { return bittorrent.SniffUTP(b) }, false, net.Network_UDP},
|
||||
},
|
||||
}
|
||||
if sniffer, err := newFakeDNSSniffer(ctx); err == nil {
|
||||
others := ret.sniffer
|
||||
ret.sniffer = append(ret.sniffer, sniffer)
|
||||
fakeDNSThenOthers, err := newFakeDNSThenOthers(ctx, sniffer, others)
|
||||
if err == nil {
|
||||
ret.sniffer = append([]protocolSnifferWithMetadata{fakeDNSThenOthers}, ret.sniffer...)
|
||||
}
|
||||
}
|
||||
return ret
|
||||
}
|
||||
|
||||
var errUnknownContent = newError("unknown content")
|
||||
|
||||
func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSniffer
|
||||
for _, s := range s.sniffer {
|
||||
result, err := s(payload)
|
||||
func (s *Sniffer) Sniff(c context.Context, payload []byte, network net.Network) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSnifferWithMetadata
|
||||
for _, si := range s.sniffer {
|
||||
s := si.protocolSniffer
|
||||
if si.metadataSniffer || si.network != network {
|
||||
continue
|
||||
}
|
||||
result, err := s(c, payload)
|
||||
if err == common.ErrNoClue {
|
||||
pendingSniffer = append(pendingSniffer, s)
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
|
||||
@@ -51,3 +79,59 @@ func (s *Sniffer) Sniff(payload []byte) (SniffResult, error) {
|
||||
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
|
||||
func (s *Sniffer) SniffMetadata(c context.Context) (SniffResult, error) {
|
||||
var pendingSniffer []protocolSnifferWithMetadata
|
||||
for _, si := range s.sniffer {
|
||||
s := si.protocolSniffer
|
||||
if !si.metadataSniffer {
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
result, err := s(c, nil)
|
||||
if err == common.ErrNoClue {
|
||||
pendingSniffer = append(pendingSniffer, si)
|
||||
continue
|
||||
}
|
||||
|
||||
if err == nil && result != nil {
|
||||
return result, nil
|
||||
}
|
||||
}
|
||||
|
||||
if len(pendingSniffer) > 0 {
|
||||
s.sniffer = pendingSniffer
|
||||
return nil, common.ErrNoClue
|
||||
}
|
||||
|
||||
return nil, errUnknownContent
|
||||
}
|
||||
|
||||
func CompositeResult(domainResult SniffResult, protocolResult SniffResult) SniffResult {
|
||||
return &compositeResult{domainResult: domainResult, protocolResult: protocolResult}
|
||||
}
|
||||
|
||||
type compositeResult struct {
|
||||
domainResult SniffResult
|
||||
protocolResult SniffResult
|
||||
}
|
||||
|
||||
func (c compositeResult) Protocol() string {
|
||||
return c.protocolResult.Protocol()
|
||||
}
|
||||
|
||||
func (c compositeResult) Domain() string {
|
||||
return c.domainResult.Domain()
|
||||
}
|
||||
|
||||
func (c compositeResult) ProtocolForDomainResult() string {
|
||||
return c.domainResult.Protocol()
|
||||
}
|
||||
|
||||
type SnifferResultComposite interface {
|
||||
ProtocolForDomainResult() string
|
||||
}
|
||||
|
||||
type SnifferIsProtoSubsetOf interface {
|
||||
IsProtoSubsetOf(protocolName string) bool
|
||||
}
|
||||
|
||||
63
app/dns/config.go
Normal file
63
app/dns/config.go
Normal file
@@ -0,0 +1,63 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/common/uuid"
|
||||
)
|
||||
|
||||
var typeMap = map[DomainMatchingType]strmatcher.Type{
|
||||
DomainMatchingType_Full: strmatcher.Full,
|
||||
DomainMatchingType_Subdomain: strmatcher.Domain,
|
||||
DomainMatchingType_Keyword: strmatcher.Substr,
|
||||
DomainMatchingType_Regex: strmatcher.Regex,
|
||||
}
|
||||
|
||||
// References:
|
||||
// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
|
||||
// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
|
||||
var localTLDsAndDotlessDomains = []*NameServer_PriorityDomain{
|
||||
{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "local"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "lan"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "example"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "test"},
|
||||
}
|
||||
|
||||
var localTLDsAndDotlessDomainsRule = &NameServer_OriginalRule{
|
||||
Rule: "geosite:private",
|
||||
Size: uint32(len(localTLDsAndDotlessDomains)),
|
||||
}
|
||||
|
||||
func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
|
||||
strMType, f := typeMap[t]
|
||||
if !f {
|
||||
return nil, newError("unknown mapping type", t).AtWarning()
|
||||
}
|
||||
matcher, err := strMType.New(domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create str matcher").Base(err)
|
||||
}
|
||||
return matcher, nil
|
||||
}
|
||||
|
||||
func toNetIP(addrs []net.Address) ([]net.IP, error) {
|
||||
ips := make([]net.IP, 0, len(addrs))
|
||||
for _, addr := range addrs {
|
||||
if addr.Family().IsIP() {
|
||||
ips = append(ips, addr.IP())
|
||||
} else {
|
||||
return nil, newError("Failed to convert address", addr, "to Net IP.").AtWarning()
|
||||
}
|
||||
}
|
||||
return ips, nil
|
||||
}
|
||||
|
||||
func generateRandomTag() string {
|
||||
id := uuid.New()
|
||||
return "xray.system." + id.String()
|
||||
}
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dns/config.proto
|
||||
|
||||
package dns
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
router "github.com/xtls/xray-core/app/router"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
@@ -23,10 +22,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type DomainMatchingType int32
|
||||
|
||||
const (
|
||||
@@ -79,12 +74,63 @@ func (DomainMatchingType) EnumDescriptor() ([]byte, []int) {
|
||||
return file_app_dns_config_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
type QueryStrategy int32
|
||||
|
||||
const (
|
||||
QueryStrategy_USE_IP QueryStrategy = 0
|
||||
QueryStrategy_USE_IP4 QueryStrategy = 1
|
||||
QueryStrategy_USE_IP6 QueryStrategy = 2
|
||||
)
|
||||
|
||||
// Enum value maps for QueryStrategy.
|
||||
var (
|
||||
QueryStrategy_name = map[int32]string{
|
||||
0: "USE_IP",
|
||||
1: "USE_IP4",
|
||||
2: "USE_IP6",
|
||||
}
|
||||
QueryStrategy_value = map[string]int32{
|
||||
"USE_IP": 0,
|
||||
"USE_IP4": 1,
|
||||
"USE_IP6": 2,
|
||||
}
|
||||
)
|
||||
|
||||
func (x QueryStrategy) Enum() *QueryStrategy {
|
||||
p := new(QueryStrategy)
|
||||
*p = x
|
||||
return p
|
||||
}
|
||||
|
||||
func (x QueryStrategy) String() string {
|
||||
return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
|
||||
}
|
||||
|
||||
func (QueryStrategy) Descriptor() protoreflect.EnumDescriptor {
|
||||
return file_app_dns_config_proto_enumTypes[1].Descriptor()
|
||||
}
|
||||
|
||||
func (QueryStrategy) Type() protoreflect.EnumType {
|
||||
return &file_app_dns_config_proto_enumTypes[1]
|
||||
}
|
||||
|
||||
func (x QueryStrategy) Number() protoreflect.EnumNumber {
|
||||
return protoreflect.EnumNumber(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use QueryStrategy.Descriptor instead.
|
||||
func (QueryStrategy) EnumDescriptor() ([]byte, []int) {
|
||||
return file_app_dns_config_proto_rawDescGZIP(), []int{1}
|
||||
}
|
||||
|
||||
type NameServer struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
Address *net.Endpoint `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"`
|
||||
ClientIp []byte `protobuf:"bytes,5,opt,name=client_ip,json=clientIp,proto3" json:"client_ip,omitempty"`
|
||||
SkipFallback bool `protobuf:"varint,6,opt,name=skipFallback,proto3" json:"skipFallback,omitempty"`
|
||||
PrioritizedDomain []*NameServer_PriorityDomain `protobuf:"bytes,2,rep,name=prioritized_domain,json=prioritizedDomain,proto3" json:"prioritized_domain,omitempty"`
|
||||
Geoip []*router.GeoIP `protobuf:"bytes,3,rep,name=geoip,proto3" json:"geoip,omitempty"`
|
||||
OriginalRules []*NameServer_OriginalRule `protobuf:"bytes,4,rep,name=original_rules,json=originalRules,proto3" json:"original_rules,omitempty"`
|
||||
@@ -129,6 +175,20 @@ func (x *NameServer) GetAddress() *net.Endpoint {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *NameServer) GetClientIp() []byte {
|
||||
if x != nil {
|
||||
return x.ClientIp
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *NameServer) GetSkipFallback() bool {
|
||||
if x != nil {
|
||||
return x.SkipFallback
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *NameServer) GetPrioritizedDomain() []*NameServer_PriorityDomain {
|
||||
if x != nil {
|
||||
return x.PrioritizedDomain
|
||||
@@ -174,6 +234,11 @@ type Config struct {
|
||||
StaticHosts []*Config_HostMapping `protobuf:"bytes,4,rep,name=static_hosts,json=staticHosts,proto3" json:"static_hosts,omitempty"`
|
||||
// Tag is the inbound tag of DNS client.
|
||||
Tag string `protobuf:"bytes,6,opt,name=tag,proto3" json:"tag,omitempty"`
|
||||
// DisableCache disables DNS cache
|
||||
DisableCache bool `protobuf:"varint,8,opt,name=disableCache,proto3" json:"disableCache,omitempty"`
|
||||
QueryStrategy QueryStrategy `protobuf:"varint,9,opt,name=query_strategy,json=queryStrategy,proto3,enum=xray.app.dns.QueryStrategy" json:"query_strategy,omitempty"`
|
||||
DisableFallback bool `protobuf:"varint,10,opt,name=disableFallback,proto3" json:"disableFallback,omitempty"`
|
||||
DisableFallbackIfMatch bool `protobuf:"varint,11,opt,name=disableFallbackIfMatch,proto3" json:"disableFallbackIfMatch,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
@@ -252,6 +317,34 @@ func (x *Config) GetTag() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *Config) GetDisableCache() bool {
|
||||
if x != nil {
|
||||
return x.DisableCache
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *Config) GetQueryStrategy() QueryStrategy {
|
||||
if x != nil {
|
||||
return x.QueryStrategy
|
||||
}
|
||||
return QueryStrategy_USE_IP
|
||||
}
|
||||
|
||||
func (x *Config) GetDisableFallback() bool {
|
||||
if x != nil {
|
||||
return x.DisableFallback
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *Config) GetDisableFallbackIfMatch() bool {
|
||||
if x != nil {
|
||||
return x.DisableFallbackIfMatch
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type NameServer_PriorityDomain struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
@@ -371,8 +464,7 @@ type Config_HostMapping struct {
|
||||
Domain string `protobuf:"bytes,2,opt,name=domain,proto3" json:"domain,omitempty"`
|
||||
Ip [][]byte `protobuf:"bytes,3,rep,name=ip,proto3" json:"ip,omitempty"`
|
||||
// ProxiedDomain indicates the mapped domain has the same IP address on this
|
||||
// domain. Xray will use this domain for IP queries. This field is only
|
||||
// effective if ip is empty.
|
||||
// domain. Xray will use this domain for IP queries.
|
||||
ProxiedDomain string `protobuf:"bytes,4,opt,name=proxied_domain,json=proxiedDomain,proto3" json:"proxied_domain,omitempty"`
|
||||
}
|
||||
|
||||
@@ -446,77 +538,98 @@ var file_app_dns_config_proto_rawDesc = []byte{
|
||||
0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6e, 0x65, 0x74, 0x2f, 0x64, 0x65, 0x73, 0x74, 0x69,
|
||||
0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x17, 0x61, 0x70,
|
||||
0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
|
||||
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xad, 0x03, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
|
||||
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xee, 0x03, 0x0a, 0x0a, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65,
|
||||
0x72, 0x76, 0x65, 0x72, 0x12, 0x33, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18,
|
||||
0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
|
||||
0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72, 0x69,
|
||||
0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
|
||||
0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x2e,
|
||||
0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x11,
|
||||
0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12,
|
||||
0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c, 0x65,
|
||||
0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
|
||||
0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
|
||||
0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d,
|
||||
0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x1a, 0x5e, 0x0a,
|
||||
0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12,
|
||||
0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f, 0x6d,
|
||||
0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x52,
|
||||
0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18,
|
||||
0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x1a, 0x36, 0x0a,
|
||||
0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a,
|
||||
0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75, 0x6c,
|
||||
0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52,
|
||||
0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0x9f, 0x04, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x18,
|
||||
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e, 0x74,
|
||||
0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
|
||||
0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72,
|
||||
0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69,
|
||||
0x65, 0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c,
|
||||
0x69, 0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x22, 0x0a, 0x0c, 0x73, 0x6b, 0x69, 0x70, 0x46, 0x61,
|
||||
0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x73, 0x6b,
|
||||
0x69, 0x70, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x56, 0x0a, 0x12, 0x70, 0x72,
|
||||
0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72,
|
||||
0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x39, 0x0a, 0x05,
|
||||
0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x78, 0x72,
|
||||
0x2e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
|
||||
0x11, 0x70, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x69, 0x7a, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28,
|
||||
0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
|
||||
0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70,
|
||||
0x12, 0x4c, 0x0a, 0x0e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x72, 0x75, 0x6c,
|
||||
0x65, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76,
|
||||
0x65, 0x72, 0x2e, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x52,
|
||||
0x0d, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x73, 0x1a, 0x5e,
|
||||
0x0a, 0x0e, 0x50, 0x72, 0x69, 0x6f, 0x72, 0x69, 0x74, 0x79, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f,
|
||||
0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65,
|
||||
0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x1a, 0x36,
|
||||
0x0a, 0x0c, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12,
|
||||
0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x75,
|
||||
0x6c, 0x65, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
|
||||
0x52, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x22, 0xef, 0x05, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x12, 0x3f, 0x0a, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73,
|
||||
0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x45, 0x6e, 0x64, 0x70, 0x6f, 0x69, 0x6e,
|
||||
0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
|
||||
0x72, 0x73, 0x12, 0x39, 0x0a, 0x0b, 0x6e, 0x61, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65,
|
||||
0x72, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
|
||||
0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x4e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65,
|
||||
0x72, 0x52, 0x0a, 0x6e, 0x61, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x39, 0x0a,
|
||||
0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66,
|
||||
0x69, 0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x42, 0x02, 0x18,
|
||||
0x01, 0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69, 0x65,
|
||||
0x6e, 0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c, 0x69,
|
||||
0x65, 0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x5f,
|
||||
0x68, 0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x42, 0x02, 0x18, 0x01,
|
||||
0x52, 0x05, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x63, 0x6c, 0x69, 0x65, 0x6e,
|
||||
0x74, 0x5f, 0x69, 0x70, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x08, 0x63, 0x6c, 0x69, 0x65,
|
||||
0x6e, 0x74, 0x49, 0x70, 0x12, 0x43, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x5f, 0x68,
|
||||
0x6f, 0x73, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x52, 0x0b, 0x73, 0x74,
|
||||
0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67,
|
||||
0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x1a, 0x55, 0x0a, 0x0a, 0x48,
|
||||
0x6f, 0x73, 0x74, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79,
|
||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76,
|
||||
0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f,
|
||||
0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02,
|
||||
0x38, 0x01, 0x1a, 0x92, 0x01, 0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69,
|
||||
0x6e, 0x67, 0x12, 0x34, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e,
|
||||
0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e,
|
||||
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79,
|
||||
0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70,
|
||||
0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65,
|
||||
0x64, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
||||
0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64, 0x6f,
|
||||
0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f, 0x72,
|
||||
0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x42, 0x46,
|
||||
0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64,
|
||||
0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f,
|
||||
0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
|
||||
0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x67, 0x2e, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x52, 0x0b, 0x73,
|
||||
0x74, 0x61, 0x74, 0x69, 0x63, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61,
|
||||
0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x22, 0x0a, 0x0c,
|
||||
0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43, 0x61, 0x63, 0x68, 0x65, 0x18, 0x08, 0x20, 0x01,
|
||||
0x28, 0x08, 0x52, 0x0c, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x43, 0x61, 0x63, 0x68, 0x65,
|
||||
0x12, 0x42, 0x0a, 0x0e, 0x71, 0x75, 0x65, 0x72, 0x79, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65,
|
||||
0x67, 0x79, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72,
|
||||
0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0d, 0x71, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61,
|
||||
0x74, 0x65, 0x67, 0x79, 0x12, 0x28, 0x0a, 0x0f, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46,
|
||||
0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0f, 0x64,
|
||||
0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x36,
|
||||
0x0a, 0x16, 0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63,
|
||||
0x6b, 0x49, 0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x08, 0x52, 0x16,
|
||||
0x64, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x46, 0x61, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x49,
|
||||
0x66, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x1a, 0x55, 0x0a, 0x0a, 0x48, 0x6f, 0x73, 0x74, 0x73, 0x45,
|
||||
0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28,
|
||||
0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x31, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18,
|
||||
0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x1a, 0x92, 0x01,
|
||||
0x0a, 0x0b, 0x48, 0x6f, 0x73, 0x74, 0x4d, 0x61, 0x70, 0x70, 0x69, 0x6e, 0x67, 0x12, 0x34, 0x0a,
|
||||
0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x20, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74,
|
||||
0x79, 0x70, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20,
|
||||
0x01, 0x28, 0x09, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12, 0x0e, 0x0a, 0x02, 0x69,
|
||||
0x70, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70, 0x12, 0x25, 0x0a, 0x0e, 0x70,
|
||||
0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x5f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x04, 0x20,
|
||||
0x01, 0x28, 0x09, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x69, 0x65, 0x64, 0x44, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x4a, 0x04, 0x08, 0x07, 0x10, 0x08, 0x2a, 0x45, 0x0a, 0x12, 0x44, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x69, 0x6e, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08,
|
||||
0x0a, 0x04, 0x46, 0x75, 0x6c, 0x6c, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x64,
|
||||
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x4b, 0x65, 0x79, 0x77, 0x6f,
|
||||
0x72, 0x64, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x52, 0x65, 0x67, 0x65, 0x78, 0x10, 0x03, 0x2a,
|
||||
0x35, 0x0a, 0x0d, 0x51, 0x75, 0x65, 0x72, 0x79, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||
0x12, 0x0a, 0x0a, 0x06, 0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07,
|
||||
0x55, 0x53, 0x45, 0x5f, 0x49, 0x50, 0x34, 0x10, 0x01, 0x12, 0x0b, 0x0a, 0x07, 0x55, 0x53, 0x45,
|
||||
0x5f, 0x49, 0x50, 0x36, 0x10, 0x02, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69,
|
||||
0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0xaa,
|
||||
0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x62, 0x06,
|
||||
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
@@ -531,37 +644,39 @@ func file_app_dns_config_proto_rawDescGZIP() []byte {
|
||||
return file_app_dns_config_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
|
||||
var file_app_dns_config_proto_enumTypes = make([]protoimpl.EnumInfo, 2)
|
||||
var file_app_dns_config_proto_msgTypes = make([]protoimpl.MessageInfo, 6)
|
||||
var file_app_dns_config_proto_goTypes = []interface{}{
|
||||
(DomainMatchingType)(0), // 0: xray.app.dns.DomainMatchingType
|
||||
(*NameServer)(nil), // 1: xray.app.dns.NameServer
|
||||
(*Config)(nil), // 2: xray.app.dns.Config
|
||||
(*NameServer_PriorityDomain)(nil), // 3: xray.app.dns.NameServer.PriorityDomain
|
||||
(*NameServer_OriginalRule)(nil), // 4: xray.app.dns.NameServer.OriginalRule
|
||||
nil, // 5: xray.app.dns.Config.HostsEntry
|
||||
(*Config_HostMapping)(nil), // 6: xray.app.dns.Config.HostMapping
|
||||
(*net.Endpoint)(nil), // 7: xray.common.net.Endpoint
|
||||
(*router.GeoIP)(nil), // 8: xray.app.router.GeoIP
|
||||
(*net.IPOrDomain)(nil), // 9: xray.common.net.IPOrDomain
|
||||
(QueryStrategy)(0), // 1: xray.app.dns.QueryStrategy
|
||||
(*NameServer)(nil), // 2: xray.app.dns.NameServer
|
||||
(*Config)(nil), // 3: xray.app.dns.Config
|
||||
(*NameServer_PriorityDomain)(nil), // 4: xray.app.dns.NameServer.PriorityDomain
|
||||
(*NameServer_OriginalRule)(nil), // 5: xray.app.dns.NameServer.OriginalRule
|
||||
nil, // 6: xray.app.dns.Config.HostsEntry
|
||||
(*Config_HostMapping)(nil), // 7: xray.app.dns.Config.HostMapping
|
||||
(*net.Endpoint)(nil), // 8: xray.common.net.Endpoint
|
||||
(*router.GeoIP)(nil), // 9: xray.app.router.GeoIP
|
||||
(*net.IPOrDomain)(nil), // 10: xray.common.net.IPOrDomain
|
||||
}
|
||||
var file_app_dns_config_proto_depIdxs = []int32{
|
||||
7, // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
|
||||
3, // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
|
||||
8, // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
|
||||
4, // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
|
||||
7, // 4: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
|
||||
1, // 5: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
|
||||
5, // 6: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
|
||||
6, // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
|
||||
0, // 8: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
|
||||
9, // 9: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
|
||||
0, // 10: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
|
||||
11, // [11:11] is the sub-list for method output_type
|
||||
11, // [11:11] is the sub-list for method input_type
|
||||
11, // [11:11] is the sub-list for extension type_name
|
||||
11, // [11:11] is the sub-list for extension extendee
|
||||
0, // [0:11] is the sub-list for field type_name
|
||||
8, // 0: xray.app.dns.NameServer.address:type_name -> xray.common.net.Endpoint
|
||||
4, // 1: xray.app.dns.NameServer.prioritized_domain:type_name -> xray.app.dns.NameServer.PriorityDomain
|
||||
9, // 2: xray.app.dns.NameServer.geoip:type_name -> xray.app.router.GeoIP
|
||||
5, // 3: xray.app.dns.NameServer.original_rules:type_name -> xray.app.dns.NameServer.OriginalRule
|
||||
8, // 4: xray.app.dns.Config.NameServers:type_name -> xray.common.net.Endpoint
|
||||
2, // 5: xray.app.dns.Config.name_server:type_name -> xray.app.dns.NameServer
|
||||
6, // 6: xray.app.dns.Config.Hosts:type_name -> xray.app.dns.Config.HostsEntry
|
||||
7, // 7: xray.app.dns.Config.static_hosts:type_name -> xray.app.dns.Config.HostMapping
|
||||
1, // 8: xray.app.dns.Config.query_strategy:type_name -> xray.app.dns.QueryStrategy
|
||||
0, // 9: xray.app.dns.NameServer.PriorityDomain.type:type_name -> xray.app.dns.DomainMatchingType
|
||||
10, // 10: xray.app.dns.Config.HostsEntry.value:type_name -> xray.common.net.IPOrDomain
|
||||
0, // 11: xray.app.dns.Config.HostMapping.type:type_name -> xray.app.dns.DomainMatchingType
|
||||
12, // [12:12] is the sub-list for method output_type
|
||||
12, // [12:12] is the sub-list for method input_type
|
||||
12, // [12:12] is the sub-list for extension type_name
|
||||
12, // [12:12] is the sub-list for extension extendee
|
||||
0, // [0:12] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_dns_config_proto_init() }
|
||||
@@ -636,7 +751,7 @@ func file_app_dns_config_proto_init() {
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_dns_config_proto_rawDesc,
|
||||
NumEnums: 1,
|
||||
NumEnums: 2,
|
||||
NumMessages: 6,
|
||||
NumExtensions: 0,
|
||||
NumServices: 0,
|
||||
|
||||
@@ -12,6 +12,8 @@ import "app/router/config.proto";
|
||||
|
||||
message NameServer {
|
||||
xray.common.net.Endpoint address = 1;
|
||||
bytes client_ip = 5;
|
||||
bool skipFallback = 6;
|
||||
|
||||
message PriorityDomain {
|
||||
DomainMatchingType type = 1;
|
||||
@@ -35,6 +37,12 @@ enum DomainMatchingType {
|
||||
Regex = 3;
|
||||
}
|
||||
|
||||
enum QueryStrategy {
|
||||
USE_IP = 0;
|
||||
USE_IP4 = 1;
|
||||
USE_IP6 = 2;
|
||||
}
|
||||
|
||||
message Config {
|
||||
// Nameservers used by this DNS. Only traditional UDP servers are support at
|
||||
// the moment. A special value 'localhost' as a domain address can be set to
|
||||
@@ -59,8 +67,7 @@ message Config {
|
||||
repeated bytes ip = 3;
|
||||
|
||||
// ProxiedDomain indicates the mapped domain has the same IP address on this
|
||||
// domain. Xray will use this domain for IP queries. This field is only
|
||||
// effective if ip is empty.
|
||||
// domain. Xray will use this domain for IP queries.
|
||||
string proxied_domain = 4;
|
||||
}
|
||||
|
||||
@@ -68,4 +75,14 @@ message Config {
|
||||
|
||||
// Tag is the inbound tag of DNS client.
|
||||
string tag = 6;
|
||||
|
||||
reserved 7;
|
||||
|
||||
// DisableCache disables DNS cache
|
||||
bool disableCache = 8;
|
||||
|
||||
QueryStrategy query_strategy = 9;
|
||||
|
||||
bool disableFallback = 10;
|
||||
bool disableFallbackIfMatch = 11;
|
||||
}
|
||||
|
||||
308
app/dns/dns.go
308
app/dns/dns.go
@@ -2,3 +2,311 @@
|
||||
package dns
|
||||
|
||||
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"strings"
|
||||
"sync"
|
||||
|
||||
"github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/features"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
// DNS is a DNS rely server.
|
||||
type DNS struct {
|
||||
sync.Mutex
|
||||
tag string
|
||||
disableCache bool
|
||||
disableFallback bool
|
||||
disableFallbackIfMatch bool
|
||||
ipOption *dns.IPOption
|
||||
hosts *StaticHosts
|
||||
clients []*Client
|
||||
ctx context.Context
|
||||
domainMatcher strmatcher.IndexMatcher
|
||||
matcherInfos []*DomainMatcherInfo
|
||||
}
|
||||
|
||||
// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
|
||||
type DomainMatcherInfo struct {
|
||||
clientIdx uint16
|
||||
domainRuleIdx uint16
|
||||
}
|
||||
|
||||
// New creates a new DNS server with given configuration.
|
||||
func New(ctx context.Context, config *Config) (*DNS, error) {
|
||||
var tag string
|
||||
if len(config.Tag) > 0 {
|
||||
tag = config.Tag
|
||||
} else {
|
||||
tag = generateRandomTag()
|
||||
}
|
||||
|
||||
var clientIP net.IP
|
||||
switch len(config.ClientIp) {
|
||||
case 0, net.IPv4len, net.IPv6len:
|
||||
clientIP = net.IP(config.ClientIp)
|
||||
default:
|
||||
return nil, newError("unexpected client IP length ", len(config.ClientIp))
|
||||
}
|
||||
|
||||
var ipOption *dns.IPOption
|
||||
switch config.QueryStrategy {
|
||||
case QueryStrategy_USE_IP:
|
||||
ipOption = &dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}
|
||||
case QueryStrategy_USE_IP4:
|
||||
ipOption = &dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
}
|
||||
case QueryStrategy_USE_IP6:
|
||||
ipOption = &dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}
|
||||
}
|
||||
|
||||
hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create hosts").Base(err)
|
||||
}
|
||||
|
||||
clients := []*Client{}
|
||||
domainRuleCount := 0
|
||||
for _, ns := range config.NameServer {
|
||||
domainRuleCount += len(ns.PrioritizedDomain)
|
||||
}
|
||||
|
||||
// MatcherInfos is ensured to cover the maximum index domainMatcher could return, where matcher's index starts from 1
|
||||
matcherInfos := make([]*DomainMatcherInfo, domainRuleCount+1)
|
||||
domainMatcher := &strmatcher.MatcherGroup{}
|
||||
geoipContainer := router.GeoIPMatcherContainer{}
|
||||
|
||||
for _, endpoint := range config.NameServers {
|
||||
features.PrintDeprecatedFeatureWarning("simple DNS server")
|
||||
client, err := NewSimpleClient(ctx, endpoint, clientIP)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create client").Base(err)
|
||||
}
|
||||
clients = append(clients, client)
|
||||
}
|
||||
|
||||
for _, ns := range config.NameServer {
|
||||
clientIdx := len(clients)
|
||||
updateDomain := func(domainRule strmatcher.Matcher, originalRuleIdx int, matcherInfos []*DomainMatcherInfo) error {
|
||||
midx := domainMatcher.Add(domainRule)
|
||||
matcherInfos[midx] = &DomainMatcherInfo{
|
||||
clientIdx: uint16(clientIdx),
|
||||
domainRuleIdx: uint16(originalRuleIdx),
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
myClientIP := clientIP
|
||||
switch len(ns.ClientIp) {
|
||||
case net.IPv4len, net.IPv6len:
|
||||
myClientIP = net.IP(ns.ClientIp)
|
||||
}
|
||||
client, err := NewClient(ctx, ns, myClientIP, geoipContainer, &matcherInfos, updateDomain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create client").Base(err)
|
||||
}
|
||||
clients = append(clients, client)
|
||||
}
|
||||
|
||||
// If there is no DNS client in config, add a `localhost` DNS client
|
||||
if len(clients) == 0 {
|
||||
clients = append(clients, NewLocalDNSClient())
|
||||
}
|
||||
|
||||
return &DNS{
|
||||
tag: tag,
|
||||
hosts: hosts,
|
||||
ipOption: ipOption,
|
||||
clients: clients,
|
||||
ctx: ctx,
|
||||
domainMatcher: domainMatcher,
|
||||
matcherInfos: matcherInfos,
|
||||
disableCache: config.DisableCache,
|
||||
disableFallback: config.DisableFallback,
|
||||
disableFallbackIfMatch: config.DisableFallbackIfMatch,
|
||||
}, nil
|
||||
}
|
||||
|
||||
// Type implements common.HasType.
|
||||
func (*DNS) Type() interface{} {
|
||||
return dns.ClientType()
|
||||
}
|
||||
|
||||
// Start implements common.Runnable.
|
||||
func (s *DNS) Start() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close implements common.Closable.
|
||||
func (s *DNS) Close() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// IsOwnLink implements proxy.dns.ownLinkVerifier
|
||||
func (s *DNS) IsOwnLink(ctx context.Context) bool {
|
||||
inbound := session.InboundFromContext(ctx)
|
||||
return inbound != nil && inbound.Tag == s.tag
|
||||
}
|
||||
|
||||
// LookupIP implements dns.Client.
|
||||
func (s *DNS) LookupIP(domain string, option dns.IPOption) ([]net.IP, error) {
|
||||
if domain == "" {
|
||||
return nil, newError("empty domain name")
|
||||
}
|
||||
|
||||
option.IPv4Enable = option.IPv4Enable && s.ipOption.IPv4Enable
|
||||
option.IPv6Enable = option.IPv6Enable && s.ipOption.IPv6Enable
|
||||
|
||||
if !option.IPv4Enable && !option.IPv6Enable {
|
||||
return nil, dns.ErrEmptyResponse
|
||||
}
|
||||
|
||||
// Normalize the FQDN form query
|
||||
if strings.HasSuffix(domain, ".") {
|
||||
domain = domain[:len(domain)-1]
|
||||
}
|
||||
|
||||
// Static host lookup
|
||||
switch addrs := s.hosts.Lookup(domain, option); {
|
||||
case addrs == nil: // Domain not recorded in static host
|
||||
break
|
||||
case len(addrs) == 0: // Domain recorded, but no valid IP returned (e.g. IPv4 address with only IPv6 enabled)
|
||||
return nil, dns.ErrEmptyResponse
|
||||
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Domain replacement
|
||||
newError("domain replaced: ", domain, " -> ", addrs[0].Domain()).WriteToLog()
|
||||
domain = addrs[0].Domain()
|
||||
default: // Successfully found ip records in static host
|
||||
newError("returning ", len(addrs), " IP(s) for domain ", domain, " -> ", addrs).WriteToLog()
|
||||
return toNetIP(addrs)
|
||||
}
|
||||
|
||||
// Name servers lookup
|
||||
errs := []error{}
|
||||
ctx := session.ContextWithInbound(s.ctx, &session.Inbound{Tag: s.tag})
|
||||
for _, client := range s.sortClients(domain) {
|
||||
if !option.FakeEnable && strings.EqualFold(client.Name(), "FakeDNS") {
|
||||
newError("skip DNS resolution for domain ", domain, " at server ", client.Name()).AtDebug().WriteToLog()
|
||||
continue
|
||||
}
|
||||
ips, err := client.QueryIP(ctx, domain, option, s.disableCache)
|
||||
if len(ips) > 0 {
|
||||
return ips, nil
|
||||
}
|
||||
if err != nil {
|
||||
newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
|
||||
errs = append(errs, err)
|
||||
}
|
||||
if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return nil, newError("returning nil for domain ", domain).Base(errors.Combine(errs...))
|
||||
}
|
||||
|
||||
// LookupHosts implements dns.HostsLookup.
|
||||
func (s *DNS) LookupHosts(domain string) *net.Address {
|
||||
domain = strings.TrimSuffix(domain, ".")
|
||||
if domain == "" {
|
||||
return nil
|
||||
}
|
||||
// Normalize the FQDN form query
|
||||
addrs := s.hosts.Lookup(domain, *s.ipOption)
|
||||
if len(addrs) > 0 {
|
||||
newError("domain replaced: ", domain, " -> ", addrs[0].String()).AtInfo().WriteToLog()
|
||||
return &addrs[0]
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetIPOption implements ClientWithIPOption.
|
||||
func (s *DNS) GetIPOption() *dns.IPOption {
|
||||
return s.ipOption
|
||||
}
|
||||
|
||||
// SetQueryOption implements ClientWithIPOption.
|
||||
func (s *DNS) SetQueryOption(isIPv4Enable, isIPv6Enable bool) {
|
||||
s.ipOption.IPv4Enable = isIPv4Enable
|
||||
s.ipOption.IPv6Enable = isIPv6Enable
|
||||
}
|
||||
|
||||
// SetFakeDNSOption implements ClientWithIPOption.
|
||||
func (s *DNS) SetFakeDNSOption(isFakeEnable bool) {
|
||||
s.ipOption.FakeEnable = isFakeEnable
|
||||
}
|
||||
|
||||
func (s *DNS) sortClients(domain string) []*Client {
|
||||
clients := make([]*Client, 0, len(s.clients))
|
||||
clientUsed := make([]bool, len(s.clients))
|
||||
clientNames := make([]string, 0, len(s.clients))
|
||||
domainRules := []string{}
|
||||
|
||||
// Priority domain matching
|
||||
hasMatch := false
|
||||
for _, match := range s.domainMatcher.Match(domain) {
|
||||
info := s.matcherInfos[match]
|
||||
client := s.clients[info.clientIdx]
|
||||
domainRule := client.domains[info.domainRuleIdx]
|
||||
domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", domainRule, info.clientIdx))
|
||||
if clientUsed[info.clientIdx] {
|
||||
continue
|
||||
}
|
||||
clientUsed[info.clientIdx] = true
|
||||
clients = append(clients, client)
|
||||
clientNames = append(clientNames, client.Name())
|
||||
hasMatch = true
|
||||
}
|
||||
|
||||
if !(s.disableFallback || s.disableFallbackIfMatch && hasMatch) {
|
||||
// Default round-robin query
|
||||
for idx, client := range s.clients {
|
||||
if clientUsed[idx] || client.skipFallback {
|
||||
continue
|
||||
}
|
||||
clientUsed[idx] = true
|
||||
clients = append(clients, client)
|
||||
clientNames = append(clientNames, client.Name())
|
||||
}
|
||||
}
|
||||
|
||||
if len(domainRules) > 0 {
|
||||
newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
|
||||
}
|
||||
if len(clientNames) > 0 {
|
||||
newError("domain ", domain, " will use DNS in order: ", clientNames).AtDebug().WriteToLog()
|
||||
}
|
||||
|
||||
if len(clients) == 0 {
|
||||
clients = append(clients, s.clients[0])
|
||||
clientNames = append(clientNames, s.clients[0].Name())
|
||||
newError("domain ", domain, " will use the first DNS: ", clientNames).AtDebug().WriteToLog()
|
||||
}
|
||||
|
||||
return clients
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
return New(ctx, config.(*Config))
|
||||
}))
|
||||
}
|
||||
|
||||
@@ -6,7 +6,6 @@ import (
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
"github.com/miekg/dns"
|
||||
|
||||
"github.com/xtls/xray-core/app/dispatcher"
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/app/policy"
|
||||
@@ -22,8 +21,7 @@ import (
|
||||
"github.com/xtls/xray-core/testing/servers/udp"
|
||||
)
|
||||
|
||||
type staticHandler struct {
|
||||
}
|
||||
type staticHandler struct{}
|
||||
|
||||
func (*staticHandler) ServeDNS(w dns.ResponseWriter, r *dns.Msg) {
|
||||
ans := new(dns.Msg)
|
||||
@@ -101,8 +99,8 @@ func (*staticHandler) ServeDNS(w dns.ResponseWriter, r *dns.Msg) {
|
||||
rr, _ := dns.NewRR("localhost-b. IN A 127.0.0.4")
|
||||
ans.Answer = append(ans.Answer, rr)
|
||||
|
||||
case q.Name == "mijia\\ cloud." && q.Qtype == dns.TypeA:
|
||||
rr, _ := dns.NewRR("mijia\\ cloud. IN A 127.0.0.1")
|
||||
case q.Name == "Mijia\\ Cloud." && q.Qtype == dns.TypeA:
|
||||
rr, _ := dns.NewRR("Mijia\\ Cloud. IN A 127.0.0.1")
|
||||
ans.Answer = append(ans.Answer, rr)
|
||||
}
|
||||
}
|
||||
@@ -154,7 +152,11 @@ func TestUDPServerSubnet(t *testing.T) {
|
||||
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -209,7 +211,11 @@ func TestUDPServer(t *testing.T) {
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -220,7 +226,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("facebook.com")
|
||||
ips, err := client.LookupIP("facebook.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -231,7 +241,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
_, err := client.LookupIP("notexist.google.com")
|
||||
_, err := client.LookupIP("notexist.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err == nil {
|
||||
t.Fatal("nil error")
|
||||
}
|
||||
@@ -241,8 +255,11 @@ func TestUDPServer(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
clientv6 := client.(feature_dns.IPv6Lookup)
|
||||
ips, err := clientv6.LookupIPv6("ipv4only.google.com")
|
||||
ips, err := client.LookupIP("ipv4only.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != feature_dns.ErrEmptyResponse {
|
||||
t.Fatal("error: ", err)
|
||||
}
|
||||
@@ -254,7 +271,11 @@ func TestUDPServer(t *testing.T) {
|
||||
dnsServer.Shutdown()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -331,7 +352,11 @@ func TestPrioritizedDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -390,10 +415,12 @@ func TestUDPServerIPv6(t *testing.T) {
|
||||
common.Must(err)
|
||||
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
client6 := client.(feature_dns.IPv6Lookup)
|
||||
|
||||
{
|
||||
ips, err := client6.LookupIPv6("ipv6.google.com")
|
||||
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -456,7 +483,11 @@ func TestStaticHostDomain(t *testing.T) {
|
||||
client := v.GetFeature(feature_dns.ClientType()).(feature_dns.Client)
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("example.com")
|
||||
ips, err := client.LookupIP("example.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -563,7 +594,11 @@ func TestIPMatch(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -682,7 +717,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{ // Will match dotless:
|
||||
ips, err := client.LookupIP("hostname")
|
||||
ips, err := client.LookupIP("hostname", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -693,7 +732,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match domain:local
|
||||
ips, err := client.LookupIP("hostname.local")
|
||||
ips, err := client.LookupIP("hostname.local", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -704,7 +747,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match static ip
|
||||
ips, err := client.LookupIP("hostnamestatic")
|
||||
ips, err := client.LookupIP("hostnamestatic", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -715,7 +762,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match domain replacing
|
||||
ips, err := client.LookupIP("hostnamealias")
|
||||
ips, err := client.LookupIP("hostnamealias", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -726,7 +777,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, but not expectIPs: 127.0.0.2, 127.0.0.3, then matches at dotless:
|
||||
ips, err := client.LookupIP("localhost")
|
||||
ips, err := client.LookupIP("localhost", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -737,7 +792,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||
ips, err := client.LookupIP("localhost-a")
|
||||
ips, err := client.LookupIP("localhost-a", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -748,7 +807,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:localhost, and expectIPs: 127.0.0.2, 127.0.0.3
|
||||
ips, err := client.LookupIP("localhost-b")
|
||||
ips, err := client.LookupIP("localhost-b", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -759,7 +822,11 @@ func TestLocalDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match dotless:
|
||||
ips, err := client.LookupIP("Mijia Cloud")
|
||||
ips, err := client.LookupIP("Mijia Cloud", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -921,7 +988,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
startTime := time.Now()
|
||||
|
||||
{ // Will match server 1,2 and server 1 returns expected ip
|
||||
ips, err := client.LookupIP("google.com")
|
||||
ips, err := client.LookupIP("google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -932,8 +1003,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 1,2 and server 1 returns unexpected ip, then server 2 returns expected one
|
||||
clientv4 := client.(feature_dns.IPv4Lookup)
|
||||
ips, err := clientv4.LookupIPv4("ipv6.google.com")
|
||||
ips, err := client.LookupIP("ipv6.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -944,7 +1018,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 3,1,2 and server 3 returns expected one
|
||||
ips, err := client.LookupIP("api.google.com")
|
||||
ips, err := client.LookupIP("api.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -955,7 +1033,11 @@ func TestMultiMatchPrioritizedDomain(t *testing.T) {
|
||||
}
|
||||
|
||||
{ // Will match server 4,3,1,2 and server 4 returns expected one
|
||||
ips, err := client.LookupIP("v2.api.google.com")
|
||||
ips, err := client.LookupIP("v2.api.google.com", feature_dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
})
|
||||
if err != nil {
|
||||
t.Fatal("unexpected error: ", err)
|
||||
}
|
||||
@@ -1,19 +1,24 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"encoding/binary"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/core"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
// Fqdn normalize domain make sure it ends with '.'
|
||||
// Fqdn normalizes domain make sure it ends with '.'
|
||||
func Fqdn(domain string) string {
|
||||
if len(domain) > 0 && domain[len(domain)-1] == '.' {
|
||||
if len(domain) > 0 && strings.HasSuffix(domain, ".") {
|
||||
return domain
|
||||
}
|
||||
return domain + "."
|
||||
@@ -52,9 +57,7 @@ func isNewer(baseRec *IPRecord, newRec *IPRecord) bool {
|
||||
return baseRec.Expire.Before(newRec.Expire)
|
||||
}
|
||||
|
||||
var (
|
||||
errRecordNotFound = errors.New("record not found")
|
||||
)
|
||||
var errRecordNotFound = errors.New("record not found")
|
||||
|
||||
type dnsRequest struct {
|
||||
reqType dnsmessage.Type
|
||||
@@ -112,7 +115,7 @@ func genEDNS0Options(clientIP net.IP) *dnsmessage.Resource {
|
||||
return opt
|
||||
}
|
||||
|
||||
func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
||||
func buildReqMsgs(domain string, option dns_feature.IPOption, reqIDGen func() uint16, reqOpts *dnsmessage.Resource) []*dnsRequest {
|
||||
qA := dnsmessage.Question{
|
||||
Name: dnsmessage.MustNewName(domain),
|
||||
Type: dnsmessage.TypeA,
|
||||
@@ -163,7 +166,7 @@ func buildReqMsgs(domain string, option IPOption, reqIDGen func() uint16, reqOpt
|
||||
return reqs
|
||||
}
|
||||
|
||||
// parseResponse parse DNS answers from the returned payload
|
||||
// parseResponse parses DNS answers from the returned payload
|
||||
func parseResponse(payload []byte) (*IPRecord, error) {
|
||||
var parser dnsmessage.Parser
|
||||
h, err := parser.Start(payload)
|
||||
@@ -211,7 +214,7 @@ L:
|
||||
case dnsmessage.TypeAAAA:
|
||||
ans, err := parser.AAAAResource()
|
||||
if err != nil {
|
||||
newError("failed to parse A record for domain: ", ah.Name).Base(err).WriteToLog()
|
||||
newError("failed to parse AAAA record for domain: ", ah.Name).Base(err).WriteToLog()
|
||||
break L
|
||||
}
|
||||
ipRecord.IP = append(ipRecord.IP, net.IPAddress(ans.AAAA[:]))
|
||||
@@ -226,3 +229,19 @@ L:
|
||||
|
||||
return ipRecord, nil
|
||||
}
|
||||
|
||||
// toDnsContext create a new background context with parent inbound, session and dns log
|
||||
func toDnsContext(ctx context.Context, addr string) context.Context {
|
||||
dnsCtx := core.ToBackgroundDetachedContext(ctx)
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
|
||||
}
|
||||
dnsCtx = session.ContextWithContent(dnsCtx, session.ContentFromContext(ctx))
|
||||
dnsCtx = log.ContextWithAccessMessage(dnsCtx, &log.AccessMessage{
|
||||
From: "DNS",
|
||||
To: addr,
|
||||
Status: log.AccessAccepted,
|
||||
Reason: "",
|
||||
})
|
||||
return dnsCtx
|
||||
}
|
||||
|
||||
@@ -9,6 +9,7 @@ import (
|
||||
"github.com/miekg/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
@@ -48,20 +49,28 @@ func Test_parseResponse(t *testing.T) {
|
||||
want *IPRecord
|
||||
wantErr bool
|
||||
}{
|
||||
{"empty",
|
||||
{
|
||||
"empty",
|
||||
&IPRecord{0, []net.Address(nil), time.Time{}, dnsmessage.RCodeSuccess},
|
||||
false,
|
||||
},
|
||||
{"error",
|
||||
{
|
||||
"error",
|
||||
nil,
|
||||
true,
|
||||
},
|
||||
{"a record",
|
||||
&IPRecord{1, []net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
|
||||
time.Time{}, dnsmessage.RCodeSuccess},
|
||||
{
|
||||
"a record",
|
||||
&IPRecord{
|
||||
1,
|
||||
[]net.Address{net.ParseAddress("8.8.8.8"), net.ParseAddress("8.8.4.4")},
|
||||
time.Time{},
|
||||
dnsmessage.RCodeSuccess,
|
||||
},
|
||||
false,
|
||||
},
|
||||
{"aaaa record",
|
||||
{
|
||||
"aaaa record",
|
||||
&IPRecord{2, []net.Address{net.ParseAddress("2001::123:8888"), net.ParseAddress("2001::123:8844")}, time.Time{}, dnsmessage.RCodeSuccess},
|
||||
false,
|
||||
},
|
||||
@@ -92,7 +101,7 @@ func Test_buildReqMsgs(t *testing.T) {
|
||||
}
|
||||
type args struct {
|
||||
domain string
|
||||
option IPOption
|
||||
option dns_feature.IPOption
|
||||
reqOpts *dnsmessage.Resource
|
||||
}
|
||||
tests := []struct {
|
||||
@@ -100,10 +109,26 @@ func Test_buildReqMsgs(t *testing.T) {
|
||||
args args
|
||||
want int
|
||||
}{
|
||||
{"dual stack", args{"test.com", IPOption{true, true}, nil}, 2},
|
||||
{"ipv4 only", args{"test.com", IPOption{true, false}, nil}, 1},
|
||||
{"ipv6 only", args{"test.com", IPOption{false, true}, nil}, 1},
|
||||
{"none/error", args{"test.com", IPOption{false, false}, nil}, 0},
|
||||
{"dual stack", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}, nil}, 2},
|
||||
{"ipv4 only", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
}, nil}, 1},
|
||||
{"ipv6 only", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}, nil}, 1},
|
||||
{"none/error", args{"test.com", dns_feature.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: false,
|
||||
FakeEnable: false,
|
||||
}, nil}, 0},
|
||||
}
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
|
||||
9
app/dns/fakedns/errors.generated.go
Normal file
9
app/dns/fakedns/errors.generated.go
Normal file
@@ -0,0 +1,9 @@
|
||||
package fakedns
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errPathObjHolder struct{}
|
||||
|
||||
func newError(values ...interface{}) *errors.Error {
|
||||
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||
}
|
||||
250
app/dns/fakedns/fake.go
Normal file
250
app/dns/fakedns/fake.go
Normal file
@@ -0,0 +1,250 @@
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"math"
|
||||
"math/big"
|
||||
gonet "net"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/cache"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
type Holder struct {
|
||||
domainToIP cache.Lru
|
||||
ipRange *gonet.IPNet
|
||||
mu *sync.Mutex
|
||||
|
||||
config *FakeDnsPool
|
||||
}
|
||||
|
||||
func (fkdns *Holder) IsIPInIPPool(ip net.Address) bool {
|
||||
if ip.Family().IsDomain() {
|
||||
return false
|
||||
}
|
||||
return fkdns.ipRange.Contains(ip.IP())
|
||||
}
|
||||
|
||||
func (fkdns *Holder) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
|
||||
isIPv6 := fkdns.ipRange.IP.To4() == nil
|
||||
if (isIPv6 && ipv6) || (!isIPv6 && ipv4) {
|
||||
return fkdns.GetFakeIPForDomain(domain)
|
||||
}
|
||||
return []net.Address{}
|
||||
}
|
||||
|
||||
func (*Holder) Type() interface{} {
|
||||
return (*dns.FakeDNSEngine)(nil)
|
||||
}
|
||||
|
||||
func (fkdns *Holder) Start() error {
|
||||
if fkdns.config != nil && fkdns.config.IpPool != "" && fkdns.config.LruSize != 0 {
|
||||
return fkdns.initializeFromConfig()
|
||||
}
|
||||
return newError("invalid fakeDNS setting")
|
||||
}
|
||||
|
||||
func (fkdns *Holder) Close() error {
|
||||
fkdns.domainToIP = nil
|
||||
fkdns.ipRange = nil
|
||||
fkdns.mu = nil
|
||||
return nil
|
||||
}
|
||||
|
||||
func NewFakeDNSHolder() (*Holder, error) {
|
||||
var fkdns *Holder
|
||||
var err error
|
||||
|
||||
if fkdns, err = NewFakeDNSHolderConfigOnly(nil); err != nil {
|
||||
return nil, newError("Unable to create Fake Dns Engine").Base(err).AtError()
|
||||
}
|
||||
err = fkdns.initialize(dns.FakeIPv4Pool, 65535)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return fkdns, nil
|
||||
}
|
||||
|
||||
func NewFakeDNSHolderConfigOnly(conf *FakeDnsPool) (*Holder, error) {
|
||||
return &Holder{nil, nil, nil, conf}, nil
|
||||
}
|
||||
|
||||
func (fkdns *Holder) initializeFromConfig() error {
|
||||
return fkdns.initialize(fkdns.config.IpPool, int(fkdns.config.LruSize))
|
||||
}
|
||||
|
||||
func (fkdns *Holder) initialize(ipPoolCidr string, lruSize int) error {
|
||||
var ipRange *gonet.IPNet
|
||||
var err error
|
||||
|
||||
if _, ipRange, err = gonet.ParseCIDR(ipPoolCidr); err != nil {
|
||||
return newError("Unable to parse CIDR for Fake DNS IP assignment").Base(err).AtError()
|
||||
}
|
||||
|
||||
ones, bits := ipRange.Mask.Size()
|
||||
rooms := bits - ones
|
||||
if math.Log2(float64(lruSize)) >= float64(rooms) {
|
||||
return newError("LRU size is bigger than subnet size").AtError()
|
||||
}
|
||||
fkdns.domainToIP = cache.NewLru(lruSize)
|
||||
fkdns.ipRange = ipRange
|
||||
fkdns.mu = new(sync.Mutex)
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetFakeIPForDomain checks and generates a fake IP for a domain name
|
||||
func (fkdns *Holder) GetFakeIPForDomain(domain string) []net.Address {
|
||||
fkdns.mu.Lock()
|
||||
defer fkdns.mu.Unlock()
|
||||
if v, ok := fkdns.domainToIP.Get(domain); ok {
|
||||
return []net.Address{v.(net.Address)}
|
||||
}
|
||||
currentTimeMillis := uint64(time.Now().UnixNano() / 1e6)
|
||||
ones, bits := fkdns.ipRange.Mask.Size()
|
||||
rooms := bits - ones
|
||||
if rooms < 64 {
|
||||
currentTimeMillis %= (uint64(1) << rooms)
|
||||
}
|
||||
bigIntIP := big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||
bigIntIP = bigIntIP.Add(bigIntIP, new(big.Int).SetUint64(currentTimeMillis))
|
||||
var ip net.Address
|
||||
for {
|
||||
ip = net.IPAddress(bigIntIP.Bytes())
|
||||
|
||||
// if we run for a long time, we may go back to beginning and start seeing the IP in use
|
||||
if _, ok := fkdns.domainToIP.PeekKeyFromValue(ip); !ok {
|
||||
break
|
||||
}
|
||||
|
||||
bigIntIP = bigIntIP.Add(bigIntIP, big.NewInt(1))
|
||||
if !fkdns.ipRange.Contains(bigIntIP.Bytes()) {
|
||||
bigIntIP = big.NewInt(0).SetBytes(fkdns.ipRange.IP)
|
||||
}
|
||||
}
|
||||
fkdns.domainToIP.Put(domain, ip)
|
||||
return []net.Address{ip}
|
||||
}
|
||||
|
||||
// GetDomainFromFakeDNS checks if an IP is a fake IP and have corresponding domain name
|
||||
func (fkdns *Holder) GetDomainFromFakeDNS(ip net.Address) string {
|
||||
if !ip.Family().IsIP() || !fkdns.ipRange.Contains(ip.IP()) {
|
||||
return ""
|
||||
}
|
||||
if k, ok := fkdns.domainToIP.GetKeyFromValue(ip); ok {
|
||||
return k.(string)
|
||||
}
|
||||
newError("A fake ip request to ", ip, ", however there is no matching domain name in fake DNS").AtInfo().WriteToLog()
|
||||
return ""
|
||||
}
|
||||
|
||||
type HolderMulti struct {
|
||||
holders []*Holder
|
||||
|
||||
config *FakeDnsPoolMulti
|
||||
}
|
||||
|
||||
func (h *HolderMulti) IsIPInIPPool(ip net.Address) bool {
|
||||
if ip.Family().IsDomain() {
|
||||
return false
|
||||
}
|
||||
for _, v := range h.holders {
|
||||
if v.IsIPInIPPool(ip) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (h *HolderMulti) GetFakeIPForDomain3(domain string, ipv4, ipv6 bool) []net.Address {
|
||||
var ret []net.Address
|
||||
for _, v := range h.holders {
|
||||
ret = append(ret, v.GetFakeIPForDomain3(domain, ipv4, ipv6)...)
|
||||
}
|
||||
return ret
|
||||
}
|
||||
|
||||
func (h *HolderMulti) GetFakeIPForDomain(domain string) []net.Address {
|
||||
var ret []net.Address
|
||||
for _, v := range h.holders {
|
||||
ret = append(ret, v.GetFakeIPForDomain(domain)...)
|
||||
}
|
||||
return ret
|
||||
}
|
||||
|
||||
func (h *HolderMulti) GetDomainFromFakeDNS(ip net.Address) string {
|
||||
for _, v := range h.holders {
|
||||
if domain := v.GetDomainFromFakeDNS(ip); domain != "" {
|
||||
return domain
|
||||
}
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (h *HolderMulti) Type() interface{} {
|
||||
return (*dns.FakeDNSEngine)(nil)
|
||||
}
|
||||
|
||||
func (h *HolderMulti) Start() error {
|
||||
for _, v := range h.holders {
|
||||
if v.config != nil && v.config.IpPool != "" && v.config.LruSize != 0 {
|
||||
if err := v.Start(); err != nil {
|
||||
return newError("Cannot start all fake dns pools").Base(err)
|
||||
}
|
||||
} else {
|
||||
return newError("invalid fakeDNS setting")
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (h *HolderMulti) Close() error {
|
||||
for _, v := range h.holders {
|
||||
if err := v.Close(); err != nil {
|
||||
return newError("Cannot close all fake dns pools").Base(err)
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (h *HolderMulti) createHolderGroups() error {
|
||||
for _, v := range h.config.Pools {
|
||||
holder, err := NewFakeDNSHolderConfigOnly(v)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
h.holders = append(h.holders, holder)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func NewFakeDNSHolderMulti(conf *FakeDnsPoolMulti) (*HolderMulti, error) {
|
||||
holderMulti := &HolderMulti{nil, conf}
|
||||
if err := holderMulti.createHolderGroups(); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return holderMulti, nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*FakeDnsPool)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
var f *Holder
|
||||
var err error
|
||||
if f, err = NewFakeDNSHolderConfigOnly(config.(*FakeDnsPool)); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}))
|
||||
|
||||
common.Must(common.RegisterConfig((*FakeDnsPoolMulti)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
var f *HolderMulti
|
||||
var err error
|
||||
if f, err = NewFakeDNSHolderMulti(config.(*FakeDnsPoolMulti)); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return f, nil
|
||||
}))
|
||||
}
|
||||
3
app/dns/fakedns/fakedns.go
Normal file
3
app/dns/fakedns/fakedns.go
Normal file
@@ -0,0 +1,3 @@
|
||||
package fakedns
|
||||
|
||||
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
||||
224
app/dns/fakedns/fakedns.pb.go
Normal file
224
app/dns/fakedns/fakedns.pb.go
Normal file
@@ -0,0 +1,224 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/dns/fakedns/fakedns.proto
|
||||
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
const (
|
||||
// Verify that this generated code is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
type FakeDnsPool struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
IpPool string `protobuf:"bytes,1,opt,name=ip_pool,json=ipPool,proto3" json:"ip_pool,omitempty"` //CIDR of IP pool used as fake DNS IP
|
||||
LruSize int64 `protobuf:"varint,2,opt,name=lruSize,proto3" json:"lruSize,omitempty"` //Size of Pool for remembering relationship between domain name and IP address
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) Reset() {
|
||||
*x = FakeDnsPool{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*FakeDnsPool) ProtoMessage() {}
|
||||
|
||||
func (x *FakeDnsPool) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[0]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use FakeDnsPool.ProtoReflect.Descriptor instead.
|
||||
func (*FakeDnsPool) Descriptor() ([]byte, []int) {
|
||||
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) GetIpPool() string {
|
||||
if x != nil {
|
||||
return x.IpPool
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *FakeDnsPool) GetLruSize() int64 {
|
||||
if x != nil {
|
||||
return x.LruSize
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
type FakeDnsPoolMulti struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
Pools []*FakeDnsPool `protobuf:"bytes,1,rep,name=pools,proto3" json:"pools,omitempty"`
|
||||
}
|
||||
|
||||
func (x *FakeDnsPoolMulti) Reset() {
|
||||
*x = FakeDnsPoolMulti{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPoolMulti) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*FakeDnsPoolMulti) ProtoMessage() {}
|
||||
|
||||
func (x *FakeDnsPoolMulti) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_dns_fakedns_fakedns_proto_msgTypes[1]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use FakeDnsPoolMulti.ProtoReflect.Descriptor instead.
|
||||
func (*FakeDnsPoolMulti) Descriptor() ([]byte, []int) {
|
||||
return file_app_dns_fakedns_fakedns_proto_rawDescGZIP(), []int{1}
|
||||
}
|
||||
|
||||
func (x *FakeDnsPoolMulti) GetPools() []*FakeDnsPool {
|
||||
if x != nil {
|
||||
return x.Pools
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
var File_app_dns_fakedns_fakedns_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_dns_fakedns_fakedns_proto_rawDesc = []byte{
|
||||
0x0a, 0x1d, 0x61, 0x70, 0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
|
||||
0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12,
|
||||
0x14, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61,
|
||||
0x6b, 0x65, 0x64, 0x6e, 0x73, 0x22, 0x40, 0x0a, 0x0b, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73,
|
||||
0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x17, 0x0a, 0x07, 0x69, 0x70, 0x5f, 0x70, 0x6f, 0x6f, 0x6c, 0x18,
|
||||
0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x69, 0x70, 0x50, 0x6f, 0x6f, 0x6c, 0x12, 0x18, 0x0a,
|
||||
0x07, 0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07,
|
||||
0x6c, 0x72, 0x75, 0x53, 0x69, 0x7a, 0x65, 0x22, 0x4b, 0x0a, 0x10, 0x46, 0x61, 0x6b, 0x65, 0x44,
|
||||
0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x12, 0x37, 0x0a, 0x05, 0x70,
|
||||
0x6f, 0x6f, 0x6c, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e,
|
||||
0x73, 0x2e, 0x46, 0x61, 0x6b, 0x65, 0x44, 0x6e, 0x73, 0x50, 0x6f, 0x6f, 0x6c, 0x52, 0x05, 0x70,
|
||||
0x6f, 0x6f, 0x6c, 0x73, 0x42, 0x5e, 0x0a, 0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x64, 0x6e, 0x73, 0x2e, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73,
|
||||
0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
|
||||
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
|
||||
0x70, 0x2f, 0x64, 0x6e, 0x73, 0x2f, 0x66, 0x61, 0x6b, 0x65, 0x64, 0x6e, 0x73, 0xaa, 0x02, 0x14,
|
||||
0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x44, 0x6e, 0x73, 0x2e, 0x46, 0x61, 0x6b,
|
||||
0x65, 0x64, 0x6e, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescOnce sync.Once
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescData = file_app_dns_fakedns_fakedns_proto_rawDesc
|
||||
)
|
||||
|
||||
func file_app_dns_fakedns_fakedns_proto_rawDescGZIP() []byte {
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescOnce.Do(func() {
|
||||
file_app_dns_fakedns_fakedns_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_dns_fakedns_fakedns_proto_rawDescData)
|
||||
})
|
||||
return file_app_dns_fakedns_fakedns_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_dns_fakedns_fakedns_proto_msgTypes = make([]protoimpl.MessageInfo, 2)
|
||||
var file_app_dns_fakedns_fakedns_proto_goTypes = []interface{}{
|
||||
(*FakeDnsPool)(nil), // 0: xray.app.dns.fakedns.FakeDnsPool
|
||||
(*FakeDnsPoolMulti)(nil), // 1: xray.app.dns.fakedns.FakeDnsPoolMulti
|
||||
}
|
||||
var file_app_dns_fakedns_fakedns_proto_depIdxs = []int32{
|
||||
0, // 0: xray.app.dns.fakedns.FakeDnsPoolMulti.pools:type_name -> xray.app.dns.fakedns.FakeDnsPool
|
||||
1, // [1:1] is the sub-list for method output_type
|
||||
1, // [1:1] is the sub-list for method input_type
|
||||
1, // [1:1] is the sub-list for extension type_name
|
||||
1, // [1:1] is the sub-list for extension extendee
|
||||
0, // [0:1] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_dns_fakedns_fakedns_proto_init() }
|
||||
func file_app_dns_fakedns_fakedns_proto_init() {
|
||||
if File_app_dns_fakedns_fakedns_proto != nil {
|
||||
return
|
||||
}
|
||||
if !protoimpl.UnsafeEnabled {
|
||||
file_app_dns_fakedns_fakedns_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*FakeDnsPool); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_dns_fakedns_fakedns_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*FakeDnsPoolMulti); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
}
|
||||
type x struct{}
|
||||
out := protoimpl.TypeBuilder{
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_dns_fakedns_fakedns_proto_rawDesc,
|
||||
NumEnums: 0,
|
||||
NumMessages: 2,
|
||||
NumExtensions: 0,
|
||||
NumServices: 0,
|
||||
},
|
||||
GoTypes: file_app_dns_fakedns_fakedns_proto_goTypes,
|
||||
DependencyIndexes: file_app_dns_fakedns_fakedns_proto_depIdxs,
|
||||
MessageInfos: file_app_dns_fakedns_fakedns_proto_msgTypes,
|
||||
}.Build()
|
||||
File_app_dns_fakedns_fakedns_proto = out.File
|
||||
file_app_dns_fakedns_fakedns_proto_rawDesc = nil
|
||||
file_app_dns_fakedns_fakedns_proto_goTypes = nil
|
||||
file_app_dns_fakedns_fakedns_proto_depIdxs = nil
|
||||
}
|
||||
16
app/dns/fakedns/fakedns.proto
Normal file
16
app/dns/fakedns/fakedns.proto
Normal file
@@ -0,0 +1,16 @@
|
||||
syntax = "proto3";
|
||||
|
||||
package xray.app.dns.fakedns;
|
||||
option csharp_namespace = "Xray.App.Dns.Fakedns";
|
||||
option go_package = "github.com/xtls/xray-core/app/dns/fakedns";
|
||||
option java_package = "com.xray.app.dns.fakedns";
|
||||
option java_multiple_files = true;
|
||||
|
||||
message FakeDnsPool{
|
||||
string ip_pool = 1; //CIDR of IP pool used as fake DNS IP
|
||||
int64 lruSize = 2; //Size of Pool for remembering relationship between domain name and IP address
|
||||
}
|
||||
|
||||
message FakeDnsPoolMulti{
|
||||
repeated FakeDnsPool pools = 1;
|
||||
}
|
||||
206
app/dns/fakedns/fakedns_test.go
Normal file
206
app/dns/fakedns/fakedns_test.go
Normal file
@@ -0,0 +1,206 @@
|
||||
package fakedns
|
||||
|
||||
import (
|
||||
gonet "net"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/uuid"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"golang.org/x/sync/errgroup"
|
||||
)
|
||||
|
||||
var ipPrefix = "198.1"
|
||||
|
||||
func TestNewFakeDnsHolder(_ *testing.T) {
|
||||
_, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMapping(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingMany(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, ipPrefix, addr[0].IP().String()[0:len(ipPrefix)])
|
||||
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
assert.Equal(t, ipPrefix, addr2[0].IP().String()[0:len(ipPrefix)])
|
||||
assert.NotEqual(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingManyAndResolve(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||
assert.Equal(t, "fakednstest.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||
assert.Equal(t, "fakednstest2.example.com", result)
|
||||
}
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingManySingleDomain(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Equal(t, addr[0].IP().String(), addr2[0].IP().String())
|
||||
}
|
||||
|
||||
func TestGetFakeIPForDomainConcurrently(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolder()
|
||||
common.Must(err)
|
||||
|
||||
total := 200
|
||||
addr := make([][]net.Address, total)
|
||||
var errg errgroup.Group
|
||||
for i := 0; i < total; i++ {
|
||||
errg.Go(testGetFakeIP(i, addr, fkdns))
|
||||
}
|
||||
errg.Wait()
|
||||
for i := 0; i < total; i++ {
|
||||
for j := i + 1; j < total; j++ {
|
||||
assert.NotEqual(t, addr[i][0].IP().String(), addr[j][0].IP().String())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func testGetFakeIP(index int, addr [][]net.Address, fkdns *Holder) func() error {
|
||||
return func() error {
|
||||
addr[index] = fkdns.GetFakeIPForDomain("fakednstest" + strconv.Itoa(index) + ".example.com")
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
func TestFakeDnsHolderCreateMappingAndRollOver(t *testing.T) {
|
||||
fkdns, err := NewFakeDNSHolderConfigOnly(&FakeDnsPool{
|
||||
IpPool: dns.FakeIPv4Pool,
|
||||
LruSize: 256,
|
||||
})
|
||||
common.Must(err)
|
||||
|
||||
err = fkdns.Start()
|
||||
|
||||
common.Must(err)
|
||||
|
||||
addr := fkdns.GetFakeIPForDomain("fakednstest.example.com")
|
||||
addr2 := fkdns.GetFakeIPForDomain("fakednstest2.example.com")
|
||||
|
||||
for i := 0; i <= 8192; i++ {
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr[0])
|
||||
assert.Equal(t, "fakednstest.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
result := fkdns.GetDomainFromFakeDNS(addr2[0])
|
||||
assert.Equal(t, "fakednstest2.example.com", result)
|
||||
}
|
||||
|
||||
{
|
||||
uuid := uuid.New()
|
||||
domain := uuid.String() + ".fakednstest.example.com"
|
||||
tempAddr := fkdns.GetFakeIPForDomain(domain)
|
||||
rsaddr := tempAddr[0].IP().String()
|
||||
|
||||
result := fkdns.GetDomainFromFakeDNS(net.ParseAddress(rsaddr))
|
||||
assert.Equal(t, domain, result)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestFakeDNSMulti(t *testing.T) {
|
||||
fakeMulti, err := NewFakeDNSHolderMulti(&FakeDnsPoolMulti{
|
||||
Pools: []*FakeDnsPool{{
|
||||
IpPool: "240.0.0.0/12",
|
||||
LruSize: 256,
|
||||
}, {
|
||||
IpPool: "fddd:c5b4:ff5f:f4f0::/64",
|
||||
LruSize: 256,
|
||||
}},
|
||||
},
|
||||
)
|
||||
common.Must(err)
|
||||
|
||||
err = fakeMulti.Start()
|
||||
|
||||
common.Must(err)
|
||||
|
||||
assert.Nil(t, err, "Should not throw error")
|
||||
_ = fakeMulti
|
||||
|
||||
t.Run("checkInRange", func(t *testing.T) {
|
||||
t.Run("ipv4", func(t *testing.T) {
|
||||
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{240, 0, 0, 5}))
|
||||
assert.True(t, inPool)
|
||||
})
|
||||
t.Run("ipv6", func(t *testing.T) {
|
||||
ip, err := gonet.ResolveIPAddr("ip", "fddd:c5b4:ff5f:f4f0::5")
|
||||
assert.Nil(t, err)
|
||||
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
|
||||
assert.True(t, inPool)
|
||||
})
|
||||
t.Run("ipv4_inverse", func(t *testing.T) {
|
||||
inPool := fakeMulti.IsIPInIPPool(net.IPAddress([]byte{241, 0, 0, 5}))
|
||||
assert.False(t, inPool)
|
||||
})
|
||||
t.Run("ipv6_inverse", func(t *testing.T) {
|
||||
ip, err := gonet.ResolveIPAddr("ip", "fcdd:c5b4:ff5f:f4f0::5")
|
||||
assert.Nil(t, err)
|
||||
inPool := fakeMulti.IsIPInIPPool(net.IPAddress(ip.IP))
|
||||
assert.False(t, inPool)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("allocateTwoAddressForTwoPool", func(t *testing.T) {
|
||||
address := fakeMulti.GetFakeIPForDomain("fakednstest.example.com")
|
||||
assert.Len(t, address, 2, "should be 2 address one for each pool")
|
||||
t.Run("eachOfThemShouldResolve:0", func(t *testing.T) {
|
||||
domain := fakeMulti.GetDomainFromFakeDNS(address[0])
|
||||
assert.Equal(t, "fakednstest.example.com", domain)
|
||||
})
|
||||
t.Run("eachOfThemShouldResolve:1", func(t *testing.T) {
|
||||
domain := fakeMulti.GetDomainFromFakeDNS(address[1])
|
||||
assert.Equal(t, "fakednstest.example.com", domain)
|
||||
})
|
||||
})
|
||||
|
||||
t.Run("understandIPTypeSelector", func(t *testing.T) {
|
||||
t.Run("ipv4", func(t *testing.T) {
|
||||
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv4.example.com", true, false)
|
||||
assert.Len(t, address, 1, "should be 1 address")
|
||||
assert.True(t, address[0].Family().IsIPv4())
|
||||
})
|
||||
t.Run("ipv6", func(t *testing.T) {
|
||||
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv6.example.com", false, true)
|
||||
assert.Len(t, address, 1, "should be 1 address")
|
||||
assert.True(t, address[0].Family().IsIPv6())
|
||||
})
|
||||
t.Run("ipv46", func(t *testing.T) {
|
||||
address := fakeMulti.GetFakeIPForDomain3("fakednstestipv46.example.com", true, true)
|
||||
assert.Len(t, address, 2, "should be 2 address")
|
||||
assert.True(t, address[0].Family().IsIPv4())
|
||||
assert.True(t, address[1].Family().IsIPv6())
|
||||
})
|
||||
})
|
||||
}
|
||||
@@ -5,6 +5,7 @@ import (
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/features"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
// StaticHosts represents static domain-ip mapping in DNS server.
|
||||
@@ -13,25 +14,6 @@ type StaticHosts struct {
|
||||
matchers *strmatcher.MatcherGroup
|
||||
}
|
||||
|
||||
var typeMap = map[DomainMatchingType]strmatcher.Type{
|
||||
DomainMatchingType_Full: strmatcher.Full,
|
||||
DomainMatchingType_Subdomain: strmatcher.Domain,
|
||||
DomainMatchingType_Keyword: strmatcher.Substr,
|
||||
DomainMatchingType_Regex: strmatcher.Regex,
|
||||
}
|
||||
|
||||
func toStrMatcher(t DomainMatchingType, domain string) (strmatcher.Matcher, error) {
|
||||
strMType, f := typeMap[t]
|
||||
if !f {
|
||||
return nil, newError("unknown mapping type", t).AtWarning()
|
||||
}
|
||||
matcher, err := strMType.New(domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create str matcher").Base(err)
|
||||
}
|
||||
return matcher, nil
|
||||
}
|
||||
|
||||
// NewStaticHosts creates a new StaticHosts instance.
|
||||
func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDomain) (*StaticHosts, error) {
|
||||
g := new(strmatcher.MatcherGroup)
|
||||
@@ -65,6 +47,8 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
|
||||
id := g.Add(matcher)
|
||||
ips := make([]net.Address, 0, len(mapping.Ip)+1)
|
||||
switch {
|
||||
case len(mapping.ProxiedDomain) > 0:
|
||||
ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
|
||||
case len(mapping.Ip) > 0:
|
||||
for _, ip := range mapping.Ip {
|
||||
addr := net.IPAddress(ip)
|
||||
@@ -73,50 +57,53 @@ func NewStaticHosts(hosts []*Config_HostMapping, legacy map[string]*net.IPOrDoma
|
||||
}
|
||||
ips = append(ips, addr)
|
||||
}
|
||||
|
||||
case len(mapping.ProxiedDomain) > 0:
|
||||
ips = append(ips, net.DomainAddress(mapping.ProxiedDomain))
|
||||
|
||||
default:
|
||||
return nil, newError("neither IP address nor proxied domain specified for domain: ", mapping.Domain).AtWarning()
|
||||
}
|
||||
|
||||
// Special handling for localhost IPv6. This is a dirty workaround as JSON config supports only single IP mapping.
|
||||
if len(ips) == 1 && ips[0] == net.LocalHostIP {
|
||||
ips = append(ips, net.LocalHostIPv6)
|
||||
}
|
||||
|
||||
sh.ips[id] = ips
|
||||
}
|
||||
|
||||
return sh, nil
|
||||
}
|
||||
|
||||
func filterIP(ips []net.Address, option IPOption) []net.Address {
|
||||
func filterIP(ips []net.Address, option dns.IPOption) []net.Address {
|
||||
filtered := make([]net.Address, 0, len(ips))
|
||||
for _, ip := range ips {
|
||||
if (ip.Family().IsIPv4() && option.IPv4Enable) || (ip.Family().IsIPv6() && option.IPv6Enable) {
|
||||
filtered = append(filtered, ip)
|
||||
}
|
||||
}
|
||||
if len(filtered) == 0 {
|
||||
return nil
|
||||
}
|
||||
return filtered
|
||||
}
|
||||
|
||||
// LookupIP returns IP address for the given domain, if exists in this StaticHosts.
|
||||
func (h *StaticHosts) LookupIP(domain string, option IPOption) []net.Address {
|
||||
indices := h.matchers.Match(domain)
|
||||
if len(indices) == 0 {
|
||||
return nil
|
||||
}
|
||||
ips := []net.Address{}
|
||||
for _, id := range indices {
|
||||
func (h *StaticHosts) lookupInternal(domain string) []net.Address {
|
||||
var ips []net.Address
|
||||
for _, id := range h.matchers.Match(domain) {
|
||||
ips = append(ips, h.ips[id]...)
|
||||
}
|
||||
if len(ips) == 1 && ips[0].Family().IsDomain() {
|
||||
return ips
|
||||
}
|
||||
return filterIP(ips, option)
|
||||
return ips
|
||||
}
|
||||
|
||||
func (h *StaticHosts) lookup(domain string, option dns.IPOption, maxDepth int) []net.Address {
|
||||
switch addrs := h.lookupInternal(domain); {
|
||||
case len(addrs) == 0: // Not recorded in static hosts, return nil
|
||||
return nil
|
||||
case len(addrs) == 1 && addrs[0].Family().IsDomain(): // Try to unwrap domain
|
||||
newError("found replaced domain: ", domain, " -> ", addrs[0].Domain(), ". Try to unwrap it").AtDebug().WriteToLog()
|
||||
if maxDepth > 0 {
|
||||
unwrapped := h.lookup(addrs[0].Domain(), option, maxDepth-1)
|
||||
if unwrapped != nil {
|
||||
return unwrapped
|
||||
}
|
||||
}
|
||||
return addrs
|
||||
default: // IP record found, return a non-nil IP array
|
||||
return filterIP(addrs, option)
|
||||
}
|
||||
}
|
||||
|
||||
// Lookup returns IP addresses or proxied domain for the given domain, if exists in this StaticHosts.
|
||||
func (h *StaticHosts) Lookup(domain string, option dns.IPOption) []net.Address {
|
||||
return h.lookup(domain, option, 5)
|
||||
}
|
||||
|
||||
@@ -4,10 +4,10 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestStaticHosts(t *testing.T) {
|
||||
@@ -19,6 +19,20 @@ func TestStaticHosts(t *testing.T) {
|
||||
{1, 1, 1, 1},
|
||||
},
|
||||
},
|
||||
{
|
||||
Type: DomainMatchingType_Full,
|
||||
Domain: "proxy.xray.com",
|
||||
Ip: [][]byte{
|
||||
{1, 2, 3, 4},
|
||||
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
|
||||
},
|
||||
ProxiedDomain: "another-proxy.xray.com",
|
||||
},
|
||||
{
|
||||
Type: DomainMatchingType_Full,
|
||||
Domain: "proxy2.xray.com",
|
||||
ProxiedDomain: "proxy.xray.com",
|
||||
},
|
||||
{
|
||||
Type: DomainMatchingType_Subdomain,
|
||||
Domain: "example.cn",
|
||||
@@ -31,6 +45,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
Domain: "baidu.com",
|
||||
Ip: [][]byte{
|
||||
{127, 0, 0, 1},
|
||||
{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1},
|
||||
},
|
||||
},
|
||||
}
|
||||
@@ -39,7 +54,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
common.Must(err)
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("example.com", IPOption{
|
||||
ips := hosts.Lookup("example.com", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
@@ -52,7 +67,33 @@ func TestStaticHosts(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("www.example.cn", IPOption{
|
||||
domain := hosts.Lookup("proxy.xray.com", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
})
|
||||
if len(domain) != 1 {
|
||||
t.Error("expect 1 domain, but got ", len(domain))
|
||||
}
|
||||
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
|
||||
t.Error(diff)
|
||||
}
|
||||
}
|
||||
|
||||
{
|
||||
domain := hosts.Lookup("proxy2.xray.com", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
})
|
||||
if len(domain) != 1 {
|
||||
t.Error("expect 1 domain, but got ", len(domain))
|
||||
}
|
||||
if diff := cmp.Diff(domain[0].Domain(), "another-proxy.xray.com"); diff != "" {
|
||||
t.Error(diff)
|
||||
}
|
||||
}
|
||||
|
||||
{
|
||||
ips := hosts.Lookup("www.example.cn", dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
@@ -65,7 +106,7 @@ func TestStaticHosts(t *testing.T) {
|
||||
}
|
||||
|
||||
{
|
||||
ips := hosts.LookupIP("baidu.com", IPOption{
|
||||
ips := hosts.Lookup("baidu.com", dns.IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
|
||||
@@ -2,53 +2,219 @@ package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/url"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns/localdns"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
)
|
||||
|
||||
// IPOption is an object for IP query options.
|
||||
type IPOption struct {
|
||||
IPv4Enable bool
|
||||
IPv6Enable bool
|
||||
// Server is the interface for Name Server.
|
||||
type Server interface {
|
||||
// Name of the Client.
|
||||
Name() string
|
||||
// QueryIP sends IP queries to its configured server.
|
||||
QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns.IPOption, disableCache bool) ([]net.IP, error)
|
||||
}
|
||||
|
||||
// Client is the interface for DNS client.
|
||||
type Client interface {
|
||||
// Name of the Client.
|
||||
Name() string
|
||||
|
||||
// QueryIP sends IP queries to its configured server.
|
||||
QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error)
|
||||
type Client struct {
|
||||
server Server
|
||||
clientIP net.IP
|
||||
skipFallback bool
|
||||
domains []string
|
||||
expectIPs []*router.GeoIPMatcher
|
||||
}
|
||||
|
||||
type LocalNameServer struct {
|
||||
client *localdns.Client
|
||||
var errExpectedIPNonMatch = errors.New("expectIPs not match")
|
||||
|
||||
// NewServer creates a name server object according to the network destination url.
|
||||
func NewServer(dest net.Destination, dispatcher routing.Dispatcher) (Server, error) {
|
||||
if address := dest.Address; address.Family().IsDomain() {
|
||||
u, err := url.Parse(address.Domain())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
switch {
|
||||
case strings.EqualFold(u.String(), "localhost"):
|
||||
return NewLocalNameServer(), nil
|
||||
case strings.EqualFold(u.Scheme, "https"): // DOH Remote mode
|
||||
return NewDoHNameServer(u, dispatcher)
|
||||
case strings.EqualFold(u.Scheme, "https+local"): // DOH Local mode
|
||||
return NewDoHLocalNameServer(u), nil
|
||||
case strings.EqualFold(u.Scheme, "quic+local"): // DNS-over-QUIC Local mode
|
||||
return NewQUICNameServer(u)
|
||||
case strings.EqualFold(u.Scheme, "tcp"): // DNS-over-TCP Remote mode
|
||||
return NewTCPNameServer(u, dispatcher)
|
||||
case strings.EqualFold(u.Scheme, "tcp+local"): // DNS-over-TCP Local mode
|
||||
return NewTCPLocalNameServer(u)
|
||||
case strings.EqualFold(u.String(), "fakedns"):
|
||||
return NewFakeDNSServer(), nil
|
||||
}
|
||||
}
|
||||
if dest.Network == net.Network_Unknown {
|
||||
dest.Network = net.Network_UDP
|
||||
}
|
||||
if dest.Network == net.Network_UDP { // UDP classic DNS mode
|
||||
return NewClassicNameServer(dest, dispatcher), nil
|
||||
}
|
||||
return nil, newError("No available name server could be created from ", dest).AtWarning()
|
||||
}
|
||||
|
||||
func (s *LocalNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
if option.IPv4Enable && option.IPv6Enable {
|
||||
return s.client.LookupIP(domain)
|
||||
// NewClient creates a DNS client managing a name server with client IP, domain rules and expected IPs.
|
||||
func NewClient(ctx context.Context, ns *NameServer, clientIP net.IP, container router.GeoIPMatcherContainer, matcherInfos *[]*DomainMatcherInfo, updateDomainRule func(strmatcher.Matcher, int, []*DomainMatcherInfo) error) (*Client, error) {
|
||||
client := &Client{}
|
||||
|
||||
err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
|
||||
// Create a new server for each client for now
|
||||
server, err := NewServer(ns.Address.AsDestination(), dispatcher)
|
||||
if err != nil {
|
||||
return newError("failed to create nameserver").Base(err).AtWarning()
|
||||
}
|
||||
|
||||
// Priotize local domains with specific TLDs or without any dot to local DNS
|
||||
if _, isLocalDNS := server.(*LocalNameServer); isLocalDNS {
|
||||
ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
|
||||
ns.OriginalRules = append(ns.OriginalRules, localTLDsAndDotlessDomainsRule)
|
||||
// The following lines is a solution to avoid core panics(rule index out of range) when setting `localhost` DNS client in config.
|
||||
// Because the `localhost` DNS client will apend len(localTLDsAndDotlessDomains) rules into matcherInfos to match `geosite:private` default rule.
|
||||
// But `matcherInfos` has no enough length to add rules, which leads to core panics (rule index out of range).
|
||||
// To avoid this, the length of `matcherInfos` must be equal to the expected, so manually append it with Golang default zero value first for later modification.
|
||||
// Related issues:
|
||||
// https://github.com/v2fly/v2ray-core/issues/529
|
||||
// https://github.com/v2fly/v2ray-core/issues/719
|
||||
for i := 0; i < len(localTLDsAndDotlessDomains); i++ {
|
||||
*matcherInfos = append(*matcherInfos, &DomainMatcherInfo{
|
||||
clientIdx: uint16(0),
|
||||
domainRuleIdx: uint16(0),
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// Establish domain rules
|
||||
var rules []string
|
||||
ruleCurr := 0
|
||||
ruleIter := 0
|
||||
for _, domain := range ns.PrioritizedDomain {
|
||||
domainRule, err := toStrMatcher(domain.Type, domain.Domain)
|
||||
if err != nil {
|
||||
return newError("failed to create prioritized domain").Base(err).AtWarning()
|
||||
}
|
||||
originalRuleIdx := ruleCurr
|
||||
if ruleCurr < len(ns.OriginalRules) {
|
||||
rule := ns.OriginalRules[ruleCurr]
|
||||
if ruleCurr >= len(rules) {
|
||||
rules = append(rules, rule.Rule)
|
||||
}
|
||||
ruleIter++
|
||||
if ruleIter >= int(rule.Size) {
|
||||
ruleIter = 0
|
||||
ruleCurr++
|
||||
}
|
||||
} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
|
||||
rules = append(rules, domainRule.String())
|
||||
ruleCurr++
|
||||
}
|
||||
err = updateDomainRule(domainRule, originalRuleIdx, *matcherInfos)
|
||||
if err != nil {
|
||||
return newError("failed to create prioritized domain").Base(err).AtWarning()
|
||||
}
|
||||
}
|
||||
|
||||
// Establish expected IPs
|
||||
var matchers []*router.GeoIPMatcher
|
||||
for _, geoip := range ns.Geoip {
|
||||
matcher, err := container.Add(geoip)
|
||||
if err != nil {
|
||||
return newError("failed to create ip matcher").Base(err).AtWarning()
|
||||
}
|
||||
matchers = append(matchers, matcher)
|
||||
}
|
||||
|
||||
if len(clientIP) > 0 {
|
||||
switch ns.Address.Address.GetAddress().(type) {
|
||||
case *net.IPOrDomain_Domain:
|
||||
newError("DNS: client ", ns.Address.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
|
||||
case *net.IPOrDomain_Ip:
|
||||
newError("DNS: client ", ns.Address.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
|
||||
}
|
||||
}
|
||||
|
||||
client.server = server
|
||||
client.clientIP = clientIP
|
||||
client.skipFallback = ns.SkipFallback
|
||||
client.domains = rules
|
||||
client.expectIPs = matchers
|
||||
return nil
|
||||
})
|
||||
return client, err
|
||||
}
|
||||
|
||||
// NewSimpleClient creates a DNS client with a simple destination.
|
||||
func NewSimpleClient(ctx context.Context, endpoint *net.Endpoint, clientIP net.IP) (*Client, error) {
|
||||
client := &Client{}
|
||||
err := core.RequireFeatures(ctx, func(dispatcher routing.Dispatcher) error {
|
||||
server, err := NewServer(endpoint.AsDestination(), dispatcher)
|
||||
if err != nil {
|
||||
return newError("failed to create nameserver").Base(err).AtWarning()
|
||||
}
|
||||
client.server = server
|
||||
client.clientIP = clientIP
|
||||
return nil
|
||||
})
|
||||
|
||||
if len(clientIP) > 0 {
|
||||
switch endpoint.Address.GetAddress().(type) {
|
||||
case *net.IPOrDomain_Domain:
|
||||
newError("DNS: client ", endpoint.Address.GetDomain(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
|
||||
case *net.IPOrDomain_Ip:
|
||||
newError("DNS: client ", endpoint.Address.GetIp(), " uses clientIP ", clientIP.String()).AtInfo().WriteToLog()
|
||||
}
|
||||
}
|
||||
|
||||
if option.IPv4Enable {
|
||||
return s.client.LookupIPv4(domain)
|
||||
}
|
||||
|
||||
if option.IPv6Enable {
|
||||
return s.client.LookupIPv6(domain)
|
||||
}
|
||||
|
||||
return nil, newError("neither IPv4 nor IPv6 is enabled")
|
||||
return client, err
|
||||
}
|
||||
|
||||
func (s *LocalNameServer) Name() string {
|
||||
return "localhost"
|
||||
// Name returns the server name the client manages.
|
||||
func (c *Client) Name() string {
|
||||
return c.server.Name()
|
||||
}
|
||||
|
||||
func NewLocalNameServer() *LocalNameServer {
|
||||
newError("DNS: created localhost client").AtInfo().WriteToLog()
|
||||
return &LocalNameServer{
|
||||
client: localdns.New(),
|
||||
// QueryIP sends DNS query to the name server with the client's IP.
|
||||
func (c *Client) QueryIP(ctx context.Context, domain string, option dns.IPOption, disableCache bool) ([]net.IP, error) {
|
||||
ctx, cancel := context.WithTimeout(ctx, 4*time.Second)
|
||||
ips, err := c.server.QueryIP(ctx, domain, c.clientIP, option, disableCache)
|
||||
cancel()
|
||||
|
||||
if err != nil {
|
||||
return ips, err
|
||||
}
|
||||
return c.MatchExpectedIPs(domain, ips)
|
||||
}
|
||||
|
||||
// MatchExpectedIPs matches queried domain IPs with expected IPs and returns matched ones.
|
||||
func (c *Client) MatchExpectedIPs(domain string, ips []net.IP) ([]net.IP, error) {
|
||||
if len(c.expectIPs) == 0 {
|
||||
return ips, nil
|
||||
}
|
||||
newIps := []net.IP{}
|
||||
for _, ip := range ips {
|
||||
for _, matcher := range c.expectIPs {
|
||||
if matcher.Match(ip) {
|
||||
newIps = append(newIps, ip)
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
if len(newIps) == 0 {
|
||||
return nil, errExpectedIPNonMatch
|
||||
}
|
||||
newError("domain ", domain, " expectIPs ", newIps, " matched at server ", c.Name()).AtDebug().WriteToLog()
|
||||
return newIps, nil
|
||||
}
|
||||
|
||||
@@ -5,7 +5,6 @@ import (
|
||||
"context"
|
||||
"fmt"
|
||||
"io"
|
||||
"io/ioutil"
|
||||
"net/http"
|
||||
"net/url"
|
||||
"sync"
|
||||
@@ -13,6 +12,7 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/net/cnc"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
@@ -31,30 +31,68 @@ import (
|
||||
type DoHNameServer struct {
|
||||
dispatcher routing.Dispatcher
|
||||
sync.RWMutex
|
||||
ips map[string]record
|
||||
ips map[string]*record
|
||||
pub *pubsub.Service
|
||||
cleanup *task.Periodic
|
||||
reqID uint32
|
||||
clientIP net.IP
|
||||
httpClient *http.Client
|
||||
dohURL string
|
||||
name string
|
||||
}
|
||||
|
||||
// NewDoHNameServer creates DOH client object for remote resolving
|
||||
func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher, clientIP net.IP) (*DoHNameServer, error) {
|
||||
// NewDoHNameServer creates DOH server object for remote resolving.
|
||||
func NewDoHNameServer(url *url.URL, dispatcher routing.Dispatcher) (*DoHNameServer, error) {
|
||||
newError("DNS: created Remote DOH client for ", url.String()).AtInfo().WriteToLog()
|
||||
s := baseDOHNameServer(url, "DOH", clientIP)
|
||||
s := baseDOHNameServer(url, "DOH")
|
||||
|
||||
s.dispatcher = dispatcher
|
||||
tr := &http.Transport{
|
||||
MaxIdleConns: 30,
|
||||
IdleConnTimeout: 90 * time.Second,
|
||||
TLSHandshakeTimeout: 30 * time.Second,
|
||||
ForceAttemptHTTP2: true,
|
||||
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
||||
dest, err := net.ParseDestination(network + ":" + addr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
link, err := s.dispatcher.Dispatch(toDnsContext(ctx, s.dohURL), dest)
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
default:
|
||||
|
||||
}
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
cc := common.ChainedClosable{}
|
||||
if cw, ok := link.Writer.(common.Closable); ok {
|
||||
cc = append(cc, cw)
|
||||
}
|
||||
if cr, ok := link.Reader.(common.Closable); ok {
|
||||
cc = append(cc, cr)
|
||||
}
|
||||
return cnc.NewConnection(
|
||||
cnc.ConnectionInputMulti(link.Writer),
|
||||
cnc.ConnectionOutputMulti(link.Reader),
|
||||
cnc.ConnectionOnClose(cc),
|
||||
), nil
|
||||
},
|
||||
}
|
||||
s.httpClient = &http.Client{
|
||||
Timeout: time.Second * 180,
|
||||
Transport: tr,
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
// NewDoHLocalNameServer creates DOH client object for local resolving
|
||||
func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
|
||||
func NewDoHLocalNameServer(url *url.URL) *DoHNameServer {
|
||||
url.Scheme = "https"
|
||||
s := baseDOHNameServer(url, "DOHL", clientIP)
|
||||
s := baseDOHNameServer(url, "DOHL")
|
||||
tr := &http.Transport{
|
||||
IdleConnTimeout: 90 * time.Second,
|
||||
ForceAttemptHTTP2: true,
|
||||
@@ -64,6 +102,12 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
|
||||
return nil, err
|
||||
}
|
||||
conn, err := internet.DialSystem(ctx, dest, nil)
|
||||
log.Record(&log.AccessMessage{
|
||||
From: "DNS",
|
||||
To: s.dohURL,
|
||||
Status: log.AccessAccepted,
|
||||
Detour: "local",
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -78,23 +122,21 @@ func NewDoHLocalNameServer(url *url.URL, clientIP net.IP) *DoHNameServer {
|
||||
return s
|
||||
}
|
||||
|
||||
func baseDOHNameServer(url *url.URL, prefix string, clientIP net.IP) *DoHNameServer {
|
||||
func baseDOHNameServer(url *url.URL, prefix string) *DoHNameServer {
|
||||
s := &DoHNameServer{
|
||||
ips: make(map[string]record),
|
||||
clientIP: clientIP,
|
||||
pub: pubsub.NewService(),
|
||||
name: prefix + "//" + url.Host,
|
||||
dohURL: url.String(),
|
||||
ips: make(map[string]*record),
|
||||
pub: pubsub.NewService(),
|
||||
name: prefix + "//" + url.Host,
|
||||
dohURL: url.String(),
|
||||
}
|
||||
s.cleanup = &task.Periodic{
|
||||
Interval: time.Minute,
|
||||
Execute: s.Cleanup,
|
||||
}
|
||||
|
||||
return s
|
||||
}
|
||||
|
||||
// Name returns client name
|
||||
// Name implements Server.
|
||||
func (s *DoHNameServer) Name() string {
|
||||
return s.name
|
||||
}
|
||||
@@ -126,7 +168,7 @@ func (s *DoHNameServer) Cleanup() error {
|
||||
}
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
s.ips = make(map[string]record)
|
||||
s.ips = make(map[string]*record)
|
||||
}
|
||||
|
||||
return nil
|
||||
@@ -136,7 +178,10 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
|
||||
elapsed := time.Since(req.start)
|
||||
|
||||
s.Lock()
|
||||
rec := s.ips[req.domain]
|
||||
rec, found := s.ips[req.domain]
|
||||
if !found {
|
||||
rec = &record{}
|
||||
}
|
||||
updated := false
|
||||
|
||||
switch req.reqType {
|
||||
@@ -146,7 +191,7 @@ func (s *DoHNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
|
||||
updated = true
|
||||
}
|
||||
case dnsmessage.TypeAAAA:
|
||||
addr := make([]net.Address, 0)
|
||||
addr := make([]net.Address, 0, len(ipRec.IP))
|
||||
for _, ip := range ipRec.IP {
|
||||
if len(ip.IP()) == net.IPv6len {
|
||||
addr = append(addr, ip)
|
||||
@@ -177,7 +222,7 @@ func (s *DoHNameServer) newReqID() uint16 {
|
||||
return uint16(atomic.AddUint32(&s.reqID, 1))
|
||||
}
|
||||
|
||||
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
||||
func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
if s.name+"." == "DOH//"+domain {
|
||||
@@ -185,7 +230,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
|
||||
return
|
||||
}
|
||||
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
|
||||
|
||||
var deadline time.Time
|
||||
if d, ok := ctx.Deadline(); ok {
|
||||
@@ -198,7 +243,7 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
|
||||
go func(r *dnsRequest) {
|
||||
// generate new context for each req, using same context
|
||||
// may cause reqs all aborted if any one encounter an error
|
||||
dnsCtx := context.Background()
|
||||
dnsCtx := ctx
|
||||
|
||||
// reserve internal dns server requested Inbound
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
@@ -206,8 +251,8 @@ func (s *DoHNameServer) sendQuery(ctx context.Context, domain string, option IPO
|
||||
}
|
||||
|
||||
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
|
||||
Protocol: "https",
|
||||
//SkipRoutePick: true,
|
||||
Protocol: "https",
|
||||
SkipDNSResolve: true,
|
||||
})
|
||||
|
||||
// forced to use mux for DOH
|
||||
@@ -249,41 +294,6 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
||||
|
||||
hc := s.httpClient
|
||||
|
||||
// Dispatched connection will be closed (interrupted) after each request
|
||||
// This makes DOH inefficient without a keep-alived connection
|
||||
// See: core/app/proxyman/outbound/handler.go:113
|
||||
// Using mux (https request wrapped in a stream layer) improves the situation.
|
||||
// Recommend to use NewDoHLocalNameServer (DOHL:) if xray instance is running on
|
||||
// a normal network eg. the server side of xray
|
||||
|
||||
if s.dispatcher != nil {
|
||||
tr := &http.Transport{
|
||||
MaxIdleConns: 30,
|
||||
IdleConnTimeout: 90 * time.Second,
|
||||
TLSHandshakeTimeout: 30 * time.Second,
|
||||
ForceAttemptHTTP2: true,
|
||||
DialContext: func(ctx context.Context, network, addr string) (net.Conn, error) {
|
||||
dest, err := net.ParseDestination(network + ":" + addr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
link, err := s.dispatcher.Dispatch(ctx, dest)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return cnc.NewConnection(
|
||||
cnc.ConnectionInputMulti(link.Writer),
|
||||
cnc.ConnectionOutputMulti(link.Reader),
|
||||
), nil
|
||||
},
|
||||
}
|
||||
hc = &http.Client{
|
||||
Timeout: time.Second * 180,
|
||||
Transport: tr,
|
||||
}
|
||||
}
|
||||
|
||||
resp, err := hc.Do(req.WithContext(ctx))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -291,14 +301,14 @@ func (s *DoHNameServer) dohHTTPSContext(ctx context.Context, b []byte) ([]byte,
|
||||
|
||||
defer resp.Body.Close()
|
||||
if resp.StatusCode != http.StatusOK {
|
||||
io.Copy(ioutil.Discard, resp.Body) // flush resp.Body so that the conn is reusable
|
||||
io.Copy(io.Discard, resp.Body) // flush resp.Body so that the conn is reusable
|
||||
return nil, fmt.Errorf("DOH server returned code %d", resp.StatusCode)
|
||||
}
|
||||
|
||||
return ioutil.ReadAll(resp.Body)
|
||||
return io.ReadAll(resp.Body)
|
||||
}
|
||||
|
||||
func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
||||
func (s *DoHNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
@@ -307,30 +317,30 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
var err4 error
|
||||
var err6 error
|
||||
var ips []net.Address
|
||||
var lastErr error
|
||||
if option.IPv6Enable && record.AAAA != nil && record.AAAA.RCode == dnsmessage.RCodeSuccess {
|
||||
aaaa, err := record.AAAA.getIPs()
|
||||
if err != nil {
|
||||
lastErr = err
|
||||
}
|
||||
ips = append(ips, aaaa...)
|
||||
var ip6 []net.Address
|
||||
|
||||
if option.IPv4Enable {
|
||||
ips, err4 = record.A.getIPs()
|
||||
}
|
||||
|
||||
if option.IPv4Enable && record.A != nil && record.A.RCode == dnsmessage.RCodeSuccess {
|
||||
a, err := record.A.getIPs()
|
||||
if err != nil {
|
||||
lastErr = err
|
||||
}
|
||||
ips = append(ips, a...)
|
||||
if option.IPv6Enable {
|
||||
ip6, err6 = record.AAAA.getIPs()
|
||||
ips = append(ips, ip6...)
|
||||
}
|
||||
|
||||
if len(ips) > 0 {
|
||||
return toNetIP(ips), nil
|
||||
return toNetIP(ips)
|
||||
}
|
||||
|
||||
if lastErr != nil {
|
||||
return nil, lastErr
|
||||
if err4 != nil {
|
||||
return nil, err4
|
||||
}
|
||||
|
||||
if err6 != nil {
|
||||
return nil, err6
|
||||
}
|
||||
|
||||
if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
|
||||
@@ -340,14 +350,19 @@ func (s *DoHNameServer) findIPsForDomain(domain string, option IPOption) ([]net.
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
// QueryIP is called from dns.Server->queryIPTimeout
|
||||
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
// QueryIP implements Server.
|
||||
func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) { // nolint: dupl
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
return ips, err
|
||||
if disableCache {
|
||||
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
|
||||
} else {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
|
||||
return ips, err
|
||||
}
|
||||
}
|
||||
|
||||
// ipv4 and ipv6 belong to different subscription groups
|
||||
@@ -376,11 +391,13 @@ func (s *DoHNameServer) QueryIP(ctx context.Context, domain string, option IPOpt
|
||||
}
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, option)
|
||||
s.sendQuery(ctx, fqdn, clientIP, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
59
app/dns/nameserver_doh_test.go
Normal file
59
app/dns/nameserver_doh_test.go
Normal file
@@ -0,0 +1,59 @@
|
||||
package dns_test
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/url"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestDOHNameServer(t *testing.T) {
|
||||
url, err := url.Parse("https+local://1.1.1.1/dns-query")
|
||||
common.Must(err)
|
||||
|
||||
s := NewDoHLocalNameServer(url)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
t.Error("expect some ips, but got 0")
|
||||
}
|
||||
}
|
||||
|
||||
func TestDOHNameServerWithCache(t *testing.T) {
|
||||
url, err := url.Parse("https+local://1.1.1.1/dns-query")
|
||||
common.Must(err)
|
||||
|
||||
s := NewDoHLocalNameServer(url)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
t.Error("expect some ips, but got 0")
|
||||
}
|
||||
|
||||
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, true)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if r := cmp.Diff(ips2, ips); r != "" {
|
||||
t.Fatal(r)
|
||||
}
|
||||
}
|
||||
49
app/dns/nameserver_fakedns.go
Normal file
49
app/dns/nameserver_fakedns.go
Normal file
@@ -0,0 +1,49 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
type FakeDNSServer struct {
|
||||
fakeDNSEngine dns.FakeDNSEngine
|
||||
}
|
||||
|
||||
func NewFakeDNSServer() *FakeDNSServer {
|
||||
return &FakeDNSServer{}
|
||||
}
|
||||
|
||||
func (FakeDNSServer) Name() string {
|
||||
return "FakeDNS"
|
||||
}
|
||||
|
||||
func (f *FakeDNSServer) QueryIP(ctx context.Context, domain string, _ net.IP, opt dns.IPOption, _ bool) ([]net.IP, error) {
|
||||
if f.fakeDNSEngine == nil {
|
||||
if err := core.RequireFeatures(ctx, func(fd dns.FakeDNSEngine) {
|
||||
f.fakeDNSEngine = fd
|
||||
}); err != nil {
|
||||
return nil, newError("Unable to locate a fake DNS Engine").Base(err).AtError()
|
||||
}
|
||||
}
|
||||
var ips []net.Address
|
||||
if fkr0, ok := f.fakeDNSEngine.(dns.FakeDNSEngineRev0); ok {
|
||||
ips = fkr0.GetFakeIPForDomain3(domain, opt.IPv4Enable, opt.IPv6Enable)
|
||||
} else {
|
||||
ips = f.fakeDNSEngine.GetFakeIPForDomain(domain)
|
||||
}
|
||||
|
||||
netIP, err := toNetIP(ips)
|
||||
if err != nil {
|
||||
return nil, newError("Unable to convert IP to net ip").Base(err).AtError()
|
||||
}
|
||||
|
||||
newError(f.Name(), " got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
|
||||
|
||||
if len(netIP) > 0 {
|
||||
return netIP, nil
|
||||
}
|
||||
return nil, dns.ErrEmptyResponse
|
||||
}
|
||||
54
app/dns/nameserver_local.go
Normal file
54
app/dns/nameserver_local.go
Normal file
@@ -0,0 +1,54 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"strings"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/dns/localdns"
|
||||
)
|
||||
|
||||
// LocalNameServer is an wrapper over local DNS feature.
|
||||
type LocalNameServer struct {
|
||||
client *localdns.Client
|
||||
}
|
||||
|
||||
const errEmptyResponse = "No address associated with hostname"
|
||||
|
||||
// QueryIP implements Server.
|
||||
func (s *LocalNameServer) QueryIP(_ context.Context, domain string, _ net.IP, option dns.IPOption, _ bool) (ips []net.IP, err error) {
|
||||
start := time.Now()
|
||||
ips, err = s.client.LookupIP(domain, option)
|
||||
|
||||
if err != nil && strings.HasSuffix(err.Error(), errEmptyResponse) {
|
||||
err = dns.ErrEmptyResponse
|
||||
}
|
||||
|
||||
if len(ips) > 0 {
|
||||
newError("Localhost got answer: ", domain, " -> ", ips).AtInfo().WriteToLog()
|
||||
log.Record(&log.DNSLog{Server: s.Name(), Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
|
||||
}
|
||||
|
||||
return
|
||||
}
|
||||
|
||||
// Name implements Server.
|
||||
func (s *LocalNameServer) Name() string {
|
||||
return "localhost"
|
||||
}
|
||||
|
||||
// NewLocalNameServer creates localdns server object for directly lookup in system DNS.
|
||||
func NewLocalNameServer() *LocalNameServer {
|
||||
newError("DNS: created localhost client").AtInfo().WriteToLog()
|
||||
return &LocalNameServer{
|
||||
client: localdns.New(),
|
||||
}
|
||||
}
|
||||
|
||||
// NewLocalDNSClient creates localdns client object for directly lookup in system DNS.
|
||||
func NewLocalDNSClient() *Client {
|
||||
return &Client{server: NewLocalNameServer()}
|
||||
}
|
||||
@@ -7,15 +7,18 @@ import (
|
||||
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestLocalNameServer(t *testing.T) {
|
||||
s := NewLocalNameServer()
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
|
||||
ips, err := s.QueryIP(ctx, "google.com", IPOption{
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP{}, dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
FakeEnable: false,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
399
app/dns/nameserver_quic.go
Normal file
399
app/dns/nameserver_quic.go
Normal file
@@ -0,0 +1,399 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/url"
|
||||
"sync"
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"github.com/lucas-clemente/quic-go"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/common/signal/pubsub"
|
||||
"github.com/xtls/xray-core/common/task"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/transport/internet/tls"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
"golang.org/x/net/http2"
|
||||
)
|
||||
|
||||
// NextProtoDQ - During connection establishment, DNS/QUIC support is indicated
|
||||
// by selecting the ALPN token "dq" in the crypto handshake.
|
||||
const NextProtoDQ = "doq-i00"
|
||||
|
||||
const handshakeTimeout = time.Second * 8
|
||||
|
||||
// QUICNameServer implemented DNS over QUIC
|
||||
type QUICNameServer struct {
|
||||
sync.RWMutex
|
||||
ips map[string]*record
|
||||
pub *pubsub.Service
|
||||
cleanup *task.Periodic
|
||||
reqID uint32
|
||||
name string
|
||||
destination *net.Destination
|
||||
connection quic.Connection
|
||||
}
|
||||
|
||||
// NewQUICNameServer creates DNS-over-QUIC client object for local resolving
|
||||
func NewQUICNameServer(url *url.URL) (*QUICNameServer, error) {
|
||||
newError("DNS: created Local DNS-over-QUIC client for ", url.String()).AtInfo().WriteToLog()
|
||||
|
||||
var err error
|
||||
port := net.Port(784)
|
||||
if url.Port() != "" {
|
||||
port, err = net.PortFromString(url.Port())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
dest := net.UDPDestination(net.ParseAddress(url.Hostname()), port)
|
||||
|
||||
s := &QUICNameServer{
|
||||
ips: make(map[string]*record),
|
||||
pub: pubsub.NewService(),
|
||||
name: url.String(),
|
||||
destination: &dest,
|
||||
}
|
||||
s.cleanup = &task.Periodic{
|
||||
Interval: time.Minute,
|
||||
Execute: s.Cleanup,
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
// Name returns client name
|
||||
func (s *QUICNameServer) Name() string {
|
||||
return s.name
|
||||
}
|
||||
|
||||
// Cleanup clears expired items from cache
|
||||
func (s *QUICNameServer) Cleanup() error {
|
||||
now := time.Now()
|
||||
s.Lock()
|
||||
defer s.Unlock()
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
return newError("nothing to do. stopping...")
|
||||
}
|
||||
|
||||
for domain, record := range s.ips {
|
||||
if record.A != nil && record.A.Expire.Before(now) {
|
||||
record.A = nil
|
||||
}
|
||||
if record.AAAA != nil && record.AAAA.Expire.Before(now) {
|
||||
record.AAAA = nil
|
||||
}
|
||||
|
||||
if record.A == nil && record.AAAA == nil {
|
||||
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
|
||||
delete(s.ips, domain)
|
||||
} else {
|
||||
s.ips[domain] = record
|
||||
}
|
||||
}
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
s.ips = make(map[string]*record)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
|
||||
elapsed := time.Since(req.start)
|
||||
|
||||
s.Lock()
|
||||
rec, found := s.ips[req.domain]
|
||||
if !found {
|
||||
rec = &record{}
|
||||
}
|
||||
updated := false
|
||||
|
||||
switch req.reqType {
|
||||
case dnsmessage.TypeA:
|
||||
if isNewer(rec.A, ipRec) {
|
||||
rec.A = ipRec
|
||||
updated = true
|
||||
}
|
||||
case dnsmessage.TypeAAAA:
|
||||
addr := make([]net.Address, 0)
|
||||
for _, ip := range ipRec.IP {
|
||||
if len(ip.IP()) == net.IPv6len {
|
||||
addr = append(addr, ip)
|
||||
}
|
||||
}
|
||||
ipRec.IP = addr
|
||||
if isNewer(rec.AAAA, ipRec) {
|
||||
rec.AAAA = ipRec
|
||||
updated = true
|
||||
}
|
||||
}
|
||||
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
|
||||
|
||||
if updated {
|
||||
s.ips[req.domain] = rec
|
||||
}
|
||||
switch req.reqType {
|
||||
case dnsmessage.TypeA:
|
||||
s.pub.Publish(req.domain+"4", nil)
|
||||
case dnsmessage.TypeAAAA:
|
||||
s.pub.Publish(req.domain+"6", nil)
|
||||
}
|
||||
s.Unlock()
|
||||
common.Must(s.cleanup.Start())
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) newReqID() uint16 {
|
||||
return uint16(atomic.AddUint32(&s.reqID, 1))
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying: ", domain).AtInfo().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
|
||||
|
||||
var deadline time.Time
|
||||
if d, ok := ctx.Deadline(); ok {
|
||||
deadline = d
|
||||
} else {
|
||||
deadline = time.Now().Add(time.Second * 5)
|
||||
}
|
||||
|
||||
for _, req := range reqs {
|
||||
go func(r *dnsRequest) {
|
||||
// generate new context for each req, using same context
|
||||
// may cause reqs all aborted if any one encounter an error
|
||||
dnsCtx := ctx
|
||||
|
||||
// reserve internal dns server requested Inbound
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
|
||||
}
|
||||
|
||||
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
|
||||
Protocol: "quic",
|
||||
SkipDNSResolve: true,
|
||||
})
|
||||
|
||||
var cancel context.CancelFunc
|
||||
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
|
||||
defer cancel()
|
||||
|
||||
b, err := dns.PackMessage(r.msg)
|
||||
if err != nil {
|
||||
newError("failed to pack dns query").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
conn, err := s.openStream(dnsCtx)
|
||||
if err != nil {
|
||||
newError("failed to open quic connection").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
_, err = conn.Write(b.Bytes())
|
||||
if err != nil {
|
||||
newError("failed to send query").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
_ = conn.Close()
|
||||
|
||||
respBuf := buf.New()
|
||||
defer respBuf.Release()
|
||||
n, err := respBuf.ReadFrom(conn)
|
||||
if err != nil && n == 0 {
|
||||
newError("failed to read response").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
rec, err := parseResponse(respBuf.Bytes())
|
||||
if err != nil {
|
||||
newError("failed to handle response").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
s.updateIP(r, rec)
|
||||
}(req)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
|
||||
if !found {
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
var err4 error
|
||||
var err6 error
|
||||
var ips []net.Address
|
||||
var ip6 []net.Address
|
||||
|
||||
if option.IPv4Enable {
|
||||
ips, err4 = record.A.getIPs()
|
||||
}
|
||||
|
||||
if option.IPv6Enable {
|
||||
ip6, err6 = record.AAAA.getIPs()
|
||||
ips = append(ips, ip6...)
|
||||
}
|
||||
|
||||
if len(ips) > 0 {
|
||||
return toNetIP(ips)
|
||||
}
|
||||
|
||||
if err4 != nil {
|
||||
return nil, err4
|
||||
}
|
||||
|
||||
if err6 != nil {
|
||||
return nil, err6
|
||||
}
|
||||
|
||||
if (option.IPv4Enable && record.A != nil) || (option.IPv6Enable && record.AAAA != nil) {
|
||||
return nil, dns_feature.ErrEmptyResponse
|
||||
}
|
||||
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
// QueryIP is called from dns.Server->queryIPTimeout
|
||||
func (s *QUICNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
if disableCache {
|
||||
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
|
||||
} else {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
|
||||
return ips, err
|
||||
}
|
||||
}
|
||||
|
||||
// ipv4 and ipv6 belong to different subscription groups
|
||||
var sub4, sub6 *pubsub.Subscriber
|
||||
if option.IPv4Enable {
|
||||
sub4 = s.pub.Subscribe(fqdn + "4")
|
||||
defer sub4.Close()
|
||||
}
|
||||
if option.IPv6Enable {
|
||||
sub6 = s.pub.Subscribe(fqdn + "6")
|
||||
defer sub6.Close()
|
||||
}
|
||||
done := make(chan interface{})
|
||||
go func() {
|
||||
if sub4 != nil {
|
||||
select {
|
||||
case <-sub4.Wait():
|
||||
case <-ctx.Done():
|
||||
}
|
||||
}
|
||||
if sub6 != nil {
|
||||
select {
|
||||
case <-sub6.Wait():
|
||||
case <-ctx.Done():
|
||||
}
|
||||
}
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, clientIP, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
case <-done:
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func isActive(s quic.Connection) bool {
|
||||
select {
|
||||
case <-s.Context().Done():
|
||||
return false
|
||||
default:
|
||||
return true
|
||||
}
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) getConnection() (quic.Connection, error) {
|
||||
var conn quic.Connection
|
||||
s.RLock()
|
||||
conn = s.connection
|
||||
if conn != nil && isActive(conn) {
|
||||
s.RUnlock()
|
||||
return conn, nil
|
||||
}
|
||||
if conn != nil {
|
||||
// we're recreating the connection, let's create a new one
|
||||
_ = conn.CloseWithError(0, "")
|
||||
}
|
||||
s.RUnlock()
|
||||
|
||||
s.Lock()
|
||||
defer s.Unlock()
|
||||
|
||||
var err error
|
||||
conn, err = s.openConnection()
|
||||
if err != nil {
|
||||
// This does not look too nice, but QUIC (or maybe quic-go)
|
||||
// doesn't seem stable enough.
|
||||
// Maybe retransmissions aren't fully implemented in quic-go?
|
||||
// Anyways, the simple solution is to make a second try when
|
||||
// it fails to open the QUIC connection.
|
||||
conn, err = s.openConnection()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
s.connection = conn
|
||||
return conn, nil
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) openConnection() (quic.Connection, error) {
|
||||
tlsConfig := tls.Config{}
|
||||
quicConfig := &quic.Config{
|
||||
HandshakeIdleTimeout: handshakeTimeout,
|
||||
}
|
||||
|
||||
conn, err := quic.DialAddrContext(context.Background(), s.destination.NetAddr(), tlsConfig.GetTLSConfig(tls.WithNextProto("http/1.1", http2.NextProtoTLS, NextProtoDQ)), quicConfig)
|
||||
log.Record(&log.AccessMessage{
|
||||
From: "DNS",
|
||||
To: s.destination,
|
||||
Status: log.AccessAccepted,
|
||||
Detour: "local",
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return conn, nil
|
||||
}
|
||||
|
||||
func (s *QUICNameServer) openStream(ctx context.Context) (quic.Stream, error) {
|
||||
conn, err := s.getConnection()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// open a new stream
|
||||
return conn.OpenStreamSync(ctx)
|
||||
}
|
||||
42
app/dns/nameserver_quic_test.go
Normal file
42
app/dns/nameserver_quic_test.go
Normal file
@@ -0,0 +1,42 @@
|
||||
package dns_test
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/url"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestQUICNameServer(t *testing.T) {
|
||||
url, err := url.Parse("quic://dns.adguard.com")
|
||||
common.Must(err)
|
||||
s, err := NewQUICNameServer(url)
|
||||
common.Must(err)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*2)
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
t.Error("expect some ips, but got 0")
|
||||
}
|
||||
|
||||
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, true)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if r := cmp.Diff(ips2, ips); r != "" {
|
||||
t.Fatal(r)
|
||||
}
|
||||
}
|
||||
365
app/dns/nameserver_tcp.go
Normal file
365
app/dns/nameserver_tcp.go
Normal file
@@ -0,0 +1,365 @@
|
||||
package dns
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"context"
|
||||
"encoding/binary"
|
||||
"net/url"
|
||||
"sync"
|
||||
"sync/atomic"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/buf"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/net/cnc"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/common/signal/pubsub"
|
||||
"github.com/xtls/xray-core/common/task"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
// TCPNameServer implemented DNS over TCP (RFC7766).
|
||||
type TCPNameServer struct {
|
||||
sync.RWMutex
|
||||
name string
|
||||
destination *net.Destination
|
||||
ips map[string]*record
|
||||
pub *pubsub.Service
|
||||
cleanup *task.Periodic
|
||||
reqID uint32
|
||||
dial func(context.Context) (net.Conn, error)
|
||||
}
|
||||
|
||||
// NewTCPNameServer creates DNS over TCP server object for remote resolving.
|
||||
func NewTCPNameServer(url *url.URL, dispatcher routing.Dispatcher) (*TCPNameServer, error) {
|
||||
s, err := baseTCPNameServer(url, "TCP")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
s.dial = func(ctx context.Context) (net.Conn, error) {
|
||||
link, err := dispatcher.Dispatch(toDnsContext(ctx, s.destination.String()), *s.destination)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return cnc.NewConnection(
|
||||
cnc.ConnectionInputMulti(link.Writer),
|
||||
cnc.ConnectionOutputMulti(link.Reader),
|
||||
), nil
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
// NewTCPLocalNameServer creates DNS over TCP client object for local resolving
|
||||
func NewTCPLocalNameServer(url *url.URL) (*TCPNameServer, error) {
|
||||
s, err := baseTCPNameServer(url, "TCPL")
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
s.dial = func(ctx context.Context) (net.Conn, error) {
|
||||
return internet.DialSystem(ctx, *s.destination, nil)
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
func baseTCPNameServer(url *url.URL, prefix string) (*TCPNameServer, error) {
|
||||
var err error
|
||||
port := net.Port(53)
|
||||
if url.Port() != "" {
|
||||
port, err = net.PortFromString(url.Port())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
dest := net.TCPDestination(net.ParseAddress(url.Hostname()), port)
|
||||
|
||||
s := &TCPNameServer{
|
||||
destination: &dest,
|
||||
ips: make(map[string]*record),
|
||||
pub: pubsub.NewService(),
|
||||
name: prefix + "//" + dest.NetAddr(),
|
||||
}
|
||||
s.cleanup = &task.Periodic{
|
||||
Interval: time.Minute,
|
||||
Execute: s.Cleanup,
|
||||
}
|
||||
|
||||
return s, nil
|
||||
}
|
||||
|
||||
// Name implements Server.
|
||||
func (s *TCPNameServer) Name() string {
|
||||
return s.name
|
||||
}
|
||||
|
||||
// Cleanup clears expired items from cache
|
||||
func (s *TCPNameServer) Cleanup() error {
|
||||
now := time.Now()
|
||||
s.Lock()
|
||||
defer s.Unlock()
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
return newError("nothing to do. stopping...")
|
||||
}
|
||||
|
||||
for domain, record := range s.ips {
|
||||
if record.A != nil && record.A.Expire.Before(now) {
|
||||
record.A = nil
|
||||
}
|
||||
if record.AAAA != nil && record.AAAA.Expire.Before(now) {
|
||||
record.AAAA = nil
|
||||
}
|
||||
|
||||
if record.A == nil && record.AAAA == nil {
|
||||
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
|
||||
delete(s.ips, domain)
|
||||
} else {
|
||||
s.ips[domain] = record
|
||||
}
|
||||
}
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
s.ips = make(map[string]*record)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *TCPNameServer) updateIP(req *dnsRequest, ipRec *IPRecord) {
|
||||
elapsed := time.Since(req.start)
|
||||
|
||||
s.Lock()
|
||||
rec, found := s.ips[req.domain]
|
||||
if !found {
|
||||
rec = &record{}
|
||||
}
|
||||
updated := false
|
||||
|
||||
switch req.reqType {
|
||||
case dnsmessage.TypeA:
|
||||
if isNewer(rec.A, ipRec) {
|
||||
rec.A = ipRec
|
||||
updated = true
|
||||
}
|
||||
case dnsmessage.TypeAAAA:
|
||||
addr := make([]net.Address, 0)
|
||||
for _, ip := range ipRec.IP {
|
||||
if len(ip.IP()) == net.IPv6len {
|
||||
addr = append(addr, ip)
|
||||
}
|
||||
}
|
||||
ipRec.IP = addr
|
||||
if isNewer(rec.AAAA, ipRec) {
|
||||
rec.AAAA = ipRec
|
||||
updated = true
|
||||
}
|
||||
}
|
||||
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
|
||||
|
||||
if updated {
|
||||
s.ips[req.domain] = rec
|
||||
}
|
||||
switch req.reqType {
|
||||
case dnsmessage.TypeA:
|
||||
s.pub.Publish(req.domain+"4", nil)
|
||||
case dnsmessage.TypeAAAA:
|
||||
s.pub.Publish(req.domain+"6", nil)
|
||||
}
|
||||
s.Unlock()
|
||||
common.Must(s.cleanup.Start())
|
||||
}
|
||||
|
||||
func (s *TCPNameServer) newReqID() uint16 {
|
||||
return uint16(atomic.AddUint32(&s.reqID, 1))
|
||||
}
|
||||
|
||||
func (s *TCPNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
|
||||
|
||||
var deadline time.Time
|
||||
if d, ok := ctx.Deadline(); ok {
|
||||
deadline = d
|
||||
} else {
|
||||
deadline = time.Now().Add(time.Second * 5)
|
||||
}
|
||||
|
||||
for _, req := range reqs {
|
||||
go func(r *dnsRequest) {
|
||||
dnsCtx := ctx
|
||||
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
dnsCtx = session.ContextWithInbound(dnsCtx, inbound)
|
||||
}
|
||||
|
||||
dnsCtx = session.ContextWithContent(dnsCtx, &session.Content{
|
||||
Protocol: "dns",
|
||||
SkipDNSResolve: true,
|
||||
})
|
||||
|
||||
var cancel context.CancelFunc
|
||||
dnsCtx, cancel = context.WithDeadline(dnsCtx, deadline)
|
||||
defer cancel()
|
||||
|
||||
b, err := dns.PackMessage(r.msg)
|
||||
if err != nil {
|
||||
newError("failed to pack dns query").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
conn, err := s.dial(dnsCtx)
|
||||
if err != nil {
|
||||
newError("failed to dial namesever").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
defer conn.Close()
|
||||
dnsReqBuf := buf.New()
|
||||
binary.Write(dnsReqBuf, binary.BigEndian, uint16(b.Len()))
|
||||
dnsReqBuf.Write(b.Bytes())
|
||||
b.Release()
|
||||
|
||||
_, err = conn.Write(dnsReqBuf.Bytes())
|
||||
if err != nil {
|
||||
newError("failed to send query").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
dnsReqBuf.Release()
|
||||
|
||||
respBuf := buf.New()
|
||||
defer respBuf.Release()
|
||||
n, err := respBuf.ReadFullFrom(conn, 2)
|
||||
if err != nil && n == 0 {
|
||||
newError("failed to read response length").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
var length int16
|
||||
err = binary.Read(bytes.NewReader(respBuf.Bytes()), binary.BigEndian, &length)
|
||||
if err != nil {
|
||||
newError("failed to parse response length").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
respBuf.Clear()
|
||||
n, err = respBuf.ReadFullFrom(conn, int32(length))
|
||||
if err != nil && n == 0 {
|
||||
newError("failed to read response length").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
rec, err := parseResponse(respBuf.Bytes())
|
||||
if err != nil {
|
||||
newError("failed to parse DNS over TCP response").Base(err).AtError().WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
s.updateIP(r, rec)
|
||||
}(req)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *TCPNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
|
||||
if !found {
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
var err4 error
|
||||
var err6 error
|
||||
var ips []net.Address
|
||||
var ip6 []net.Address
|
||||
|
||||
if option.IPv4Enable {
|
||||
ips, err4 = record.A.getIPs()
|
||||
}
|
||||
|
||||
if option.IPv6Enable {
|
||||
ip6, err6 = record.AAAA.getIPs()
|
||||
ips = append(ips, ip6...)
|
||||
}
|
||||
|
||||
if len(ips) > 0 {
|
||||
return toNetIP(ips)
|
||||
}
|
||||
|
||||
if err4 != nil {
|
||||
return nil, err4
|
||||
}
|
||||
|
||||
if err6 != nil {
|
||||
return nil, err6
|
||||
}
|
||||
|
||||
return nil, dns_feature.ErrEmptyResponse
|
||||
}
|
||||
|
||||
// QueryIP implements Server.
|
||||
func (s *TCPNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
if disableCache {
|
||||
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
|
||||
} else {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
|
||||
return ips, err
|
||||
}
|
||||
}
|
||||
|
||||
// ipv4 and ipv6 belong to different subscription groups
|
||||
var sub4, sub6 *pubsub.Subscriber
|
||||
if option.IPv4Enable {
|
||||
sub4 = s.pub.Subscribe(fqdn + "4")
|
||||
defer sub4.Close()
|
||||
}
|
||||
if option.IPv6Enable {
|
||||
sub6 = s.pub.Subscribe(fqdn + "6")
|
||||
defer sub6.Close()
|
||||
}
|
||||
done := make(chan interface{})
|
||||
go func() {
|
||||
if sub4 != nil {
|
||||
select {
|
||||
case <-sub4.Wait():
|
||||
case <-ctx.Done():
|
||||
}
|
||||
}
|
||||
if sub6 != nil {
|
||||
select {
|
||||
case <-sub6.Wait():
|
||||
case <-ctx.Done():
|
||||
}
|
||||
}
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, clientIP, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
select {
|
||||
case <-ctx.Done():
|
||||
return nil, ctx.Err()
|
||||
case <-done:
|
||||
}
|
||||
}
|
||||
}
|
||||
59
app/dns/nameserver_tcp_test.go
Normal file
59
app/dns/nameserver_tcp_test.go
Normal file
@@ -0,0 +1,59 @@
|
||||
package dns_test
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net/url"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
. "github.com/xtls/xray-core/app/dns"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
dns_feature "github.com/xtls/xray-core/features/dns"
|
||||
)
|
||||
|
||||
func TestTCPLocalNameServer(t *testing.T) {
|
||||
url, err := url.Parse("tcp+local://8.8.8.8")
|
||||
common.Must(err)
|
||||
s, err := NewTCPLocalNameServer(url)
|
||||
common.Must(err)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
t.Error("expect some ips, but got 0")
|
||||
}
|
||||
}
|
||||
|
||||
func TestTCPLocalNameServerWithCache(t *testing.T) {
|
||||
url, err := url.Parse("tcp+local://8.8.8.8")
|
||||
common.Must(err)
|
||||
s, err := NewTCPLocalNameServer(url)
|
||||
common.Must(err)
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips, err := s.QueryIP(ctx, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, false)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if len(ips) == 0 {
|
||||
t.Error("expect some ips, but got 0")
|
||||
}
|
||||
|
||||
ctx2, cancel := context.WithTimeout(context.Background(), time.Second*5)
|
||||
ips2, err := s.QueryIP(ctx2, "google.com", net.IP(nil), dns_feature.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
}, true)
|
||||
cancel()
|
||||
common.Must(err)
|
||||
if r := cmp.Diff(ips2, ips); r != "" {
|
||||
t.Fatal(r)
|
||||
}
|
||||
}
|
||||
@@ -8,6 +8,7 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/protocol/dns"
|
||||
udp_proto "github.com/xtls/xray-core/common/protocol/udp"
|
||||
@@ -20,30 +21,30 @@ import (
|
||||
"golang.org/x/net/dns/dnsmessage"
|
||||
)
|
||||
|
||||
// ClassicNameServer implemented traditional UDP DNS.
|
||||
type ClassicNameServer struct {
|
||||
sync.RWMutex
|
||||
name string
|
||||
address net.Destination
|
||||
ips map[string]record
|
||||
requests map[uint16]dnsRequest
|
||||
address *net.Destination
|
||||
ips map[string]*record
|
||||
requests map[uint16]*dnsRequest
|
||||
pub *pubsub.Service
|
||||
udpServer *udp.Dispatcher
|
||||
cleanup *task.Periodic
|
||||
reqID uint32
|
||||
clientIP net.IP
|
||||
}
|
||||
|
||||
func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher, clientIP net.IP) *ClassicNameServer {
|
||||
// NewClassicNameServer creates udp server object for remote resolving.
|
||||
func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher) *ClassicNameServer {
|
||||
// default to 53 if unspecific
|
||||
if address.Port == 0 {
|
||||
address.Port = net.Port(53)
|
||||
}
|
||||
|
||||
s := &ClassicNameServer{
|
||||
address: address,
|
||||
ips: make(map[string]record),
|
||||
requests: make(map[uint16]dnsRequest),
|
||||
clientIP: clientIP,
|
||||
address: &address,
|
||||
ips: make(map[string]*record),
|
||||
requests: make(map[uint16]*dnsRequest),
|
||||
pub: pubsub.NewService(),
|
||||
name: strings.ToUpper(address.String()),
|
||||
}
|
||||
@@ -52,14 +53,16 @@ func NewClassicNameServer(address net.Destination, dispatcher routing.Dispatcher
|
||||
Execute: s.Cleanup,
|
||||
}
|
||||
s.udpServer = udp.NewDispatcher(dispatcher, s.HandleResponse)
|
||||
newError("DNS: created udp client inited for ", address.NetAddr()).AtInfo().WriteToLog()
|
||||
newError("DNS: created UDP client initialized for ", address.NetAddr()).AtInfo().WriteToLog()
|
||||
return s
|
||||
}
|
||||
|
||||
// Name implements Server.
|
||||
func (s *ClassicNameServer) Name() string {
|
||||
return s.name
|
||||
}
|
||||
|
||||
// Cleanup clears expired items from cache
|
||||
func (s *ClassicNameServer) Cleanup() error {
|
||||
now := time.Now()
|
||||
s.Lock()
|
||||
@@ -78,6 +81,7 @@ func (s *ClassicNameServer) Cleanup() error {
|
||||
}
|
||||
|
||||
if record.A == nil && record.AAAA == nil {
|
||||
newError(s.name, " cleanup ", domain).AtDebug().WriteToLog()
|
||||
delete(s.ips, domain)
|
||||
} else {
|
||||
s.ips[domain] = record
|
||||
@@ -85,7 +89,7 @@ func (s *ClassicNameServer) Cleanup() error {
|
||||
}
|
||||
|
||||
if len(s.ips) == 0 {
|
||||
s.ips = make(map[string]record)
|
||||
s.ips = make(map[string]*record)
|
||||
}
|
||||
|
||||
for id, req := range s.requests {
|
||||
@@ -95,12 +99,13 @@ func (s *ClassicNameServer) Cleanup() error {
|
||||
}
|
||||
|
||||
if len(s.requests) == 0 {
|
||||
s.requests = make(map[uint16]dnsRequest)
|
||||
s.requests = make(map[uint16]*dnsRequest)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// HandleResponse handles udp response packet from remote DNS server.
|
||||
func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_proto.Packet) {
|
||||
ipRec, err := parseResponse(packet.Payload.Bytes())
|
||||
if err != nil {
|
||||
@@ -132,15 +137,17 @@ func (s *ClassicNameServer) HandleResponse(ctx context.Context, packet *udp_prot
|
||||
elapsed := time.Since(req.start)
|
||||
newError(s.name, " got answer: ", req.domain, " ", req.reqType, " -> ", ipRec.IP, " ", elapsed).AtInfo().WriteToLog()
|
||||
if len(req.domain) > 0 && (rec.A != nil || rec.AAAA != nil) {
|
||||
s.updateIP(req.domain, rec)
|
||||
s.updateIP(req.domain, &rec)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) updateIP(domain string, newRec record) {
|
||||
func (s *ClassicNameServer) updateIP(domain string, newRec *record) {
|
||||
s.Lock()
|
||||
|
||||
newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
|
||||
rec := s.ips[domain]
|
||||
rec, found := s.ips[domain]
|
||||
if !found {
|
||||
rec = &record{}
|
||||
}
|
||||
|
||||
updated := false
|
||||
if isNewer(rec.A, newRec.A) {
|
||||
@@ -153,6 +160,7 @@ func (s *ClassicNameServer) updateIP(domain string, newRec record) {
|
||||
}
|
||||
|
||||
if updated {
|
||||
newError(s.name, " updating IP records for domain:", domain).AtDebug().WriteToLog()
|
||||
s.ips[domain] = rec
|
||||
}
|
||||
if newRec.A != nil {
|
||||
@@ -175,29 +183,22 @@ func (s *ClassicNameServer) addPendingRequest(req *dnsRequest) {
|
||||
|
||||
id := req.msg.ID
|
||||
req.expire = time.Now().Add(time.Second * 8)
|
||||
s.requests[id] = *req
|
||||
s.requests[id] = req
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, option IPOption) {
|
||||
func (s *ClassicNameServer) sendQuery(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption) {
|
||||
newError(s.name, " querying DNS for: ", domain).AtDebug().WriteToLog(session.ExportIDToError(ctx))
|
||||
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(s.clientIP))
|
||||
reqs := buildReqMsgs(domain, option, s.newReqID, genEDNS0Options(clientIP))
|
||||
|
||||
for _, req := range reqs {
|
||||
s.addPendingRequest(req)
|
||||
b, _ := dns.PackMessage(req.msg)
|
||||
udpCtx := context.Background()
|
||||
if inbound := session.InboundFromContext(ctx); inbound != nil {
|
||||
udpCtx = session.ContextWithInbound(udpCtx, inbound)
|
||||
}
|
||||
udpCtx = session.ContextWithContent(udpCtx, &session.Content{
|
||||
Protocol: "dns",
|
||||
})
|
||||
s.udpServer.Dispatch(udpCtx, s.address, b)
|
||||
s.udpServer.Dispatch(toDnsContext(ctx, s.address.String()), *s.address, b)
|
||||
}
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]net.IP, error) {
|
||||
func (s *ClassicNameServer) findIPsForDomain(domain string, option dns_feature.IPOption) ([]net.IP, error) {
|
||||
s.RLock()
|
||||
record, found := s.ips[domain]
|
||||
s.RUnlock()
|
||||
@@ -206,42 +207,48 @@ func (s *ClassicNameServer) findIPsForDomain(domain string, option IPOption) ([]
|
||||
return nil, errRecordNotFound
|
||||
}
|
||||
|
||||
var err4 error
|
||||
var err6 error
|
||||
var ips []net.Address
|
||||
var lastErr error
|
||||
var ip6 []net.Address
|
||||
|
||||
if option.IPv4Enable {
|
||||
a, err := record.A.getIPs()
|
||||
if err != nil {
|
||||
lastErr = err
|
||||
}
|
||||
ips = append(ips, a...)
|
||||
ips, err4 = record.A.getIPs()
|
||||
}
|
||||
|
||||
if option.IPv6Enable {
|
||||
aaaa, err := record.AAAA.getIPs()
|
||||
if err != nil {
|
||||
lastErr = err
|
||||
}
|
||||
ips = append(ips, aaaa...)
|
||||
ip6, err6 = record.AAAA.getIPs()
|
||||
ips = append(ips, ip6...)
|
||||
}
|
||||
|
||||
if len(ips) > 0 {
|
||||
return toNetIP(ips), nil
|
||||
return toNetIP(ips)
|
||||
}
|
||||
|
||||
if lastErr != nil {
|
||||
return nil, lastErr
|
||||
if err4 != nil {
|
||||
return nil, err4
|
||||
}
|
||||
|
||||
if err6 != nil {
|
||||
return nil, err6
|
||||
}
|
||||
|
||||
return nil, dns_feature.ErrEmptyResponse
|
||||
}
|
||||
|
||||
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option IPOption) ([]net.IP, error) {
|
||||
// QueryIP implements Server.
|
||||
func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, clientIP net.IP, option dns_feature.IPOption, disableCache bool) ([]net.IP, error) {
|
||||
fqdn := Fqdn(domain)
|
||||
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
return ips, err
|
||||
if disableCache {
|
||||
newError("DNS cache is disabled. Querying IP for ", domain, " at ", s.name).AtDebug().WriteToLog()
|
||||
} else {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
newError(s.name, " cache HIT ", domain, " -> ", ips).Base(err).AtDebug().WriteToLog()
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSCacheHit, Elapsed: 0, Error: err})
|
||||
return ips, err
|
||||
}
|
||||
}
|
||||
|
||||
// ipv4 and ipv6 belong to different subscription groups
|
||||
@@ -270,11 +277,13 @@ func (s *ClassicNameServer) QueryIP(ctx context.Context, domain string, option I
|
||||
}
|
||||
close(done)
|
||||
}()
|
||||
s.sendQuery(ctx, fqdn, option)
|
||||
s.sendQuery(ctx, fqdn, clientIP, option)
|
||||
start := time.Now()
|
||||
|
||||
for {
|
||||
ips, err := s.findIPsForDomain(fqdn, option)
|
||||
if err != errRecordNotFound {
|
||||
log.Record(&log.DNSLog{Server: s.name, Domain: domain, Result: ips, Status: log.DNSQueried, Elapsed: time.Since(start), Error: err})
|
||||
return ips, err
|
||||
}
|
||||
|
||||
@@ -1,448 +0,0 @@
|
||||
package dns
|
||||
|
||||
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"log"
|
||||
"net/url"
|
||||
"strings"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/common/uuid"
|
||||
core "github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
)
|
||||
|
||||
// Server is a DNS rely server.
|
||||
type Server struct {
|
||||
sync.Mutex
|
||||
hosts *StaticHosts
|
||||
clientIP net.IP
|
||||
clients []Client // clientIdx -> Client
|
||||
ipIndexMap []*MultiGeoIPMatcher // clientIdx -> *MultiGeoIPMatcher
|
||||
domainRules [][]string // clientIdx -> domainRuleIdx -> DomainRule
|
||||
domainMatcher strmatcher.IndexMatcher
|
||||
matcherInfos []DomainMatcherInfo // matcherIdx -> DomainMatcherInfo
|
||||
tag string
|
||||
}
|
||||
|
||||
// DomainMatcherInfo contains information attached to index returned by Server.domainMatcher
|
||||
type DomainMatcherInfo struct {
|
||||
clientIdx uint16
|
||||
domainRuleIdx uint16
|
||||
}
|
||||
|
||||
// MultiGeoIPMatcher for match
|
||||
type MultiGeoIPMatcher struct {
|
||||
matchers []*router.GeoIPMatcher
|
||||
}
|
||||
|
||||
var errExpectedIPNonMatch = errors.New("expectIPs not match")
|
||||
|
||||
// Match check ip match
|
||||
func (c *MultiGeoIPMatcher) Match(ip net.IP) bool {
|
||||
for _, matcher := range c.matchers {
|
||||
if matcher.Match(ip) {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// HasMatcher check has matcher
|
||||
func (c *MultiGeoIPMatcher) HasMatcher() bool {
|
||||
return len(c.matchers) > 0
|
||||
}
|
||||
|
||||
func generateRandomTag() string {
|
||||
id := uuid.New()
|
||||
return "xray.system." + id.String()
|
||||
}
|
||||
|
||||
// New creates a new DNS server with given configuration.
|
||||
func New(ctx context.Context, config *Config) (*Server, error) {
|
||||
server := &Server{
|
||||
clients: make([]Client, 0, len(config.NameServers)+len(config.NameServer)),
|
||||
tag: config.Tag,
|
||||
}
|
||||
if server.tag == "" {
|
||||
server.tag = generateRandomTag()
|
||||
}
|
||||
if len(config.ClientIp) > 0 {
|
||||
if len(config.ClientIp) != net.IPv4len && len(config.ClientIp) != net.IPv6len {
|
||||
return nil, newError("unexpected IP length", len(config.ClientIp))
|
||||
}
|
||||
server.clientIP = net.IP(config.ClientIp)
|
||||
}
|
||||
|
||||
hosts, err := NewStaticHosts(config.StaticHosts, config.Hosts)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create hosts").Base(err)
|
||||
}
|
||||
server.hosts = hosts
|
||||
|
||||
addNameServer := func(ns *NameServer) int {
|
||||
endpoint := ns.Address
|
||||
address := endpoint.Address.AsAddress()
|
||||
|
||||
switch {
|
||||
case address.Family().IsDomain() && address.Domain() == "localhost":
|
||||
server.clients = append(server.clients, NewLocalNameServer())
|
||||
// Priotize local domains with specific TLDs or without any dot to local DNS
|
||||
// References:
|
||||
// https://www.iana.org/assignments/special-use-domain-names/special-use-domain-names.xhtml
|
||||
// https://unix.stackexchange.com/questions/92441/whats-the-difference-between-local-home-and-lan
|
||||
localTLDsAndDotlessDomains := []*NameServer_PriorityDomain{
|
||||
{Type: DomainMatchingType_Regex, Domain: "^[^.]+$"}, // This will only match domains without any dot
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "local"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "localdomain"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "localhost"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "lan"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "home.arpa"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "example"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "invalid"},
|
||||
{Type: DomainMatchingType_Subdomain, Domain: "test"},
|
||||
}
|
||||
ns.PrioritizedDomain = append(ns.PrioritizedDomain, localTLDsAndDotlessDomains...)
|
||||
|
||||
case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https+local://"):
|
||||
// URI schemed string treated as domain
|
||||
// DOH Local mode
|
||||
u, err := url.Parse(address.Domain())
|
||||
if err != nil {
|
||||
log.Fatalln(newError("DNS config error").Base(err))
|
||||
}
|
||||
server.clients = append(server.clients, NewDoHLocalNameServer(u, server.clientIP))
|
||||
|
||||
case address.Family().IsDomain() && strings.HasPrefix(address.Domain(), "https://"):
|
||||
// DOH Remote mode
|
||||
u, err := url.Parse(address.Domain())
|
||||
if err != nil {
|
||||
log.Fatalln(newError("DNS config error").Base(err))
|
||||
}
|
||||
idx := len(server.clients)
|
||||
server.clients = append(server.clients, nil)
|
||||
|
||||
// need the core dispatcher, register DOHClient at callback
|
||||
common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
|
||||
c, err := NewDoHNameServer(u, d, server.clientIP)
|
||||
if err != nil {
|
||||
log.Fatalln(newError("DNS config error").Base(err))
|
||||
}
|
||||
server.clients[idx] = c
|
||||
}))
|
||||
|
||||
default:
|
||||
// UDP classic DNS mode
|
||||
dest := endpoint.AsDestination()
|
||||
if dest.Network == net.Network_Unknown {
|
||||
dest.Network = net.Network_UDP
|
||||
}
|
||||
if dest.Network == net.Network_UDP {
|
||||
idx := len(server.clients)
|
||||
server.clients = append(server.clients, nil)
|
||||
|
||||
common.Must(core.RequireFeatures(ctx, func(d routing.Dispatcher) {
|
||||
server.clients[idx] = NewClassicNameServer(dest, d, server.clientIP)
|
||||
}))
|
||||
}
|
||||
}
|
||||
server.ipIndexMap = append(server.ipIndexMap, nil)
|
||||
return len(server.clients) - 1
|
||||
}
|
||||
|
||||
if len(config.NameServers) > 0 {
|
||||
features.PrintDeprecatedFeatureWarning("simple DNS server")
|
||||
for _, destPB := range config.NameServers {
|
||||
addNameServer(&NameServer{Address: destPB})
|
||||
}
|
||||
}
|
||||
|
||||
if len(config.NameServer) > 0 {
|
||||
clientIndices := []int{}
|
||||
domainRuleCount := 0
|
||||
for _, ns := range config.NameServer {
|
||||
idx := addNameServer(ns)
|
||||
clientIndices = append(clientIndices, idx)
|
||||
domainRuleCount += len(ns.PrioritizedDomain)
|
||||
}
|
||||
|
||||
domainRules := make([][]string, len(server.clients))
|
||||
domainMatcher := &strmatcher.MatcherGroup{}
|
||||
matcherInfos := make([]DomainMatcherInfo, domainRuleCount+1) // matcher index starts from 1
|
||||
var geoIPMatcherContainer router.GeoIPMatcherContainer
|
||||
for nidx, ns := range config.NameServer {
|
||||
idx := clientIndices[nidx]
|
||||
|
||||
// Establish domain rule matcher
|
||||
rules := []string{}
|
||||
ruleCurr := 0
|
||||
ruleIter := 0
|
||||
for _, domain := range ns.PrioritizedDomain {
|
||||
matcher, err := toStrMatcher(domain.Type, domain.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create prioritized domain").Base(err).AtWarning()
|
||||
}
|
||||
midx := domainMatcher.Add(matcher)
|
||||
if midx >= uint32(len(matcherInfos)) { // This rarely happens according to current matcher's implementation
|
||||
newError("expanding domain matcher info array to size ", midx, " when adding ", matcher).AtDebug().WriteToLog()
|
||||
matcherInfos = append(matcherInfos, make([]DomainMatcherInfo, midx-uint32(len(matcherInfos))+1)...)
|
||||
}
|
||||
info := &matcherInfos[midx]
|
||||
info.clientIdx = uint16(idx)
|
||||
if ruleCurr < len(ns.OriginalRules) {
|
||||
info.domainRuleIdx = uint16(ruleCurr)
|
||||
rule := ns.OriginalRules[ruleCurr]
|
||||
if ruleCurr >= len(rules) {
|
||||
rules = append(rules, rule.Rule)
|
||||
}
|
||||
ruleIter++
|
||||
if ruleIter >= int(rule.Size) {
|
||||
ruleIter = 0
|
||||
ruleCurr++
|
||||
}
|
||||
} else { // No original rule, generate one according to current domain matcher (majorly for compatibility with tests)
|
||||
info.domainRuleIdx = uint16(len(rules))
|
||||
rules = append(rules, matcher.String())
|
||||
}
|
||||
}
|
||||
domainRules[idx] = rules
|
||||
|
||||
// only add to ipIndexMap if GeoIP is configured
|
||||
if len(ns.Geoip) > 0 {
|
||||
var matchers []*router.GeoIPMatcher
|
||||
for _, geoip := range ns.Geoip {
|
||||
matcher, err := geoIPMatcherContainer.Add(geoip)
|
||||
if err != nil {
|
||||
return nil, newError("failed to create ip matcher").Base(err).AtWarning()
|
||||
}
|
||||
matchers = append(matchers, matcher)
|
||||
}
|
||||
matcher := &MultiGeoIPMatcher{matchers: matchers}
|
||||
server.ipIndexMap[idx] = matcher
|
||||
}
|
||||
}
|
||||
server.domainRules = domainRules
|
||||
server.domainMatcher = domainMatcher
|
||||
server.matcherInfos = matcherInfos
|
||||
}
|
||||
|
||||
if len(server.clients) == 0 {
|
||||
server.clients = append(server.clients, NewLocalNameServer())
|
||||
server.ipIndexMap = append(server.ipIndexMap, nil)
|
||||
}
|
||||
|
||||
return server, nil
|
||||
}
|
||||
|
||||
// Type implements common.HasType.
|
||||
func (*Server) Type() interface{} {
|
||||
return dns.ClientType()
|
||||
}
|
||||
|
||||
// Start implements common.Runnable.
|
||||
func (s *Server) Start() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close implements common.Closable.
|
||||
func (s *Server) Close() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (s *Server) IsOwnLink(ctx context.Context) bool {
|
||||
inbound := session.InboundFromContext(ctx)
|
||||
return inbound != nil && inbound.Tag == s.tag
|
||||
}
|
||||
|
||||
// Match check dns ip match geoip
|
||||
func (s *Server) Match(idx int, client Client, domain string, ips []net.IP) ([]net.IP, error) {
|
||||
var matcher *MultiGeoIPMatcher
|
||||
if idx < len(s.ipIndexMap) {
|
||||
matcher = s.ipIndexMap[idx]
|
||||
}
|
||||
if matcher == nil {
|
||||
return ips, nil
|
||||
}
|
||||
|
||||
if !matcher.HasMatcher() {
|
||||
newError("domain ", domain, " server has no valid matcher: ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
|
||||
return ips, nil
|
||||
}
|
||||
|
||||
newIps := []net.IP{}
|
||||
for _, ip := range ips {
|
||||
if matcher.Match(ip) {
|
||||
newIps = append(newIps, ip)
|
||||
}
|
||||
}
|
||||
if len(newIps) == 0 {
|
||||
return nil, errExpectedIPNonMatch
|
||||
}
|
||||
newError("domain ", domain, " expectIPs ", newIps, " matched at server ", client.Name(), " idx:", idx).AtDebug().WriteToLog()
|
||||
return newIps, nil
|
||||
}
|
||||
|
||||
func (s *Server) queryIPTimeout(idx int, client Client, domain string, option IPOption) ([]net.IP, error) {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second*4)
|
||||
if len(s.tag) > 0 {
|
||||
ctx = session.ContextWithInbound(ctx, &session.Inbound{
|
||||
Tag: s.tag,
|
||||
})
|
||||
}
|
||||
ips, err := client.QueryIP(ctx, domain, option)
|
||||
cancel()
|
||||
|
||||
if err != nil {
|
||||
return ips, err
|
||||
}
|
||||
|
||||
ips, err = s.Match(idx, client, domain, ips)
|
||||
return ips, err
|
||||
}
|
||||
|
||||
// LookupIP implements dns.Client.
|
||||
func (s *Server) LookupIP(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
}
|
||||
|
||||
// LookupIPv4 implements dns.IPv4Lookup.
|
||||
func (s *Server) LookupIPv4(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: false,
|
||||
})
|
||||
}
|
||||
|
||||
// LookupIPv6 implements dns.IPv6Lookup.
|
||||
func (s *Server) LookupIPv6(domain string) ([]net.IP, error) {
|
||||
return s.lookupIPInternal(domain, IPOption{
|
||||
IPv4Enable: false,
|
||||
IPv6Enable: true,
|
||||
})
|
||||
}
|
||||
|
||||
func (s *Server) lookupStatic(domain string, option IPOption, depth int32) []net.Address {
|
||||
ips := s.hosts.LookupIP(domain, option)
|
||||
if ips == nil {
|
||||
return nil
|
||||
}
|
||||
if ips[0].Family().IsDomain() && depth < 5 {
|
||||
if newIPs := s.lookupStatic(ips[0].Domain(), option, depth+1); newIPs != nil {
|
||||
return newIPs
|
||||
}
|
||||
}
|
||||
return ips
|
||||
}
|
||||
|
||||
func toNetIP(ips []net.Address) []net.IP {
|
||||
if len(ips) == 0 {
|
||||
return nil
|
||||
}
|
||||
netips := make([]net.IP, 0, len(ips))
|
||||
for _, ip := range ips {
|
||||
netips = append(netips, ip.IP())
|
||||
}
|
||||
return netips
|
||||
}
|
||||
|
||||
func (s *Server) lookupIPInternal(domain string, option IPOption) ([]net.IP, error) {
|
||||
if domain == "" {
|
||||
return nil, newError("empty domain name")
|
||||
}
|
||||
domain = strings.ToLower(domain)
|
||||
|
||||
// normalize the FQDN form query
|
||||
if domain[len(domain)-1] == '.' {
|
||||
domain = domain[:len(domain)-1]
|
||||
}
|
||||
|
||||
ips := s.lookupStatic(domain, option, 0)
|
||||
if ips != nil && ips[0].Family().IsIP() {
|
||||
newError("returning ", len(ips), " IPs for domain ", domain).WriteToLog()
|
||||
return toNetIP(ips), nil
|
||||
}
|
||||
|
||||
if ips != nil && ips[0].Family().IsDomain() {
|
||||
newdomain := ips[0].Domain()
|
||||
newError("domain replaced: ", domain, " -> ", newdomain).WriteToLog()
|
||||
domain = newdomain
|
||||
}
|
||||
|
||||
var lastErr error
|
||||
var matchedClient Client
|
||||
if s.domainMatcher != nil {
|
||||
indices := s.domainMatcher.Match(domain)
|
||||
domainRules := []string{}
|
||||
matchingDNS := []string{}
|
||||
for _, idx := range indices {
|
||||
info := s.matcherInfos[idx]
|
||||
rule := s.domainRules[info.clientIdx][info.domainRuleIdx]
|
||||
domainRules = append(domainRules, fmt.Sprintf("%s(DNS idx:%d)", rule, info.clientIdx))
|
||||
matchingDNS = append(matchingDNS, s.clients[info.clientIdx].Name())
|
||||
}
|
||||
if len(domainRules) > 0 {
|
||||
newError("domain ", domain, " matches following rules: ", domainRules).AtDebug().WriteToLog()
|
||||
}
|
||||
if len(matchingDNS) > 0 {
|
||||
newError("domain ", domain, " uses following DNS first: ", matchingDNS).AtDebug().WriteToLog()
|
||||
}
|
||||
for _, idx := range indices {
|
||||
clientIdx := int(s.matcherInfos[idx].clientIdx)
|
||||
matchedClient = s.clients[clientIdx]
|
||||
ips, err := s.queryIPTimeout(clientIdx, matchedClient, domain, option)
|
||||
if len(ips) > 0 {
|
||||
return ips, nil
|
||||
}
|
||||
if err == dns.ErrEmptyResponse {
|
||||
return nil, err
|
||||
}
|
||||
if err != nil {
|
||||
newError("failed to lookup ip for domain ", domain, " at server ", matchedClient.Name()).Base(err).WriteToLog()
|
||||
lastErr = err
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for idx, client := range s.clients {
|
||||
if client == matchedClient {
|
||||
newError("domain ", domain, " at server ", client.Name(), " idx:", idx, " already lookup failed, just ignore").AtDebug().WriteToLog()
|
||||
continue
|
||||
}
|
||||
|
||||
ips, err := s.queryIPTimeout(idx, client, domain, option)
|
||||
if len(ips) > 0 {
|
||||
return ips, nil
|
||||
}
|
||||
|
||||
if err != nil {
|
||||
newError("failed to lookup ip for domain ", domain, " at server ", client.Name()).Base(err).WriteToLog()
|
||||
lastErr = err
|
||||
}
|
||||
if err != context.Canceled && err != context.DeadlineExceeded && err != errExpectedIPNonMatch {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return nil, newError("returning nil for domain ", domain).Base(lastErr)
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
return New(ctx, config.(*Config))
|
||||
}))
|
||||
}
|
||||
@@ -5,11 +5,10 @@ package command
|
||||
import (
|
||||
"context"
|
||||
|
||||
grpc "google.golang.org/grpc"
|
||||
|
||||
"github.com/xtls/xray-core/app/log"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/core"
|
||||
grpc "google.golang.org/grpc"
|
||||
)
|
||||
|
||||
type LoggerServer struct {
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/log/command/config.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,4 +1,8 @@
|
||||
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
|
||||
// versions:
|
||||
// - protoc-gen-go-grpc v1.2.0
|
||||
// - protoc v3.18.0
|
||||
// source: app/log/command/config.proto
|
||||
|
||||
package command
|
||||
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/log/config.proto
|
||||
|
||||
package log
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
log "github.com/xtls/xray-core/common/log"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type LogType int32
|
||||
|
||||
const (
|
||||
@@ -88,6 +83,7 @@ type Config struct {
|
||||
ErrorLogPath string `protobuf:"bytes,3,opt,name=error_log_path,json=errorLogPath,proto3" json:"error_log_path,omitempty"`
|
||||
AccessLogType LogType `protobuf:"varint,4,opt,name=access_log_type,json=accessLogType,proto3,enum=xray.app.log.LogType" json:"access_log_type,omitempty"`
|
||||
AccessLogPath string `protobuf:"bytes,5,opt,name=access_log_path,json=accessLogPath,proto3" json:"access_log_path,omitempty"`
|
||||
EnableDnsLog bool `protobuf:"varint,6,opt,name=enable_dns_log,json=enableDnsLog,proto3" json:"enable_dns_log,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
@@ -133,7 +129,7 @@ func (x *Config) GetErrorLogLevel() log.Severity {
|
||||
if x != nil {
|
||||
return x.ErrorLogLevel
|
||||
}
|
||||
return log.Severity_Unknown
|
||||
return log.Severity(0)
|
||||
}
|
||||
|
||||
func (x *Config) GetErrorLogPath() string {
|
||||
@@ -157,13 +153,20 @@ func (x *Config) GetAccessLogPath() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *Config) GetEnableDnsLog() bool {
|
||||
if x != nil {
|
||||
return x.EnableDnsLog
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
var File_app_log_config_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_log_config_proto_rawDesc = []byte{
|
||||
0x0a, 0x14, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67,
|
||||
0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0c, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x6c, 0x6f, 0x67, 0x1a, 0x14, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2f, 0x6c, 0x6f, 0x67,
|
||||
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x95, 0x02, 0x0a, 0x06, 0x43,
|
||||
0x2f, 0x6c, 0x6f, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xbb, 0x02, 0x0a, 0x06, 0x43,
|
||||
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x3b, 0x0a, 0x0e, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x6c,
|
||||
0x6f, 0x67, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x15, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x2e, 0x4c, 0x6f, 0x67,
|
||||
@@ -181,15 +184,17 @@ var file_app_log_config_proto_rawDesc = []byte{
|
||||
0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x26, 0x0a, 0x0f, 0x61, 0x63,
|
||||
0x63, 0x65, 0x73, 0x73, 0x5f, 0x6c, 0x6f, 0x67, 0x5f, 0x70, 0x61, 0x74, 0x68, 0x18, 0x05, 0x20,
|
||||
0x01, 0x28, 0x09, 0x52, 0x0d, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x4c, 0x6f, 0x67, 0x50, 0x61,
|
||||
0x74, 0x68, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54, 0x79, 0x70, 0x65, 0x12, 0x08, 0x0a,
|
||||
0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a, 0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f,
|
||||
0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69, 0x6c, 0x65, 0x10, 0x02, 0x12, 0x09,
|
||||
0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42, 0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a,
|
||||
0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73,
|
||||
0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c,
|
||||
0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f,
|
||||
0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x74, 0x68, 0x12, 0x24, 0x0a, 0x0e, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x64, 0x6e, 0x73,
|
||||
0x5f, 0x6c, 0x6f, 0x67, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x65, 0x6e, 0x61, 0x62,
|
||||
0x6c, 0x65, 0x44, 0x6e, 0x73, 0x4c, 0x6f, 0x67, 0x2a, 0x35, 0x0a, 0x07, 0x4c, 0x6f, 0x67, 0x54,
|
||||
0x79, 0x70, 0x65, 0x12, 0x08, 0x0a, 0x04, 0x4e, 0x6f, 0x6e, 0x65, 0x10, 0x00, 0x12, 0x0b, 0x0a,
|
||||
0x07, 0x43, 0x6f, 0x6e, 0x73, 0x6f, 0x6c, 0x65, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, 0x46, 0x69,
|
||||
0x6c, 0x65, 0x10, 0x02, 0x12, 0x09, 0x0a, 0x05, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x10, 0x03, 0x42,
|
||||
0x46, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
||||
0x6c, 0x6f, 0x67, 0x50, 0x01, 0x5a, 0x21, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65,
|
||||
0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6c, 0x6f, 0x67, 0xaa, 0x02, 0x0c, 0x58, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x41, 0x70, 0x70, 0x2e, 0x4c, 0x6f, 0x67, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -22,4 +22,5 @@ message Config {
|
||||
|
||||
LogType access_log_type = 4;
|
||||
string access_log_path = 5;
|
||||
bool enable_dns_log = 6;
|
||||
}
|
||||
|
||||
@@ -17,6 +17,7 @@ type Instance struct {
|
||||
accessLogger log.Handler
|
||||
errorLogger log.Handler
|
||||
active bool
|
||||
dns bool
|
||||
}
|
||||
|
||||
// New creates a new log.Instance based on the given config.
|
||||
@@ -24,6 +25,7 @@ func New(ctx context.Context, config *Config) (*Instance, error) {
|
||||
g := &Instance{
|
||||
config: config,
|
||||
active: false,
|
||||
dns: config.EnableDnsLog,
|
||||
}
|
||||
log.RegisterHandler(g)
|
||||
|
||||
@@ -103,6 +105,10 @@ func (g *Instance) Handle(msg log.Message) {
|
||||
if g.accessLogger != nil {
|
||||
g.accessLogger.Handle(msg)
|
||||
}
|
||||
case *log.DNSLog:
|
||||
if g.dns && g.accessLogger != nil {
|
||||
g.accessLogger.Handle(msg)
|
||||
}
|
||||
case *log.GeneralMessage:
|
||||
if g.errorLogger != nil && msg.Severity <= g.config.ErrorLogLevel {
|
||||
g.errorLogger.Handle(msg)
|
||||
|
||||
@@ -1,6 +1,8 @@
|
||||
package log
|
||||
|
||||
import (
|
||||
"sync"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/log"
|
||||
)
|
||||
@@ -11,20 +13,26 @@ type HandlerCreatorOptions struct {
|
||||
|
||||
type HandlerCreator func(LogType, HandlerCreatorOptions) (log.Handler, error)
|
||||
|
||||
var (
|
||||
handlerCreatorMap = make(map[LogType]HandlerCreator)
|
||||
)
|
||||
var handlerCreatorMap = make(map[LogType]HandlerCreator)
|
||||
|
||||
var handlerCreatorMapLock = &sync.RWMutex{}
|
||||
|
||||
func RegisterHandlerCreator(logType LogType, f HandlerCreator) error {
|
||||
if f == nil {
|
||||
return newError("nil HandlerCreator")
|
||||
}
|
||||
|
||||
handlerCreatorMapLock.Lock()
|
||||
defer handlerCreatorMapLock.Unlock()
|
||||
|
||||
handlerCreatorMap[logType] = f
|
||||
return nil
|
||||
}
|
||||
|
||||
func createHandler(logType LogType, options HandlerCreatorOptions) (log.Handler, error) {
|
||||
handlerCreatorMapLock.RLock()
|
||||
defer handlerCreatorMapLock.RUnlock()
|
||||
|
||||
creator, found := handlerCreatorMap[logType]
|
||||
if !found {
|
||||
return nil, newError("unable to create log handler for ", logType)
|
||||
|
||||
149
app/metrics/config.pb.go
Normal file
149
app/metrics/config.pb.go
Normal file
@@ -0,0 +1,149 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.28.0
|
||||
// protoc v3.19.4
|
||||
// source: app/metrics/config.proto
|
||||
|
||||
package metrics
|
||||
|
||||
import (
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
const (
|
||||
// Verify that this generated code is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// Config is the settings for metrics.
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// Tag of the outbound handler that handles metrics http connections.
|
||||
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
*x = Config{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_metrics_config_proto_msgTypes[0]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *Config) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*Config) ProtoMessage() {}
|
||||
|
||||
func (x *Config) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_metrics_config_proto_msgTypes[0]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
|
||||
func (*Config) Descriptor() ([]byte, []int) {
|
||||
return file_app_metrics_config_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
func (x *Config) GetTag() string {
|
||||
if x != nil {
|
||||
return x.Tag
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
var File_app_metrics_config_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_metrics_config_proto_rawDesc = []byte{
|
||||
0x0a, 0x18, 0x61, 0x70, 0x70, 0x2f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x2f, 0x63, 0x6f,
|
||||
0x6e, 0x66, 0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x10, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x22, 0x1a, 0x0a, 0x06,
|
||||
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20,
|
||||
0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x42, 0x52, 0x0a, 0x14, 0x63, 0x6f, 0x6d, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73,
|
||||
0x50, 0x01, 0x5a, 0x25, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78,
|
||||
0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70,
|
||||
0x70, 0x2f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0xaa, 0x02, 0x10, 0x58, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x62, 0x06, 0x70, 0x72,
|
||||
0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
file_app_metrics_config_proto_rawDescOnce sync.Once
|
||||
file_app_metrics_config_proto_rawDescData = file_app_metrics_config_proto_rawDesc
|
||||
)
|
||||
|
||||
func file_app_metrics_config_proto_rawDescGZIP() []byte {
|
||||
file_app_metrics_config_proto_rawDescOnce.Do(func() {
|
||||
file_app_metrics_config_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_metrics_config_proto_rawDescData)
|
||||
})
|
||||
return file_app_metrics_config_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_metrics_config_proto_msgTypes = make([]protoimpl.MessageInfo, 1)
|
||||
var file_app_metrics_config_proto_goTypes = []interface{}{
|
||||
(*Config)(nil), // 0: xray.app.metrics.Config
|
||||
}
|
||||
var file_app_metrics_config_proto_depIdxs = []int32{
|
||||
0, // [0:0] is the sub-list for method output_type
|
||||
0, // [0:0] is the sub-list for method input_type
|
||||
0, // [0:0] is the sub-list for extension type_name
|
||||
0, // [0:0] is the sub-list for extension extendee
|
||||
0, // [0:0] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_metrics_config_proto_init() }
|
||||
func file_app_metrics_config_proto_init() {
|
||||
if File_app_metrics_config_proto != nil {
|
||||
return
|
||||
}
|
||||
if !protoimpl.UnsafeEnabled {
|
||||
file_app_metrics_config_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*Config); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
}
|
||||
type x struct{}
|
||||
out := protoimpl.TypeBuilder{
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_metrics_config_proto_rawDesc,
|
||||
NumEnums: 0,
|
||||
NumMessages: 1,
|
||||
NumExtensions: 0,
|
||||
NumServices: 0,
|
||||
},
|
||||
GoTypes: file_app_metrics_config_proto_goTypes,
|
||||
DependencyIndexes: file_app_metrics_config_proto_depIdxs,
|
||||
MessageInfos: file_app_metrics_config_proto_msgTypes,
|
||||
}.Build()
|
||||
File_app_metrics_config_proto = out.File
|
||||
file_app_metrics_config_proto_rawDesc = nil
|
||||
file_app_metrics_config_proto_goTypes = nil
|
||||
file_app_metrics_config_proto_depIdxs = nil
|
||||
}
|
||||
13
app/metrics/config.proto
Normal file
13
app/metrics/config.proto
Normal file
@@ -0,0 +1,13 @@
|
||||
syntax = "proto3";
|
||||
|
||||
package xray.app.metrics;
|
||||
option csharp_namespace = "Xray.App.Metrics";
|
||||
option go_package = "github.com/xtls/xray-core/app/metrics";
|
||||
option java_package = "com.xray.app.metrics";
|
||||
option java_multiple_files = true;
|
||||
|
||||
// Config is the settings for metrics.
|
||||
message Config {
|
||||
// Tag of the outbound handler that handles metrics http connections.
|
||||
string tag = 1;
|
||||
}
|
||||
9
app/metrics/errors.generated.go
Normal file
9
app/metrics/errors.generated.go
Normal file
@@ -0,0 +1,9 @@
|
||||
package metrics
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errPathObjHolder struct{}
|
||||
|
||||
func newError(values ...interface{}) *errors.Error {
|
||||
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||
}
|
||||
118
app/metrics/metrics.go
Normal file
118
app/metrics/metrics.go
Normal file
@@ -0,0 +1,118 @@
|
||||
package metrics
|
||||
|
||||
import (
|
||||
"context"
|
||||
"expvar"
|
||||
"net/http"
|
||||
_ "net/http/pprof"
|
||||
"strings"
|
||||
|
||||
"github.com/xtls/xray-core/app/observatory"
|
||||
"github.com/xtls/xray-core/app/stats"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/signal/done"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/extension"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
feature_stats "github.com/xtls/xray-core/features/stats"
|
||||
)
|
||||
|
||||
type MetricsHandler struct {
|
||||
ohm outbound.Manager
|
||||
statsManager feature_stats.Manager
|
||||
observatory extension.Observatory
|
||||
tag string
|
||||
}
|
||||
|
||||
// NewMetricsHandler creates a new MetricsHandler based on the given config.
|
||||
func NewMetricsHandler(ctx context.Context, config *Config) (*MetricsHandler, error) {
|
||||
c := &MetricsHandler{
|
||||
tag: config.Tag,
|
||||
}
|
||||
common.Must(core.RequireFeatures(ctx, func(om outbound.Manager, sm feature_stats.Manager) {
|
||||
c.statsManager = sm
|
||||
c.ohm = om
|
||||
}))
|
||||
expvar.Publish("stats", expvar.Func(func() interface{} {
|
||||
manager, ok := c.statsManager.(*stats.Manager)
|
||||
if !ok {
|
||||
return nil
|
||||
}
|
||||
resp := map[string]map[string]map[string]int64{
|
||||
"inbound": {},
|
||||
"outbound": {},
|
||||
"user": {},
|
||||
}
|
||||
manager.VisitCounters(func(name string, counter feature_stats.Counter) bool {
|
||||
nameSplit := strings.Split(name, ">>>")
|
||||
typeName, tagOrUser, direction := nameSplit[0], nameSplit[1], nameSplit[3]
|
||||
if item, found := resp[typeName][tagOrUser]; found {
|
||||
item[direction] = counter.Value()
|
||||
} else {
|
||||
resp[typeName][tagOrUser] = map[string]int64{
|
||||
direction: counter.Value(),
|
||||
}
|
||||
}
|
||||
return true
|
||||
})
|
||||
return resp
|
||||
}))
|
||||
expvar.Publish("observatory", expvar.Func(func() interface{} {
|
||||
if c.observatory == nil {
|
||||
common.Must(core.RequireFeatures(ctx, func(observatory extension.Observatory) error {
|
||||
c.observatory = observatory
|
||||
return nil
|
||||
}))
|
||||
if c.observatory == nil {
|
||||
return nil
|
||||
}
|
||||
}
|
||||
resp := map[string]*observatory.OutboundStatus{}
|
||||
if o, err := c.observatory.GetObservation(context.Background()); err != nil {
|
||||
return err
|
||||
} else {
|
||||
for _, x := range o.(*observatory.ObservationResult).GetStatus() {
|
||||
resp[x.OutboundTag] = x
|
||||
}
|
||||
}
|
||||
return resp
|
||||
}))
|
||||
return c, nil
|
||||
}
|
||||
|
||||
func (p *MetricsHandler) Type() interface{} {
|
||||
return (*MetricsHandler)(nil)
|
||||
}
|
||||
|
||||
func (p *MetricsHandler) Start() error {
|
||||
listener := &OutboundListener{
|
||||
buffer: make(chan net.Conn, 4),
|
||||
done: done.New(),
|
||||
}
|
||||
|
||||
go func() {
|
||||
if err := http.Serve(listener, http.DefaultServeMux); err != nil {
|
||||
newError("failed to start metrics server").Base(err).AtError().WriteToLog()
|
||||
}
|
||||
}()
|
||||
|
||||
if err := p.ohm.RemoveHandler(context.Background(), p.tag); err != nil {
|
||||
newError("failed to remove existing handler").WriteToLog()
|
||||
}
|
||||
|
||||
return p.ohm.AddHandler(context.Background(), &Outbound{
|
||||
tag: p.tag,
|
||||
listener: listener,
|
||||
})
|
||||
}
|
||||
|
||||
func (p *MetricsHandler) Close() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
|
||||
return NewMetricsHandler(ctx, cfg.(*Config))
|
||||
}))
|
||||
}
|
||||
109
app/metrics/outbound.go
Normal file
109
app/metrics/outbound.go
Normal file
@@ -0,0 +1,109 @@
|
||||
package metrics
|
||||
|
||||
import (
|
||||
"context"
|
||||
"sync"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/net/cnc"
|
||||
"github.com/xtls/xray-core/common/signal/done"
|
||||
"github.com/xtls/xray-core/transport"
|
||||
)
|
||||
|
||||
// OutboundListener is a net.Listener for listening metrics http connections.
|
||||
type OutboundListener struct {
|
||||
buffer chan net.Conn
|
||||
done *done.Instance
|
||||
}
|
||||
|
||||
func (l *OutboundListener) add(conn net.Conn) {
|
||||
select {
|
||||
case l.buffer <- conn:
|
||||
case <-l.done.Wait():
|
||||
conn.Close()
|
||||
default:
|
||||
conn.Close()
|
||||
}
|
||||
}
|
||||
|
||||
// Accept implements net.Listener.
|
||||
func (l *OutboundListener) Accept() (net.Conn, error) {
|
||||
select {
|
||||
case <-l.done.Wait():
|
||||
return nil, newError("listen closed")
|
||||
case c := <-l.buffer:
|
||||
return c, nil
|
||||
}
|
||||
}
|
||||
|
||||
// Close implement net.Listener.
|
||||
func (l *OutboundListener) Close() error {
|
||||
common.Must(l.done.Close())
|
||||
L:
|
||||
for {
|
||||
select {
|
||||
case c := <-l.buffer:
|
||||
c.Close()
|
||||
default:
|
||||
break L
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
// Addr implements net.Listener.
|
||||
func (l *OutboundListener) Addr() net.Addr {
|
||||
return &net.TCPAddr{
|
||||
IP: net.IP{0, 0, 0, 0},
|
||||
Port: 0,
|
||||
}
|
||||
}
|
||||
|
||||
// Outbound is an outbound.Handler that handles metrics http connections.
|
||||
type Outbound struct {
|
||||
tag string
|
||||
listener *OutboundListener
|
||||
access sync.RWMutex
|
||||
closed bool
|
||||
}
|
||||
|
||||
// Dispatch implements outbound.Handler.
|
||||
func (co *Outbound) Dispatch(ctx context.Context, link *transport.Link) {
|
||||
co.access.RLock()
|
||||
|
||||
if co.closed {
|
||||
common.Interrupt(link.Reader)
|
||||
common.Interrupt(link.Writer)
|
||||
co.access.RUnlock()
|
||||
return
|
||||
}
|
||||
|
||||
closeSignal := done.New()
|
||||
c := cnc.NewConnection(cnc.ConnectionInputMulti(link.Writer), cnc.ConnectionOutputMulti(link.Reader), cnc.ConnectionOnClose(closeSignal))
|
||||
co.listener.add(c)
|
||||
co.access.RUnlock()
|
||||
<-closeSignal.Wait()
|
||||
}
|
||||
|
||||
// Tag implements outbound.Handler.
|
||||
func (co *Outbound) Tag() string {
|
||||
return co.tag
|
||||
}
|
||||
|
||||
// Start implements common.Runnable.
|
||||
func (co *Outbound) Start() error {
|
||||
co.access.Lock()
|
||||
co.closed = false
|
||||
co.access.Unlock()
|
||||
return nil
|
||||
}
|
||||
|
||||
// Close implements common.Closable.
|
||||
func (co *Outbound) Close() error {
|
||||
co.access.Lock()
|
||||
defer co.access.Unlock()
|
||||
|
||||
co.closed = true
|
||||
return co.listener.Close()
|
||||
}
|
||||
50
app/observatory/command/command.go
Normal file
50
app/observatory/command/command.go
Normal file
@@ -0,0 +1,50 @@
|
||||
//go:build !confonly
|
||||
// +build !confonly
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/app/observatory"
|
||||
"github.com/xtls/xray-core/common"
|
||||
core "github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/extension"
|
||||
"google.golang.org/grpc"
|
||||
)
|
||||
|
||||
type service struct {
|
||||
UnimplementedObservatoryServiceServer
|
||||
v *core.Instance
|
||||
|
||||
observatory extension.Observatory
|
||||
}
|
||||
|
||||
func (s *service) GetOutboundStatus(ctx context.Context, request *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
|
||||
resp, err := s.observatory.GetObservation(ctx)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
retdata := resp.(*observatory.ObservationResult)
|
||||
return &GetOutboundStatusResponse{
|
||||
Status: retdata,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (s *service) Register(server *grpc.Server) {
|
||||
RegisterObservatoryServiceServer(server, s)
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, cfg interface{}) (interface{}, error) {
|
||||
s := core.MustFromContext(ctx)
|
||||
sv := &service{v: s}
|
||||
err := s.RequireFeatures(func(Observatory extension.Observatory) {
|
||||
sv.observatory = Observatory
|
||||
})
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return sv, nil
|
||||
}))
|
||||
}
|
||||
278
app/observatory/command/command.pb.go
Normal file
278
app/observatory/command/command.pb.go
Normal file
@@ -0,0 +1,278 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/observatory/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
observatory "github.com/xtls/xray-core/app/observatory"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
const (
|
||||
// Verify that this generated code is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
type GetOutboundStatusRequest struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
}
|
||||
|
||||
func (x *GetOutboundStatusRequest) Reset() {
|
||||
*x = GetOutboundStatusRequest{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[0]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *GetOutboundStatusRequest) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*GetOutboundStatusRequest) ProtoMessage() {}
|
||||
|
||||
func (x *GetOutboundStatusRequest) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[0]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use GetOutboundStatusRequest.ProtoReflect.Descriptor instead.
|
||||
func (*GetOutboundStatusRequest) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
type GetOutboundStatusResponse struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
Status *observatory.ObservationResult `protobuf:"bytes,1,opt,name=status,proto3" json:"status,omitempty"`
|
||||
}
|
||||
|
||||
func (x *GetOutboundStatusResponse) Reset() {
|
||||
*x = GetOutboundStatusResponse{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[1]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *GetOutboundStatusResponse) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*GetOutboundStatusResponse) ProtoMessage() {}
|
||||
|
||||
func (x *GetOutboundStatusResponse) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[1]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use GetOutboundStatusResponse.ProtoReflect.Descriptor instead.
|
||||
func (*GetOutboundStatusResponse) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{1}
|
||||
}
|
||||
|
||||
func (x *GetOutboundStatusResponse) GetStatus() *observatory.ObservationResult {
|
||||
if x != nil {
|
||||
return x.Status
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
*x = Config{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[2]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *Config) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*Config) ProtoMessage() {}
|
||||
|
||||
func (x *Config) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_command_command_proto_msgTypes[2]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
|
||||
func (*Config) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_command_command_proto_rawDescGZIP(), []int{2}
|
||||
}
|
||||
|
||||
var File_app_observatory_command_command_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_observatory_command_command_proto_rawDesc = []byte{
|
||||
0x0a, 0x25, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
|
||||
0x79, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e,
|
||||
0x64, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x21, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f,
|
||||
0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x1a, 0x1c, 0x61, 0x70, 0x70, 0x2f,
|
||||
0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2f, 0x63, 0x6f, 0x6e, 0x66,
|
||||
0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x1a, 0x0a, 0x18, 0x47, 0x65, 0x74, 0x4f,
|
||||
0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71,
|
||||
0x75, 0x65, 0x73, 0x74, 0x22, 0x61, 0x0a, 0x19, 0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f,
|
||||
0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73,
|
||||
0x65, 0x12, 0x44, 0x0a, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x2c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x4f, 0x62,
|
||||
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x52,
|
||||
0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x22, 0x08, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x32, 0xa7, 0x01, 0x0a, 0x12, 0x4f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
|
||||
0x79, 0x53, 0x65, 0x72, 0x76, 0x69, 0x63, 0x65, 0x12, 0x90, 0x01, 0x0a, 0x11, 0x47, 0x65, 0x74,
|
||||
0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x3b,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f,
|
||||
0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61,
|
||||
0x6e, 0x64, 0x2e, 0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74,
|
||||
0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x3c, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65,
|
||||
0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x2e,
|
||||
0x47, 0x65, 0x74, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75,
|
||||
0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x42, 0x80, 0x01, 0x0a, 0x25,
|
||||
0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x50, 0x01, 0x5a, 0x31, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e,
|
||||
0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f,
|
||||
0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f,
|
||||
0x72, 0x79, 0x2f, 0x63, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0xaa, 0x02, 0x21, 0x58, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x43, 0x6f, 0x72, 0x65, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x4f, 0x62, 0x73, 0x65, 0x72,
|
||||
0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x43, 0x6f, 0x6d, 0x6d, 0x61, 0x6e, 0x64, 0x62, 0x06,
|
||||
0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
file_app_observatory_command_command_proto_rawDescOnce sync.Once
|
||||
file_app_observatory_command_command_proto_rawDescData = file_app_observatory_command_command_proto_rawDesc
|
||||
)
|
||||
|
||||
func file_app_observatory_command_command_proto_rawDescGZIP() []byte {
|
||||
file_app_observatory_command_command_proto_rawDescOnce.Do(func() {
|
||||
file_app_observatory_command_command_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_observatory_command_command_proto_rawDescData)
|
||||
})
|
||||
return file_app_observatory_command_command_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_observatory_command_command_proto_msgTypes = make([]protoimpl.MessageInfo, 3)
|
||||
var file_app_observatory_command_command_proto_goTypes = []interface{}{
|
||||
(*GetOutboundStatusRequest)(nil), // 0: xray.core.app.observatory.command.GetOutboundStatusRequest
|
||||
(*GetOutboundStatusResponse)(nil), // 1: xray.core.app.observatory.command.GetOutboundStatusResponse
|
||||
(*Config)(nil), // 2: xray.core.app.observatory.command.Config
|
||||
(*observatory.ObservationResult)(nil), // 3: xray.core.app.observatory.ObservationResult
|
||||
}
|
||||
var file_app_observatory_command_command_proto_depIdxs = []int32{
|
||||
3, // 0: xray.core.app.observatory.command.GetOutboundStatusResponse.status:type_name -> xray.core.app.observatory.ObservationResult
|
||||
0, // 1: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:input_type -> xray.core.app.observatory.command.GetOutboundStatusRequest
|
||||
1, // 2: xray.core.app.observatory.command.ObservatoryService.GetOutboundStatus:output_type -> xray.core.app.observatory.command.GetOutboundStatusResponse
|
||||
2, // [2:3] is the sub-list for method output_type
|
||||
1, // [1:2] is the sub-list for method input_type
|
||||
1, // [1:1] is the sub-list for extension type_name
|
||||
1, // [1:1] is the sub-list for extension extendee
|
||||
0, // [0:1] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_observatory_command_command_proto_init() }
|
||||
func file_app_observatory_command_command_proto_init() {
|
||||
if File_app_observatory_command_command_proto != nil {
|
||||
return
|
||||
}
|
||||
if !protoimpl.UnsafeEnabled {
|
||||
file_app_observatory_command_command_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*GetOutboundStatusRequest); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_command_command_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*GetOutboundStatusResponse); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_command_command_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*Config); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
}
|
||||
type x struct{}
|
||||
out := protoimpl.TypeBuilder{
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_observatory_command_command_proto_rawDesc,
|
||||
NumEnums: 0,
|
||||
NumMessages: 3,
|
||||
NumExtensions: 0,
|
||||
NumServices: 1,
|
||||
},
|
||||
GoTypes: file_app_observatory_command_command_proto_goTypes,
|
||||
DependencyIndexes: file_app_observatory_command_command_proto_depIdxs,
|
||||
MessageInfos: file_app_observatory_command_command_proto_msgTypes,
|
||||
}.Build()
|
||||
File_app_observatory_command_command_proto = out.File
|
||||
file_app_observatory_command_command_proto_rawDesc = nil
|
||||
file_app_observatory_command_command_proto_goTypes = nil
|
||||
file_app_observatory_command_command_proto_depIdxs = nil
|
||||
}
|
||||
24
app/observatory/command/command.proto
Normal file
24
app/observatory/command/command.proto
Normal file
@@ -0,0 +1,24 @@
|
||||
syntax = "proto3";
|
||||
|
||||
package xray.core.app.observatory.command;
|
||||
option csharp_namespace = "Xray.Core.App.Observatory.Command";
|
||||
option go_package = "github.com/xtls/xray-core/app/observatory/command";
|
||||
option java_package = "com.xray.core.app.observatory.command";
|
||||
option java_multiple_files = true;
|
||||
|
||||
import "app/observatory/config.proto";
|
||||
|
||||
message GetOutboundStatusRequest {
|
||||
}
|
||||
|
||||
message GetOutboundStatusResponse {
|
||||
xray.core.app.observatory.ObservationResult status = 1;
|
||||
}
|
||||
|
||||
service ObservatoryService {
|
||||
rpc GetOutboundStatus(GetOutboundStatusRequest)
|
||||
returns (GetOutboundStatusResponse) {}
|
||||
}
|
||||
|
||||
|
||||
message Config {}
|
||||
105
app/observatory/command/command_grpc.pb.go
Normal file
105
app/observatory/command/command_grpc.pb.go
Normal file
@@ -0,0 +1,105 @@
|
||||
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
|
||||
// versions:
|
||||
// - protoc-gen-go-grpc v1.2.0
|
||||
// - protoc v3.18.0
|
||||
// source: app/observatory/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
context "context"
|
||||
grpc "google.golang.org/grpc"
|
||||
codes "google.golang.org/grpc/codes"
|
||||
status "google.golang.org/grpc/status"
|
||||
)
|
||||
|
||||
// This is a compile-time assertion to ensure that this generated file
|
||||
// is compatible with the grpc package it is being compiled against.
|
||||
// Requires gRPC-Go v1.32.0 or later.
|
||||
const _ = grpc.SupportPackageIsVersion7
|
||||
|
||||
// ObservatoryServiceClient is the client API for ObservatoryService service.
|
||||
//
|
||||
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
|
||||
type ObservatoryServiceClient interface {
|
||||
GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error)
|
||||
}
|
||||
|
||||
type observatoryServiceClient struct {
|
||||
cc grpc.ClientConnInterface
|
||||
}
|
||||
|
||||
func NewObservatoryServiceClient(cc grpc.ClientConnInterface) ObservatoryServiceClient {
|
||||
return &observatoryServiceClient{cc}
|
||||
}
|
||||
|
||||
func (c *observatoryServiceClient) GetOutboundStatus(ctx context.Context, in *GetOutboundStatusRequest, opts ...grpc.CallOption) (*GetOutboundStatusResponse, error) {
|
||||
out := new(GetOutboundStatusResponse)
|
||||
err := c.cc.Invoke(ctx, "/xray.core.app.observatory.command.ObservatoryService/GetOutboundStatus", in, out, opts...)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return out, nil
|
||||
}
|
||||
|
||||
// ObservatoryServiceServer is the server API for ObservatoryService service.
|
||||
// All implementations must embed UnimplementedObservatoryServiceServer
|
||||
// for forward compatibility
|
||||
type ObservatoryServiceServer interface {
|
||||
GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error)
|
||||
mustEmbedUnimplementedObservatoryServiceServer()
|
||||
}
|
||||
|
||||
// UnimplementedObservatoryServiceServer must be embedded to have forward compatible implementations.
|
||||
type UnimplementedObservatoryServiceServer struct {
|
||||
}
|
||||
|
||||
func (UnimplementedObservatoryServiceServer) GetOutboundStatus(context.Context, *GetOutboundStatusRequest) (*GetOutboundStatusResponse, error) {
|
||||
return nil, status.Errorf(codes.Unimplemented, "method GetOutboundStatus not implemented")
|
||||
}
|
||||
func (UnimplementedObservatoryServiceServer) mustEmbedUnimplementedObservatoryServiceServer() {}
|
||||
|
||||
// UnsafeObservatoryServiceServer may be embedded to opt out of forward compatibility for this service.
|
||||
// Use of this interface is not recommended, as added methods to ObservatoryServiceServer will
|
||||
// result in compilation errors.
|
||||
type UnsafeObservatoryServiceServer interface {
|
||||
mustEmbedUnimplementedObservatoryServiceServer()
|
||||
}
|
||||
|
||||
func RegisterObservatoryServiceServer(s grpc.ServiceRegistrar, srv ObservatoryServiceServer) {
|
||||
s.RegisterService(&ObservatoryService_ServiceDesc, srv)
|
||||
}
|
||||
|
||||
func _ObservatoryService_GetOutboundStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
|
||||
in := new(GetOutboundStatusRequest)
|
||||
if err := dec(in); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if interceptor == nil {
|
||||
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, in)
|
||||
}
|
||||
info := &grpc.UnaryServerInfo{
|
||||
Server: srv,
|
||||
FullMethod: "/xray.core.app.observatory.command.ObservatoryService/GetOutboundStatus",
|
||||
}
|
||||
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
|
||||
return srv.(ObservatoryServiceServer).GetOutboundStatus(ctx, req.(*GetOutboundStatusRequest))
|
||||
}
|
||||
return interceptor(ctx, in, info, handler)
|
||||
}
|
||||
|
||||
// ObservatoryService_ServiceDesc is the grpc.ServiceDesc for ObservatoryService service.
|
||||
// It's only intended for direct use with grpc.RegisterService,
|
||||
// and not to be introspected or modified (even as a copy)
|
||||
var ObservatoryService_ServiceDesc = grpc.ServiceDesc{
|
||||
ServiceName: "xray.core.app.observatory.command.ObservatoryService",
|
||||
HandlerType: (*ObservatoryServiceServer)(nil),
|
||||
Methods: []grpc.MethodDesc{
|
||||
{
|
||||
MethodName: "GetOutboundStatus",
|
||||
Handler: _ObservatoryService_GetOutboundStatus_Handler,
|
||||
},
|
||||
},
|
||||
Streams: []grpc.StreamDesc{},
|
||||
Metadata: "app/observatory/command/command.proto",
|
||||
}
|
||||
530
app/observatory/config.pb.go
Normal file
530
app/observatory/config.pb.go
Normal file
@@ -0,0 +1,530 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/observatory/config.proto
|
||||
|
||||
package observatory
|
||||
|
||||
import (
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
sync "sync"
|
||||
)
|
||||
|
||||
const (
|
||||
// Verify that this generated code is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
|
||||
// Verify that runtime/protoimpl is sufficiently up-to-date.
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
type ObservationResult struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
Status []*OutboundStatus `protobuf:"bytes,1,rep,name=status,proto3" json:"status,omitempty"`
|
||||
}
|
||||
|
||||
func (x *ObservationResult) Reset() {
|
||||
*x = ObservationResult{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[0]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *ObservationResult) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*ObservationResult) ProtoMessage() {}
|
||||
|
||||
func (x *ObservationResult) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[0]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use ObservationResult.ProtoReflect.Descriptor instead.
|
||||
func (*ObservationResult) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_config_proto_rawDescGZIP(), []int{0}
|
||||
}
|
||||
|
||||
func (x *ObservationResult) GetStatus() []*OutboundStatus {
|
||||
if x != nil {
|
||||
return x.Status
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
type OutboundStatus struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// @Document Whether this outbound is usable
|
||||
//@Restriction ReadOnlyForUser
|
||||
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
|
||||
// @Document The time for probe request to finish.
|
||||
//@Type time.ms
|
||||
//@Restriction ReadOnlyForUser
|
||||
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
|
||||
// @Document The last error caused this outbound failed to relay probe request
|
||||
//@Restriction NotMachineReadable
|
||||
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
|
||||
// @Document The outbound tag for this Server
|
||||
//@Type id.outboundTag
|
||||
OutboundTag string `protobuf:"bytes,4,opt,name=outbound_tag,json=outboundTag,proto3" json:"outbound_tag,omitempty"`
|
||||
// @Document The time this outbound is known to be alive
|
||||
//@Type id.outboundTag
|
||||
LastSeenTime int64 `protobuf:"varint,5,opt,name=last_seen_time,json=lastSeenTime,proto3" json:"last_seen_time,omitempty"`
|
||||
// @Document The time this outbound is tried
|
||||
//@Type id.outboundTag
|
||||
LastTryTime int64 `protobuf:"varint,6,opt,name=last_try_time,json=lastTryTime,proto3" json:"last_try_time,omitempty"`
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) Reset() {
|
||||
*x = OutboundStatus{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[1]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*OutboundStatus) ProtoMessage() {}
|
||||
|
||||
func (x *OutboundStatus) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[1]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use OutboundStatus.ProtoReflect.Descriptor instead.
|
||||
func (*OutboundStatus) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_config_proto_rawDescGZIP(), []int{1}
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetAlive() bool {
|
||||
if x != nil {
|
||||
return x.Alive
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetDelay() int64 {
|
||||
if x != nil {
|
||||
return x.Delay
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetLastErrorReason() string {
|
||||
if x != nil {
|
||||
return x.LastErrorReason
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetOutboundTag() string {
|
||||
if x != nil {
|
||||
return x.OutboundTag
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetLastSeenTime() int64 {
|
||||
if x != nil {
|
||||
return x.LastSeenTime
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (x *OutboundStatus) GetLastTryTime() int64 {
|
||||
if x != nil {
|
||||
return x.LastTryTime
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
type ProbeResult struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// @Document Whether this outbound is usable
|
||||
//@Restriction ReadOnlyForUser
|
||||
Alive bool `protobuf:"varint,1,opt,name=alive,proto3" json:"alive,omitempty"`
|
||||
// @Document The time for probe request to finish.
|
||||
//@Type time.ms
|
||||
//@Restriction ReadOnlyForUser
|
||||
Delay int64 `protobuf:"varint,2,opt,name=delay,proto3" json:"delay,omitempty"`
|
||||
// @Document The error caused this outbound failed to relay probe request
|
||||
//@Restriction NotMachineReadable
|
||||
LastErrorReason string `protobuf:"bytes,3,opt,name=last_error_reason,json=lastErrorReason,proto3" json:"last_error_reason,omitempty"`
|
||||
}
|
||||
|
||||
func (x *ProbeResult) Reset() {
|
||||
*x = ProbeResult{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[2]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *ProbeResult) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*ProbeResult) ProtoMessage() {}
|
||||
|
||||
func (x *ProbeResult) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[2]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use ProbeResult.ProtoReflect.Descriptor instead.
|
||||
func (*ProbeResult) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_config_proto_rawDescGZIP(), []int{2}
|
||||
}
|
||||
|
||||
func (x *ProbeResult) GetAlive() bool {
|
||||
if x != nil {
|
||||
return x.Alive
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *ProbeResult) GetDelay() int64 {
|
||||
if x != nil {
|
||||
return x.Delay
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (x *ProbeResult) GetLastErrorReason() string {
|
||||
if x != nil {
|
||||
return x.LastErrorReason
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type Intensity struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// @Document The time interval for a probe request in ms.
|
||||
//@Type time.ms
|
||||
ProbeInterval uint32 `protobuf:"varint,1,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Intensity) Reset() {
|
||||
*x = Intensity{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[3]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *Intensity) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*Intensity) ProtoMessage() {}
|
||||
|
||||
func (x *Intensity) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[3]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use Intensity.ProtoReflect.Descriptor instead.
|
||||
func (*Intensity) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_config_proto_rawDescGZIP(), []int{3}
|
||||
}
|
||||
|
||||
func (x *Intensity) GetProbeInterval() uint32 {
|
||||
if x != nil {
|
||||
return x.ProbeInterval
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// @Document The selectors for outbound under observation
|
||||
SubjectSelector []string `protobuf:"bytes,2,rep,name=subject_selector,json=subjectSelector,proto3" json:"subject_selector,omitempty"`
|
||||
ProbeUrl string `protobuf:"bytes,3,opt,name=probe_url,json=probeUrl,proto3" json:"probe_url,omitempty"`
|
||||
ProbeInterval int64 `protobuf:"varint,4,opt,name=probe_interval,json=probeInterval,proto3" json:"probe_interval,omitempty"`
|
||||
EnableConcurrency bool `protobuf:"varint,5,opt,name=enable_concurrency,json=enableConcurrency,proto3" json:"enable_concurrency,omitempty"`
|
||||
}
|
||||
|
||||
func (x *Config) Reset() {
|
||||
*x = Config{}
|
||||
if protoimpl.UnsafeEnabled {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[4]
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
}
|
||||
|
||||
func (x *Config) String() string {
|
||||
return protoimpl.X.MessageStringOf(x)
|
||||
}
|
||||
|
||||
func (*Config) ProtoMessage() {}
|
||||
|
||||
func (x *Config) ProtoReflect() protoreflect.Message {
|
||||
mi := &file_app_observatory_config_proto_msgTypes[4]
|
||||
if protoimpl.UnsafeEnabled && x != nil {
|
||||
ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
|
||||
if ms.LoadMessageInfo() == nil {
|
||||
ms.StoreMessageInfo(mi)
|
||||
}
|
||||
return ms
|
||||
}
|
||||
return mi.MessageOf(x)
|
||||
}
|
||||
|
||||
// Deprecated: Use Config.ProtoReflect.Descriptor instead.
|
||||
func (*Config) Descriptor() ([]byte, []int) {
|
||||
return file_app_observatory_config_proto_rawDescGZIP(), []int{4}
|
||||
}
|
||||
|
||||
func (x *Config) GetSubjectSelector() []string {
|
||||
if x != nil {
|
||||
return x.SubjectSelector
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *Config) GetProbeUrl() string {
|
||||
if x != nil {
|
||||
return x.ProbeUrl
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *Config) GetProbeInterval() int64 {
|
||||
if x != nil {
|
||||
return x.ProbeInterval
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
func (x *Config) GetEnableConcurrency() bool {
|
||||
if x != nil {
|
||||
return x.EnableConcurrency
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
var File_app_observatory_config_proto protoreflect.FileDescriptor
|
||||
|
||||
var file_app_observatory_config_proto_rawDesc = []byte{
|
||||
0x0a, 0x1c, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72,
|
||||
0x79, 0x2f, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x19,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62,
|
||||
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x22, 0x56, 0x0a, 0x11, 0x4f, 0x62, 0x73,
|
||||
0x65, 0x72, 0x76, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x12, 0x41,
|
||||
0x0a, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x29,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x72, 0x65, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f,
|
||||
0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x2e, 0x4f, 0x75, 0x74, 0x62, 0x6f,
|
||||
0x75, 0x6e, 0x64, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x06, 0x73, 0x74, 0x61, 0x74, 0x75,
|
||||
0x73, 0x22, 0xd5, 0x01, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x74,
|
||||
0x61, 0x74, 0x75, 0x73, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x18, 0x01, 0x20,
|
||||
0x01, 0x28, 0x08, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x12, 0x14, 0x0a, 0x05, 0x64, 0x65,
|
||||
0x6c, 0x61, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x64, 0x65, 0x6c, 0x61, 0x79,
|
||||
0x12, 0x2a, 0x0a, 0x11, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x72,
|
||||
0x65, 0x61, 0x73, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x6c, 0x61, 0x73,
|
||||
0x74, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x52, 0x65, 0x61, 0x73, 0x6f, 0x6e, 0x12, 0x21, 0x0a, 0x0c,
|
||||
0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x04, 0x20, 0x01,
|
||||
0x28, 0x09, 0x52, 0x0b, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12,
|
||||
0x24, 0x0a, 0x0e, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x73, 0x65, 0x65, 0x6e, 0x5f, 0x74, 0x69, 0x6d,
|
||||
0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, 0x6c, 0x61, 0x73, 0x74, 0x53, 0x65, 0x65,
|
||||
0x6e, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x74, 0x72,
|
||||
0x79, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x6c, 0x61,
|
||||
0x73, 0x74, 0x54, 0x72, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x22, 0x65, 0x0a, 0x0b, 0x50, 0x72, 0x6f,
|
||||
0x62, 0x65, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x76,
|
||||
0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x76, 0x65, 0x12, 0x14,
|
||||
0x0a, 0x05, 0x64, 0x65, 0x6c, 0x61, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x64,
|
||||
0x65, 0x6c, 0x61, 0x79, 0x12, 0x2a, 0x0a, 0x11, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x65, 0x72, 0x72,
|
||||
0x6f, 0x72, 0x5f, 0x72, 0x65, 0x61, 0x73, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52,
|
||||
0x0f, 0x6c, 0x61, 0x73, 0x74, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x52, 0x65, 0x61, 0x73, 0x6f, 0x6e,
|
||||
0x22, 0x32, 0x0a, 0x09, 0x49, 0x6e, 0x74, 0x65, 0x6e, 0x73, 0x69, 0x74, 0x79, 0x12, 0x25, 0x0a,
|
||||
0x0e, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x18,
|
||||
0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x49, 0x6e, 0x74, 0x65,
|
||||
0x72, 0x76, 0x61, 0x6c, 0x22, 0xa6, 0x01, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12,
|
||||
0x29, 0x0a, 0x10, 0x73, 0x75, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63,
|
||||
0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0f, 0x73, 0x75, 0x62, 0x6a, 0x65,
|
||||
0x63, 0x74, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x12, 0x1b, 0x0a, 0x09, 0x70, 0x72,
|
||||
0x6f, 0x62, 0x65, 0x5f, 0x75, 0x72, 0x6c, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x70,
|
||||
0x72, 0x6f, 0x62, 0x65, 0x55, 0x72, 0x6c, 0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x62, 0x65,
|
||||
0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52,
|
||||
0x0d, 0x70, 0x72, 0x6f, 0x62, 0x65, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x12, 0x2d,
|
||||
0x0a, 0x12, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72,
|
||||
0x65, 0x6e, 0x63, 0x79, 0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x11, 0x65, 0x6e, 0x61, 0x62,
|
||||
0x6c, 0x65, 0x43, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x42, 0x5e, 0x0a,
|
||||
0x18, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x6f, 0x62,
|
||||
0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x50, 0x01, 0x5a, 0x29, 0x67, 0x69, 0x74,
|
||||
0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x6f, 0x62, 0x73, 0x65, 0x72,
|
||||
0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0xaa, 0x02, 0x14, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
|
||||
0x70, 0x2e, 0x4f, 0x62, 0x73, 0x65, 0x72, 0x76, 0x61, 0x74, 0x6f, 0x72, 0x79, 0x62, 0x06, 0x70,
|
||||
0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
file_app_observatory_config_proto_rawDescOnce sync.Once
|
||||
file_app_observatory_config_proto_rawDescData = file_app_observatory_config_proto_rawDesc
|
||||
)
|
||||
|
||||
func file_app_observatory_config_proto_rawDescGZIP() []byte {
|
||||
file_app_observatory_config_proto_rawDescOnce.Do(func() {
|
||||
file_app_observatory_config_proto_rawDescData = protoimpl.X.CompressGZIP(file_app_observatory_config_proto_rawDescData)
|
||||
})
|
||||
return file_app_observatory_config_proto_rawDescData
|
||||
}
|
||||
|
||||
var file_app_observatory_config_proto_msgTypes = make([]protoimpl.MessageInfo, 5)
|
||||
var file_app_observatory_config_proto_goTypes = []interface{}{
|
||||
(*ObservationResult)(nil), // 0: xray.core.app.observatory.ObservationResult
|
||||
(*OutboundStatus)(nil), // 1: xray.core.app.observatory.OutboundStatus
|
||||
(*ProbeResult)(nil), // 2: xray.core.app.observatory.ProbeResult
|
||||
(*Intensity)(nil), // 3: xray.core.app.observatory.Intensity
|
||||
(*Config)(nil), // 4: xray.core.app.observatory.Config
|
||||
}
|
||||
var file_app_observatory_config_proto_depIdxs = []int32{
|
||||
1, // 0: xray.core.app.observatory.ObservationResult.status:type_name -> xray.core.app.observatory.OutboundStatus
|
||||
1, // [1:1] is the sub-list for method output_type
|
||||
1, // [1:1] is the sub-list for method input_type
|
||||
1, // [1:1] is the sub-list for extension type_name
|
||||
1, // [1:1] is the sub-list for extension extendee
|
||||
0, // [0:1] is the sub-list for field type_name
|
||||
}
|
||||
|
||||
func init() { file_app_observatory_config_proto_init() }
|
||||
func file_app_observatory_config_proto_init() {
|
||||
if File_app_observatory_config_proto != nil {
|
||||
return
|
||||
}
|
||||
if !protoimpl.UnsafeEnabled {
|
||||
file_app_observatory_config_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*ObservationResult); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_config_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*OutboundStatus); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_config_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*ProbeResult); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_config_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*Intensity); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
file_app_observatory_config_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} {
|
||||
switch v := v.(*Config); i {
|
||||
case 0:
|
||||
return &v.state
|
||||
case 1:
|
||||
return &v.sizeCache
|
||||
case 2:
|
||||
return &v.unknownFields
|
||||
default:
|
||||
return nil
|
||||
}
|
||||
}
|
||||
}
|
||||
type x struct{}
|
||||
out := protoimpl.TypeBuilder{
|
||||
File: protoimpl.DescBuilder{
|
||||
GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
|
||||
RawDescriptor: file_app_observatory_config_proto_rawDesc,
|
||||
NumEnums: 0,
|
||||
NumMessages: 5,
|
||||
NumExtensions: 0,
|
||||
NumServices: 0,
|
||||
},
|
||||
GoTypes: file_app_observatory_config_proto_goTypes,
|
||||
DependencyIndexes: file_app_observatory_config_proto_depIdxs,
|
||||
MessageInfos: file_app_observatory_config_proto_msgTypes,
|
||||
}.Build()
|
||||
File_app_observatory_config_proto = out.File
|
||||
file_app_observatory_config_proto_rawDesc = nil
|
||||
file_app_observatory_config_proto_goTypes = nil
|
||||
file_app_observatory_config_proto_depIdxs = nil
|
||||
}
|
||||
73
app/observatory/config.proto
Normal file
73
app/observatory/config.proto
Normal file
@@ -0,0 +1,73 @@
|
||||
syntax = "proto3";
|
||||
|
||||
package xray.core.app.observatory;
|
||||
option csharp_namespace = "Xray.App.Observatory";
|
||||
option go_package = "github.com/xtls/xray-core/app/observatory";
|
||||
option java_package = "com.xray.app.observatory";
|
||||
option java_multiple_files = true;
|
||||
|
||||
message ObservationResult {
|
||||
repeated OutboundStatus status = 1;
|
||||
}
|
||||
|
||||
message OutboundStatus{
|
||||
/* @Document Whether this outbound is usable
|
||||
@Restriction ReadOnlyForUser
|
||||
*/
|
||||
bool alive = 1;
|
||||
/* @Document The time for probe request to finish.
|
||||
@Type time.ms
|
||||
@Restriction ReadOnlyForUser
|
||||
*/
|
||||
int64 delay = 2;
|
||||
/* @Document The last error caused this outbound failed to relay probe request
|
||||
@Restriction NotMachineReadable
|
||||
*/
|
||||
string last_error_reason = 3;
|
||||
/* @Document The outbound tag for this Server
|
||||
@Type id.outboundTag
|
||||
*/
|
||||
string outbound_tag = 4;
|
||||
/* @Document The time this outbound is known to be alive
|
||||
@Type id.outboundTag
|
||||
*/
|
||||
int64 last_seen_time = 5;
|
||||
/* @Document The time this outbound is tried
|
||||
@Type id.outboundTag
|
||||
*/
|
||||
int64 last_try_time = 6;
|
||||
}
|
||||
|
||||
message ProbeResult{
|
||||
/* @Document Whether this outbound is usable
|
||||
@Restriction ReadOnlyForUser
|
||||
*/
|
||||
bool alive = 1;
|
||||
/* @Document The time for probe request to finish.
|
||||
@Type time.ms
|
||||
@Restriction ReadOnlyForUser
|
||||
*/
|
||||
int64 delay = 2;
|
||||
/* @Document The error caused this outbound failed to relay probe request
|
||||
@Restriction NotMachineReadable
|
||||
*/
|
||||
string last_error_reason = 3;
|
||||
}
|
||||
|
||||
message Intensity{
|
||||
/* @Document The time interval for a probe request in ms.
|
||||
@Type time.ms
|
||||
*/
|
||||
uint32 probe_interval = 1;
|
||||
}
|
||||
message Config {
|
||||
/* @Document The selectors for outbound under observation
|
||||
*/
|
||||
repeated string subject_selector = 2;
|
||||
|
||||
string probe_url = 3;
|
||||
|
||||
int64 probe_interval = 4;
|
||||
|
||||
bool enable_concurrency = 5;
|
||||
}
|
||||
9
app/observatory/errors.generated.go
Normal file
9
app/observatory/errors.generated.go
Normal file
@@ -0,0 +1,9 @@
|
||||
package observatory
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errPathObjHolder struct{}
|
||||
|
||||
func newError(values ...interface{}) *errors.Error {
|
||||
return errors.New(values...).WithPathObj(errPathObjHolder{})
|
||||
}
|
||||
26
app/observatory/explainErrors.go
Normal file
26
app/observatory/explainErrors.go
Normal file
@@ -0,0 +1,26 @@
|
||||
package observatory
|
||||
|
||||
import "github.com/xtls/xray-core/common/errors"
|
||||
|
||||
type errorCollector struct {
|
||||
errors *errors.Error
|
||||
}
|
||||
|
||||
func (e *errorCollector) SubmitError(err error) {
|
||||
if e.errors == nil {
|
||||
e.errors = newError("underlying connection error").Base(err)
|
||||
return
|
||||
}
|
||||
e.errors = e.errors.Base(newError("underlying connection error").Base(err))
|
||||
}
|
||||
|
||||
func newErrorCollector() *errorCollector {
|
||||
return &errorCollector{}
|
||||
}
|
||||
|
||||
func (e *errorCollector) UnderlyingError() error {
|
||||
if e.errors == nil {
|
||||
return newError("failed to produce report")
|
||||
}
|
||||
return e.errors
|
||||
}
|
||||
3
app/observatory/observatory.go
Normal file
3
app/observatory/observatory.go
Normal file
@@ -0,0 +1,3 @@
|
||||
package observatory
|
||||
|
||||
//go:generate go run github.com/xtls/xray-core/common/errors/errorgen
|
||||
238
app/observatory/observer.go
Normal file
238
app/observatory/observer.go
Normal file
@@ -0,0 +1,238 @@
|
||||
package observatory
|
||||
|
||||
import (
|
||||
"context"
|
||||
"net"
|
||||
"net/http"
|
||||
"net/url"
|
||||
"sort"
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
"github.com/golang/protobuf/proto"
|
||||
"github.com/xtls/xray-core/common"
|
||||
v2net "github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/common/signal/done"
|
||||
"github.com/xtls/xray-core/common/task"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/extension"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/transport/internet/tagged"
|
||||
)
|
||||
|
||||
type Observer struct {
|
||||
config *Config
|
||||
ctx context.Context
|
||||
|
||||
statusLock sync.Mutex
|
||||
status []*OutboundStatus
|
||||
|
||||
finished *done.Instance
|
||||
|
||||
ohm outbound.Manager
|
||||
}
|
||||
|
||||
func (o *Observer) GetObservation(ctx context.Context) (proto.Message, error) {
|
||||
return &ObservationResult{Status: o.status}, nil
|
||||
}
|
||||
|
||||
func (o *Observer) Type() interface{} {
|
||||
return extension.ObservatoryType()
|
||||
}
|
||||
|
||||
func (o *Observer) Start() error {
|
||||
if o.config != nil && len(o.config.SubjectSelector) != 0 {
|
||||
o.finished = done.New()
|
||||
go o.background()
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (o *Observer) Close() error {
|
||||
if o.finished != nil {
|
||||
return o.finished.Close()
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
func (o *Observer) background() {
|
||||
for !o.finished.Done() {
|
||||
hs, ok := o.ohm.(outbound.HandlerSelector)
|
||||
if !ok {
|
||||
newError("outbound.Manager is not a HandlerSelector").WriteToLog()
|
||||
return
|
||||
}
|
||||
|
||||
outbounds := hs.Select(o.config.SubjectSelector)
|
||||
|
||||
o.updateStatus(outbounds)
|
||||
|
||||
sleepTime := time.Second * 10
|
||||
if o.config.ProbeInterval != 0 {
|
||||
sleepTime = time.Duration(o.config.ProbeInterval)
|
||||
}
|
||||
|
||||
if !o.config.EnableConcurrency {
|
||||
sort.Strings(outbounds)
|
||||
for _, v := range outbounds {
|
||||
result := o.probe(v)
|
||||
o.updateStatusForResult(v, &result)
|
||||
if o.finished.Done() {
|
||||
return
|
||||
}
|
||||
time.Sleep(sleepTime)
|
||||
}
|
||||
continue
|
||||
}
|
||||
|
||||
ch := make(chan struct{}, len(outbounds))
|
||||
|
||||
for _, v := range outbounds {
|
||||
go func(v string) {
|
||||
result := o.probe(v)
|
||||
o.updateStatusForResult(v, &result)
|
||||
ch <- struct{}{}
|
||||
}(v)
|
||||
}
|
||||
|
||||
for range outbounds {
|
||||
select {
|
||||
case <-ch:
|
||||
case <-o.finished.Wait():
|
||||
return
|
||||
}
|
||||
}
|
||||
time.Sleep(sleepTime)
|
||||
}
|
||||
}
|
||||
|
||||
func (o *Observer) updateStatus(outbounds []string) {
|
||||
o.statusLock.Lock()
|
||||
defer o.statusLock.Unlock()
|
||||
// TODO should remove old inbound that is removed
|
||||
_ = outbounds
|
||||
}
|
||||
|
||||
func (o *Observer) probe(outbound string) ProbeResult {
|
||||
errorCollectorForRequest := newErrorCollector()
|
||||
|
||||
httpTransport := http.Transport{
|
||||
Proxy: func(*http.Request) (*url.URL, error) {
|
||||
return nil, nil
|
||||
},
|
||||
DialContext: func(ctx context.Context, network string, addr string) (net.Conn, error) {
|
||||
var connection net.Conn
|
||||
taskErr := task.Run(ctx, func() error {
|
||||
// MUST use Xray's built in context system
|
||||
dest, err := v2net.ParseDestination(network + ":" + addr)
|
||||
if err != nil {
|
||||
return newError("cannot understand address").Base(err)
|
||||
}
|
||||
trackedCtx := session.TrackedConnectionError(o.ctx, errorCollectorForRequest)
|
||||
conn, err := tagged.Dialer(trackedCtx, dest, outbound)
|
||||
if err != nil {
|
||||
return newError("cannot dial remote address ", dest).Base(err)
|
||||
}
|
||||
connection = conn
|
||||
return nil
|
||||
})
|
||||
if taskErr != nil {
|
||||
return nil, newError("cannot finish connection").Base(taskErr)
|
||||
}
|
||||
return connection, nil
|
||||
},
|
||||
TLSHandshakeTimeout: time.Second * 5,
|
||||
}
|
||||
httpClient := &http.Client{
|
||||
Transport: &httpTransport,
|
||||
CheckRedirect: func(req *http.Request, via []*http.Request) error {
|
||||
return http.ErrUseLastResponse
|
||||
},
|
||||
Jar: nil,
|
||||
Timeout: time.Second * 5,
|
||||
}
|
||||
var GETTime time.Duration
|
||||
err := task.Run(o.ctx, func() error {
|
||||
startTime := time.Now()
|
||||
probeURL := "https://www.google.com/generate_204"
|
||||
if o.config.ProbeUrl != "" {
|
||||
probeURL = o.config.ProbeUrl
|
||||
}
|
||||
response, err := httpClient.Get(probeURL)
|
||||
if err != nil {
|
||||
return newError("outbound failed to relay connection").Base(err)
|
||||
}
|
||||
if response.Body != nil {
|
||||
response.Body.Close()
|
||||
}
|
||||
endTime := time.Now()
|
||||
GETTime = endTime.Sub(startTime)
|
||||
return nil
|
||||
})
|
||||
if err != nil {
|
||||
fullerr := newError("underlying connection failed").Base(errorCollectorForRequest.UnderlyingError())
|
||||
fullerr = newError("with outbound handler report").Base(fullerr)
|
||||
fullerr = newError("GET request failed:", err).Base(fullerr)
|
||||
fullerr = newError("the outbound ", outbound, " is dead:").Base(fullerr)
|
||||
fullerr = fullerr.AtInfo()
|
||||
fullerr.WriteToLog()
|
||||
return ProbeResult{Alive: false, LastErrorReason: fullerr.Error()}
|
||||
}
|
||||
newError("the outbound ", outbound, " is alive:", GETTime.Seconds()).AtInfo().WriteToLog()
|
||||
return ProbeResult{Alive: true, Delay: GETTime.Milliseconds()}
|
||||
}
|
||||
|
||||
func (o *Observer) updateStatusForResult(outbound string, result *ProbeResult) {
|
||||
o.statusLock.Lock()
|
||||
defer o.statusLock.Unlock()
|
||||
var status *OutboundStatus
|
||||
if location := o.findStatusLocationLockHolderOnly(outbound); location != -1 {
|
||||
status = o.status[location]
|
||||
} else {
|
||||
status = &OutboundStatus{}
|
||||
o.status = append(o.status, status)
|
||||
}
|
||||
|
||||
status.LastTryTime = time.Now().Unix()
|
||||
status.OutboundTag = outbound
|
||||
status.Alive = result.Alive
|
||||
if result.Alive {
|
||||
status.Delay = result.Delay
|
||||
status.LastSeenTime = status.LastTryTime
|
||||
status.LastErrorReason = ""
|
||||
} else {
|
||||
status.LastErrorReason = result.LastErrorReason
|
||||
status.Delay = 99999999
|
||||
}
|
||||
}
|
||||
|
||||
func (o *Observer) findStatusLocationLockHolderOnly(outbound string) int {
|
||||
for i, v := range o.status {
|
||||
if v.OutboundTag == outbound {
|
||||
return i
|
||||
}
|
||||
}
|
||||
return -1
|
||||
}
|
||||
|
||||
func New(ctx context.Context, config *Config) (*Observer, error) {
|
||||
var outboundManager outbound.Manager
|
||||
err := core.RequireFeatures(ctx, func(om outbound.Manager) {
|
||||
outboundManager = om
|
||||
})
|
||||
if err != nil {
|
||||
return nil, newError("Cannot get depended features").Base(err)
|
||||
}
|
||||
return &Observer{
|
||||
config: config,
|
||||
ctx: ctx,
|
||||
ohm: outboundManager,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
return New(ctx, config.(*Config))
|
||||
}))
|
||||
}
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/policy/config.proto
|
||||
|
||||
package policy
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Second struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -3,13 +3,12 @@ package command
|
||||
import (
|
||||
"context"
|
||||
|
||||
grpc "google.golang.org/grpc"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/inbound"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/proxy"
|
||||
grpc "google.golang.org/grpc"
|
||||
)
|
||||
|
||||
// InboundOperation is the interface for operations that applies to inbound handlers.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/proxyman/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protocol "github.com/xtls/xray-core/common/protocol"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
core "github.com/xtls/xray-core/core"
|
||||
@@ -24,10 +23,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type AddUserOperation struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,4 +1,8 @@
|
||||
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
|
||||
// versions:
|
||||
// - protoc-gen-go-grpc v1.2.0
|
||||
// - protoc v3.18.0
|
||||
// source: app/proxyman/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/proxyman/config.proto
|
||||
|
||||
package proxyman
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
serial "github.com/xtls/xray-core/common/serial"
|
||||
internet "github.com/xtls/xray-core/transport/internet"
|
||||
@@ -24,10 +23,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type KnownProtocols int32
|
||||
|
||||
const (
|
||||
@@ -239,9 +234,14 @@ type SniffingConfig struct {
|
||||
// Whether or not to enable content sniffing on an inbound connection.
|
||||
Enabled bool `protobuf:"varint,1,opt,name=enabled,proto3" json:"enabled,omitempty"`
|
||||
// Override target destination if sniff'ed protocol is in the given list.
|
||||
// Supported values are "http", "tls".
|
||||
// Supported values are "http", "tls", "fakedns".
|
||||
DestinationOverride []string `protobuf:"bytes,2,rep,name=destination_override,json=destinationOverride,proto3" json:"destination_override,omitempty"`
|
||||
DomainsExcluded []string `protobuf:"bytes,3,rep,name=domains_excluded,json=domainsExcluded,proto3" json:"domains_excluded,omitempty"`
|
||||
// Whether should only try to sniff metadata without waiting for client input.
|
||||
// Can be used to support SMTP like protocol where server send the first
|
||||
// message.
|
||||
MetadataOnly bool `protobuf:"varint,4,opt,name=metadata_only,json=metadataOnly,proto3" json:"metadata_only,omitempty"`
|
||||
RouteOnly bool `protobuf:"varint,5,opt,name=route_only,json=routeOnly,proto3" json:"route_only,omitempty"`
|
||||
}
|
||||
|
||||
func (x *SniffingConfig) Reset() {
|
||||
@@ -297,13 +297,27 @@ func (x *SniffingConfig) GetDomainsExcluded() []string {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *SniffingConfig) GetMetadataOnly() bool {
|
||||
if x != nil {
|
||||
return x.MetadataOnly
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
func (x *SniffingConfig) GetRouteOnly() bool {
|
||||
if x != nil {
|
||||
return x.RouteOnly
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type ReceiverConfig struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
// PortRange specifies the ports which the Receiver should listen on.
|
||||
PortRange *net.PortRange `protobuf:"bytes,1,opt,name=port_range,json=portRange,proto3" json:"port_range,omitempty"`
|
||||
// PortList specifies the ports which the Receiver should listen on.
|
||||
PortList *net.PortList `protobuf:"bytes,1,opt,name=port_list,json=portList,proto3" json:"port_list,omitempty"`
|
||||
// Listen specifies the IP address that the Receiver should listen on.
|
||||
Listen *net.IPOrDomain `protobuf:"bytes,2,opt,name=listen,proto3" json:"listen,omitempty"`
|
||||
AllocationStrategy *AllocationStrategy `protobuf:"bytes,3,opt,name=allocation_strategy,json=allocationStrategy,proto3" json:"allocation_strategy,omitempty"`
|
||||
@@ -349,9 +363,9 @@ func (*ReceiverConfig) Descriptor() ([]byte, []int) {
|
||||
return file_app_proxyman_config_proto_rawDescGZIP(), []int{3}
|
||||
}
|
||||
|
||||
func (x *ReceiverConfig) GetPortRange() *net.PortRange {
|
||||
func (x *ReceiverConfig) GetPortList() *net.PortList {
|
||||
if x != nil {
|
||||
return x.PortRange
|
||||
return x.PortList
|
||||
}
|
||||
return nil
|
||||
}
|
||||
@@ -764,7 +778,7 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
|
||||
0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x22, 0x2c, 0x0a, 0x04, 0x54, 0x79, 0x70, 0x65, 0x12,
|
||||
0x0a, 0x0a, 0x06, 0x41, 0x6c, 0x77, 0x61, 0x79, 0x73, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x52,
|
||||
0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x10, 0x01, 0x12, 0x0c, 0x0a, 0x08, 0x45, 0x78, 0x74, 0x65, 0x72,
|
||||
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0x88, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
|
||||
0x6e, 0x61, 0x6c, 0x10, 0x02, 0x22, 0xcc, 0x01, 0x0a, 0x0e, 0x53, 0x6e, 0x69, 0x66, 0x66, 0x69,
|
||||
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62,
|
||||
0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c,
|
||||
0x65, 0x64, 0x12, 0x31, 0x0a, 0x14, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f,
|
||||
@@ -773,86 +787,90 @@ var file_app_proxyman_config_proto_rawDesc = []byte{
|
||||
0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x29, 0x0a, 0x10, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73,
|
||||
0x5f, 0x65, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64, 0x18, 0x03, 0x20, 0x03, 0x28, 0x09, 0x52,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x73, 0x45, 0x78, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x64,
|
||||
0x22, 0x90, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x43, 0x6f, 0x6e,
|
||||
0x66, 0x69, 0x67, 0x12, 0x39, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67,
|
||||
0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
|
||||
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61,
|
||||
0x6e, 0x67, 0x65, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x33,
|
||||
0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
|
||||
0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69, 0x73,
|
||||
0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f,
|
||||
0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
|
||||
0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78,
|
||||
0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53,
|
||||
0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74,
|
||||
0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f, 0x73,
|
||||
0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04,
|
||||
0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e,
|
||||
0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53,
|
||||
0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72,
|
||||
0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c, 0x72,
|
||||
0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f,
|
||||
0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28,
|
||||
0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69, 0x6e,
|
||||
0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e, 0x0a,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65,
|
||||
0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e,
|
||||
0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e, 0x64,
|
||||
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e, 0x0a,
|
||||
0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e,
|
||||
0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e, 0x69,
|
||||
0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e, 0x69,
|
||||
0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04, 0x08,
|
||||
0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x48,
|
||||
0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a, 0x03,
|
||||
0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x4d,
|
||||
0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
||||
0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54,
|
||||
0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65, 0x63,
|
||||
0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47, 0x0a,
|
||||
0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
||||
0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d,
|
||||
0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65, 0x64,
|
||||
0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
|
||||
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f, 0x75,
|
||||
0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65, 0x6e,
|
||||
0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69, 0x61,
|
||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d,
|
||||
0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72, 0x65,
|
||||
0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72, 0x65,
|
||||
0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61, 0x6d,
|
||||
0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78,
|
||||
0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b,
|
||||
0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f, 0x72,
|
||||
0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79,
|
||||
0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65, 0x74,
|
||||
0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c,
|
||||
0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28,
|
||||
0x12, 0x23, 0x0a, 0x0d, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6f, 0x6e, 0x6c,
|
||||
0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0c, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74,
|
||||
0x61, 0x4f, 0x6e, 0x6c, 0x79, 0x12, 0x1d, 0x0a, 0x0a, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x5f, 0x6f,
|
||||
0x6e, 0x6c, 0x79, 0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x09, 0x72, 0x6f, 0x75, 0x74, 0x65,
|
||||
0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x8d, 0x04, 0x0a, 0x0e, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65,
|
||||
0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x36, 0x0a, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x5f,
|
||||
0x6c, 0x69, 0x73, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72,
|
||||
0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12,
|
||||
0x33, 0x0a, 0x06, 0x6c, 0x69, 0x73, 0x74, 0x65, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32,
|
||||
0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65,
|
||||
0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x6c, 0x69,
|
||||
0x73, 0x74, 0x65, 0x6e, 0x12, 0x56, 0x0a, 0x13, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69,
|
||||
0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69,
|
||||
0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
|
||||
0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x50, 0x0a, 0x12, 0x4d,
|
||||
0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69,
|
||||
0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01,
|
||||
0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a, 0x0b, 0x63,
|
||||
0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d,
|
||||
0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x2a, 0x23, 0x0a,
|
||||
0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x12,
|
||||
0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a, 0x03, 0x54, 0x4c, 0x53,
|
||||
0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
|
||||
0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50, 0x01, 0x5a, 0x26, 0x67,
|
||||
0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70,
|
||||
0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f,
|
||||
0x33,
|
||||
0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e,
|
||||
0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x12, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61,
|
||||
0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x4e, 0x0a, 0x0f,
|
||||
0x73, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18,
|
||||
0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61,
|
||||
0x6e, 0x73, 0x70, 0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e,
|
||||
0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74,
|
||||
0x72, 0x65, 0x61, 0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x40, 0x0a, 0x1c,
|
||||
0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x5f, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c,
|
||||
0x5f, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01,
|
||||
0x28, 0x08, 0x52, 0x1a, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x4f, 0x72, 0x69, 0x67, 0x69,
|
||||
0x6e, 0x61, 0x6c, 0x44, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4e,
|
||||
0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x6f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64,
|
||||
0x65, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61,
|
||||
0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4b, 0x6e, 0x6f, 0x77,
|
||||
0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0e,
|
||||
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4f, 0x76, 0x65, 0x72, 0x72, 0x69, 0x64, 0x65, 0x12, 0x4e,
|
||||
0x0a, 0x11, 0x73, 0x6e, 0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69,
|
||||
0x6e, 0x67, 0x73, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x53, 0x6e,
|
||||
0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x10, 0x73, 0x6e,
|
||||
0x69, 0x66, 0x66, 0x69, 0x6e, 0x67, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x4a, 0x04,
|
||||
0x08, 0x06, 0x10, 0x07, 0x22, 0xc0, 0x01, 0x0a, 0x14, 0x49, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64,
|
||||
0x48, 0x61, 0x6e, 0x64, 0x6c, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x10, 0x0a,
|
||||
0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12,
|
||||
0x4d, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x74, 0x74,
|
||||
0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61,
|
||||
0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e,
|
||||
0x54, 0x79, 0x70, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x10, 0x72, 0x65,
|
||||
0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x47,
|
||||
0x0a, 0x0e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73,
|
||||
0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f,
|
||||
0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x2e, 0x54, 0x79, 0x70, 0x65,
|
||||
0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53,
|
||||
0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x10, 0x0a, 0x0e, 0x4f, 0x75, 0x74, 0x62, 0x6f,
|
||||
0x75, 0x6e, 0x64, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x22, 0xb0, 0x02, 0x0a, 0x0c, 0x53, 0x65,
|
||||
0x6e, 0x64, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x2d, 0x0a, 0x03, 0x76, 0x69,
|
||||
0x61, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
|
||||
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x49, 0x50, 0x4f, 0x72, 0x44, 0x6f,
|
||||
0x6d, 0x61, 0x69, 0x6e, 0x52, 0x03, 0x76, 0x69, 0x61, 0x12, 0x4e, 0x0a, 0x0f, 0x73, 0x74, 0x72,
|
||||
0x65, 0x61, 0x6d, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x02, 0x20, 0x01,
|
||||
0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70,
|
||||
0x6f, 0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x53, 0x74, 0x72,
|
||||
0x65, 0x61, 0x6d, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0e, 0x73, 0x74, 0x72, 0x65, 0x61,
|
||||
0x6d, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x4b, 0x0a, 0x0e, 0x70, 0x72, 0x6f,
|
||||
0x78, 0x79, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x24, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x2e, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x72, 0x6f, 0x78,
|
||||
0x79, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x0d, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x53, 0x65,
|
||||
0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x12, 0x54, 0x0a, 0x12, 0x6d, 0x75, 0x6c, 0x74, 0x69, 0x70,
|
||||
0x6c, 0x65, 0x78, 0x5f, 0x73, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x18, 0x04, 0x20, 0x01,
|
||||
0x28, 0x0b, 0x32, 0x25, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x70, 0x72,
|
||||
0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x2e, 0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78,
|
||||
0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x52, 0x11, 0x6d, 0x75, 0x6c, 0x74, 0x69,
|
||||
0x70, 0x6c, 0x65, 0x78, 0x53, 0x65, 0x74, 0x74, 0x69, 0x6e, 0x67, 0x73, 0x22, 0x50, 0x0a, 0x12,
|
||||
0x4d, 0x75, 0x6c, 0x74, 0x69, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x6e, 0x67, 0x43, 0x6f, 0x6e, 0x66,
|
||||
0x69, 0x67, 0x12, 0x18, 0x0a, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x18, 0x01, 0x20,
|
||||
0x01, 0x28, 0x08, 0x52, 0x07, 0x65, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x64, 0x12, 0x20, 0x0a, 0x0b,
|
||||
0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28,
|
||||
0x0d, 0x52, 0x0b, 0x63, 0x6f, 0x6e, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x79, 0x2a, 0x23,
|
||||
0x0a, 0x0e, 0x4b, 0x6e, 0x6f, 0x77, 0x6e, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x73,
|
||||
0x12, 0x08, 0x0a, 0x04, 0x48, 0x54, 0x54, 0x50, 0x10, 0x00, 0x12, 0x07, 0x0a, 0x03, 0x54, 0x4c,
|
||||
0x53, 0x10, 0x01, 0x42, 0x55, 0x0a, 0x15, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x50, 0x01, 0x5a, 0x26,
|
||||
0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x70, 0x72,
|
||||
0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0xaa, 0x02, 0x11, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70,
|
||||
0x70, 0x2e, 0x50, 0x72, 0x6f, 0x78, 0x79, 0x6d, 0x61, 0x6e, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74,
|
||||
0x6f, 0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
@@ -882,7 +900,7 @@ var file_app_proxyman_config_proto_goTypes = []interface{}{
|
||||
(*MultiplexingConfig)(nil), // 9: xray.app.proxyman.MultiplexingConfig
|
||||
(*AllocationStrategy_AllocationStrategyConcurrency)(nil), // 10: xray.app.proxyman.AllocationStrategy.AllocationStrategyConcurrency
|
||||
(*AllocationStrategy_AllocationStrategyRefresh)(nil), // 11: xray.app.proxyman.AllocationStrategy.AllocationStrategyRefresh
|
||||
(*net.PortRange)(nil), // 12: xray.common.net.PortRange
|
||||
(*net.PortList)(nil), // 12: xray.common.net.PortList
|
||||
(*net.IPOrDomain)(nil), // 13: xray.common.net.IPOrDomain
|
||||
(*internet.StreamConfig)(nil), // 14: xray.transport.internet.StreamConfig
|
||||
(*serial.TypedMessage)(nil), // 15: xray.common.serial.TypedMessage
|
||||
@@ -892,7 +910,7 @@ var file_app_proxyman_config_proto_depIdxs = []int32{
|
||||
1, // 0: xray.app.proxyman.AllocationStrategy.type:type_name -> xray.app.proxyman.AllocationStrategy.Type
|
||||
10, // 1: xray.app.proxyman.AllocationStrategy.concurrency:type_name -> xray.app.proxyman.AllocationStrategy.AllocationStrategyConcurrency
|
||||
11, // 2: xray.app.proxyman.AllocationStrategy.refresh:type_name -> xray.app.proxyman.AllocationStrategy.AllocationStrategyRefresh
|
||||
12, // 3: xray.app.proxyman.ReceiverConfig.port_range:type_name -> xray.common.net.PortRange
|
||||
12, // 3: xray.app.proxyman.ReceiverConfig.port_list:type_name -> xray.common.net.PortList
|
||||
13, // 4: xray.app.proxyman.ReceiverConfig.listen:type_name -> xray.common.net.IPOrDomain
|
||||
3, // 5: xray.app.proxyman.ReceiverConfig.allocation_strategy:type_name -> xray.app.proxyman.AllocationStrategy
|
||||
14, // 6: xray.app.proxyman.ReceiverConfig.stream_settings:type_name -> xray.transport.internet.StreamConfig
|
||||
|
||||
@@ -27,17 +27,13 @@ message AllocationStrategy {
|
||||
|
||||
Type type = 1;
|
||||
|
||||
message AllocationStrategyConcurrency {
|
||||
uint32 value = 1;
|
||||
}
|
||||
message AllocationStrategyConcurrency { uint32 value = 1; }
|
||||
|
||||
// Number of handlers (ports) running in parallel.
|
||||
// Default value is 3 if unset.
|
||||
AllocationStrategyConcurrency concurrency = 2;
|
||||
|
||||
message AllocationStrategyRefresh {
|
||||
uint32 value = 1;
|
||||
}
|
||||
message AllocationStrategyRefresh { uint32 value = 1; }
|
||||
|
||||
// Number of minutes before a handler is regenerated.
|
||||
// Default value is 5 if unset.
|
||||
@@ -54,14 +50,21 @@ message SniffingConfig {
|
||||
bool enabled = 1;
|
||||
|
||||
// Override target destination if sniff'ed protocol is in the given list.
|
||||
// Supported values are "http", "tls".
|
||||
// Supported values are "http", "tls", "fakedns".
|
||||
repeated string destination_override = 2;
|
||||
repeated string domains_excluded = 3;
|
||||
|
||||
// Whether should only try to sniff metadata without waiting for client input.
|
||||
// Can be used to support SMTP like protocol where server send the first
|
||||
// message.
|
||||
bool metadata_only = 4;
|
||||
|
||||
bool route_only = 5;
|
||||
}
|
||||
|
||||
message ReceiverConfig {
|
||||
// PortRange specifies the ports which the Receiver should listen on.
|
||||
xray.common.net.PortRange port_range = 1;
|
||||
// PortList specifies the ports which the Receiver should listen on.
|
||||
xray.common.net.PortList port_list = 1;
|
||||
// Listen specifies the IP address that the Receiver should listen on.
|
||||
xray.common.net.IPOrDomain listen = 2;
|
||||
AllocationStrategy allocation_strategy = 3;
|
||||
@@ -70,7 +73,7 @@ message ReceiverConfig {
|
||||
reserved 6;
|
||||
// Override domains for the given protocol.
|
||||
// Deprecated. Use sniffing_settings.
|
||||
repeated KnownProtocols domain_override = 7 [deprecated = true];
|
||||
repeated KnownProtocols domain_override = 7 [ deprecated = true ];
|
||||
SniffingConfig sniffing_settings = 8;
|
||||
}
|
||||
|
||||
|
||||
@@ -67,7 +67,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
|
||||
uplinkCounter, downlinkCounter := getStatCounter(core.MustFromContext(ctx), tag)
|
||||
|
||||
nl := p.Network()
|
||||
pr := receiverConfig.PortRange
|
||||
pl := receiverConfig.PortList
|
||||
address := receiverConfig.Listen.AsAddress()
|
||||
if address == nil {
|
||||
address = net.AnyIP
|
||||
@@ -87,7 +87,7 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
|
||||
}
|
||||
mss.SocketSettings.ReceiveOriginalDestAddress = true
|
||||
}
|
||||
if pr == nil {
|
||||
if pl == nil {
|
||||
if net.HasNetwork(nl, net.Network_UNIX) {
|
||||
newError("creating unix domain socket worker on ", address).AtDebug().WriteToLog()
|
||||
|
||||
@@ -105,40 +105,43 @@ func NewAlwaysOnInboundHandler(ctx context.Context, tag string, receiverConfig *
|
||||
h.workers = append(h.workers, worker)
|
||||
}
|
||||
}
|
||||
if pr != nil {
|
||||
for port := pr.From; port <= pr.To; port++ {
|
||||
if net.HasNetwork(nl, net.Network_TCP) {
|
||||
newError("creating stream worker on ", address, ":", port).AtDebug().WriteToLog()
|
||||
if pl != nil {
|
||||
for _, pr := range pl.Range {
|
||||
for port := pr.From; port <= pr.To; port++ {
|
||||
if net.HasNetwork(nl, net.Network_TCP) {
|
||||
newError("creating stream worker on ", address, ":", port).AtDebug().WriteToLog()
|
||||
|
||||
worker := &tcpWorker{
|
||||
address: address,
|
||||
port: net.Port(port),
|
||||
proxy: p,
|
||||
stream: mss,
|
||||
recvOrigDest: receiverConfig.ReceiveOriginalDestination,
|
||||
tag: tag,
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
ctx: ctx,
|
||||
worker := &tcpWorker{
|
||||
address: address,
|
||||
port: net.Port(port),
|
||||
proxy: p,
|
||||
stream: mss,
|
||||
recvOrigDest: receiverConfig.ReceiveOriginalDestination,
|
||||
tag: tag,
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
ctx: ctx,
|
||||
}
|
||||
h.workers = append(h.workers, worker)
|
||||
}
|
||||
h.workers = append(h.workers, worker)
|
||||
}
|
||||
|
||||
if net.HasNetwork(nl, net.Network_UDP) {
|
||||
worker := &udpWorker{
|
||||
tag: tag,
|
||||
proxy: p,
|
||||
address: address,
|
||||
port: net.Port(port),
|
||||
dispatcher: h.mux,
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
stream: mss,
|
||||
ctx: ctx,
|
||||
if net.HasNetwork(nl, net.Network_UDP) {
|
||||
worker := &udpWorker{
|
||||
tag: tag,
|
||||
proxy: p,
|
||||
address: address,
|
||||
port: net.Port(port),
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
stream: mss,
|
||||
ctx: ctx,
|
||||
}
|
||||
h.workers = append(h.workers, worker)
|
||||
}
|
||||
h.workers = append(h.workers, worker)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -69,15 +69,18 @@ func NewDynamicInboundHandler(ctx context.Context, tag string, receiverConfig *p
|
||||
}
|
||||
|
||||
func (h *DynamicInboundHandler) allocatePort() net.Port {
|
||||
from := int(h.receiverConfig.PortRange.From)
|
||||
delta := int(h.receiverConfig.PortRange.To) - from + 1
|
||||
|
||||
allPorts := []int32{}
|
||||
for _, pr := range h.receiverConfig.PortList.Range {
|
||||
for i := pr.From; i <= pr.To; i++ {
|
||||
allPorts = append(allPorts, int32(i))
|
||||
}
|
||||
}
|
||||
h.portMutex.Lock()
|
||||
defer h.portMutex.Unlock()
|
||||
|
||||
for {
|
||||
r := dice.Roll(delta)
|
||||
port := net.Port(from + r)
|
||||
r := dice.Roll(len(allPorts))
|
||||
port := net.Port(allPorts[r])
|
||||
_, used := h.portsInUse[port]
|
||||
if !used {
|
||||
h.portsInUse[port] = true
|
||||
@@ -153,6 +156,7 @@ func (h *DynamicInboundHandler) refresh() error {
|
||||
address: address,
|
||||
port: port,
|
||||
dispatcher: h.mux,
|
||||
sniffingConfig: h.receiverConfig.GetEffectiveSniffingSettings(),
|
||||
uplinkCounter: uplinkCounter,
|
||||
downlinkCounter: downlinkCounter,
|
||||
stream: h.streamSettings,
|
||||
|
||||
@@ -18,6 +18,7 @@ import (
|
||||
"github.com/xtls/xray-core/features/stats"
|
||||
"github.com/xtls/xray-core/proxy"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
"github.com/xtls/xray-core/transport/internet/tcp"
|
||||
"github.com/xtls/xray-core/transport/internet/udp"
|
||||
"github.com/xtls/xray-core/transport/pipe"
|
||||
@@ -54,7 +55,7 @@ func getTProxyType(s *internet.MemoryStreamConfig) internet.SocketConfig_TProxyM
|
||||
return s.SocketSettings.Tproxy
|
||||
}
|
||||
|
||||
func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
func (w *tcpWorker) callback(conn stat.Connection) {
|
||||
ctx, cancel := context.WithCancel(w.ctx)
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
@@ -80,7 +81,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
}
|
||||
|
||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||
conn = &internet.StatCouterConnection{
|
||||
conn = &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: w.uplinkCounter,
|
||||
WriteCounter: w.downlinkCounter,
|
||||
@@ -98,6 +99,8 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
|
||||
@@ -105,9 +108,7 @@ func (w *tcpWorker) callback(conn internet.Connection) {
|
||||
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
cancel()
|
||||
if err := conn.Close(); err != nil {
|
||||
newError("failed to close connection").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
conn.Close()
|
||||
}
|
||||
|
||||
func (w *tcpWorker) Proxy() proxy.Inbound {
|
||||
@@ -116,7 +117,7 @@ func (w *tcpWorker) Proxy() proxy.Inbound {
|
||||
|
||||
func (w *tcpWorker) Start() error {
|
||||
ctx := context.Background()
|
||||
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn internet.Connection) {
|
||||
hub, err := internet.ListenTCP(ctx, w.address, w.port, w.stream, func(conn stat.Connection) {
|
||||
go w.callback(conn)
|
||||
})
|
||||
if err != nil {
|
||||
@@ -157,6 +158,11 @@ type udpConn struct {
|
||||
done *done.Instance
|
||||
uplink stats.Counter
|
||||
downlink stats.Counter
|
||||
inactive bool
|
||||
}
|
||||
|
||||
func (c *udpConn) setInactive() {
|
||||
c.inactive = true
|
||||
}
|
||||
|
||||
func (c *udpConn) updateActivity() {
|
||||
@@ -235,6 +241,7 @@ type udpWorker struct {
|
||||
tag string
|
||||
stream *internet.MemoryStreamConfig
|
||||
dispatcher routing.Dispatcher
|
||||
sniffingConfig *proxyman.SniffingConfig
|
||||
uplinkCounter stats.Counter
|
||||
downlinkCounter stats.Counter
|
||||
|
||||
@@ -297,7 +304,7 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
||||
common.Must(w.checker.Start())
|
||||
|
||||
go func() {
|
||||
ctx := context.Background()
|
||||
ctx := w.ctx
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
|
||||
@@ -311,11 +318,23 @@ func (w *udpWorker) callback(b *buf.Buffer, source net.Destination, originalDest
|
||||
Gateway: net.UDPDestination(w.address, w.port),
|
||||
Tag: w.tag,
|
||||
})
|
||||
content := new(session.Content)
|
||||
if w.sniffingConfig != nil {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
if err := w.proxy.Process(ctx, net.Network_UDP, conn, w.dispatcher); err != nil {
|
||||
newError("connection ends").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
}
|
||||
conn.Close()
|
||||
w.removeConn(id)
|
||||
// conn not removed by checker TODO may be lock worker here is better
|
||||
if !conn.inactive {
|
||||
conn.setInactive()
|
||||
w.removeConn(id)
|
||||
}
|
||||
}()
|
||||
}
|
||||
}
|
||||
@@ -343,8 +362,11 @@ func (w *udpWorker) clean() error {
|
||||
}
|
||||
|
||||
for addr, conn := range w.activeConn {
|
||||
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 300 {
|
||||
delete(w.activeConn, addr)
|
||||
if nowSec-atomic.LoadInt64(&conn.lastActivityTime) > 5*60 { // TODO Timeout too small
|
||||
if !conn.inactive {
|
||||
conn.setInactive()
|
||||
delete(w.activeConn, addr)
|
||||
}
|
||||
conn.Close()
|
||||
}
|
||||
}
|
||||
@@ -427,13 +449,13 @@ type dsWorker struct {
|
||||
ctx context.Context
|
||||
}
|
||||
|
||||
func (w *dsWorker) callback(conn internet.Connection) {
|
||||
func (w *dsWorker) callback(conn stat.Connection) {
|
||||
ctx, cancel := context.WithCancel(w.ctx)
|
||||
sid := session.NewID()
|
||||
ctx = session.ContextWithID(ctx, sid)
|
||||
|
||||
if w.uplinkCounter != nil || w.downlinkCounter != nil {
|
||||
conn = &internet.StatCouterConnection{
|
||||
conn = &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: w.uplinkCounter,
|
||||
WriteCounter: w.downlinkCounter,
|
||||
@@ -451,6 +473,8 @@ func (w *dsWorker) callback(conn internet.Connection) {
|
||||
content.SniffingRequest.Enabled = w.sniffingConfig.Enabled
|
||||
content.SniffingRequest.OverrideDestinationForProtocol = w.sniffingConfig.DestinationOverride
|
||||
content.SniffingRequest.ExcludeForDomain = w.sniffingConfig.DomainsExcluded
|
||||
content.SniffingRequest.MetadataOnly = w.sniffingConfig.MetadataOnly
|
||||
content.SniffingRequest.RouteOnly = w.sniffingConfig.RouteOnly
|
||||
}
|
||||
ctx = session.ContextWithContent(ctx, content)
|
||||
|
||||
@@ -470,9 +494,10 @@ func (w *dsWorker) Proxy() proxy.Inbound {
|
||||
func (w *dsWorker) Port() net.Port {
|
||||
return net.Port(0)
|
||||
}
|
||||
|
||||
func (w *dsWorker) Start() error {
|
||||
ctx := context.Background()
|
||||
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn internet.Connection) {
|
||||
hub, err := internet.ListenUnix(ctx, w.address, w.stream, func(conn stat.Connection) {
|
||||
go w.callback(conn)
|
||||
})
|
||||
if err != nil {
|
||||
|
||||
@@ -2,6 +2,9 @@ package outbound
|
||||
|
||||
import (
|
||||
"context"
|
||||
"errors"
|
||||
"io"
|
||||
"os"
|
||||
|
||||
"github.com/xtls/xray-core/app/proxyman"
|
||||
"github.com/xtls/xray-core/common"
|
||||
@@ -16,6 +19,7 @@ import (
|
||||
"github.com/xtls/xray-core/proxy"
|
||||
"github.com/xtls/xray-core/transport"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
"github.com/xtls/xray-core/transport/internet/tls"
|
||||
"github.com/xtls/xray-core/transport/pipe"
|
||||
)
|
||||
@@ -57,7 +61,7 @@ type Handler struct {
|
||||
downlinkCounter stats.Counter
|
||||
}
|
||||
|
||||
// NewHandler create a new Handler based on the given configuration.
|
||||
// NewHandler creates a new Handler based on the given configuration.
|
||||
func NewHandler(ctx context.Context, config *core.OutboundHandlerConfig) (outbound.Handler, error) {
|
||||
v := core.MustFromContext(ctx)
|
||||
uplinkCounter, downlinkCounter := getStatCounter(v, config.Tag)
|
||||
@@ -134,13 +138,23 @@ func (h *Handler) Tag() string {
|
||||
func (h *Handler) Dispatch(ctx context.Context, link *transport.Link) {
|
||||
if h.mux != nil && (h.mux.Enabled || session.MuxPreferedFromContext(ctx)) {
|
||||
if err := h.mux.Dispatch(ctx, link); err != nil {
|
||||
newError("failed to process mux outbound traffic").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
err := newError("failed to process mux outbound traffic").Base(err)
|
||||
session.SubmitOutboundErrorToOriginator(ctx, err)
|
||||
err.WriteToLog(session.ExportIDToError(ctx))
|
||||
common.Interrupt(link.Writer)
|
||||
}
|
||||
} else {
|
||||
if err := h.proxy.Process(ctx, link, h); err != nil {
|
||||
err := h.proxy.Process(ctx, link, h)
|
||||
if err != nil {
|
||||
if errors.Is(err, io.EOF) || errors.Is(err, io.ErrClosedPipe) || errors.Is(err, context.Canceled) {
|
||||
err = nil
|
||||
}
|
||||
}
|
||||
if err != nil {
|
||||
// Ensure outbound ray is properly closed.
|
||||
newError("failed to process outbound traffic").Base(err).WriteToLog(session.ExportIDToError(ctx))
|
||||
err := newError("failed to process outbound traffic").Base(err)
|
||||
session.SubmitOutboundErrorToOriginator(ctx, err)
|
||||
err.WriteToLog(session.ExportIDToError(ctx))
|
||||
common.Interrupt(link.Writer)
|
||||
} else {
|
||||
common.Must(common.Close(link.Writer))
|
||||
@@ -158,7 +172,7 @@ func (h *Handler) Address() net.Address {
|
||||
}
|
||||
|
||||
// Dial implements internet.Dialer.
|
||||
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Connection, error) {
|
||||
func (h *Handler) Dial(ctx context.Context, dest net.Destination) (stat.Connection, error) {
|
||||
if h.senderSettings != nil {
|
||||
if h.senderSettings.ProxySettings.HasTag() {
|
||||
tag := h.senderSettings.ProxySettings.Tag
|
||||
@@ -197,13 +211,17 @@ func (h *Handler) Dial(ctx context.Context, dest net.Destination) (internet.Conn
|
||||
}
|
||||
}
|
||||
|
||||
if conn, err := h.getUoTConnection(ctx, dest); err != os.ErrInvalid {
|
||||
return conn, err
|
||||
}
|
||||
|
||||
conn, err := internet.Dial(ctx, dest, h.streamSettings)
|
||||
return h.getStatCouterConnection(conn), err
|
||||
}
|
||||
|
||||
func (h *Handler) getStatCouterConnection(conn internet.Connection) internet.Connection {
|
||||
func (h *Handler) getStatCouterConnection(conn stat.Connection) stat.Connection {
|
||||
if h.uplinkCounter != nil || h.downlinkCounter != nil {
|
||||
return &internet.StatCouterConnection{
|
||||
return &stat.CounterConnection{
|
||||
Connection: conn,
|
||||
ReadCounter: h.downlinkCounter,
|
||||
WriteCounter: h.uplinkCounter,
|
||||
|
||||
@@ -12,7 +12,7 @@ import (
|
||||
core "github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
"github.com/xtls/xray-core/proxy/freedom"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
)
|
||||
|
||||
func TestInterfaces(t *testing.T) {
|
||||
@@ -44,9 +44,9 @@ func TestOutboundWithoutStatCounter(t *testing.T) {
|
||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||
})
|
||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||
_, ok := conn.(*internet.StatCouterConnection)
|
||||
_, ok := conn.(*stat.CounterConnection)
|
||||
if ok {
|
||||
t.Errorf("Expected conn to not be StatCouterConnection")
|
||||
t.Errorf("Expected conn to not be CounterConnection")
|
||||
}
|
||||
}
|
||||
|
||||
@@ -73,8 +73,8 @@ func TestOutboundWithStatCounter(t *testing.T) {
|
||||
ProxySettings: serial.ToTypedMessage(&freedom.Config{}),
|
||||
})
|
||||
conn, _ := h.(*Handler).Dial(ctx, net.TCPDestination(net.DomainAddress("localhost"), 13146))
|
||||
_, ok := conn.(*internet.StatCouterConnection)
|
||||
_, ok := conn.(*stat.CounterConnection)
|
||||
if !ok {
|
||||
t.Errorf("Expected conn to be StatCouterConnection")
|
||||
t.Errorf("Expected conn to be CounterConnection")
|
||||
}
|
||||
}
|
||||
|
||||
25
app/proxyman/outbound/uot.go
Normal file
25
app/proxyman/outbound/uot.go
Normal file
@@ -0,0 +1,25 @@
|
||||
//go:build go1.18
|
||||
|
||||
package outbound
|
||||
|
||||
import (
|
||||
"context"
|
||||
"os"
|
||||
|
||||
"github.com/sagernet/sing/common/uot"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/transport/internet"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
)
|
||||
|
||||
func (h *Handler) getUoTConnection(ctx context.Context, dest net.Destination) (stat.Connection, error) {
|
||||
if !dest.Address.Family().IsDomain() || dest.Address.Domain() != uot.UOTMagicAddress {
|
||||
return nil, os.ErrInvalid
|
||||
}
|
||||
packetConn, err := internet.ListenSystemPacket(ctx, &net.UDPAddr{IP: net.AnyIP.IP(), Port: 0}, h.streamSettings.SocketSettings)
|
||||
if err != nil {
|
||||
return nil, newError("unable to listen socket").Base(err)
|
||||
}
|
||||
conn := uot.NewServerConn(packetConn)
|
||||
return h.getStatCouterConnection(conn), nil
|
||||
}
|
||||
15
app/proxyman/outbound/uot_stub.go
Normal file
15
app/proxyman/outbound/uot_stub.go
Normal file
@@ -0,0 +1,15 @@
|
||||
//go:build !go1.18
|
||||
|
||||
package outbound
|
||||
|
||||
import (
|
||||
"context"
|
||||
"os"
|
||||
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/transport/internet/stat"
|
||||
)
|
||||
|
||||
func (h *Handler) getUoTConnection(ctx context.Context, dest net.Destination) (stat.Connection, error) {
|
||||
return nil, os.ErrInvalid
|
||||
}
|
||||
@@ -146,7 +146,7 @@ func (w *BridgeWorker) Connections() uint32 {
|
||||
return w.worker.ActiveConnections()
|
||||
}
|
||||
|
||||
func (w *BridgeWorker) handleInternalConn(link transport.Link) {
|
||||
func (w *BridgeWorker) handleInternalConn(link *transport.Link) {
|
||||
go func() {
|
||||
reader := link.Reader
|
||||
for {
|
||||
@@ -180,7 +180,7 @@ func (w *BridgeWorker) Dispatch(ctx context.Context, dest net.Destination) (*tra
|
||||
uplinkReader, uplinkWriter := pipe.New(opt...)
|
||||
downlinkReader, downlinkWriter := pipe.New(opt...)
|
||||
|
||||
w.handleInternalConn(transport.Link{
|
||||
w.handleInternalConn(&transport.Link{
|
||||
Reader: downlinkReader,
|
||||
Writer: uplinkWriter,
|
||||
})
|
||||
@@ -190,3 +190,16 @@ func (w *BridgeWorker) Dispatch(ctx context.Context, dest net.Destination) (*tra
|
||||
Writer: downlinkWriter,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (w *BridgeWorker) DispatchLink(ctx context.Context, dest net.Destination, link *transport.Link) error {
|
||||
if !isInternalDomain(dest) {
|
||||
ctx = session.ContextWithInbound(ctx, &session.Inbound{
|
||||
Tag: w.tag,
|
||||
})
|
||||
return w.dispatcher.DispatchLink(ctx, dest, link)
|
||||
}
|
||||
|
||||
w.handleInternalConn(link)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/reverse/config.proto
|
||||
|
||||
package reverse
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Control_State int32
|
||||
|
||||
const (
|
||||
|
||||
@@ -14,7 +14,7 @@ import (
|
||||
)
|
||||
|
||||
const (
|
||||
internalDomain = "reverse.internal.example.com"
|
||||
internalDomain = "reverse.internal.v2fly.org" // make reverse proxy compatible with v2fly
|
||||
)
|
||||
|
||||
func isDomain(dest net.Destination, domain string) bool {
|
||||
|
||||
@@ -1,7 +1,10 @@
|
||||
package router
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/common/dice"
|
||||
"github.com/xtls/xray-core/features/extension"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
)
|
||||
|
||||
@@ -9,8 +12,7 @@ type BalancingStrategy interface {
|
||||
PickOutbound([]string) string
|
||||
}
|
||||
|
||||
type RandomStrategy struct {
|
||||
}
|
||||
type RandomStrategy struct{}
|
||||
|
||||
func (s *RandomStrategy) PickOutbound(tags []string) string {
|
||||
n := len(tags)
|
||||
@@ -42,3 +44,9 @@ func (b *Balancer) PickOutbound() (string, error) {
|
||||
}
|
||||
return tag, nil
|
||||
}
|
||||
|
||||
func (b *Balancer) InjectContext(ctx context.Context) {
|
||||
if contextReceiver, ok := b.strategy.(extension.ContextReceiver); ok {
|
||||
contextReceiver.InjectContext(ctx)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -6,12 +6,11 @@ import (
|
||||
"context"
|
||||
"time"
|
||||
|
||||
"google.golang.org/grpc"
|
||||
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"github.com/xtls/xray-core/features/stats"
|
||||
"google.golang.org/grpc"
|
||||
)
|
||||
|
||||
// routingServer is an implementation of RoutingService.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/router/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// RoutingContext is the context with information relative to routing process.
|
||||
// It conforms to the structure of xray.features.routing.Context and
|
||||
// xray.features.routing.Route.
|
||||
@@ -91,7 +86,7 @@ func (x *RoutingContext) GetNetwork() net.Network {
|
||||
if x != nil {
|
||||
return x.Network
|
||||
}
|
||||
return net.Network_Unknown
|
||||
return net.Network(0)
|
||||
}
|
||||
|
||||
func (x *RoutingContext) GetSourceIPs() [][]byte {
|
||||
|
||||
@@ -1,4 +1,8 @@
|
||||
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
|
||||
// versions:
|
||||
// - protoc-gen-go-grpc v1.2.0
|
||||
// - protoc v3.18.0
|
||||
// source: app/router/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
|
||||
@@ -44,7 +44,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
|
||||
}
|
||||
errCh := make(chan error)
|
||||
nextPub := make(chan struct{})
|
||||
|
||||
// Server goroutine
|
||||
go func() {
|
||||
@@ -76,13 +75,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
if err := publishTestCases(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
|
||||
// Wait for next round of publishing
|
||||
<-nextPub
|
||||
|
||||
if err := publishTestCases(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
}()
|
||||
|
||||
// Client goroutine
|
||||
@@ -144,6 +136,92 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
return nil
|
||||
}
|
||||
|
||||
if err := testRetrievingAllFields(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
errCh <- nil // Client passed all tests successfully
|
||||
}()
|
||||
|
||||
// Wait for goroutines to complete
|
||||
select {
|
||||
case <-time.After(2 * time.Second):
|
||||
t.Fatal("Test timeout after 2s")
|
||||
case err := <-errCh:
|
||||
if err != nil {
|
||||
t.Fatal(err)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestServiceSubscribeSubsetOfFields(t *testing.T) {
|
||||
c := stats.NewChannel(&stats.ChannelConfig{
|
||||
SubscriberLimit: 1,
|
||||
BufferSize: 0,
|
||||
Blocking: true,
|
||||
})
|
||||
common.Must(c.Start())
|
||||
defer c.Close()
|
||||
|
||||
lis := bufconn.Listen(1024 * 1024)
|
||||
bufDialer := func(context.Context, string) (net.Conn, error) {
|
||||
return lis.Dial()
|
||||
}
|
||||
|
||||
testCases := []*RoutingContext{
|
||||
{InboundTag: "in", OutboundTag: "out"},
|
||||
{TargetIPs: [][]byte{{1, 2, 3, 4}}, TargetPort: 8080, OutboundTag: "out"},
|
||||
{TargetDomain: "example.com", TargetPort: 443, OutboundTag: "out"},
|
||||
{SourcePort: 9999, TargetPort: 9999, OutboundTag: "out"},
|
||||
{Network: net.Network_UDP, OutboundGroupTags: []string{"outergroup", "innergroup"}, OutboundTag: "out"},
|
||||
{Protocol: "bittorrent", OutboundTag: "blocked"},
|
||||
{User: "example@example.com", OutboundTag: "out"},
|
||||
{SourceIPs: [][]byte{{127, 0, 0, 1}}, Attributes: map[string]string{"attr": "value"}, OutboundTag: "out"},
|
||||
}
|
||||
errCh := make(chan error)
|
||||
|
||||
// Server goroutine
|
||||
go func() {
|
||||
server := grpc.NewServer()
|
||||
RegisterRoutingServiceServer(server, NewRoutingServer(nil, c))
|
||||
errCh <- server.Serve(lis)
|
||||
}()
|
||||
|
||||
// Publisher goroutine
|
||||
go func() {
|
||||
publishTestCases := func() error {
|
||||
ctx, cancel := context.WithTimeout(context.Background(), time.Second)
|
||||
defer cancel()
|
||||
for { // Wait until there's one subscriber in routing stats channel
|
||||
if len(c.Subscribers()) > 0 {
|
||||
break
|
||||
}
|
||||
if ctx.Err() != nil {
|
||||
return ctx.Err()
|
||||
}
|
||||
}
|
||||
for _, tc := range testCases {
|
||||
c.Publish(context.Background(), AsRoutingRoute(tc))
|
||||
time.Sleep(time.Millisecond)
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if err := publishTestCases(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
}()
|
||||
|
||||
// Client goroutine
|
||||
go func() {
|
||||
defer lis.Close()
|
||||
conn, err := grpc.DialContext(context.Background(), "bufnet", grpc.WithContextDialer(bufDialer), grpc.WithInsecure())
|
||||
if err != nil {
|
||||
errCh <- err
|
||||
return
|
||||
}
|
||||
defer conn.Close()
|
||||
client := NewRoutingServiceClient(conn)
|
||||
|
||||
// Test retrieving only a subset of fields
|
||||
testRetrievingSubsetOfFields := func() error {
|
||||
streamCtx, streamClose := context.WithCancel(context.Background())
|
||||
@@ -155,9 +233,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
return err
|
||||
}
|
||||
|
||||
// Send nextPub signal to start next round of publishing
|
||||
close(nextPub)
|
||||
|
||||
for _, tc := range testCases {
|
||||
msg, err := stream.Recv()
|
||||
if err != nil {
|
||||
@@ -179,10 +254,6 @@ func TestServiceSubscribeRoutingStats(t *testing.T) {
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
if err := testRetrievingAllFields(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
if err := testRetrievingSubsetOfFields(); err != nil {
|
||||
errCh <- err
|
||||
}
|
||||
@@ -212,7 +283,7 @@ func TestSerivceTestRoute(t *testing.T) {
|
||||
r := new(router.Router)
|
||||
mockCtl := gomock.NewController(t)
|
||||
defer mockCtl.Finish()
|
||||
common.Must(r.Init(&router.Config{
|
||||
common.Must(r.Init(context.TODO(), &router.Config{
|
||||
Rule: []*router.RoutingRule{
|
||||
{
|
||||
InboundTag: []string{"in"},
|
||||
|
||||
@@ -28,6 +28,13 @@ func (c routingContext) GetTargetPort() net.Port {
|
||||
return net.Port(c.RoutingContext.GetTargetPort())
|
||||
}
|
||||
|
||||
// GetSkipDNSResolve is a mock implementation here to match the interface,
|
||||
// SkipDNSResolve is set from dns module, no use if coming from a protobuf object?
|
||||
// TODO: please confirm @Vigilans
|
||||
func (c routingContext) GetSkipDNSResolve() bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// AsRoutingContext converts a protobuf RoutingContext into an implementation of routing.Context.
|
||||
func AsRoutingContext(r *RoutingContext) routing.Context {
|
||||
return routingContext{r}
|
||||
|
||||
@@ -3,12 +3,11 @@ package router
|
||||
import (
|
||||
"strings"
|
||||
|
||||
"go.starlark.net/starlark"
|
||||
"go.starlark.net/syntax"
|
||||
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/features/routing"
|
||||
"go.starlark.net/starlark"
|
||||
"go.starlark.net/syntax"
|
||||
)
|
||||
|
||||
type Condition interface {
|
||||
@@ -66,6 +65,24 @@ type DomainMatcher struct {
|
||||
matchers strmatcher.IndexMatcher
|
||||
}
|
||||
|
||||
func NewMphMatcherGroup(domains []*Domain) (*DomainMatcher, error) {
|
||||
g := strmatcher.NewMphMatcherGroup()
|
||||
for _, d := range domains {
|
||||
matcherType, f := matcherTypeMap[d.Type]
|
||||
if !f {
|
||||
return nil, newError("unsupported domain type", d.Type)
|
||||
}
|
||||
_, err := g.AddPattern(d.Value, matcherType)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
g.Build()
|
||||
return &DomainMatcher{
|
||||
matchers: g,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
||||
g := new(strmatcher.MatcherGroup)
|
||||
for _, d := range domains {
|
||||
@@ -82,7 +99,7 @@ func NewDomainMatcher(domains []*Domain) (*DomainMatcher, error) {
|
||||
}
|
||||
|
||||
func (m *DomainMatcher) ApplyDomain(domain string) bool {
|
||||
return len(m.matchers.Match(domain)) > 0
|
||||
return len(m.matchers.Match(strings.ToLower(domain))) > 0
|
||||
}
|
||||
|
||||
// Apply implements Condition.
|
||||
@@ -91,7 +108,7 @@ func (m *DomainMatcher) Apply(ctx routing.Context) bool {
|
||||
if len(domain) == 0 {
|
||||
return false
|
||||
}
|
||||
return m.ApplyDomain(strings.ToLower(domain))
|
||||
return m.ApplyDomain(domain)
|
||||
}
|
||||
|
||||
type MultiGeoIPMatcher struct {
|
||||
|
||||
@@ -13,11 +13,12 @@ type ipv6 struct {
|
||||
}
|
||||
|
||||
type GeoIPMatcher struct {
|
||||
countryCode string
|
||||
ip4 []uint32
|
||||
prefix4 []uint8
|
||||
ip6 []ipv6
|
||||
prefix6 []uint8
|
||||
countryCode string
|
||||
reverseMatch bool
|
||||
ip4 []uint32
|
||||
prefix4 []uint8
|
||||
ip6 []ipv6
|
||||
prefix6 []uint8
|
||||
}
|
||||
|
||||
func normalize4(ip uint32, prefix uint8) uint32 {
|
||||
@@ -58,7 +59,7 @@ func (m *GeoIPMatcher) Init(cidrs []*CIDR) error {
|
||||
m.ip6 = make([]ipv6, 0, ip6Count)
|
||||
m.prefix6 = make([]uint8, 0, ip6Count)
|
||||
|
||||
for _, cidr := range cidrs {
|
||||
for _, cidr := range cidrList {
|
||||
ip := cidr.Ip
|
||||
prefix := uint8(cidr.Prefix)
|
||||
switch len(ip) {
|
||||
@@ -80,6 +81,10 @@ func (m *GeoIPMatcher) Init(cidrs []*CIDR) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (m *GeoIPMatcher) SetReverseMatch(isReverseMatch bool) {
|
||||
m.reverseMatch = isReverseMatch
|
||||
}
|
||||
|
||||
func (m *GeoIPMatcher) match4(ip uint32) bool {
|
||||
if len(m.ip4) == 0 {
|
||||
return false
|
||||
@@ -147,8 +152,17 @@ func (m *GeoIPMatcher) match6(ip ipv6) bool {
|
||||
func (m *GeoIPMatcher) Match(ip net.IP) bool {
|
||||
switch len(ip) {
|
||||
case 4:
|
||||
if m.reverseMatch {
|
||||
return !m.match4(binary.BigEndian.Uint32(ip))
|
||||
}
|
||||
return m.match4(binary.BigEndian.Uint32(ip))
|
||||
case 16:
|
||||
if m.reverseMatch {
|
||||
return !m.match6(ipv6{
|
||||
a: binary.BigEndian.Uint64(ip[0:8]),
|
||||
b: binary.BigEndian.Uint64(ip[8:16]),
|
||||
})
|
||||
}
|
||||
return m.match6(ipv6{
|
||||
a: binary.BigEndian.Uint64(ip[0:8]),
|
||||
b: binary.BigEndian.Uint64(ip[8:16]),
|
||||
@@ -168,14 +182,15 @@ type GeoIPMatcherContainer struct {
|
||||
func (c *GeoIPMatcherContainer) Add(geoip *GeoIP) (*GeoIPMatcher, error) {
|
||||
if len(geoip.CountryCode) > 0 {
|
||||
for _, m := range c.matchers {
|
||||
if m.countryCode == geoip.CountryCode {
|
||||
if m.countryCode == geoip.CountryCode && m.reverseMatch == geoip.ReverseMatch {
|
||||
return m, nil
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
m := &GeoIPMatcher{
|
||||
countryCode: geoip.CountryCode,
|
||||
countryCode: geoip.CountryCode,
|
||||
reverseMatch: geoip.ReverseMatch,
|
||||
}
|
||||
if err := m.Init(geoip.Cidr); err != nil {
|
||||
return nil, err
|
||||
@@ -186,6 +201,4 @@ func (c *GeoIPMatcherContainer) Add(geoip *GeoIP) (*GeoIPMatcher, error) {
|
||||
return m, nil
|
||||
}
|
||||
|
||||
var (
|
||||
globalGeoIPContainer GeoIPMatcherContainer
|
||||
)
|
||||
var globalGeoIPContainer GeoIPMatcherContainer
|
||||
|
||||
@@ -88,7 +88,8 @@ func TestGeoIPMatcher(t *testing.T) {
|
||||
{
|
||||
Input: "192.0.1.0",
|
||||
Output: false,
|
||||
}, {
|
||||
},
|
||||
{
|
||||
Input: "0.1.0.0",
|
||||
Output: true,
|
||||
},
|
||||
@@ -123,6 +124,42 @@ func TestGeoIPMatcher(t *testing.T) {
|
||||
}
|
||||
}
|
||||
|
||||
func TestGeoIPReverseMatcher(t *testing.T) {
|
||||
cidrList := router.CIDRList{
|
||||
{Ip: []byte{8, 8, 8, 8}, Prefix: 32},
|
||||
{Ip: []byte{91, 108, 4, 0}, Prefix: 16},
|
||||
}
|
||||
matcher := &router.GeoIPMatcher{}
|
||||
matcher.SetReverseMatch(true) // Reverse match
|
||||
common.Must(matcher.Init(cidrList))
|
||||
|
||||
testCases := []struct {
|
||||
Input string
|
||||
Output bool
|
||||
}{
|
||||
{
|
||||
Input: "8.8.8.8",
|
||||
Output: false,
|
||||
},
|
||||
{
|
||||
Input: "2001:cdba::3257:9652",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Input: "91.108.255.254",
|
||||
Output: false,
|
||||
},
|
||||
}
|
||||
|
||||
for _, testCase := range testCases {
|
||||
ip := net.ParseAddress(testCase.Input).IP()
|
||||
actual := matcher.Match(ip)
|
||||
if actual != testCase.Output {
|
||||
t.Error("expect input", testCase.Input, "to be", testCase.Output, ", but actually", actual)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func TestGeoIPMatcher4CN(t *testing.T) {
|
||||
ips, err := loadGeoIP("CN")
|
||||
common.Must(err)
|
||||
|
||||
@@ -7,7 +7,6 @@ import (
|
||||
"testing"
|
||||
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
||||
. "github.com/xtls/xray-core/app/router"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/errors"
|
||||
@@ -359,6 +358,9 @@ func TestChinaSites(t *testing.T) {
|
||||
matcher, err := NewDomainMatcher(domains)
|
||||
common.Must(err)
|
||||
|
||||
acMatcher, err := NewMphMatcherGroup(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
@@ -387,9 +389,96 @@ func TestChinaSites(t *testing.T) {
|
||||
}
|
||||
|
||||
for _, testCase := range testCases {
|
||||
r := matcher.ApplyDomain(testCase.Domain)
|
||||
if r != testCase.Output {
|
||||
t.Error("expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r)
|
||||
r1 := matcher.ApplyDomain(testCase.Domain)
|
||||
r2 := acMatcher.ApplyDomain(testCase.Domain)
|
||||
if r1 != testCase.Output {
|
||||
t.Error("DomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r1)
|
||||
} else if r2 != testCase.Output {
|
||||
t.Error("ACDomainMatcher expected output ", testCase.Output, " for domain ", testCase.Domain, " but got ", r2)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkMphDomainMatcher(b *testing.B) {
|
||||
domains, err := loadGeoSite("CN")
|
||||
common.Must(err)
|
||||
|
||||
matcher, err := NewMphMatcherGroup(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
}
|
||||
testCases := []TestCase{
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
}
|
||||
|
||||
for i := 0; i < 1024; i++ {
|
||||
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||
}
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
for _, testCase := range testCases {
|
||||
_ = matcher.ApplyDomain(testCase.Domain)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkDomainMatcher(b *testing.B) {
|
||||
domains, err := loadGeoSite("CN")
|
||||
common.Must(err)
|
||||
|
||||
matcher, err := NewDomainMatcher(domains)
|
||||
common.Must(err)
|
||||
|
||||
type TestCase struct {
|
||||
Domain string
|
||||
Output bool
|
||||
}
|
||||
testCases := []TestCase{
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "163.com",
|
||||
Output: true,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
{
|
||||
Domain: "164.com",
|
||||
Output: false,
|
||||
},
|
||||
}
|
||||
|
||||
for i := 0; i < 1024; i++ {
|
||||
testCases = append(testCases, TestCase{Domain: strconv.Itoa(i) + ".not-exists.com", Output: false})
|
||||
}
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
for _, testCase := range testCases {
|
||||
_ = matcher.ApplyDomain(testCase.Domain)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -67,11 +67,23 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
|
||||
conds := NewConditionChan()
|
||||
|
||||
if len(rr.Domain) > 0 {
|
||||
matcher, err := NewDomainMatcher(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition").Base(err)
|
||||
switch rr.DomainMatcher {
|
||||
case "linear":
|
||||
matcher, err := NewDomainMatcher(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition").Base(err)
|
||||
}
|
||||
conds.Add(matcher)
|
||||
case "mph", "hybrid":
|
||||
fallthrough
|
||||
default:
|
||||
matcher, err := NewMphMatcherGroup(rr.Domain)
|
||||
if err != nil {
|
||||
return nil, newError("failed to build domain condition with MphDomainMatcher").Base(err)
|
||||
}
|
||||
newError("MphDomainMatcher is enabled for ", len(rr.Domain), " domain rule(s)").AtDebug().WriteToLog()
|
||||
conds.Add(matcher)
|
||||
}
|
||||
conds.Add(matcher)
|
||||
}
|
||||
|
||||
if len(rr.UserEmail) > 0 {
|
||||
@@ -146,9 +158,21 @@ func (rr *RoutingRule) BuildCondition() (Condition, error) {
|
||||
}
|
||||
|
||||
func (br *BalancingRule) Build(ohm outbound.Manager) (*Balancer, error) {
|
||||
return &Balancer{
|
||||
selectors: br.OutboundSelector,
|
||||
strategy: &RandomStrategy{},
|
||||
ohm: ohm,
|
||||
}, nil
|
||||
switch br.Strategy {
|
||||
case "leastPing":
|
||||
return &Balancer{
|
||||
selectors: br.OutboundSelector,
|
||||
strategy: &LeastPingStrategy{},
|
||||
ohm: ohm,
|
||||
}, nil
|
||||
case "random":
|
||||
fallthrough
|
||||
default:
|
||||
return &Balancer{
|
||||
selectors: br.OutboundSelector,
|
||||
strategy: &RandomStrategy{},
|
||||
ohm: ohm,
|
||||
}, nil
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/router/config.proto
|
||||
|
||||
package router
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
net "github.com/xtls/xray-core/common/net"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
@@ -22,10 +21,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
// Type of domain value.
|
||||
type Domain_Type int32
|
||||
|
||||
@@ -269,8 +264,9 @@ type GeoIP struct {
|
||||
sizeCache protoimpl.SizeCache
|
||||
unknownFields protoimpl.UnknownFields
|
||||
|
||||
CountryCode string `protobuf:"bytes,1,opt,name=country_code,json=countryCode,proto3" json:"country_code,omitempty"`
|
||||
Cidr []*CIDR `protobuf:"bytes,2,rep,name=cidr,proto3" json:"cidr,omitempty"`
|
||||
CountryCode string `protobuf:"bytes,1,opt,name=country_code,json=countryCode,proto3" json:"country_code,omitempty"`
|
||||
Cidr []*CIDR `protobuf:"bytes,2,rep,name=cidr,proto3" json:"cidr,omitempty"`
|
||||
ReverseMatch bool `protobuf:"varint,3,opt,name=reverse_match,json=reverseMatch,proto3" json:"reverse_match,omitempty"`
|
||||
}
|
||||
|
||||
func (x *GeoIP) Reset() {
|
||||
@@ -319,6 +315,13 @@ func (x *GeoIP) GetCidr() []*CIDR {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *GeoIP) GetReverseMatch() bool {
|
||||
if x != nil {
|
||||
return x.ReverseMatch
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type GeoIPList struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
@@ -515,6 +518,7 @@ type RoutingRule struct {
|
||||
InboundTag []string `protobuf:"bytes,8,rep,name=inbound_tag,json=inboundTag,proto3" json:"inbound_tag,omitempty"`
|
||||
Protocol []string `protobuf:"bytes,9,rep,name=protocol,proto3" json:"protocol,omitempty"`
|
||||
Attributes string `protobuf:"bytes,15,opt,name=attributes,proto3" json:"attributes,omitempty"`
|
||||
DomainMatcher string `protobuf:"bytes,17,opt,name=domain_matcher,json=domainMatcher,proto3" json:"domain_matcher,omitempty"`
|
||||
}
|
||||
|
||||
func (x *RoutingRule) Reset() {
|
||||
@@ -672,6 +676,13 @@ func (x *RoutingRule) GetAttributes() string {
|
||||
return ""
|
||||
}
|
||||
|
||||
func (x *RoutingRule) GetDomainMatcher() string {
|
||||
if x != nil {
|
||||
return x.DomainMatcher
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type isRoutingRule_TargetTag interface {
|
||||
isRoutingRule_TargetTag()
|
||||
}
|
||||
@@ -697,6 +708,7 @@ type BalancingRule struct {
|
||||
|
||||
Tag string `protobuf:"bytes,1,opt,name=tag,proto3" json:"tag,omitempty"`
|
||||
OutboundSelector []string `protobuf:"bytes,2,rep,name=outbound_selector,json=outboundSelector,proto3" json:"outbound_selector,omitempty"`
|
||||
Strategy string `protobuf:"bytes,3,opt,name=strategy,proto3" json:"strategy,omitempty"`
|
||||
}
|
||||
|
||||
func (x *BalancingRule) Reset() {
|
||||
@@ -745,6 +757,13 @@ func (x *BalancingRule) GetOutboundSelector() []string {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (x *BalancingRule) GetStrategy() string {
|
||||
if x != nil {
|
||||
return x.Strategy
|
||||
}
|
||||
return ""
|
||||
}
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
@@ -927,103 +946,110 @@ var file_app_router_config_proto_rawDesc = []byte{
|
||||
0x03, 0x22, 0x2e, 0x0a, 0x04, 0x43, 0x49, 0x44, 0x52, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18,
|
||||
0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x70, 0x12, 0x16, 0x0a, 0x06, 0x70, 0x72, 0x65,
|
||||
0x66, 0x69, 0x78, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x70, 0x72, 0x65, 0x66, 0x69,
|
||||
0x78, 0x22, 0x55, 0x0a, 0x05, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f,
|
||||
0x78, 0x22, 0x7a, 0x0a, 0x05, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f,
|
||||
0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
|
||||
0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x43, 0x6f, 0x64, 0x65, 0x12, 0x29, 0x0a,
|
||||
0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49,
|
||||
0x44, 0x52, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x22, 0x39, 0x0a, 0x09, 0x47, 0x65, 0x6f, 0x49,
|
||||
0x50, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2c, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01,
|
||||
0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
||||
0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x65, 0x6e,
|
||||
0x74, 0x72, 0x79, 0x22, 0x5d, 0x0a, 0x07, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x12, 0x21,
|
||||
0x0a, 0x0c, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x18, 0x01,
|
||||
0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x43, 0x6f, 0x64,
|
||||
0x65, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28,
|
||||
0x44, 0x52, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x12, 0x23, 0x0a, 0x0d, 0x72, 0x65, 0x76, 0x65,
|
||||
0x72, 0x73, 0x65, 0x5f, 0x6d, 0x61, 0x74, 0x63, 0x68, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52,
|
||||
0x0c, 0x72, 0x65, 0x76, 0x65, 0x72, 0x73, 0x65, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x22, 0x39, 0x0a,
|
||||
0x09, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2c, 0x0a, 0x05, 0x65, 0x6e,
|
||||
0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79,
|
||||
0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49,
|
||||
0x50, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x22, 0x5d, 0x0a, 0x07, 0x47, 0x65, 0x6f, 0x53,
|
||||
0x69, 0x74, 0x65, 0x12, 0x21, 0x0a, 0x0c, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x63,
|
||||
0x6f, 0x64, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x63, 0x6f, 0x75, 0x6e, 0x74,
|
||||
0x72, 0x79, 0x43, 0x6f, 0x64, 0x65, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e,
|
||||
0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52,
|
||||
0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x22, 0x3d, 0x0a, 0x0b, 0x47, 0x65, 0x6f, 0x53, 0x69,
|
||||
0x74, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18,
|
||||
0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52,
|
||||
0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x22, 0xb5, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69,
|
||||
0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20,
|
||||
0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61,
|
||||
0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28,
|
||||
0x09, 0x48, 0x00, 0x52, 0x0c, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x54, 0x61,
|
||||
0x67, 0x12, 0x2f, 0x0a, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28,
|
||||
0x0b, 0x32, 0x17, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
|
||||
0x74, 0x65, 0x72, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61,
|
||||
0x69, 0x6e, 0x22, 0x3d, 0x0a, 0x0b, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x4c, 0x69, 0x73,
|
||||
0x74, 0x12, 0x2e, 0x0a, 0x05, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x53, 0x69, 0x74, 0x65, 0x52, 0x05, 0x65, 0x6e, 0x74, 0x72,
|
||||
0x79, 0x22, 0x8e, 0x06, 0x0a, 0x0b, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c,
|
||||
0x65, 0x12, 0x12, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00,
|
||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69,
|
||||
0x6e, 0x67, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0c,
|
||||
0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x54, 0x61, 0x67, 0x12, 0x2f, 0x0a, 0x06,
|
||||
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x44,
|
||||
0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x52, 0x06, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x12, 0x2d, 0x0a,
|
||||
0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49,
|
||||
0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x04, 0x63, 0x69, 0x64, 0x72, 0x12, 0x2c, 0x0a, 0x05,
|
||||
0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0a, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72,
|
||||
0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65,
|
||||
0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12, 0x3d, 0x0a, 0x0a, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1a,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74,
|
||||
0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x42, 0x02, 0x18, 0x01, 0x52, 0x09,
|
||||
0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x36, 0x0a, 0x09, 0x70, 0x6f, 0x72,
|
||||
0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x0e, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50,
|
||||
0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73,
|
||||
0x74, 0x12, 0x43, 0x0a, 0x0c, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x5f, 0x6c, 0x69, 0x73,
|
||||
0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63,
|
||||
0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e, 0x65, 0x74, 0x77, 0x6f, 0x72,
|
||||
0x6b, 0x4c, 0x69, 0x73, 0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b, 0x6e, 0x65, 0x74, 0x77, 0x6f,
|
||||
0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x34, 0x0a, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72,
|
||||
0x6b, 0x73, 0x18, 0x0d, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x18, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e, 0x65, 0x74, 0x77, 0x6f,
|
||||
0x72, 0x6b, 0x52, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x73, 0x12, 0x3a, 0x0a, 0x0b,
|
||||
0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x63, 0x69, 0x64, 0x72, 0x18, 0x06, 0x20, 0x03, 0x28,
|
||||
0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75,
|
||||
0x74, 0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0a, 0x73, 0x6f,
|
||||
0x75, 0x72, 0x63, 0x65, 0x43, 0x69, 0x64, 0x72, 0x12, 0x39, 0x0a, 0x0c, 0x73, 0x6f, 0x75, 0x72,
|
||||
0x63, 0x65, 0x5f, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0b, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x16,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72,
|
||||
0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x0b, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x47, 0x65,
|
||||
0x6f, 0x69, 0x70, 0x12, 0x43, 0x0a, 0x10, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x10, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e,
|
||||
0x69, 0x6e, 0x12, 0x2d, 0x0a, 0x04, 0x63, 0x69, 0x64, 0x72, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18, 0x01, 0x52, 0x04, 0x63, 0x69, 0x64,
|
||||
0x72, 0x12, 0x2c, 0x0a, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0a, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x05, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x12,
|
||||
0x3d, 0x0a, 0x0a, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x72, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x04, 0x20,
|
||||
0x01, 0x28, 0x0b, 0x32, 0x1a, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f,
|
||||
0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x42,
|
||||
0x02, 0x18, 0x01, 0x52, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x36,
|
||||
0x0a, 0x09, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x0e, 0x20, 0x01, 0x28,
|
||||
0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e,
|
||||
0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x08, 0x70, 0x6f,
|
||||
0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x43, 0x0a, 0x0c, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72,
|
||||
0x6b, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x4e,
|
||||
0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x42, 0x02, 0x18, 0x01, 0x52, 0x0b,
|
||||
0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x34, 0x0a, 0x08, 0x6e,
|
||||
0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x73, 0x18, 0x0d, 0x20, 0x03, 0x28, 0x0e, 0x32, 0x18, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e, 0x2e, 0x6e, 0x65, 0x74, 0x2e,
|
||||
0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x0e, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65,
|
||||
0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x1d, 0x0a, 0x0a, 0x75, 0x73, 0x65, 0x72,
|
||||
0x5f, 0x65, 0x6d, 0x61, 0x69, 0x6c, 0x18, 0x07, 0x20, 0x03, 0x28, 0x09, 0x52, 0x09, 0x75, 0x73,
|
||||
0x65, 0x72, 0x45, 0x6d, 0x61, 0x69, 0x6c, 0x12, 0x1f, 0x0a, 0x0b, 0x69, 0x6e, 0x62, 0x6f, 0x75,
|
||||
0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x08, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0a, 0x69, 0x6e,
|
||||
0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12, 0x1a, 0x0a, 0x08, 0x70, 0x72, 0x6f, 0x74,
|
||||
0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52, 0x08, 0x70, 0x72, 0x6f, 0x74,
|
||||
0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
|
||||
0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x72, 0x69, 0x62,
|
||||
0x75, 0x74, 0x65, 0x73, 0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74,
|
||||
0x61, 0x67, 0x22, 0x4e, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52,
|
||||
0x75, 0x6c, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
|
||||
0x52, 0x03, 0x74, 0x61, 0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e,
|
||||
0x64, 0x5f, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09,
|
||||
0x52, 0x10, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74,
|
||||
0x6f, 0x72, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a,
|
||||
0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79,
|
||||
0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e,
|
||||
0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e,
|
||||
0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30,
|
||||
0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78,
|
||||
0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52,
|
||||
0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65,
|
||||
0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75,
|
||||
0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e,
|
||||
0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e,
|
||||
0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63,
|
||||
0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22, 0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69,
|
||||
0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49,
|
||||
0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10,
|
||||
0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02,
|
||||
0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e, 0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03,
|
||||
0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70,
|
||||
0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50, 0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75,
|
||||
0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74, 0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d,
|
||||
0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70, 0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa,
|
||||
0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41, 0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65,
|
||||
0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
|
||||
0x4e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b, 0x52, 0x08, 0x6e, 0x65, 0x74, 0x77, 0x6f, 0x72, 0x6b,
|
||||
0x73, 0x12, 0x3a, 0x0a, 0x0b, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x63, 0x69, 0x64, 0x72,
|
||||
0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70,
|
||||
0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x43, 0x49, 0x44, 0x52, 0x42, 0x02, 0x18,
|
||||
0x01, 0x52, 0x0a, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x43, 0x69, 0x64, 0x72, 0x12, 0x39, 0x0a,
|
||||
0x0c, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x67, 0x65, 0x6f, 0x69, 0x70, 0x18, 0x0b, 0x20,
|
||||
0x03, 0x28, 0x0b, 0x32, 0x16, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72,
|
||||
0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x47, 0x65, 0x6f, 0x49, 0x50, 0x52, 0x0b, 0x73, 0x6f, 0x75,
|
||||
0x72, 0x63, 0x65, 0x47, 0x65, 0x6f, 0x69, 0x70, 0x12, 0x43, 0x0a, 0x10, 0x73, 0x6f, 0x75, 0x72,
|
||||
0x63, 0x65, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x5f, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x10, 0x20, 0x01,
|
||||
0x28, 0x0b, 0x32, 0x19, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x63, 0x6f, 0x6d, 0x6d, 0x6f, 0x6e,
|
||||
0x2e, 0x6e, 0x65, 0x74, 0x2e, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x0e, 0x73,
|
||||
0x6f, 0x75, 0x72, 0x63, 0x65, 0x50, 0x6f, 0x72, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x1d, 0x0a,
|
||||
0x0a, 0x75, 0x73, 0x65, 0x72, 0x5f, 0x65, 0x6d, 0x61, 0x69, 0x6c, 0x18, 0x07, 0x20, 0x03, 0x28,
|
||||
0x09, 0x52, 0x09, 0x75, 0x73, 0x65, 0x72, 0x45, 0x6d, 0x61, 0x69, 0x6c, 0x12, 0x1f, 0x0a, 0x0b,
|
||||
0x69, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x08, 0x20, 0x03, 0x28,
|
||||
0x09, 0x52, 0x0a, 0x69, 0x6e, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x54, 0x61, 0x67, 0x12, 0x1a, 0x0a,
|
||||
0x08, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x18, 0x09, 0x20, 0x03, 0x28, 0x09, 0x52,
|
||||
0x08, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x63, 0x6f, 0x6c, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74,
|
||||
0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x61,
|
||||
0x74, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x73, 0x12, 0x25, 0x0a, 0x0e, 0x64, 0x6f, 0x6d,
|
||||
0x61, 0x69, 0x6e, 0x5f, 0x6d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x18, 0x11, 0x20, 0x01, 0x28,
|
||||
0x09, 0x52, 0x0d, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72,
|
||||
0x42, 0x0c, 0x0a, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x61, 0x67, 0x22, 0x6a,
|
||||
0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x12,
|
||||
0x10, 0x0a, 0x03, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x61,
|
||||
0x67, 0x12, 0x2b, 0x0a, 0x11, 0x6f, 0x75, 0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x5f, 0x73, 0x65,
|
||||
0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x10, 0x6f, 0x75,
|
||||
0x74, 0x62, 0x6f, 0x75, 0x6e, 0x64, 0x53, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x6f, 0x72, 0x12, 0x1a,
|
||||
0x0a, 0x08, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09,
|
||||
0x52, 0x08, 0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x22, 0x9b, 0x02, 0x0a, 0x06, 0x43,
|
||||
0x6f, 0x6e, 0x66, 0x69, 0x67, 0x12, 0x4f, 0x0a, 0x0f, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x5f,
|
||||
0x73, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x26,
|
||||
0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72,
|
||||
0x2e, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x2e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74,
|
||||
0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x52, 0x0e, 0x64, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74,
|
||||
0x72, 0x61, 0x74, 0x65, 0x67, 0x79, 0x12, 0x30, 0x0a, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x02,
|
||||
0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e,
|
||||
0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x69, 0x6e, 0x67, 0x52, 0x75,
|
||||
0x6c, 0x65, 0x52, 0x04, 0x72, 0x75, 0x6c, 0x65, 0x12, 0x45, 0x0a, 0x0e, 0x62, 0x61, 0x6c, 0x61,
|
||||
0x6e, 0x63, 0x69, 0x6e, 0x67, 0x5f, 0x72, 0x75, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b,
|
||||
0x32, 0x1e, 0x2e, 0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74,
|
||||
0x65, 0x72, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65,
|
||||
0x52, 0x0d, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x69, 0x6e, 0x67, 0x52, 0x75, 0x6c, 0x65, 0x22,
|
||||
0x47, 0x0a, 0x0e, 0x44, 0x6f, 0x6d, 0x61, 0x69, 0x6e, 0x53, 0x74, 0x72, 0x61, 0x74, 0x65, 0x67,
|
||||
0x79, 0x12, 0x08, 0x0a, 0x04, 0x41, 0x73, 0x49, 0x73, 0x10, 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55,
|
||||
0x73, 0x65, 0x49, 0x70, 0x10, 0x01, 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x70, 0x49, 0x66, 0x4e, 0x6f,
|
||||
0x6e, 0x4d, 0x61, 0x74, 0x63, 0x68, 0x10, 0x02, 0x12, 0x0e, 0x0a, 0x0a, 0x49, 0x70, 0x4f, 0x6e,
|
||||
0x44, 0x65, 0x6d, 0x61, 0x6e, 0x64, 0x10, 0x03, 0x42, 0x4f, 0x0a, 0x13, 0x63, 0x6f, 0x6d, 0x2e,
|
||||
0x78, 0x72, 0x61, 0x79, 0x2e, 0x61, 0x70, 0x70, 0x2e, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x50,
|
||||
0x01, 0x5a, 0x24, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x78, 0x74,
|
||||
0x6c, 0x73, 0x2f, 0x78, 0x72, 0x61, 0x79, 0x2d, 0x63, 0x6f, 0x72, 0x65, 0x2f, 0x61, 0x70, 0x70,
|
||||
0x2f, 0x72, 0x6f, 0x75, 0x74, 0x65, 0x72, 0xaa, 0x02, 0x0f, 0x58, 0x72, 0x61, 0x79, 0x2e, 0x41,
|
||||
0x70, 0x70, 0x2e, 0x52, 0x6f, 0x75, 0x74, 0x65, 0x72, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f,
|
||||
0x33,
|
||||
}
|
||||
|
||||
var (
|
||||
|
||||
@@ -54,6 +54,7 @@ message CIDR {
|
||||
message GeoIP {
|
||||
string country_code = 1;
|
||||
repeated CIDR cidr = 2;
|
||||
bool reverse_match = 3;
|
||||
}
|
||||
|
||||
message GeoIPList {
|
||||
@@ -119,11 +120,14 @@ message RoutingRule {
|
||||
repeated string protocol = 9;
|
||||
|
||||
string attributes = 15;
|
||||
|
||||
string domain_matcher = 17;
|
||||
}
|
||||
|
||||
message BalancingRule {
|
||||
string tag = 1;
|
||||
repeated string outbound_selector = 2;
|
||||
string strategy = 3;
|
||||
}
|
||||
|
||||
message Config {
|
||||
|
||||
@@ -29,7 +29,7 @@ type Route struct {
|
||||
}
|
||||
|
||||
// Init initializes the Router.
|
||||
func (r *Router) Init(config *Config, d dns.Client, ohm outbound.Manager) error {
|
||||
func (r *Router) Init(ctx context.Context, config *Config, d dns.Client, ohm outbound.Manager) error {
|
||||
r.domainStrategy = config.DomainStrategy
|
||||
r.dns = d
|
||||
|
||||
@@ -39,6 +39,7 @@ func (r *Router) Init(config *Config, d dns.Client, ohm outbound.Manager) error
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
balancer.InjectContext(ctx)
|
||||
r.balancers[rule.Tag] = balancer
|
||||
}
|
||||
|
||||
@@ -80,7 +81,12 @@ func (r *Router) PickRoute(ctx routing.Context) (routing.Route, error) {
|
||||
}
|
||||
|
||||
func (r *Router) pickRouteInternal(ctx routing.Context) (*Rule, routing.Context, error) {
|
||||
if r.domainStrategy == Config_IpOnDemand {
|
||||
// SkipDNSResolve is set from DNS module.
|
||||
// the DOH remote server maybe a domain name,
|
||||
// this prevents cycle resolving dead loop
|
||||
skipDNSResolve := ctx.GetSkipDNSResolve()
|
||||
|
||||
if r.domainStrategy == Config_IpOnDemand && !skipDNSResolve {
|
||||
ctx = routing_dns.ContextWithDNSClient(ctx, r.dns)
|
||||
}
|
||||
|
||||
@@ -90,7 +96,7 @@ func (r *Router) pickRouteInternal(ctx routing.Context) (*Rule, routing.Context,
|
||||
}
|
||||
}
|
||||
|
||||
if r.domainStrategy != Config_IpIfNonMatch || len(ctx.GetTargetDomain()) == 0 {
|
||||
if r.domainStrategy != Config_IpIfNonMatch || len(ctx.GetTargetDomain()) == 0 || skipDNSResolve {
|
||||
return nil, ctx, common.ErrNoClue
|
||||
}
|
||||
|
||||
@@ -116,7 +122,7 @@ func (*Router) Close() error {
|
||||
return nil
|
||||
}
|
||||
|
||||
// Type implement common.HasType.
|
||||
// Type implements common.HasType.
|
||||
func (*Router) Type() interface{} {
|
||||
return routing.RouterType()
|
||||
}
|
||||
@@ -135,7 +141,7 @@ func init() {
|
||||
common.Must(common.RegisterConfig((*Config)(nil), func(ctx context.Context, config interface{}) (interface{}, error) {
|
||||
r := new(Router)
|
||||
if err := core.RequireFeatures(ctx, func(d dns.Client, ohm outbound.Manager) error {
|
||||
return r.Init(config.(*Config), d, ohm)
|
||||
return r.Init(ctx, config.(*Config), d, ohm)
|
||||
}); err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
@@ -9,6 +9,7 @@ import (
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/net"
|
||||
"github.com/xtls/xray-core/common/session"
|
||||
"github.com/xtls/xray-core/features/dns"
|
||||
"github.com/xtls/xray-core/features/outbound"
|
||||
routing_session "github.com/xtls/xray-core/features/routing/session"
|
||||
"github.com/xtls/xray-core/testing/mocks"
|
||||
@@ -39,7 +40,7 @@ func TestSimpleRouter(t *testing.T) {
|
||||
mockHs := mocks.NewOutboundHandlerSelector(mockCtl)
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, &mockOutboundManager{
|
||||
common.Must(r.Init(context.TODO(), config, mockDNS, &mockOutboundManager{
|
||||
Manager: mockOhm,
|
||||
HandlerSelector: mockHs,
|
||||
}))
|
||||
@@ -80,7 +81,7 @@ func TestSimpleBalancer(t *testing.T) {
|
||||
mockHs.EXPECT().Select(gomock.Eq([]string{"test-"})).Return([]string{"test"})
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, &mockOutboundManager{
|
||||
common.Must(r.Init(context.TODO(), config, mockDNS, &mockOutboundManager{
|
||||
Manager: mockOhm,
|
||||
HandlerSelector: mockHs,
|
||||
}))
|
||||
@@ -115,10 +116,14 @@ func TestIPOnDemand(t *testing.T) {
|
||||
defer mockCtl.Finish()
|
||||
|
||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, nil))
|
||||
common.Must(r.Init(context.TODO(), config, mockDNS, nil))
|
||||
|
||||
ctx := session.ContextWithOutbound(context.Background(), &session.Outbound{Target: net.TCPDestination(net.DomainAddress("example.com"), 80)})
|
||||
route, err := r.PickRoute(routing_session.AsRoutingContext(ctx))
|
||||
@@ -150,10 +155,14 @@ func TestIPIfNonMatchDomain(t *testing.T) {
|
||||
defer mockCtl.Finish()
|
||||
|
||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com")).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
mockDNS.EXPECT().LookupIP(gomock.Eq("example.com"), dns.IPOption{
|
||||
IPv4Enable: true,
|
||||
IPv6Enable: true,
|
||||
FakeEnable: false,
|
||||
}).Return([]net.IP{{192, 168, 0, 1}}, nil).AnyTimes()
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, nil))
|
||||
common.Must(r.Init(context.TODO(), config, mockDNS, nil))
|
||||
|
||||
ctx := session.ContextWithOutbound(context.Background(), &session.Outbound{Target: net.TCPDestination(net.DomainAddress("example.com"), 80)})
|
||||
route, err := r.PickRoute(routing_session.AsRoutingContext(ctx))
|
||||
@@ -187,7 +196,7 @@ func TestIPIfNonMatchIP(t *testing.T) {
|
||||
mockDNS := mocks.NewDNSClient(mockCtl)
|
||||
|
||||
r := new(Router)
|
||||
common.Must(r.Init(config, mockDNS, nil))
|
||||
common.Must(r.Init(context.TODO(), config, mockDNS, nil))
|
||||
|
||||
ctx := session.ContextWithOutbound(context.Background(), &session.Outbound{Target: net.TCPDestination(net.LocalHostIP, 80)})
|
||||
route, err := r.PickRoute(routing_session.AsRoutingContext(ctx))
|
||||
|
||||
61
app/router/strategy_leastping.go
Normal file
61
app/router/strategy_leastping.go
Normal file
@@ -0,0 +1,61 @@
|
||||
package router
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/xtls/xray-core/app/observatory"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/core"
|
||||
"github.com/xtls/xray-core/features/extension"
|
||||
)
|
||||
|
||||
type LeastPingStrategy struct {
|
||||
ctx context.Context
|
||||
observatory extension.Observatory
|
||||
}
|
||||
|
||||
func (l *LeastPingStrategy) InjectContext(ctx context.Context) {
|
||||
l.ctx = ctx
|
||||
}
|
||||
|
||||
func (l *LeastPingStrategy) PickOutbound(strings []string) string {
|
||||
if l.observatory == nil {
|
||||
common.Must(core.RequireFeatures(l.ctx, func(observatory extension.Observatory) error {
|
||||
l.observatory = observatory
|
||||
return nil
|
||||
}))
|
||||
}
|
||||
|
||||
observeReport, err := l.observatory.GetObservation(l.ctx)
|
||||
if err != nil {
|
||||
newError("cannot get observe report").Base(err).WriteToLog()
|
||||
return ""
|
||||
}
|
||||
outboundsList := outboundList(strings)
|
||||
if result, ok := observeReport.(*observatory.ObservationResult); ok {
|
||||
status := result.Status
|
||||
leastPing := int64(99999999)
|
||||
selectedOutboundName := ""
|
||||
for _, v := range status {
|
||||
if outboundsList.contains(v.OutboundTag) && v.Alive && v.Delay < leastPing {
|
||||
selectedOutboundName = v.OutboundTag
|
||||
leastPing = v.Delay
|
||||
}
|
||||
}
|
||||
return selectedOutboundName
|
||||
}
|
||||
|
||||
// No way to understand observeReport
|
||||
return ""
|
||||
}
|
||||
|
||||
type outboundList []string
|
||||
|
||||
func (o outboundList) contains(name string) bool {
|
||||
for _, v := range o {
|
||||
if v == name {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
@@ -7,13 +7,12 @@ import (
|
||||
"runtime"
|
||||
"time"
|
||||
|
||||
grpc "google.golang.org/grpc"
|
||||
|
||||
"github.com/xtls/xray-core/app/stats"
|
||||
"github.com/xtls/xray-core/common"
|
||||
"github.com/xtls/xray-core/common/strmatcher"
|
||||
"github.com/xtls/xray-core/core"
|
||||
feature_stats "github.com/xtls/xray-core/features/stats"
|
||||
grpc "google.golang.org/grpc"
|
||||
)
|
||||
|
||||
// statsServer is an implementation of StatsService.
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/stats/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type GetStatsRequest struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
@@ -1,4 +1,8 @@
|
||||
// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
|
||||
// versions:
|
||||
// - protoc-gen-go-grpc v1.2.0
|
||||
// - protoc v3.18.0
|
||||
// source: app/stats/command/command.proto
|
||||
|
||||
package command
|
||||
|
||||
|
||||
@@ -6,7 +6,6 @@ import (
|
||||
|
||||
"github.com/google/go-cmp/cmp"
|
||||
"github.com/google/go-cmp/cmp/cmpopts"
|
||||
|
||||
"github.com/xtls/xray-core/app/stats"
|
||||
. "github.com/xtls/xray-core/app/stats/command"
|
||||
"github.com/xtls/xray-core/common"
|
||||
|
||||
@@ -1,13 +1,12 @@
|
||||
// Code generated by protoc-gen-go. DO NOT EDIT.
|
||||
// versions:
|
||||
// protoc-gen-go v1.25.0
|
||||
// protoc v3.14.0
|
||||
// protoc-gen-go v1.27.1
|
||||
// protoc v3.18.0
|
||||
// source: app/stats/config.proto
|
||||
|
||||
package stats
|
||||
|
||||
import (
|
||||
proto "github.com/golang/protobuf/proto"
|
||||
protoreflect "google.golang.org/protobuf/reflect/protoreflect"
|
||||
protoimpl "google.golang.org/protobuf/runtime/protoimpl"
|
||||
reflect "reflect"
|
||||
@@ -21,10 +20,6 @@ const (
|
||||
_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
|
||||
)
|
||||
|
||||
// This is a compile-time assertion that a sufficiently up-to-date version
|
||||
// of the legacy proto package is being used.
|
||||
const _ = proto.ProtoPackageIsVersion4
|
||||
|
||||
type Config struct {
|
||||
state protoimpl.MessageState
|
||||
sizeCache protoimpl.SizeCache
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user